From 319beeadff7169ab2a1134375c142b8fecd8c9f4 Mon Sep 17 00:00:00 2001 From: Jerome Wolff Date: Fri, 5 Jul 2024 13:02:45 +0200 Subject: [PATCH] Fix missing dependency --- dist/index.js | 34549 +++++++++++++++++++++++++++++++++++++------- package-lock.json | 1208 ++ package.json | 1 + 3 files changed, 30281 insertions(+), 5477 deletions(-) diff --git a/dist/index.js b/dist/index.js index 33b165b..e27179a 100644 --- a/dist/index.js +++ b/dist/index.js @@ -1794,6 +1794,21031 @@ function isLoopbackAddress(host) { } //# sourceMappingURL=proxy.js.map +/***/ }), + +/***/ 37983: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.defaultECSHttpAuthSchemeProvider = exports.defaultECSHttpAuthSchemeParametersProvider = void 0; +const core_1 = __nccwpck_require__(59963); +const util_middleware_1 = __nccwpck_require__(2390); +const defaultECSHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultECSHttpAuthSchemeParametersProvider = defaultECSHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "ecs", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +const defaultECSHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultECSHttpAuthSchemeProvider = defaultECSHttpAuthSchemeProvider; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0, + }; +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 55021: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const util_endpoints_2 = __nccwpck_require__(45473); +const ruleset_1 = __nccwpck_require__(83635); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 83635: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const s = "required", t = "fn", u = "argv", v = "ref"; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = { [s]: false, "type": "String" }, i = { [s]: true, "default": false, "type": "Boolean" }, j = { [v]: "Endpoint" }, k = { [t]: c, [u]: [{ [v]: "UseFIPS" }, true] }, l = { [t]: c, [u]: [{ [v]: "UseDualStack" }, true] }, m = {}, n = { [t]: "getAttr", [u]: [{ [v]: g }, "supportsFIPS"] }, o = { [t]: c, [u]: [true, { [t]: "getAttr", [u]: [{ [v]: g }, "supportsDualStack"] }] }, p = [k], q = [l], r = [{ [v]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: h, UseDualStack: i, UseFIPS: i, Endpoint: h }, rules: [{ conditions: [{ [t]: b, [u]: [j] }], rules: [{ conditions: p, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: q, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: j, properties: m, headers: m }, type: e }], type: f }, { conditions: [{ [t]: b, [u]: r }], rules: [{ conditions: [{ [t]: "aws.partition", [u]: r, assign: g }], rules: [{ conditions: [k, l], rules: [{ conditions: [{ [t]: c, [u]: [a, n] }, o], rules: [{ endpoint: { url: "https://ecs-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: p, rules: [{ conditions: [{ [t]: c, [u]: [n, a] }], rules: [{ endpoint: { url: "https://ecs-fips.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: q, rules: [{ conditions: [o], rules: [{ endpoint: { url: "https://ecs.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: m, headers: m }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://ecs.{Region}.{PartitionResult#dnsSuffix}", properties: m, headers: m }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 18209: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AccessDeniedException: () => AccessDeniedException, + AgentUpdateStatus: () => AgentUpdateStatus, + ApplicationProtocol: () => ApplicationProtocol, + AssignPublicIp: () => AssignPublicIp, + AttributeLimitExceededException: () => AttributeLimitExceededException, + BlockedException: () => BlockedException, + CPUArchitecture: () => CPUArchitecture, + CapacityProviderField: () => CapacityProviderField, + CapacityProviderStatus: () => CapacityProviderStatus, + CapacityProviderUpdateStatus: () => CapacityProviderUpdateStatus, + ClientException: () => ClientException, + ClusterContainsContainerInstancesException: () => ClusterContainsContainerInstancesException, + ClusterContainsServicesException: () => ClusterContainsServicesException, + ClusterContainsTasksException: () => ClusterContainsTasksException, + ClusterField: () => ClusterField, + ClusterNotFoundException: () => ClusterNotFoundException, + ClusterSettingName: () => ClusterSettingName, + Compatibility: () => Compatibility, + ConflictException: () => ConflictException, + Connectivity: () => Connectivity, + ContainerCondition: () => ContainerCondition, + ContainerInstanceField: () => ContainerInstanceField, + ContainerInstanceStatus: () => ContainerInstanceStatus, + CreateCapacityProviderCommand: () => CreateCapacityProviderCommand, + CreateClusterCommand: () => CreateClusterCommand, + CreateServiceCommand: () => CreateServiceCommand, + CreateTaskSetCommand: () => CreateTaskSetCommand, + DeleteAccountSettingCommand: () => DeleteAccountSettingCommand, + DeleteAttributesCommand: () => DeleteAttributesCommand, + DeleteCapacityProviderCommand: () => DeleteCapacityProviderCommand, + DeleteClusterCommand: () => DeleteClusterCommand, + DeleteServiceCommand: () => DeleteServiceCommand, + DeleteTaskDefinitionsCommand: () => DeleteTaskDefinitionsCommand, + DeleteTaskSetCommand: () => DeleteTaskSetCommand, + DeploymentControllerType: () => DeploymentControllerType, + DeploymentRolloutState: () => DeploymentRolloutState, + DeregisterContainerInstanceCommand: () => DeregisterContainerInstanceCommand, + DeregisterTaskDefinitionCommand: () => DeregisterTaskDefinitionCommand, + DescribeCapacityProvidersCommand: () => DescribeCapacityProvidersCommand, + DescribeClustersCommand: () => DescribeClustersCommand, + DescribeContainerInstancesCommand: () => DescribeContainerInstancesCommand, + DescribeServicesCommand: () => DescribeServicesCommand, + DescribeTaskDefinitionCommand: () => DescribeTaskDefinitionCommand, + DescribeTaskSetsCommand: () => DescribeTaskSetsCommand, + DescribeTasksCommand: () => DescribeTasksCommand, + DesiredStatus: () => DesiredStatus, + DeviceCgroupPermission: () => DeviceCgroupPermission, + DiscoverPollEndpointCommand: () => DiscoverPollEndpointCommand, + EBSResourceType: () => EBSResourceType, + ECS: () => ECS, + ECSClient: () => ECSClient, + ECSServiceException: () => ECSServiceException, + EFSAuthorizationConfigIAM: () => EFSAuthorizationConfigIAM, + EFSTransitEncryption: () => EFSTransitEncryption, + EnvironmentFileType: () => EnvironmentFileType, + ExecuteCommandCommand: () => ExecuteCommandCommand, + ExecuteCommandLogging: () => ExecuteCommandLogging, + ExecuteCommandResponseFilterSensitiveLog: () => ExecuteCommandResponseFilterSensitiveLog, + FirelensConfigurationType: () => FirelensConfigurationType, + GetTaskProtectionCommand: () => GetTaskProtectionCommand, + HealthStatus: () => HealthStatus, + InstanceHealthCheckState: () => InstanceHealthCheckState, + InstanceHealthCheckType: () => InstanceHealthCheckType, + InvalidParameterException: () => InvalidParameterException, + IpcMode: () => IpcMode, + LaunchType: () => LaunchType, + LimitExceededException: () => LimitExceededException, + ListAccountSettingsCommand: () => ListAccountSettingsCommand, + ListAttributesCommand: () => ListAttributesCommand, + ListClustersCommand: () => ListClustersCommand, + ListContainerInstancesCommand: () => ListContainerInstancesCommand, + ListServicesByNamespaceCommand: () => ListServicesByNamespaceCommand, + ListServicesCommand: () => ListServicesCommand, + ListTagsForResourceCommand: () => ListTagsForResourceCommand, + ListTaskDefinitionFamiliesCommand: () => ListTaskDefinitionFamiliesCommand, + ListTaskDefinitionsCommand: () => ListTaskDefinitionsCommand, + ListTasksCommand: () => ListTasksCommand, + LogDriver: () => LogDriver, + ManagedAgentName: () => ManagedAgentName, + ManagedDraining: () => ManagedDraining, + ManagedScalingStatus: () => ManagedScalingStatus, + ManagedTerminationProtection: () => ManagedTerminationProtection, + MissingVersionException: () => MissingVersionException, + NamespaceNotFoundException: () => NamespaceNotFoundException, + NetworkMode: () => NetworkMode, + NoUpdateAvailableException: () => NoUpdateAvailableException, + OSFamily: () => OSFamily, + PidMode: () => PidMode, + PlacementConstraintType: () => PlacementConstraintType, + PlacementStrategyType: () => PlacementStrategyType, + PlatformDeviceType: () => PlatformDeviceType, + PlatformTaskDefinitionIncompatibilityException: () => PlatformTaskDefinitionIncompatibilityException, + PlatformUnknownException: () => PlatformUnknownException, + PropagateTags: () => PropagateTags, + ProxyConfigurationType: () => ProxyConfigurationType, + PutAccountSettingCommand: () => PutAccountSettingCommand, + PutAccountSettingDefaultCommand: () => PutAccountSettingDefaultCommand, + PutAttributesCommand: () => PutAttributesCommand, + PutClusterCapacityProvidersCommand: () => PutClusterCapacityProvidersCommand, + RegisterContainerInstanceCommand: () => RegisterContainerInstanceCommand, + RegisterTaskDefinitionCommand: () => RegisterTaskDefinitionCommand, + ResourceInUseException: () => ResourceInUseException, + ResourceNotFoundException: () => ResourceNotFoundException, + ResourceType: () => ResourceType, + RunTaskCommand: () => RunTaskCommand, + ScaleUnit: () => ScaleUnit, + SchedulingStrategy: () => SchedulingStrategy, + Scope: () => Scope, + ServerException: () => ServerException, + ServiceField: () => ServiceField, + ServiceNotActiveException: () => ServiceNotActiveException, + ServiceNotFoundException: () => ServiceNotFoundException, + SessionFilterSensitiveLog: () => SessionFilterSensitiveLog, + SettingName: () => SettingName, + SettingType: () => SettingType, + SortOrder: () => SortOrder, + StabilityStatus: () => StabilityStatus, + StartTaskCommand: () => StartTaskCommand, + StopTaskCommand: () => StopTaskCommand, + SubmitAttachmentStateChangesCommand: () => SubmitAttachmentStateChangesCommand, + SubmitContainerStateChangeCommand: () => SubmitContainerStateChangeCommand, + SubmitTaskStateChangeCommand: () => SubmitTaskStateChangeCommand, + TagResourceCommand: () => TagResourceCommand, + TargetNotConnectedException: () => TargetNotConnectedException, + TargetNotFoundException: () => TargetNotFoundException, + TargetType: () => TargetType, + TaskDefinitionFamilyStatus: () => TaskDefinitionFamilyStatus, + TaskDefinitionField: () => TaskDefinitionField, + TaskDefinitionPlacementConstraintType: () => TaskDefinitionPlacementConstraintType, + TaskDefinitionStatus: () => TaskDefinitionStatus, + TaskField: () => TaskField, + TaskFilesystemType: () => TaskFilesystemType, + TaskSetField: () => TaskSetField, + TaskSetNotFoundException: () => TaskSetNotFoundException, + TaskStopCode: () => TaskStopCode, + TransportProtocol: () => TransportProtocol, + UlimitName: () => UlimitName, + UnsupportedFeatureException: () => UnsupportedFeatureException, + UntagResourceCommand: () => UntagResourceCommand, + UpdateCapacityProviderCommand: () => UpdateCapacityProviderCommand, + UpdateClusterCommand: () => UpdateClusterCommand, + UpdateClusterSettingsCommand: () => UpdateClusterSettingsCommand, + UpdateContainerAgentCommand: () => UpdateContainerAgentCommand, + UpdateContainerInstancesStateCommand: () => UpdateContainerInstancesStateCommand, + UpdateInProgressException: () => UpdateInProgressException, + UpdateServiceCommand: () => UpdateServiceCommand, + UpdateServicePrimaryTaskSetCommand: () => UpdateServicePrimaryTaskSetCommand, + UpdateTaskProtectionCommand: () => UpdateTaskProtectionCommand, + UpdateTaskSetCommand: () => UpdateTaskSetCommand, + __Client: () => import_smithy_client.Client, + paginateListAccountSettings: () => paginateListAccountSettings, + paginateListAttributes: () => paginateListAttributes, + paginateListClusters: () => paginateListClusters, + paginateListContainerInstances: () => paginateListContainerInstances, + paginateListServices: () => paginateListServices, + paginateListServicesByNamespace: () => paginateListServicesByNamespace, + paginateListTaskDefinitionFamilies: () => paginateListTaskDefinitionFamilies, + paginateListTaskDefinitions: () => paginateListTaskDefinitions, + paginateListTasks: () => paginateListTasks, + waitForServicesInactive: () => waitForServicesInactive, + waitForServicesStable: () => waitForServicesStable, + waitForTasksRunning: () => waitForTasksRunning, + waitForTasksStopped: () => waitForTasksStopped, + waitUntilServicesInactive: () => waitUntilServicesInactive, + waitUntilServicesStable: () => waitUntilServicesStable, + waitUntilTasksRunning: () => waitUntilTasksRunning, + waitUntilTasksStopped: () => waitUntilTasksStopped +}); +module.exports = __toCommonJS(src_exports); + +// src/ECSClient.ts +var import_middleware_host_header = __nccwpck_require__(22545); +var import_middleware_logger = __nccwpck_require__(17415); +var import_middleware_recursion_detection = __nccwpck_require__(85525); +var import_middleware_user_agent = __nccwpck_require__(64688); +var import_config_resolver = __nccwpck_require__(53098); +var import_core = __nccwpck_require__(55829); +var import_middleware_content_length = __nccwpck_require__(82800); +var import_middleware_endpoint = __nccwpck_require__(82918); +var import_middleware_retry = __nccwpck_require__(96039); + +var import_httpAuthSchemeProvider = __nccwpck_require__(37983); + +// src/endpoint/EndpointParameters.ts +var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "ecs" + }; +}, "resolveClientEndpointParameters"); +var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } +}; + +// src/ECSClient.ts +var import_runtimeConfig = __nccwpck_require__(47246); + +// src/runtimeExtensions.ts +var import_region_config_resolver = __nccwpck_require__(18156); +var import_protocol_http = __nccwpck_require__(64418); +var import_smithy_client = __nccwpck_require__(63570); + +// src/auth/httpAuthExtensionConfiguration.ts +var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + } + }; +}, "getHttpAuthExtensionConfiguration"); +var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; +}, "resolveHttpAuthRuntimeConfig"); + +// src/runtimeExtensions.ts +var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); +var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; +}, "resolveRuntimeExtensions"); + +// src/ECSClient.ts +var _ECSClient = class _ECSClient extends import_smithy_client.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_config_resolver.resolveRegionConfig)(_config_1); + const _config_3 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_2); + const _config_4 = (0, import_middleware_retry.resolveRetryConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: this.getDefaultHttpAuthSchemeParametersProvider(), + identityProviderConfigProvider: this.getIdentityProviderConfigProvider() + }) + ); + this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); + } + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); + } + getDefaultHttpAuthSchemeParametersProvider() { + return import_httpAuthSchemeProvider.defaultECSHttpAuthSchemeParametersProvider; + } + getIdentityProviderConfigProvider() { + return async (config) => new import_core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }); + } +}; +__name(_ECSClient, "ECSClient"); +var ECSClient = _ECSClient; + +// src/ECS.ts + + +// src/commands/CreateCapacityProviderCommand.ts + +var import_middleware_serde = __nccwpck_require__(81238); + + +// src/protocols/Aws_json1_1.ts +var import_core2 = __nccwpck_require__(59963); + + +var import_uuid = __nccwpck_require__(82522); + +// src/models/ECSServiceException.ts + +var _ECSServiceException = class _ECSServiceException extends import_smithy_client.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _ECSServiceException.prototype); + } +}; +__name(_ECSServiceException, "ECSServiceException"); +var ECSServiceException = _ECSServiceException; + +// src/models/models_0.ts + +var _AccessDeniedException = class _AccessDeniedException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts + }); + this.name = "AccessDeniedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AccessDeniedException.prototype); + } +}; +__name(_AccessDeniedException, "AccessDeniedException"); +var AccessDeniedException = _AccessDeniedException; +var AgentUpdateStatus = { + FAILED: "FAILED", + PENDING: "PENDING", + STAGED: "STAGED", + STAGING: "STAGING", + UPDATED: "UPDATED", + UPDATING: "UPDATING" +}; +var _ClientException = class _ClientException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ClientException", + $fault: "client", + ...opts + }); + this.name = "ClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ClientException.prototype); + } +}; +__name(_ClientException, "ClientException"); +var ClientException = _ClientException; +var ManagedDraining = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var ManagedScalingStatus = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var ManagedTerminationProtection = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var CapacityProviderStatus = { + ACTIVE: "ACTIVE", + INACTIVE: "INACTIVE" +}; +var CapacityProviderUpdateStatus = { + DELETE_COMPLETE: "DELETE_COMPLETE", + DELETE_FAILED: "DELETE_FAILED", + DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", + UPDATE_COMPLETE: "UPDATE_COMPLETE", + UPDATE_FAILED: "UPDATE_FAILED", + UPDATE_IN_PROGRESS: "UPDATE_IN_PROGRESS" +}; +var _InvalidParameterException = class _InvalidParameterException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidParameterException", + $fault: "client", + ...opts + }); + this.name = "InvalidParameterException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidParameterException.prototype); + } +}; +__name(_InvalidParameterException, "InvalidParameterException"); +var InvalidParameterException = _InvalidParameterException; +var _LimitExceededException = class _LimitExceededException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "LimitExceededException", + $fault: "client", + ...opts + }); + this.name = "LimitExceededException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _LimitExceededException.prototype); + } +}; +__name(_LimitExceededException, "LimitExceededException"); +var LimitExceededException = _LimitExceededException; +var _ServerException = class _ServerException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ServerException", + $fault: "server", + ...opts + }); + this.name = "ServerException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _ServerException.prototype); + } +}; +__name(_ServerException, "ServerException"); +var ServerException = _ServerException; +var _UpdateInProgressException = class _UpdateInProgressException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UpdateInProgressException", + $fault: "client", + ...opts + }); + this.name = "UpdateInProgressException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UpdateInProgressException.prototype); + } +}; +__name(_UpdateInProgressException, "UpdateInProgressException"); +var UpdateInProgressException = _UpdateInProgressException; +var ExecuteCommandLogging = { + DEFAULT: "DEFAULT", + NONE: "NONE", + OVERRIDE: "OVERRIDE" +}; +var ClusterSettingName = { + CONTAINER_INSIGHTS: "containerInsights" +}; +var _NamespaceNotFoundException = class _NamespaceNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "NamespaceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "NamespaceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _NamespaceNotFoundException.prototype); + } +}; +__name(_NamespaceNotFoundException, "NamespaceNotFoundException"); +var NamespaceNotFoundException = _NamespaceNotFoundException; +var _ClusterNotFoundException = class _ClusterNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ClusterNotFoundException", + $fault: "client", + ...opts + }); + this.name = "ClusterNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ClusterNotFoundException.prototype); + } +}; +__name(_ClusterNotFoundException, "ClusterNotFoundException"); +var ClusterNotFoundException = _ClusterNotFoundException; +var DeploymentControllerType = { + CODE_DEPLOY: "CODE_DEPLOY", + ECS: "ECS", + EXTERNAL: "EXTERNAL" +}; +var LaunchType = { + EC2: "EC2", + EXTERNAL: "EXTERNAL", + FARGATE: "FARGATE" +}; +var AssignPublicIp = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var PlacementConstraintType = { + DISTINCT_INSTANCE: "distinctInstance", + MEMBER_OF: "memberOf" +}; +var PlacementStrategyType = { + BINPACK: "binpack", + RANDOM: "random", + SPREAD: "spread" +}; +var PropagateTags = { + NONE: "NONE", + SERVICE: "SERVICE", + TASK_DEFINITION: "TASK_DEFINITION" +}; +var SchedulingStrategy = { + DAEMON: "DAEMON", + REPLICA: "REPLICA" +}; +var LogDriver = { + AWSFIRELENS: "awsfirelens", + AWSLOGS: "awslogs", + FLUENTD: "fluentd", + GELF: "gelf", + JOURNALD: "journald", + JSON_FILE: "json-file", + SPLUNK: "splunk", + SYSLOG: "syslog" +}; +var TaskFilesystemType = { + EXT3: "ext3", + EXT4: "ext4", + XFS: "xfs" +}; +var EBSResourceType = { + VOLUME: "volume" +}; +var DeploymentRolloutState = { + COMPLETED: "COMPLETED", + FAILED: "FAILED", + IN_PROGRESS: "IN_PROGRESS" +}; +var ScaleUnit = { + PERCENT: "PERCENT" +}; +var StabilityStatus = { + STABILIZING: "STABILIZING", + STEADY_STATE: "STEADY_STATE" +}; +var _PlatformTaskDefinitionIncompatibilityException = class _PlatformTaskDefinitionIncompatibilityException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "PlatformTaskDefinitionIncompatibilityException", + $fault: "client", + ...opts + }); + this.name = "PlatformTaskDefinitionIncompatibilityException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _PlatformTaskDefinitionIncompatibilityException.prototype); + } +}; +__name(_PlatformTaskDefinitionIncompatibilityException, "PlatformTaskDefinitionIncompatibilityException"); +var PlatformTaskDefinitionIncompatibilityException = _PlatformTaskDefinitionIncompatibilityException; +var _PlatformUnknownException = class _PlatformUnknownException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "PlatformUnknownException", + $fault: "client", + ...opts + }); + this.name = "PlatformUnknownException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _PlatformUnknownException.prototype); + } +}; +__name(_PlatformUnknownException, "PlatformUnknownException"); +var PlatformUnknownException = _PlatformUnknownException; +var _UnsupportedFeatureException = class _UnsupportedFeatureException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnsupportedFeatureException", + $fault: "client", + ...opts + }); + this.name = "UnsupportedFeatureException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnsupportedFeatureException.prototype); + } +}; +__name(_UnsupportedFeatureException, "UnsupportedFeatureException"); +var UnsupportedFeatureException = _UnsupportedFeatureException; +var _ServiceNotActiveException = class _ServiceNotActiveException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ServiceNotActiveException", + $fault: "client", + ...opts + }); + this.name = "ServiceNotActiveException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ServiceNotActiveException.prototype); + } +}; +__name(_ServiceNotActiveException, "ServiceNotActiveException"); +var ServiceNotActiveException = _ServiceNotActiveException; +var _ServiceNotFoundException = class _ServiceNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ServiceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "ServiceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ServiceNotFoundException.prototype); + } +}; +__name(_ServiceNotFoundException, "ServiceNotFoundException"); +var ServiceNotFoundException = _ServiceNotFoundException; +var SettingName = { + AWSVPC_TRUNKING: "awsvpcTrunking", + CONTAINER_INSIGHTS: "containerInsights", + CONTAINER_INSTANCE_LONG_ARN_FORMAT: "containerInstanceLongArnFormat", + FARGATE_FIPS_MODE: "fargateFIPSMode", + FARGATE_TASK_RETIREMENT_WAIT_PERIOD: "fargateTaskRetirementWaitPeriod", + GUARD_DUTY_ACTIVATE: "guardDutyActivate", + SERVICE_LONG_ARN_FORMAT: "serviceLongArnFormat", + TAG_RESOURCE_AUTHORIZATION: "tagResourceAuthorization", + TASK_LONG_ARN_FORMAT: "taskLongArnFormat" +}; +var SettingType = { + AWS_MANAGED: "aws_managed", + USER: "user" +}; +var TargetType = { + CONTAINER_INSTANCE: "container-instance" +}; +var _TargetNotFoundException = class _TargetNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TargetNotFoundException", + $fault: "client", + ...opts + }); + this.name = "TargetNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TargetNotFoundException.prototype); + } +}; +__name(_TargetNotFoundException, "TargetNotFoundException"); +var TargetNotFoundException = _TargetNotFoundException; +var _ClusterContainsContainerInstancesException = class _ClusterContainsContainerInstancesException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ClusterContainsContainerInstancesException", + $fault: "client", + ...opts + }); + this.name = "ClusterContainsContainerInstancesException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ClusterContainsContainerInstancesException.prototype); + } +}; +__name(_ClusterContainsContainerInstancesException, "ClusterContainsContainerInstancesException"); +var ClusterContainsContainerInstancesException = _ClusterContainsContainerInstancesException; +var _ClusterContainsServicesException = class _ClusterContainsServicesException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ClusterContainsServicesException", + $fault: "client", + ...opts + }); + this.name = "ClusterContainsServicesException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ClusterContainsServicesException.prototype); + } +}; +__name(_ClusterContainsServicesException, "ClusterContainsServicesException"); +var ClusterContainsServicesException = _ClusterContainsServicesException; +var _ClusterContainsTasksException = class _ClusterContainsTasksException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ClusterContainsTasksException", + $fault: "client", + ...opts + }); + this.name = "ClusterContainsTasksException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ClusterContainsTasksException.prototype); + } +}; +__name(_ClusterContainsTasksException, "ClusterContainsTasksException"); +var ClusterContainsTasksException = _ClusterContainsTasksException; +var Compatibility = { + EC2: "EC2", + EXTERNAL: "EXTERNAL", + FARGATE: "FARGATE" +}; +var ContainerCondition = { + COMPLETE: "COMPLETE", + HEALTHY: "HEALTHY", + START: "START", + SUCCESS: "SUCCESS" +}; +var EnvironmentFileType = { + S3: "s3" +}; +var FirelensConfigurationType = { + FLUENTBIT: "fluentbit", + FLUENTD: "fluentd" +}; +var DeviceCgroupPermission = { + MKNOD: "mknod", + READ: "read", + WRITE: "write" +}; +var ApplicationProtocol = { + GRPC: "grpc", + HTTP: "http", + HTTP2: "http2" +}; +var TransportProtocol = { + TCP: "tcp", + UDP: "udp" +}; +var ResourceType = { + GPU: "GPU", + INFERENCE_ACCELERATOR: "InferenceAccelerator" +}; +var UlimitName = { + CORE: "core", + CPU: "cpu", + DATA: "data", + FSIZE: "fsize", + LOCKS: "locks", + MEMLOCK: "memlock", + MSGQUEUE: "msgqueue", + NICE: "nice", + NOFILE: "nofile", + NPROC: "nproc", + RSS: "rss", + RTPRIO: "rtprio", + RTTIME: "rttime", + SIGPENDING: "sigpending", + STACK: "stack" +}; +var IpcMode = { + HOST: "host", + NONE: "none", + TASK: "task" +}; +var NetworkMode = { + AWSVPC: "awsvpc", + BRIDGE: "bridge", + HOST: "host", + NONE: "none" +}; +var PidMode = { + HOST: "host", + TASK: "task" +}; +var TaskDefinitionPlacementConstraintType = { + MEMBER_OF: "memberOf" +}; +var ProxyConfigurationType = { + APPMESH: "APPMESH" +}; +var CPUArchitecture = { + ARM64: "ARM64", + X86_64: "X86_64" +}; +var OSFamily = { + LINUX: "LINUX", + WINDOWS_SERVER_2004_CORE: "WINDOWS_SERVER_2004_CORE", + WINDOWS_SERVER_2016_FULL: "WINDOWS_SERVER_2016_FULL", + WINDOWS_SERVER_2019_CORE: "WINDOWS_SERVER_2019_CORE", + WINDOWS_SERVER_2019_FULL: "WINDOWS_SERVER_2019_FULL", + WINDOWS_SERVER_2022_CORE: "WINDOWS_SERVER_2022_CORE", + WINDOWS_SERVER_2022_FULL: "WINDOWS_SERVER_2022_FULL", + WINDOWS_SERVER_20H2_CORE: "WINDOWS_SERVER_20H2_CORE" +}; +var TaskDefinitionStatus = { + ACTIVE: "ACTIVE", + DELETE_IN_PROGRESS: "DELETE_IN_PROGRESS", + INACTIVE: "INACTIVE" +}; +var Scope = { + SHARED: "shared", + TASK: "task" +}; +var EFSAuthorizationConfigIAM = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var EFSTransitEncryption = { + DISABLED: "DISABLED", + ENABLED: "ENABLED" +}; +var _TaskSetNotFoundException = class _TaskSetNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TaskSetNotFoundException", + $fault: "client", + ...opts + }); + this.name = "TaskSetNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TaskSetNotFoundException.prototype); + } +}; +__name(_TaskSetNotFoundException, "TaskSetNotFoundException"); +var TaskSetNotFoundException = _TaskSetNotFoundException; +var InstanceHealthCheckState = { + IMPAIRED: "IMPAIRED", + INITIALIZING: "INITIALIZING", + INSUFFICIENT_DATA: "INSUFFICIENT_DATA", + OK: "OK" +}; +var InstanceHealthCheckType = { + CONTAINER_RUNTIME: "CONTAINER_RUNTIME" +}; +var CapacityProviderField = { + TAGS: "TAGS" +}; +var ClusterField = { + ATTACHMENTS: "ATTACHMENTS", + CONFIGURATIONS: "CONFIGURATIONS", + SETTINGS: "SETTINGS", + STATISTICS: "STATISTICS", + TAGS: "TAGS" +}; +var ContainerInstanceField = { + CONTAINER_INSTANCE_HEALTH: "CONTAINER_INSTANCE_HEALTH", + TAGS: "TAGS" +}; +var ServiceField = { + TAGS: "TAGS" +}; +var TaskDefinitionField = { + TAGS: "TAGS" +}; +var TaskField = { + TAGS: "TAGS" +}; +var Connectivity = { + CONNECTED: "CONNECTED", + DISCONNECTED: "DISCONNECTED" +}; +var HealthStatus = { + HEALTHY: "HEALTHY", + UNHEALTHY: "UNHEALTHY", + UNKNOWN: "UNKNOWN" +}; +var ManagedAgentName = { + ExecuteCommandAgent: "ExecuteCommandAgent" +}; +var TaskStopCode = { + ESSENTIAL_CONTAINER_EXITED: "EssentialContainerExited", + SERVICE_SCHEDULER_INITIATED: "ServiceSchedulerInitiated", + SPOT_INTERRUPTION: "SpotInterruption", + TASK_FAILED_TO_START: "TaskFailedToStart", + TERMINATION_NOTICE: "TerminationNotice", + USER_INITIATED: "UserInitiated" +}; +var TaskSetField = { + TAGS: "TAGS" +}; +var _TargetNotConnectedException = class _TargetNotConnectedException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TargetNotConnectedException", + $fault: "client", + ...opts + }); + this.name = "TargetNotConnectedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TargetNotConnectedException.prototype); + } +}; +__name(_TargetNotConnectedException, "TargetNotConnectedException"); +var TargetNotConnectedException = _TargetNotConnectedException; +var _ResourceNotFoundException = class _ResourceNotFoundException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "ResourceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ResourceNotFoundException.prototype); + } +}; +__name(_ResourceNotFoundException, "ResourceNotFoundException"); +var ResourceNotFoundException = _ResourceNotFoundException; +var ContainerInstanceStatus = { + ACTIVE: "ACTIVE", + DEREGISTERING: "DEREGISTERING", + DRAINING: "DRAINING", + REGISTERING: "REGISTERING", + REGISTRATION_FAILED: "REGISTRATION_FAILED" +}; +var TaskDefinitionFamilyStatus = { + ACTIVE: "ACTIVE", + ALL: "ALL", + INACTIVE: "INACTIVE" +}; +var SortOrder = { + ASC: "ASC", + DESC: "DESC" +}; +var DesiredStatus = { + PENDING: "PENDING", + RUNNING: "RUNNING", + STOPPED: "STOPPED" +}; +var _AttributeLimitExceededException = class _AttributeLimitExceededException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AttributeLimitExceededException", + $fault: "client", + ...opts + }); + this.name = "AttributeLimitExceededException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AttributeLimitExceededException.prototype); + } +}; +__name(_AttributeLimitExceededException, "AttributeLimitExceededException"); +var AttributeLimitExceededException = _AttributeLimitExceededException; +var _ResourceInUseException = class _ResourceInUseException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ResourceInUseException", + $fault: "client", + ...opts + }); + this.name = "ResourceInUseException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ResourceInUseException.prototype); + } +}; +__name(_ResourceInUseException, "ResourceInUseException"); +var ResourceInUseException = _ResourceInUseException; +var PlatformDeviceType = { + GPU: "GPU" +}; +var _BlockedException = class _BlockedException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "BlockedException", + $fault: "client", + ...opts + }); + this.name = "BlockedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _BlockedException.prototype); + } +}; +__name(_BlockedException, "BlockedException"); +var BlockedException = _BlockedException; +var _ConflictException = class _ConflictException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ConflictException", + $fault: "client", + ...opts + }); + this.name = "ConflictException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ConflictException.prototype); + this.resourceIds = opts.resourceIds; + } +}; +__name(_ConflictException, "ConflictException"); +var ConflictException = _ConflictException; +var _MissingVersionException = class _MissingVersionException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "MissingVersionException", + $fault: "client", + ...opts + }); + this.name = "MissingVersionException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _MissingVersionException.prototype); + } +}; +__name(_MissingVersionException, "MissingVersionException"); +var MissingVersionException = _MissingVersionException; +var _NoUpdateAvailableException = class _NoUpdateAvailableException extends ECSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "NoUpdateAvailableException", + $fault: "client", + ...opts + }); + this.name = "NoUpdateAvailableException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _NoUpdateAvailableException.prototype); + } +}; +__name(_NoUpdateAvailableException, "NoUpdateAvailableException"); +var NoUpdateAvailableException = _NoUpdateAvailableException; +var SessionFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.tokenValue && { tokenValue: import_smithy_client.SENSITIVE_STRING } +}), "SessionFilterSensitiveLog"); +var ExecuteCommandResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.session && { session: SessionFilterSensitiveLog(obj.session) } +}), "ExecuteCommandResponseFilterSensitiveLog"); + +// src/protocols/Aws_json1_1.ts +var se_CreateCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateCapacityProvider"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_CreateCapacityProviderCommand"); +var se_CreateClusterCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateCluster"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_CreateClusterCommand"); +var se_CreateServiceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateService"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_CreateServiceCommand"); +var se_CreateTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("CreateTaskSet"); + let body; + body = JSON.stringify(se_CreateTaskSetRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_CreateTaskSetCommand"); +var se_DeleteAccountSettingCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteAccountSetting"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteAccountSettingCommand"); +var se_DeleteAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteAttributes"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteAttributesCommand"); +var se_DeleteCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteCapacityProvider"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteCapacityProviderCommand"); +var se_DeleteClusterCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteCluster"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteClusterCommand"); +var se_DeleteServiceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteService"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteServiceCommand"); +var se_DeleteTaskDefinitionsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteTaskDefinitions"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteTaskDefinitionsCommand"); +var se_DeleteTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeleteTaskSet"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeleteTaskSetCommand"); +var se_DeregisterContainerInstanceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeregisterContainerInstance"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeregisterContainerInstanceCommand"); +var se_DeregisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DeregisterTaskDefinition"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DeregisterTaskDefinitionCommand"); +var se_DescribeCapacityProvidersCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeCapacityProviders"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeCapacityProvidersCommand"); +var se_DescribeClustersCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeClusters"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeClustersCommand"); +var se_DescribeContainerInstancesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeContainerInstances"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeContainerInstancesCommand"); +var se_DescribeServicesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeServices"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeServicesCommand"); +var se_DescribeTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeTaskDefinition"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeTaskDefinitionCommand"); +var se_DescribeTasksCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeTasks"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeTasksCommand"); +var se_DescribeTaskSetsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DescribeTaskSets"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DescribeTaskSetsCommand"); +var se_DiscoverPollEndpointCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("DiscoverPollEndpoint"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DiscoverPollEndpointCommand"); +var se_ExecuteCommandCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ExecuteCommand"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ExecuteCommandCommand"); +var se_GetTaskProtectionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("GetTaskProtection"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_GetTaskProtectionCommand"); +var se_ListAccountSettingsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListAccountSettings"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListAccountSettingsCommand"); +var se_ListAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListAttributes"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListAttributesCommand"); +var se_ListClustersCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListClusters"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListClustersCommand"); +var se_ListContainerInstancesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListContainerInstances"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListContainerInstancesCommand"); +var se_ListServicesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListServices"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListServicesCommand"); +var se_ListServicesByNamespaceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListServicesByNamespace"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListServicesByNamespaceCommand"); +var se_ListTagsForResourceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListTagsForResource"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListTagsForResourceCommand"); +var se_ListTaskDefinitionFamiliesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListTaskDefinitionFamilies"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListTaskDefinitionFamiliesCommand"); +var se_ListTaskDefinitionsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListTaskDefinitions"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListTaskDefinitionsCommand"); +var se_ListTasksCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("ListTasks"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_ListTasksCommand"); +var se_PutAccountSettingCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("PutAccountSetting"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_PutAccountSettingCommand"); +var se_PutAccountSettingDefaultCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("PutAccountSettingDefault"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_PutAccountSettingDefaultCommand"); +var se_PutAttributesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("PutAttributes"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_PutAttributesCommand"); +var se_PutClusterCapacityProvidersCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("PutClusterCapacityProviders"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_PutClusterCapacityProvidersCommand"); +var se_RegisterContainerInstanceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RegisterContainerInstance"); + let body; + body = JSON.stringify(se_RegisterContainerInstanceRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_RegisterContainerInstanceCommand"); +var se_RegisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RegisterTaskDefinition"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_RegisterTaskDefinitionCommand"); +var se_RunTaskCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("RunTask"); + let body; + body = JSON.stringify(se_RunTaskRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_RunTaskCommand"); +var se_StartTaskCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("StartTask"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_StartTaskCommand"); +var se_StopTaskCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("StopTask"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_StopTaskCommand"); +var se_SubmitAttachmentStateChangesCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("SubmitAttachmentStateChanges"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_SubmitAttachmentStateChangesCommand"); +var se_SubmitContainerStateChangeCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("SubmitContainerStateChange"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_SubmitContainerStateChangeCommand"); +var se_SubmitTaskStateChangeCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("SubmitTaskStateChange"); + let body; + body = JSON.stringify(se_SubmitTaskStateChangeRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_SubmitTaskStateChangeCommand"); +var se_TagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("TagResource"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_TagResourceCommand"); +var se_UntagResourceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UntagResource"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UntagResourceCommand"); +var se_UpdateCapacityProviderCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateCapacityProvider"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateCapacityProviderCommand"); +var se_UpdateClusterCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateCluster"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateClusterCommand"); +var se_UpdateClusterSettingsCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateClusterSettings"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateClusterSettingsCommand"); +var se_UpdateContainerAgentCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateContainerAgent"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateContainerAgentCommand"); +var se_UpdateContainerInstancesStateCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateContainerInstancesState"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateContainerInstancesStateCommand"); +var se_UpdateServiceCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateService"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateServiceCommand"); +var se_UpdateServicePrimaryTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateServicePrimaryTaskSet"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateServicePrimaryTaskSetCommand"); +var se_UpdateTaskProtectionCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateTaskProtection"); + let body; + body = JSON.stringify((0, import_smithy_client._json)(input)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateTaskProtectionCommand"); +var se_UpdateTaskSetCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = sharedHeaders("UpdateTaskSet"); + let body; + body = JSON.stringify(se_UpdateTaskSetRequest(input, context)); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_UpdateTaskSetCommand"); +var de_CreateCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_CreateCapacityProviderCommand"); +var de_CreateClusterCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_CreateClusterCommand"); +var de_CreateServiceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_CreateServiceResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_CreateServiceCommand"); +var de_CreateTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_CreateTaskSetResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_CreateTaskSetCommand"); +var de_DeleteAccountSettingCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteAccountSettingCommand"); +var de_DeleteAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteAttributesCommand"); +var de_DeleteCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteCapacityProviderCommand"); +var de_DeleteClusterCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteClusterCommand"); +var de_DeleteServiceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeleteServiceResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteServiceCommand"); +var de_DeleteTaskDefinitionsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeleteTaskDefinitionsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteTaskDefinitionsCommand"); +var de_DeleteTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeleteTaskSetResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeleteTaskSetCommand"); +var de_DeregisterContainerInstanceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeregisterContainerInstanceResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeregisterContainerInstanceCommand"); +var de_DeregisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DeregisterTaskDefinitionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DeregisterTaskDefinitionCommand"); +var de_DescribeCapacityProvidersCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeCapacityProvidersCommand"); +var de_DescribeClustersCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeClustersCommand"); +var de_DescribeContainerInstancesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeContainerInstancesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeContainerInstancesCommand"); +var de_DescribeServicesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeServicesResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeServicesCommand"); +var de_DescribeTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeTaskDefinitionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeTaskDefinitionCommand"); +var de_DescribeTasksCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeTasksResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeTasksCommand"); +var de_DescribeTaskSetsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_DescribeTaskSetsResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DescribeTaskSetsCommand"); +var de_DiscoverPollEndpointCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DiscoverPollEndpointCommand"); +var de_ExecuteCommandCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ExecuteCommandCommand"); +var de_GetTaskProtectionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_GetTaskProtectionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_GetTaskProtectionCommand"); +var de_ListAccountSettingsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListAccountSettingsCommand"); +var de_ListAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListAttributesCommand"); +var de_ListClustersCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListClustersCommand"); +var de_ListContainerInstancesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListContainerInstancesCommand"); +var de_ListServicesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListServicesCommand"); +var de_ListServicesByNamespaceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListServicesByNamespaceCommand"); +var de_ListTagsForResourceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListTagsForResourceCommand"); +var de_ListTaskDefinitionFamiliesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListTaskDefinitionFamiliesCommand"); +var de_ListTaskDefinitionsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListTaskDefinitionsCommand"); +var de_ListTasksCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_ListTasksCommand"); +var de_PutAccountSettingCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_PutAccountSettingCommand"); +var de_PutAccountSettingDefaultCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_PutAccountSettingDefaultCommand"); +var de_PutAttributesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_PutAttributesCommand"); +var de_PutClusterCapacityProvidersCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_PutClusterCapacityProvidersCommand"); +var de_RegisterContainerInstanceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_RegisterContainerInstanceResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_RegisterContainerInstanceCommand"); +var de_RegisterTaskDefinitionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_RegisterTaskDefinitionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_RegisterTaskDefinitionCommand"); +var de_RunTaskCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_RunTaskResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_RunTaskCommand"); +var de_StartTaskCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_StartTaskResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_StartTaskCommand"); +var de_StopTaskCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_StopTaskResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_StopTaskCommand"); +var de_SubmitAttachmentStateChangesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_SubmitAttachmentStateChangesCommand"); +var de_SubmitContainerStateChangeCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_SubmitContainerStateChangeCommand"); +var de_SubmitTaskStateChangeCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_SubmitTaskStateChangeCommand"); +var de_TagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_TagResourceCommand"); +var de_UntagResourceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UntagResourceCommand"); +var de_UpdateCapacityProviderCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateCapacityProviderCommand"); +var de_UpdateClusterCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateClusterCommand"); +var de_UpdateClusterSettingsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = (0, import_smithy_client._json)(data); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateClusterSettingsCommand"); +var de_UpdateContainerAgentCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateContainerAgentResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateContainerAgentCommand"); +var de_UpdateContainerInstancesStateCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateContainerInstancesStateResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateContainerInstancesStateCommand"); +var de_UpdateServiceCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateServiceResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateServiceCommand"); +var de_UpdateServicePrimaryTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateServicePrimaryTaskSetResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateServicePrimaryTaskSetCommand"); +var de_UpdateTaskProtectionCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateTaskProtectionResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateTaskProtectionCommand"); +var de_UpdateTaskSetCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core2.parseJsonBody)(output.body, context); + let contents = {}; + contents = de_UpdateTaskSetResponse(data, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_UpdateTaskSetCommand"); +var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core2.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "ClientException": + case "com.amazonaws.ecs#ClientException": + throw await de_ClientExceptionRes(parsedOutput, context); + case "InvalidParameterException": + case "com.amazonaws.ecs#InvalidParameterException": + throw await de_InvalidParameterExceptionRes(parsedOutput, context); + case "LimitExceededException": + case "com.amazonaws.ecs#LimitExceededException": + throw await de_LimitExceededExceptionRes(parsedOutput, context); + case "ServerException": + case "com.amazonaws.ecs#ServerException": + throw await de_ServerExceptionRes(parsedOutput, context); + case "UpdateInProgressException": + case "com.amazonaws.ecs#UpdateInProgressException": + throw await de_UpdateInProgressExceptionRes(parsedOutput, context); + case "NamespaceNotFoundException": + case "com.amazonaws.ecs#NamespaceNotFoundException": + throw await de_NamespaceNotFoundExceptionRes(parsedOutput, context); + case "AccessDeniedException": + case "com.amazonaws.ecs#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput, context); + case "ClusterNotFoundException": + case "com.amazonaws.ecs#ClusterNotFoundException": + throw await de_ClusterNotFoundExceptionRes(parsedOutput, context); + case "PlatformTaskDefinitionIncompatibilityException": + case "com.amazonaws.ecs#PlatformTaskDefinitionIncompatibilityException": + throw await de_PlatformTaskDefinitionIncompatibilityExceptionRes(parsedOutput, context); + case "PlatformUnknownException": + case "com.amazonaws.ecs#PlatformUnknownException": + throw await de_PlatformUnknownExceptionRes(parsedOutput, context); + case "UnsupportedFeatureException": + case "com.amazonaws.ecs#UnsupportedFeatureException": + throw await de_UnsupportedFeatureExceptionRes(parsedOutput, context); + case "ServiceNotActiveException": + case "com.amazonaws.ecs#ServiceNotActiveException": + throw await de_ServiceNotActiveExceptionRes(parsedOutput, context); + case "ServiceNotFoundException": + case "com.amazonaws.ecs#ServiceNotFoundException": + throw await de_ServiceNotFoundExceptionRes(parsedOutput, context); + case "TargetNotFoundException": + case "com.amazonaws.ecs#TargetNotFoundException": + throw await de_TargetNotFoundExceptionRes(parsedOutput, context); + case "ClusterContainsContainerInstancesException": + case "com.amazonaws.ecs#ClusterContainsContainerInstancesException": + throw await de_ClusterContainsContainerInstancesExceptionRes(parsedOutput, context); + case "ClusterContainsServicesException": + case "com.amazonaws.ecs#ClusterContainsServicesException": + throw await de_ClusterContainsServicesExceptionRes(parsedOutput, context); + case "ClusterContainsTasksException": + case "com.amazonaws.ecs#ClusterContainsTasksException": + throw await de_ClusterContainsTasksExceptionRes(parsedOutput, context); + case "TaskSetNotFoundException": + case "com.amazonaws.ecs#TaskSetNotFoundException": + throw await de_TaskSetNotFoundExceptionRes(parsedOutput, context); + case "TargetNotConnectedException": + case "com.amazonaws.ecs#TargetNotConnectedException": + throw await de_TargetNotConnectedExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.ecs#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "AttributeLimitExceededException": + case "com.amazonaws.ecs#AttributeLimitExceededException": + throw await de_AttributeLimitExceededExceptionRes(parsedOutput, context); + case "ResourceInUseException": + case "com.amazonaws.ecs#ResourceInUseException": + throw await de_ResourceInUseExceptionRes(parsedOutput, context); + case "BlockedException": + case "com.amazonaws.ecs#BlockedException": + throw await de_BlockedExceptionRes(parsedOutput, context); + case "ConflictException": + case "com.amazonaws.ecs#ConflictException": + throw await de_ConflictExceptionRes(parsedOutput, context); + case "MissingVersionException": + case "com.amazonaws.ecs#MissingVersionException": + throw await de_MissingVersionExceptionRes(parsedOutput, context); + case "NoUpdateAvailableException": + case "com.amazonaws.ecs#NoUpdateAvailableException": + throw await de_NoUpdateAvailableExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}, "de_CommandError"); +var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new AccessDeniedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_AccessDeniedExceptionRes"); +var de_AttributeLimitExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new AttributeLimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_AttributeLimitExceededExceptionRes"); +var de_BlockedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new BlockedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_BlockedExceptionRes"); +var de_ClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ClientExceptionRes"); +var de_ClusterContainsContainerInstancesExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ClusterContainsContainerInstancesException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ClusterContainsContainerInstancesExceptionRes"); +var de_ClusterContainsServicesExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ClusterContainsServicesException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ClusterContainsServicesExceptionRes"); +var de_ClusterContainsTasksExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ClusterContainsTasksException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ClusterContainsTasksExceptionRes"); +var de_ClusterNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ClusterNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ClusterNotFoundExceptionRes"); +var de_ConflictExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ConflictException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ConflictExceptionRes"); +var de_InvalidParameterExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new InvalidParameterException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_InvalidParameterExceptionRes"); +var de_LimitExceededExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new LimitExceededException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_LimitExceededExceptionRes"); +var de_MissingVersionExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new MissingVersionException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_MissingVersionExceptionRes"); +var de_NamespaceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new NamespaceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_NamespaceNotFoundExceptionRes"); +var de_NoUpdateAvailableExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new NoUpdateAvailableException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_NoUpdateAvailableExceptionRes"); +var de_PlatformTaskDefinitionIncompatibilityExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new PlatformTaskDefinitionIncompatibilityException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_PlatformTaskDefinitionIncompatibilityExceptionRes"); +var de_PlatformUnknownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new PlatformUnknownException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_PlatformUnknownExceptionRes"); +var de_ResourceInUseExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ResourceInUseException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ResourceInUseExceptionRes"); +var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ResourceNotFoundExceptionRes"); +var de_ServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ServerExceptionRes"); +var de_ServiceNotActiveExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ServiceNotActiveException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ServiceNotActiveExceptionRes"); +var de_ServiceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new ServiceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ServiceNotFoundExceptionRes"); +var de_TargetNotConnectedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new TargetNotConnectedException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_TargetNotConnectedExceptionRes"); +var de_TargetNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new TargetNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_TargetNotFoundExceptionRes"); +var de_TaskSetNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new TaskSetNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_TaskSetNotFoundExceptionRes"); +var de_UnsupportedFeatureExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new UnsupportedFeatureException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_UnsupportedFeatureExceptionRes"); +var de_UpdateInProgressExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = (0, import_smithy_client._json)(body); + const exception = new UpdateInProgressException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_UpdateInProgressExceptionRes"); +var se_CreateTaskSetRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + capacityProviderStrategy: import_smithy_client._json, + clientToken: [], + cluster: [], + externalId: [], + launchType: [], + loadBalancers: import_smithy_client._json, + networkConfiguration: import_smithy_client._json, + platformVersion: [], + scale: (_) => se_Scale(_, context), + service: [], + serviceRegistries: import_smithy_client._json, + tags: import_smithy_client._json, + taskDefinition: [] + }); +}, "se_CreateTaskSetRequest"); +var se_RegisterContainerInstanceRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + attributes: import_smithy_client._json, + cluster: [], + containerInstanceArn: [], + instanceIdentityDocument: [], + instanceIdentityDocumentSignature: [], + platformDevices: import_smithy_client._json, + tags: import_smithy_client._json, + totalResources: (_) => se_Resources(_, context), + versionInfo: import_smithy_client._json + }); +}, "se_RegisterContainerInstanceRequest"); +var se_Resource = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + doubleValue: import_smithy_client.serializeFloat, + integerValue: [], + longValue: [], + name: [], + stringSetValue: import_smithy_client._json, + type: [] + }); +}, "se_Resource"); +var se_Resources = /* @__PURE__ */ __name((input, context) => { + return input.filter((e) => e != null).map((entry) => { + return se_Resource(entry, context); + }); +}, "se_Resources"); +var se_RunTaskRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + capacityProviderStrategy: import_smithy_client._json, + clientToken: [true, (_) => _ ?? (0, import_uuid.v4)()], + cluster: [], + count: [], + enableECSManagedTags: [], + enableExecuteCommand: [], + group: [], + launchType: [], + networkConfiguration: import_smithy_client._json, + overrides: import_smithy_client._json, + placementConstraints: import_smithy_client._json, + placementStrategy: import_smithy_client._json, + platformVersion: [], + propagateTags: [], + referenceId: [], + startedBy: [], + tags: import_smithy_client._json, + taskDefinition: [], + volumeConfigurations: import_smithy_client._json + }); +}, "se_RunTaskRequest"); +var se_Scale = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + unit: [], + value: import_smithy_client.serializeFloat + }); +}, "se_Scale"); +var se_SubmitTaskStateChangeRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + attachments: import_smithy_client._json, + cluster: [], + containers: import_smithy_client._json, + executionStoppedAt: (_) => _.getTime() / 1e3, + managedAgents: import_smithy_client._json, + pullStartedAt: (_) => _.getTime() / 1e3, + pullStoppedAt: (_) => _.getTime() / 1e3, + reason: [], + status: [], + task: [] + }); +}, "se_SubmitTaskStateChangeRequest"); +var se_UpdateTaskSetRequest = /* @__PURE__ */ __name((input, context) => { + return (0, import_smithy_client.take)(input, { + cluster: [], + scale: (_) => se_Scale(_, context), + service: [], + taskSet: [] + }); +}, "se_UpdateTaskSetRequest"); +var de_Container = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerArn: import_smithy_client.expectString, + cpu: import_smithy_client.expectString, + exitCode: import_smithy_client.expectInt32, + gpuIds: import_smithy_client._json, + healthStatus: import_smithy_client.expectString, + image: import_smithy_client.expectString, + imageDigest: import_smithy_client.expectString, + lastStatus: import_smithy_client.expectString, + managedAgents: (_) => de_ManagedAgents(_, context), + memory: import_smithy_client.expectString, + memoryReservation: import_smithy_client.expectString, + name: import_smithy_client.expectString, + networkBindings: import_smithy_client._json, + networkInterfaces: import_smithy_client._json, + reason: import_smithy_client.expectString, + runtimeId: import_smithy_client.expectString, + taskArn: import_smithy_client.expectString + }); +}, "de_Container"); +var de_ContainerInstance = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + agentConnected: import_smithy_client.expectBoolean, + agentUpdateStatus: import_smithy_client.expectString, + attachments: import_smithy_client._json, + attributes: import_smithy_client._json, + capacityProviderName: import_smithy_client.expectString, + containerInstanceArn: import_smithy_client.expectString, + ec2InstanceId: import_smithy_client.expectString, + healthStatus: (_) => de_ContainerInstanceHealthStatus(_, context), + pendingTasksCount: import_smithy_client.expectInt32, + registeredAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + registeredResources: (_) => de_Resources(_, context), + remainingResources: (_) => de_Resources(_, context), + runningTasksCount: import_smithy_client.expectInt32, + status: import_smithy_client.expectString, + statusReason: import_smithy_client.expectString, + tags: import_smithy_client._json, + version: import_smithy_client.expectLong, + versionInfo: import_smithy_client._json + }); +}, "de_ContainerInstance"); +var de_ContainerInstanceHealthStatus = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + details: (_) => de_InstanceHealthCheckResultList(_, context), + overallStatus: import_smithy_client.expectString + }); +}, "de_ContainerInstanceHealthStatus"); +var de_ContainerInstances = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_ContainerInstance(entry, context); + }); + return retVal; +}, "de_ContainerInstances"); +var de_Containers = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_Container(entry, context); + }); + return retVal; +}, "de_Containers"); +var de_CreateServiceResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + service: (_) => de_Service(_, context) + }); +}, "de_CreateServiceResponse"); +var de_CreateTaskSetResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + taskSet: (_) => de_TaskSet(_, context) + }); +}, "de_CreateTaskSetResponse"); +var de_DeleteServiceResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + service: (_) => de_Service(_, context) + }); +}, "de_DeleteServiceResponse"); +var de_DeleteTaskDefinitionsResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + taskDefinitions: (_) => de_TaskDefinitionList(_, context) + }); +}, "de_DeleteTaskDefinitionsResponse"); +var de_DeleteTaskSetResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + taskSet: (_) => de_TaskSet(_, context) + }); +}, "de_DeleteTaskSetResponse"); +var de_Deployment = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + capacityProviderStrategy: import_smithy_client._json, + createdAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + desiredCount: import_smithy_client.expectInt32, + failedTasks: import_smithy_client.expectInt32, + fargateEphemeralStorage: import_smithy_client._json, + id: import_smithy_client.expectString, + launchType: import_smithy_client.expectString, + networkConfiguration: import_smithy_client._json, + pendingCount: import_smithy_client.expectInt32, + platformFamily: import_smithy_client.expectString, + platformVersion: import_smithy_client.expectString, + rolloutState: import_smithy_client.expectString, + rolloutStateReason: import_smithy_client.expectString, + runningCount: import_smithy_client.expectInt32, + serviceConnectConfiguration: import_smithy_client._json, + serviceConnectResources: import_smithy_client._json, + status: import_smithy_client.expectString, + taskDefinition: import_smithy_client.expectString, + updatedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + volumeConfigurations: import_smithy_client._json + }); +}, "de_Deployment"); +var de_Deployments = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_Deployment(entry, context); + }); + return retVal; +}, "de_Deployments"); +var de_DeregisterContainerInstanceResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerInstance: (_) => de_ContainerInstance(_, context) + }); +}, "de_DeregisterContainerInstanceResponse"); +var de_DeregisterTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + taskDefinition: (_) => de_TaskDefinition(_, context) + }); +}, "de_DeregisterTaskDefinitionResponse"); +var de_DescribeContainerInstancesResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerInstances: (_) => de_ContainerInstances(_, context), + failures: import_smithy_client._json + }); +}, "de_DescribeContainerInstancesResponse"); +var de_DescribeServicesResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + services: (_) => de_Services(_, context) + }); +}, "de_DescribeServicesResponse"); +var de_DescribeTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + tags: import_smithy_client._json, + taskDefinition: (_) => de_TaskDefinition(_, context) + }); +}, "de_DescribeTaskDefinitionResponse"); +var de_DescribeTaskSetsResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + taskSets: (_) => de_TaskSets(_, context) + }); +}, "de_DescribeTaskSetsResponse"); +var de_DescribeTasksResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + tasks: (_) => de_Tasks(_, context) + }); +}, "de_DescribeTasksResponse"); +var de_GetTaskProtectionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + protectedTasks: (_) => de_ProtectedTasks(_, context) + }); +}, "de_GetTaskProtectionResponse"); +var de_InstanceHealthCheckResult = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + lastStatusChange: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + lastUpdated: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + status: import_smithy_client.expectString, + type: import_smithy_client.expectString + }); +}, "de_InstanceHealthCheckResult"); +var de_InstanceHealthCheckResultList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_InstanceHealthCheckResult(entry, context); + }); + return retVal; +}, "de_InstanceHealthCheckResultList"); +var de_ManagedAgent = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + lastStartedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + lastStatus: import_smithy_client.expectString, + name: import_smithy_client.expectString, + reason: import_smithy_client.expectString + }); +}, "de_ManagedAgent"); +var de_ManagedAgents = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_ManagedAgent(entry, context); + }); + return retVal; +}, "de_ManagedAgents"); +var de_ProtectedTask = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + expirationDate: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + protectionEnabled: import_smithy_client.expectBoolean, + taskArn: import_smithy_client.expectString + }); +}, "de_ProtectedTask"); +var de_ProtectedTasks = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_ProtectedTask(entry, context); + }); + return retVal; +}, "de_ProtectedTasks"); +var de_RegisterContainerInstanceResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerInstance: (_) => de_ContainerInstance(_, context) + }); +}, "de_RegisterContainerInstanceResponse"); +var de_RegisterTaskDefinitionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + tags: import_smithy_client._json, + taskDefinition: (_) => de_TaskDefinition(_, context) + }); +}, "de_RegisterTaskDefinitionResponse"); +var de_Resource = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + doubleValue: import_smithy_client.limitedParseDouble, + integerValue: import_smithy_client.expectInt32, + longValue: import_smithy_client.expectLong, + name: import_smithy_client.expectString, + stringSetValue: import_smithy_client._json, + type: import_smithy_client.expectString + }); +}, "de_Resource"); +var de_Resources = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_Resource(entry, context); + }); + return retVal; +}, "de_Resources"); +var de_RunTaskResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + tasks: (_) => de_Tasks(_, context) + }); +}, "de_RunTaskResponse"); +var de_Scale = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + unit: import_smithy_client.expectString, + value: import_smithy_client.limitedParseDouble + }); +}, "de_Scale"); +var de_Service = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + capacityProviderStrategy: import_smithy_client._json, + clusterArn: import_smithy_client.expectString, + createdAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + createdBy: import_smithy_client.expectString, + deploymentConfiguration: import_smithy_client._json, + deploymentController: import_smithy_client._json, + deployments: (_) => de_Deployments(_, context), + desiredCount: import_smithy_client.expectInt32, + enableECSManagedTags: import_smithy_client.expectBoolean, + enableExecuteCommand: import_smithy_client.expectBoolean, + events: (_) => de_ServiceEvents(_, context), + healthCheckGracePeriodSeconds: import_smithy_client.expectInt32, + launchType: import_smithy_client.expectString, + loadBalancers: import_smithy_client._json, + networkConfiguration: import_smithy_client._json, + pendingCount: import_smithy_client.expectInt32, + placementConstraints: import_smithy_client._json, + placementStrategy: import_smithy_client._json, + platformFamily: import_smithy_client.expectString, + platformVersion: import_smithy_client.expectString, + propagateTags: import_smithy_client.expectString, + roleArn: import_smithy_client.expectString, + runningCount: import_smithy_client.expectInt32, + schedulingStrategy: import_smithy_client.expectString, + serviceArn: import_smithy_client.expectString, + serviceName: import_smithy_client.expectString, + serviceRegistries: import_smithy_client._json, + status: import_smithy_client.expectString, + tags: import_smithy_client._json, + taskDefinition: import_smithy_client.expectString, + taskSets: (_) => de_TaskSets(_, context) + }); +}, "de_Service"); +var de_ServiceEvent = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + createdAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + id: import_smithy_client.expectString, + message: import_smithy_client.expectString + }); +}, "de_ServiceEvent"); +var de_ServiceEvents = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_ServiceEvent(entry, context); + }); + return retVal; +}, "de_ServiceEvents"); +var de_Services = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_Service(entry, context); + }); + return retVal; +}, "de_Services"); +var de_StartTaskResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + tasks: (_) => de_Tasks(_, context) + }); +}, "de_StartTaskResponse"); +var de_StopTaskResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + task: (_) => de_Task(_, context) + }); +}, "de_StopTaskResponse"); +var de_Task = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + attachments: import_smithy_client._json, + attributes: import_smithy_client._json, + availabilityZone: import_smithy_client.expectString, + capacityProviderName: import_smithy_client.expectString, + clusterArn: import_smithy_client.expectString, + connectivity: import_smithy_client.expectString, + connectivityAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + containerInstanceArn: import_smithy_client.expectString, + containers: (_) => de_Containers(_, context), + cpu: import_smithy_client.expectString, + createdAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + desiredStatus: import_smithy_client.expectString, + enableExecuteCommand: import_smithy_client.expectBoolean, + ephemeralStorage: import_smithy_client._json, + executionStoppedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + fargateEphemeralStorage: import_smithy_client._json, + group: import_smithy_client.expectString, + healthStatus: import_smithy_client.expectString, + inferenceAccelerators: import_smithy_client._json, + lastStatus: import_smithy_client.expectString, + launchType: import_smithy_client.expectString, + memory: import_smithy_client.expectString, + overrides: import_smithy_client._json, + platformFamily: import_smithy_client.expectString, + platformVersion: import_smithy_client.expectString, + pullStartedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + pullStoppedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + startedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + startedBy: import_smithy_client.expectString, + stopCode: import_smithy_client.expectString, + stoppedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + stoppedReason: import_smithy_client.expectString, + stoppingAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + tags: import_smithy_client._json, + taskArn: import_smithy_client.expectString, + taskDefinitionArn: import_smithy_client.expectString, + version: import_smithy_client.expectLong + }); +}, "de_Task"); +var de_TaskDefinition = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + compatibilities: import_smithy_client._json, + containerDefinitions: import_smithy_client._json, + cpu: import_smithy_client.expectString, + deregisteredAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + ephemeralStorage: import_smithy_client._json, + executionRoleArn: import_smithy_client.expectString, + family: import_smithy_client.expectString, + inferenceAccelerators: import_smithy_client._json, + ipcMode: import_smithy_client.expectString, + memory: import_smithy_client.expectString, + networkMode: import_smithy_client.expectString, + pidMode: import_smithy_client.expectString, + placementConstraints: import_smithy_client._json, + proxyConfiguration: import_smithy_client._json, + registeredAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + registeredBy: import_smithy_client.expectString, + requiresAttributes: import_smithy_client._json, + requiresCompatibilities: import_smithy_client._json, + revision: import_smithy_client.expectInt32, + runtimePlatform: import_smithy_client._json, + status: import_smithy_client.expectString, + taskDefinitionArn: import_smithy_client.expectString, + taskRoleArn: import_smithy_client.expectString, + volumes: import_smithy_client._json + }); +}, "de_TaskDefinition"); +var de_TaskDefinitionList = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_TaskDefinition(entry, context); + }); + return retVal; +}, "de_TaskDefinitionList"); +var de_Tasks = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_Task(entry, context); + }); + return retVal; +}, "de_Tasks"); +var de_TaskSet = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + capacityProviderStrategy: import_smithy_client._json, + clusterArn: import_smithy_client.expectString, + computedDesiredCount: import_smithy_client.expectInt32, + createdAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + externalId: import_smithy_client.expectString, + fargateEphemeralStorage: import_smithy_client._json, + id: import_smithy_client.expectString, + launchType: import_smithy_client.expectString, + loadBalancers: import_smithy_client._json, + networkConfiguration: import_smithy_client._json, + pendingCount: import_smithy_client.expectInt32, + platformFamily: import_smithy_client.expectString, + platformVersion: import_smithy_client.expectString, + runningCount: import_smithy_client.expectInt32, + scale: (_) => de_Scale(_, context), + serviceArn: import_smithy_client.expectString, + serviceRegistries: import_smithy_client._json, + stabilityStatus: import_smithy_client.expectString, + stabilityStatusAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))), + startedBy: import_smithy_client.expectString, + status: import_smithy_client.expectString, + tags: import_smithy_client._json, + taskDefinition: import_smithy_client.expectString, + taskSetArn: import_smithy_client.expectString, + updatedAt: (_) => (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseEpochTimestamp)((0, import_smithy_client.expectNumber)(_))) + }); +}, "de_TaskSet"); +var de_TaskSets = /* @__PURE__ */ __name((output, context) => { + const retVal = (output || []).filter((e) => e != null).map((entry) => { + return de_TaskSet(entry, context); + }); + return retVal; +}, "de_TaskSets"); +var de_UpdateContainerAgentResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerInstance: (_) => de_ContainerInstance(_, context) + }); +}, "de_UpdateContainerAgentResponse"); +var de_UpdateContainerInstancesStateResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + containerInstances: (_) => de_ContainerInstances(_, context), + failures: import_smithy_client._json + }); +}, "de_UpdateContainerInstancesStateResponse"); +var de_UpdateServicePrimaryTaskSetResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + taskSet: (_) => de_TaskSet(_, context) + }); +}, "de_UpdateServicePrimaryTaskSetResponse"); +var de_UpdateServiceResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + service: (_) => de_Service(_, context) + }); +}, "de_UpdateServiceResponse"); +var de_UpdateTaskProtectionResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + failures: import_smithy_client._json, + protectedTasks: (_) => de_ProtectedTasks(_, context) + }); +}, "de_UpdateTaskProtectionResponse"); +var de_UpdateTaskSetResponse = /* @__PURE__ */ __name((output, context) => { + return (0, import_smithy_client.take)(output, { + taskSet: (_) => de_TaskSet(_, context) + }); +}, "de_UpdateTaskSetResponse"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); +var throwDefaultError = (0, import_smithy_client.withBaseException)(ECSServiceException); +var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers + }; + if (resolvedHostname !== void 0) { + contents.hostname = resolvedHostname; + } + if (body !== void 0) { + contents.body = body; + } + return new import_protocol_http.HttpRequest(contents); +}, "buildHttpRpcRequest"); +function sharedHeaders(operation) { + return { + "content-type": "application/x-amz-json-1.1", + "x-amz-target": `AmazonEC2ContainerServiceV20141113.${operation}` + }; +} +__name(sharedHeaders, "sharedHeaders"); + +// src/commands/CreateCapacityProviderCommand.ts +var _CreateCapacityProviderCommand = class _CreateCapacityProviderCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "CreateCapacityProvider", {}).n("ECSClient", "CreateCapacityProviderCommand").f(void 0, void 0).ser(se_CreateCapacityProviderCommand).de(de_CreateCapacityProviderCommand).build() { +}; +__name(_CreateCapacityProviderCommand, "CreateCapacityProviderCommand"); +var CreateCapacityProviderCommand = _CreateCapacityProviderCommand; + +// src/commands/CreateClusterCommand.ts + + + +var _CreateClusterCommand = class _CreateClusterCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "CreateCluster", {}).n("ECSClient", "CreateClusterCommand").f(void 0, void 0).ser(se_CreateClusterCommand).de(de_CreateClusterCommand).build() { +}; +__name(_CreateClusterCommand, "CreateClusterCommand"); +var CreateClusterCommand = _CreateClusterCommand; + +// src/commands/CreateServiceCommand.ts + + + +var _CreateServiceCommand = class _CreateServiceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "CreateService", {}).n("ECSClient", "CreateServiceCommand").f(void 0, void 0).ser(se_CreateServiceCommand).de(de_CreateServiceCommand).build() { +}; +__name(_CreateServiceCommand, "CreateServiceCommand"); +var CreateServiceCommand = _CreateServiceCommand; + +// src/commands/CreateTaskSetCommand.ts + + + +var _CreateTaskSetCommand = class _CreateTaskSetCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "CreateTaskSet", {}).n("ECSClient", "CreateTaskSetCommand").f(void 0, void 0).ser(se_CreateTaskSetCommand).de(de_CreateTaskSetCommand).build() { +}; +__name(_CreateTaskSetCommand, "CreateTaskSetCommand"); +var CreateTaskSetCommand = _CreateTaskSetCommand; + +// src/commands/DeleteAccountSettingCommand.ts + + + +var _DeleteAccountSettingCommand = class _DeleteAccountSettingCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteAccountSetting", {}).n("ECSClient", "DeleteAccountSettingCommand").f(void 0, void 0).ser(se_DeleteAccountSettingCommand).de(de_DeleteAccountSettingCommand).build() { +}; +__name(_DeleteAccountSettingCommand, "DeleteAccountSettingCommand"); +var DeleteAccountSettingCommand = _DeleteAccountSettingCommand; + +// src/commands/DeleteAttributesCommand.ts + + + +var _DeleteAttributesCommand = class _DeleteAttributesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteAttributes", {}).n("ECSClient", "DeleteAttributesCommand").f(void 0, void 0).ser(se_DeleteAttributesCommand).de(de_DeleteAttributesCommand).build() { +}; +__name(_DeleteAttributesCommand, "DeleteAttributesCommand"); +var DeleteAttributesCommand = _DeleteAttributesCommand; + +// src/commands/DeleteCapacityProviderCommand.ts + + + +var _DeleteCapacityProviderCommand = class _DeleteCapacityProviderCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteCapacityProvider", {}).n("ECSClient", "DeleteCapacityProviderCommand").f(void 0, void 0).ser(se_DeleteCapacityProviderCommand).de(de_DeleteCapacityProviderCommand).build() { +}; +__name(_DeleteCapacityProviderCommand, "DeleteCapacityProviderCommand"); +var DeleteCapacityProviderCommand = _DeleteCapacityProviderCommand; + +// src/commands/DeleteClusterCommand.ts + + + +var _DeleteClusterCommand = class _DeleteClusterCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteCluster", {}).n("ECSClient", "DeleteClusterCommand").f(void 0, void 0).ser(se_DeleteClusterCommand).de(de_DeleteClusterCommand).build() { +}; +__name(_DeleteClusterCommand, "DeleteClusterCommand"); +var DeleteClusterCommand = _DeleteClusterCommand; + +// src/commands/DeleteServiceCommand.ts + + + +var _DeleteServiceCommand = class _DeleteServiceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteService", {}).n("ECSClient", "DeleteServiceCommand").f(void 0, void 0).ser(se_DeleteServiceCommand).de(de_DeleteServiceCommand).build() { +}; +__name(_DeleteServiceCommand, "DeleteServiceCommand"); +var DeleteServiceCommand = _DeleteServiceCommand; + +// src/commands/DeleteTaskDefinitionsCommand.ts + + + +var _DeleteTaskDefinitionsCommand = class _DeleteTaskDefinitionsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteTaskDefinitions", {}).n("ECSClient", "DeleteTaskDefinitionsCommand").f(void 0, void 0).ser(se_DeleteTaskDefinitionsCommand).de(de_DeleteTaskDefinitionsCommand).build() { +}; +__name(_DeleteTaskDefinitionsCommand, "DeleteTaskDefinitionsCommand"); +var DeleteTaskDefinitionsCommand = _DeleteTaskDefinitionsCommand; + +// src/commands/DeleteTaskSetCommand.ts + + + +var _DeleteTaskSetCommand = class _DeleteTaskSetCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeleteTaskSet", {}).n("ECSClient", "DeleteTaskSetCommand").f(void 0, void 0).ser(se_DeleteTaskSetCommand).de(de_DeleteTaskSetCommand).build() { +}; +__name(_DeleteTaskSetCommand, "DeleteTaskSetCommand"); +var DeleteTaskSetCommand = _DeleteTaskSetCommand; + +// src/commands/DeregisterContainerInstanceCommand.ts + + + +var _DeregisterContainerInstanceCommand = class _DeregisterContainerInstanceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeregisterContainerInstance", {}).n("ECSClient", "DeregisterContainerInstanceCommand").f(void 0, void 0).ser(se_DeregisterContainerInstanceCommand).de(de_DeregisterContainerInstanceCommand).build() { +}; +__name(_DeregisterContainerInstanceCommand, "DeregisterContainerInstanceCommand"); +var DeregisterContainerInstanceCommand = _DeregisterContainerInstanceCommand; + +// src/commands/DeregisterTaskDefinitionCommand.ts + + + +var _DeregisterTaskDefinitionCommand = class _DeregisterTaskDefinitionCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DeregisterTaskDefinition", {}).n("ECSClient", "DeregisterTaskDefinitionCommand").f(void 0, void 0).ser(se_DeregisterTaskDefinitionCommand).de(de_DeregisterTaskDefinitionCommand).build() { +}; +__name(_DeregisterTaskDefinitionCommand, "DeregisterTaskDefinitionCommand"); +var DeregisterTaskDefinitionCommand = _DeregisterTaskDefinitionCommand; + +// src/commands/DescribeCapacityProvidersCommand.ts + + + +var _DescribeCapacityProvidersCommand = class _DescribeCapacityProvidersCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeCapacityProviders", {}).n("ECSClient", "DescribeCapacityProvidersCommand").f(void 0, void 0).ser(se_DescribeCapacityProvidersCommand).de(de_DescribeCapacityProvidersCommand).build() { +}; +__name(_DescribeCapacityProvidersCommand, "DescribeCapacityProvidersCommand"); +var DescribeCapacityProvidersCommand = _DescribeCapacityProvidersCommand; + +// src/commands/DescribeClustersCommand.ts + + + +var _DescribeClustersCommand = class _DescribeClustersCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeClusters", {}).n("ECSClient", "DescribeClustersCommand").f(void 0, void 0).ser(se_DescribeClustersCommand).de(de_DescribeClustersCommand).build() { +}; +__name(_DescribeClustersCommand, "DescribeClustersCommand"); +var DescribeClustersCommand = _DescribeClustersCommand; + +// src/commands/DescribeContainerInstancesCommand.ts + + + +var _DescribeContainerInstancesCommand = class _DescribeContainerInstancesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeContainerInstances", {}).n("ECSClient", "DescribeContainerInstancesCommand").f(void 0, void 0).ser(se_DescribeContainerInstancesCommand).de(de_DescribeContainerInstancesCommand).build() { +}; +__name(_DescribeContainerInstancesCommand, "DescribeContainerInstancesCommand"); +var DescribeContainerInstancesCommand = _DescribeContainerInstancesCommand; + +// src/commands/DescribeServicesCommand.ts + + + +var _DescribeServicesCommand = class _DescribeServicesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeServices", {}).n("ECSClient", "DescribeServicesCommand").f(void 0, void 0).ser(se_DescribeServicesCommand).de(de_DescribeServicesCommand).build() { +}; +__name(_DescribeServicesCommand, "DescribeServicesCommand"); +var DescribeServicesCommand = _DescribeServicesCommand; + +// src/commands/DescribeTaskDefinitionCommand.ts + + + +var _DescribeTaskDefinitionCommand = class _DescribeTaskDefinitionCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeTaskDefinition", {}).n("ECSClient", "DescribeTaskDefinitionCommand").f(void 0, void 0).ser(se_DescribeTaskDefinitionCommand).de(de_DescribeTaskDefinitionCommand).build() { +}; +__name(_DescribeTaskDefinitionCommand, "DescribeTaskDefinitionCommand"); +var DescribeTaskDefinitionCommand = _DescribeTaskDefinitionCommand; + +// src/commands/DescribeTasksCommand.ts + + + +var _DescribeTasksCommand = class _DescribeTasksCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeTasks", {}).n("ECSClient", "DescribeTasksCommand").f(void 0, void 0).ser(se_DescribeTasksCommand).de(de_DescribeTasksCommand).build() { +}; +__name(_DescribeTasksCommand, "DescribeTasksCommand"); +var DescribeTasksCommand = _DescribeTasksCommand; + +// src/commands/DescribeTaskSetsCommand.ts + + + +var _DescribeTaskSetsCommand = class _DescribeTaskSetsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DescribeTaskSets", {}).n("ECSClient", "DescribeTaskSetsCommand").f(void 0, void 0).ser(se_DescribeTaskSetsCommand).de(de_DescribeTaskSetsCommand).build() { +}; +__name(_DescribeTaskSetsCommand, "DescribeTaskSetsCommand"); +var DescribeTaskSetsCommand = _DescribeTaskSetsCommand; + +// src/commands/DiscoverPollEndpointCommand.ts + + + +var _DiscoverPollEndpointCommand = class _DiscoverPollEndpointCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "DiscoverPollEndpoint", {}).n("ECSClient", "DiscoverPollEndpointCommand").f(void 0, void 0).ser(se_DiscoverPollEndpointCommand).de(de_DiscoverPollEndpointCommand).build() { +}; +__name(_DiscoverPollEndpointCommand, "DiscoverPollEndpointCommand"); +var DiscoverPollEndpointCommand = _DiscoverPollEndpointCommand; + +// src/commands/ExecuteCommandCommand.ts + + + +var _ExecuteCommandCommand = class _ExecuteCommandCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ExecuteCommand", {}).n("ECSClient", "ExecuteCommandCommand").f(void 0, ExecuteCommandResponseFilterSensitiveLog).ser(se_ExecuteCommandCommand).de(de_ExecuteCommandCommand).build() { +}; +__name(_ExecuteCommandCommand, "ExecuteCommandCommand"); +var ExecuteCommandCommand = _ExecuteCommandCommand; + +// src/commands/GetTaskProtectionCommand.ts + + + +var _GetTaskProtectionCommand = class _GetTaskProtectionCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "GetTaskProtection", {}).n("ECSClient", "GetTaskProtectionCommand").f(void 0, void 0).ser(se_GetTaskProtectionCommand).de(de_GetTaskProtectionCommand).build() { +}; +__name(_GetTaskProtectionCommand, "GetTaskProtectionCommand"); +var GetTaskProtectionCommand = _GetTaskProtectionCommand; + +// src/commands/ListAccountSettingsCommand.ts + + + +var _ListAccountSettingsCommand = class _ListAccountSettingsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListAccountSettings", {}).n("ECSClient", "ListAccountSettingsCommand").f(void 0, void 0).ser(se_ListAccountSettingsCommand).de(de_ListAccountSettingsCommand).build() { +}; +__name(_ListAccountSettingsCommand, "ListAccountSettingsCommand"); +var ListAccountSettingsCommand = _ListAccountSettingsCommand; + +// src/commands/ListAttributesCommand.ts + + + +var _ListAttributesCommand = class _ListAttributesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListAttributes", {}).n("ECSClient", "ListAttributesCommand").f(void 0, void 0).ser(se_ListAttributesCommand).de(de_ListAttributesCommand).build() { +}; +__name(_ListAttributesCommand, "ListAttributesCommand"); +var ListAttributesCommand = _ListAttributesCommand; + +// src/commands/ListClustersCommand.ts + + + +var _ListClustersCommand = class _ListClustersCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListClusters", {}).n("ECSClient", "ListClustersCommand").f(void 0, void 0).ser(se_ListClustersCommand).de(de_ListClustersCommand).build() { +}; +__name(_ListClustersCommand, "ListClustersCommand"); +var ListClustersCommand = _ListClustersCommand; + +// src/commands/ListContainerInstancesCommand.ts + + + +var _ListContainerInstancesCommand = class _ListContainerInstancesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListContainerInstances", {}).n("ECSClient", "ListContainerInstancesCommand").f(void 0, void 0).ser(se_ListContainerInstancesCommand).de(de_ListContainerInstancesCommand).build() { +}; +__name(_ListContainerInstancesCommand, "ListContainerInstancesCommand"); +var ListContainerInstancesCommand = _ListContainerInstancesCommand; + +// src/commands/ListServicesByNamespaceCommand.ts + + + +var _ListServicesByNamespaceCommand = class _ListServicesByNamespaceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListServicesByNamespace", {}).n("ECSClient", "ListServicesByNamespaceCommand").f(void 0, void 0).ser(se_ListServicesByNamespaceCommand).de(de_ListServicesByNamespaceCommand).build() { +}; +__name(_ListServicesByNamespaceCommand, "ListServicesByNamespaceCommand"); +var ListServicesByNamespaceCommand = _ListServicesByNamespaceCommand; + +// src/commands/ListServicesCommand.ts + + + +var _ListServicesCommand = class _ListServicesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListServices", {}).n("ECSClient", "ListServicesCommand").f(void 0, void 0).ser(se_ListServicesCommand).de(de_ListServicesCommand).build() { +}; +__name(_ListServicesCommand, "ListServicesCommand"); +var ListServicesCommand = _ListServicesCommand; + +// src/commands/ListTagsForResourceCommand.ts + + + +var _ListTagsForResourceCommand = class _ListTagsForResourceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListTagsForResource", {}).n("ECSClient", "ListTagsForResourceCommand").f(void 0, void 0).ser(se_ListTagsForResourceCommand).de(de_ListTagsForResourceCommand).build() { +}; +__name(_ListTagsForResourceCommand, "ListTagsForResourceCommand"); +var ListTagsForResourceCommand = _ListTagsForResourceCommand; + +// src/commands/ListTaskDefinitionFamiliesCommand.ts + + + +var _ListTaskDefinitionFamiliesCommand = class _ListTaskDefinitionFamiliesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitionFamilies", {}).n("ECSClient", "ListTaskDefinitionFamiliesCommand").f(void 0, void 0).ser(se_ListTaskDefinitionFamiliesCommand).de(de_ListTaskDefinitionFamiliesCommand).build() { +}; +__name(_ListTaskDefinitionFamiliesCommand, "ListTaskDefinitionFamiliesCommand"); +var ListTaskDefinitionFamiliesCommand = _ListTaskDefinitionFamiliesCommand; + +// src/commands/ListTaskDefinitionsCommand.ts + + + +var _ListTaskDefinitionsCommand = class _ListTaskDefinitionsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListTaskDefinitions", {}).n("ECSClient", "ListTaskDefinitionsCommand").f(void 0, void 0).ser(se_ListTaskDefinitionsCommand).de(de_ListTaskDefinitionsCommand).build() { +}; +__name(_ListTaskDefinitionsCommand, "ListTaskDefinitionsCommand"); +var ListTaskDefinitionsCommand = _ListTaskDefinitionsCommand; + +// src/commands/ListTasksCommand.ts + + + +var _ListTasksCommand = class _ListTasksCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "ListTasks", {}).n("ECSClient", "ListTasksCommand").f(void 0, void 0).ser(se_ListTasksCommand).de(de_ListTasksCommand).build() { +}; +__name(_ListTasksCommand, "ListTasksCommand"); +var ListTasksCommand = _ListTasksCommand; + +// src/commands/PutAccountSettingCommand.ts + + + +var _PutAccountSettingCommand = class _PutAccountSettingCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "PutAccountSetting", {}).n("ECSClient", "PutAccountSettingCommand").f(void 0, void 0).ser(se_PutAccountSettingCommand).de(de_PutAccountSettingCommand).build() { +}; +__name(_PutAccountSettingCommand, "PutAccountSettingCommand"); +var PutAccountSettingCommand = _PutAccountSettingCommand; + +// src/commands/PutAccountSettingDefaultCommand.ts + + + +var _PutAccountSettingDefaultCommand = class _PutAccountSettingDefaultCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "PutAccountSettingDefault", {}).n("ECSClient", "PutAccountSettingDefaultCommand").f(void 0, void 0).ser(se_PutAccountSettingDefaultCommand).de(de_PutAccountSettingDefaultCommand).build() { +}; +__name(_PutAccountSettingDefaultCommand, "PutAccountSettingDefaultCommand"); +var PutAccountSettingDefaultCommand = _PutAccountSettingDefaultCommand; + +// src/commands/PutAttributesCommand.ts + + + +var _PutAttributesCommand = class _PutAttributesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "PutAttributes", {}).n("ECSClient", "PutAttributesCommand").f(void 0, void 0).ser(se_PutAttributesCommand).de(de_PutAttributesCommand).build() { +}; +__name(_PutAttributesCommand, "PutAttributesCommand"); +var PutAttributesCommand = _PutAttributesCommand; + +// src/commands/PutClusterCapacityProvidersCommand.ts + + + +var _PutClusterCapacityProvidersCommand = class _PutClusterCapacityProvidersCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "PutClusterCapacityProviders", {}).n("ECSClient", "PutClusterCapacityProvidersCommand").f(void 0, void 0).ser(se_PutClusterCapacityProvidersCommand).de(de_PutClusterCapacityProvidersCommand).build() { +}; +__name(_PutClusterCapacityProvidersCommand, "PutClusterCapacityProvidersCommand"); +var PutClusterCapacityProvidersCommand = _PutClusterCapacityProvidersCommand; + +// src/commands/RegisterContainerInstanceCommand.ts + + + +var _RegisterContainerInstanceCommand = class _RegisterContainerInstanceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "RegisterContainerInstance", {}).n("ECSClient", "RegisterContainerInstanceCommand").f(void 0, void 0).ser(se_RegisterContainerInstanceCommand).de(de_RegisterContainerInstanceCommand).build() { +}; +__name(_RegisterContainerInstanceCommand, "RegisterContainerInstanceCommand"); +var RegisterContainerInstanceCommand = _RegisterContainerInstanceCommand; + +// src/commands/RegisterTaskDefinitionCommand.ts + + + +var _RegisterTaskDefinitionCommand = class _RegisterTaskDefinitionCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "RegisterTaskDefinition", {}).n("ECSClient", "RegisterTaskDefinitionCommand").f(void 0, void 0).ser(se_RegisterTaskDefinitionCommand).de(de_RegisterTaskDefinitionCommand).build() { +}; +__name(_RegisterTaskDefinitionCommand, "RegisterTaskDefinitionCommand"); +var RegisterTaskDefinitionCommand = _RegisterTaskDefinitionCommand; + +// src/commands/RunTaskCommand.ts + + + +var _RunTaskCommand = class _RunTaskCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "RunTask", {}).n("ECSClient", "RunTaskCommand").f(void 0, void 0).ser(se_RunTaskCommand).de(de_RunTaskCommand).build() { +}; +__name(_RunTaskCommand, "RunTaskCommand"); +var RunTaskCommand = _RunTaskCommand; + +// src/commands/StartTaskCommand.ts + + + +var _StartTaskCommand = class _StartTaskCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "StartTask", {}).n("ECSClient", "StartTaskCommand").f(void 0, void 0).ser(se_StartTaskCommand).de(de_StartTaskCommand).build() { +}; +__name(_StartTaskCommand, "StartTaskCommand"); +var StartTaskCommand = _StartTaskCommand; + +// src/commands/StopTaskCommand.ts + + + +var _StopTaskCommand = class _StopTaskCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "StopTask", {}).n("ECSClient", "StopTaskCommand").f(void 0, void 0).ser(se_StopTaskCommand).de(de_StopTaskCommand).build() { +}; +__name(_StopTaskCommand, "StopTaskCommand"); +var StopTaskCommand = _StopTaskCommand; + +// src/commands/SubmitAttachmentStateChangesCommand.ts + + + +var _SubmitAttachmentStateChangesCommand = class _SubmitAttachmentStateChangesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "SubmitAttachmentStateChanges", {}).n("ECSClient", "SubmitAttachmentStateChangesCommand").f(void 0, void 0).ser(se_SubmitAttachmentStateChangesCommand).de(de_SubmitAttachmentStateChangesCommand).build() { +}; +__name(_SubmitAttachmentStateChangesCommand, "SubmitAttachmentStateChangesCommand"); +var SubmitAttachmentStateChangesCommand = _SubmitAttachmentStateChangesCommand; + +// src/commands/SubmitContainerStateChangeCommand.ts + + + +var _SubmitContainerStateChangeCommand = class _SubmitContainerStateChangeCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "SubmitContainerStateChange", {}).n("ECSClient", "SubmitContainerStateChangeCommand").f(void 0, void 0).ser(se_SubmitContainerStateChangeCommand).de(de_SubmitContainerStateChangeCommand).build() { +}; +__name(_SubmitContainerStateChangeCommand, "SubmitContainerStateChangeCommand"); +var SubmitContainerStateChangeCommand = _SubmitContainerStateChangeCommand; + +// src/commands/SubmitTaskStateChangeCommand.ts + + + +var _SubmitTaskStateChangeCommand = class _SubmitTaskStateChangeCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "SubmitTaskStateChange", {}).n("ECSClient", "SubmitTaskStateChangeCommand").f(void 0, void 0).ser(se_SubmitTaskStateChangeCommand).de(de_SubmitTaskStateChangeCommand).build() { +}; +__name(_SubmitTaskStateChangeCommand, "SubmitTaskStateChangeCommand"); +var SubmitTaskStateChangeCommand = _SubmitTaskStateChangeCommand; + +// src/commands/TagResourceCommand.ts + + + +var _TagResourceCommand = class _TagResourceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "TagResource", {}).n("ECSClient", "TagResourceCommand").f(void 0, void 0).ser(se_TagResourceCommand).de(de_TagResourceCommand).build() { +}; +__name(_TagResourceCommand, "TagResourceCommand"); +var TagResourceCommand = _TagResourceCommand; + +// src/commands/UntagResourceCommand.ts + + + +var _UntagResourceCommand = class _UntagResourceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UntagResource", {}).n("ECSClient", "UntagResourceCommand").f(void 0, void 0).ser(se_UntagResourceCommand).de(de_UntagResourceCommand).build() { +}; +__name(_UntagResourceCommand, "UntagResourceCommand"); +var UntagResourceCommand = _UntagResourceCommand; + +// src/commands/UpdateCapacityProviderCommand.ts + + + +var _UpdateCapacityProviderCommand = class _UpdateCapacityProviderCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateCapacityProvider", {}).n("ECSClient", "UpdateCapacityProviderCommand").f(void 0, void 0).ser(se_UpdateCapacityProviderCommand).de(de_UpdateCapacityProviderCommand).build() { +}; +__name(_UpdateCapacityProviderCommand, "UpdateCapacityProviderCommand"); +var UpdateCapacityProviderCommand = _UpdateCapacityProviderCommand; + +// src/commands/UpdateClusterCommand.ts + + + +var _UpdateClusterCommand = class _UpdateClusterCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateCluster", {}).n("ECSClient", "UpdateClusterCommand").f(void 0, void 0).ser(se_UpdateClusterCommand).de(de_UpdateClusterCommand).build() { +}; +__name(_UpdateClusterCommand, "UpdateClusterCommand"); +var UpdateClusterCommand = _UpdateClusterCommand; + +// src/commands/UpdateClusterSettingsCommand.ts + + + +var _UpdateClusterSettingsCommand = class _UpdateClusterSettingsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateClusterSettings", {}).n("ECSClient", "UpdateClusterSettingsCommand").f(void 0, void 0).ser(se_UpdateClusterSettingsCommand).de(de_UpdateClusterSettingsCommand).build() { +}; +__name(_UpdateClusterSettingsCommand, "UpdateClusterSettingsCommand"); +var UpdateClusterSettingsCommand = _UpdateClusterSettingsCommand; + +// src/commands/UpdateContainerAgentCommand.ts + + + +var _UpdateContainerAgentCommand = class _UpdateContainerAgentCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateContainerAgent", {}).n("ECSClient", "UpdateContainerAgentCommand").f(void 0, void 0).ser(se_UpdateContainerAgentCommand).de(de_UpdateContainerAgentCommand).build() { +}; +__name(_UpdateContainerAgentCommand, "UpdateContainerAgentCommand"); +var UpdateContainerAgentCommand = _UpdateContainerAgentCommand; + +// src/commands/UpdateContainerInstancesStateCommand.ts + + + +var _UpdateContainerInstancesStateCommand = class _UpdateContainerInstancesStateCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateContainerInstancesState", {}).n("ECSClient", "UpdateContainerInstancesStateCommand").f(void 0, void 0).ser(se_UpdateContainerInstancesStateCommand).de(de_UpdateContainerInstancesStateCommand).build() { +}; +__name(_UpdateContainerInstancesStateCommand, "UpdateContainerInstancesStateCommand"); +var UpdateContainerInstancesStateCommand = _UpdateContainerInstancesStateCommand; + +// src/commands/UpdateServiceCommand.ts + + + +var _UpdateServiceCommand = class _UpdateServiceCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateService", {}).n("ECSClient", "UpdateServiceCommand").f(void 0, void 0).ser(se_UpdateServiceCommand).de(de_UpdateServiceCommand).build() { +}; +__name(_UpdateServiceCommand, "UpdateServiceCommand"); +var UpdateServiceCommand = _UpdateServiceCommand; + +// src/commands/UpdateServicePrimaryTaskSetCommand.ts + + + +var _UpdateServicePrimaryTaskSetCommand = class _UpdateServicePrimaryTaskSetCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateServicePrimaryTaskSet", {}).n("ECSClient", "UpdateServicePrimaryTaskSetCommand").f(void 0, void 0).ser(se_UpdateServicePrimaryTaskSetCommand).de(de_UpdateServicePrimaryTaskSetCommand).build() { +}; +__name(_UpdateServicePrimaryTaskSetCommand, "UpdateServicePrimaryTaskSetCommand"); +var UpdateServicePrimaryTaskSetCommand = _UpdateServicePrimaryTaskSetCommand; + +// src/commands/UpdateTaskProtectionCommand.ts + + + +var _UpdateTaskProtectionCommand = class _UpdateTaskProtectionCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateTaskProtection", {}).n("ECSClient", "UpdateTaskProtectionCommand").f(void 0, void 0).ser(se_UpdateTaskProtectionCommand).de(de_UpdateTaskProtectionCommand).build() { +}; +__name(_UpdateTaskProtectionCommand, "UpdateTaskProtectionCommand"); +var UpdateTaskProtectionCommand = _UpdateTaskProtectionCommand; + +// src/commands/UpdateTaskSetCommand.ts + + + +var _UpdateTaskSetCommand = class _UpdateTaskSetCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AmazonEC2ContainerServiceV20141113", "UpdateTaskSet", {}).n("ECSClient", "UpdateTaskSetCommand").f(void 0, void 0).ser(se_UpdateTaskSetCommand).de(de_UpdateTaskSetCommand).build() { +}; +__name(_UpdateTaskSetCommand, "UpdateTaskSetCommand"); +var UpdateTaskSetCommand = _UpdateTaskSetCommand; + +// src/ECS.ts +var commands = { + CreateCapacityProviderCommand, + CreateClusterCommand, + CreateServiceCommand, + CreateTaskSetCommand, + DeleteAccountSettingCommand, + DeleteAttributesCommand, + DeleteCapacityProviderCommand, + DeleteClusterCommand, + DeleteServiceCommand, + DeleteTaskDefinitionsCommand, + DeleteTaskSetCommand, + DeregisterContainerInstanceCommand, + DeregisterTaskDefinitionCommand, + DescribeCapacityProvidersCommand, + DescribeClustersCommand, + DescribeContainerInstancesCommand, + DescribeServicesCommand, + DescribeTaskDefinitionCommand, + DescribeTasksCommand, + DescribeTaskSetsCommand, + DiscoverPollEndpointCommand, + ExecuteCommandCommand, + GetTaskProtectionCommand, + ListAccountSettingsCommand, + ListAttributesCommand, + ListClustersCommand, + ListContainerInstancesCommand, + ListServicesCommand, + ListServicesByNamespaceCommand, + ListTagsForResourceCommand, + ListTaskDefinitionFamiliesCommand, + ListTaskDefinitionsCommand, + ListTasksCommand, + PutAccountSettingCommand, + PutAccountSettingDefaultCommand, + PutAttributesCommand, + PutClusterCapacityProvidersCommand, + RegisterContainerInstanceCommand, + RegisterTaskDefinitionCommand, + RunTaskCommand, + StartTaskCommand, + StopTaskCommand, + SubmitAttachmentStateChangesCommand, + SubmitContainerStateChangeCommand, + SubmitTaskStateChangeCommand, + TagResourceCommand, + UntagResourceCommand, + UpdateCapacityProviderCommand, + UpdateClusterCommand, + UpdateClusterSettingsCommand, + UpdateContainerAgentCommand, + UpdateContainerInstancesStateCommand, + UpdateServiceCommand, + UpdateServicePrimaryTaskSetCommand, + UpdateTaskProtectionCommand, + UpdateTaskSetCommand +}; +var _ECS = class _ECS extends ECSClient { +}; +__name(_ECS, "ECS"); +var ECS = _ECS; +(0, import_smithy_client.createAggregatedClient)(commands, ECS); + +// src/pagination/ListAccountSettingsPaginator.ts + +var paginateListAccountSettings = (0, import_core.createPaginator)(ECSClient, ListAccountSettingsCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListAttributesPaginator.ts + +var paginateListAttributes = (0, import_core.createPaginator)(ECSClient, ListAttributesCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListClustersPaginator.ts + +var paginateListClusters = (0, import_core.createPaginator)(ECSClient, ListClustersCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListContainerInstancesPaginator.ts + +var paginateListContainerInstances = (0, import_core.createPaginator)(ECSClient, ListContainerInstancesCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListServicesByNamespacePaginator.ts + +var paginateListServicesByNamespace = (0, import_core.createPaginator)(ECSClient, ListServicesByNamespaceCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListServicesPaginator.ts + +var paginateListServices = (0, import_core.createPaginator)(ECSClient, ListServicesCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListTaskDefinitionFamiliesPaginator.ts + +var paginateListTaskDefinitionFamilies = (0, import_core.createPaginator)(ECSClient, ListTaskDefinitionFamiliesCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListTaskDefinitionsPaginator.ts + +var paginateListTaskDefinitions = (0, import_core.createPaginator)(ECSClient, ListTaskDefinitionsCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListTasksPaginator.ts + +var paginateListTasks = (0, import_core.createPaginator)(ECSClient, ListTasksCommand, "nextToken", "nextToken", "maxResults"); + +// src/waiters/waitForServicesInactive.ts +var import_util_waiter = __nccwpck_require__(78011); +var checkState = /* @__PURE__ */ __name(async (client, input) => { + let reason; + try { + const result = await client.send(new DescribeServicesCommand(input)); + reason = result; + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "INACTIVE") { + return { state: import_util_waiter.WaiterState.SUCCESS, reason }; + } + } + } catch (e) { + } + } catch (exception) { + reason = exception; + } + return { state: import_util_waiter.WaiterState.RETRY, reason }; +}, "checkState"); +var waitForServicesInactive = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); +}, "waitForServicesInactive"); +var waitUntilServicesInactive = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState); + return (0, import_util_waiter.checkExceptions)(result); +}, "waitUntilServicesInactive"); + +// src/waiters/waitForServicesStable.ts + +var checkState2 = /* @__PURE__ */ __name(async (client, input) => { + let reason; + try { + const result = await client.send(new DescribeServicesCommand(input)); + reason = result; + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "DRAINING") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.services); + const projection_3 = flat_1.map((element_2) => { + return element_2.status; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "INACTIVE") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const filterRes_2 = result.services.filter((element_1) => { + return !(element_1.deployments.length == 1 && element_1.runningCount == element_1.desiredCount); + }); + return filterRes_2.length == 0; + }, "returnComparator"); + if (returnComparator() == true) { + return { state: import_util_waiter.WaiterState.SUCCESS, reason }; + } + } catch (e) { + } + } catch (exception) { + reason = exception; + } + return { state: import_util_waiter.WaiterState.RETRY, reason }; +}, "checkState"); +var waitForServicesStable = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState2); +}, "waitForServicesStable"); +var waitUntilServicesStable = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 15, maxDelay: 120 }; + const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState2); + return (0, import_util_waiter.checkExceptions)(result); +}, "waitUntilServicesStable"); + +// src/waiters/waitForTasksRunning.ts + +var checkState3 = /* @__PURE__ */ __name(async (client, input) => { + let reason; + try { + const result = await client.send(new DescribeTasksCommand(input)); + reason = result; + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "STOPPED") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.failures); + const projection_3 = flat_1.map((element_2) => { + return element_2.reason; + }); + return projection_3; + }, "returnComparator"); + for (const anyStringEq_4 of returnComparator()) { + if (anyStringEq_4 == "MISSING") { + return { state: import_util_waiter.WaiterState.FAILURE, reason }; + } + } + } catch (e) { + } + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }, "returnComparator"); + let allStringEq_5 = returnComparator().length > 0; + for (const element_4 of returnComparator()) { + allStringEq_5 = allStringEq_5 && element_4 == "RUNNING"; + } + if (allStringEq_5) { + return { state: import_util_waiter.WaiterState.SUCCESS, reason }; + } + } catch (e) { + } + } catch (exception) { + reason = exception; + } + return { state: import_util_waiter.WaiterState.RETRY, reason }; +}, "checkState"); +var waitForTasksRunning = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState3); +}, "waitForTasksRunning"); +var waitUntilTasksRunning = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState3); + return (0, import_util_waiter.checkExceptions)(result); +}, "waitUntilTasksRunning"); + +// src/waiters/waitForTasksStopped.ts + +var checkState4 = /* @__PURE__ */ __name(async (client, input) => { + let reason; + try { + const result = await client.send(new DescribeTasksCommand(input)); + reason = result; + try { + const returnComparator = /* @__PURE__ */ __name(() => { + const flat_1 = [].concat(...result.tasks); + const projection_3 = flat_1.map((element_2) => { + return element_2.lastStatus; + }); + return projection_3; + }, "returnComparator"); + let allStringEq_5 = returnComparator().length > 0; + for (const element_4 of returnComparator()) { + allStringEq_5 = allStringEq_5 && element_4 == "STOPPED"; + } + if (allStringEq_5) { + return { state: import_util_waiter.WaiterState.SUCCESS, reason }; + } + } catch (e) { + } + } catch (exception) { + reason = exception; + } + return { state: import_util_waiter.WaiterState.RETRY, reason }; +}, "checkState"); +var waitForTasksStopped = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + return (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState4); +}, "waitForTasksStopped"); +var waitUntilTasksStopped = /* @__PURE__ */ __name(async (params, input) => { + const serviceDefaults = { minDelay: 6, maxDelay: 120 }; + const result = await (0, import_util_waiter.createWaiter)({ ...serviceDefaults, ...params }, input, checkState4); + return (0, import_util_waiter.checkExceptions)(result); +}, "waitUntilTasksStopped"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 47246: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(95223)); +const core_1 = __nccwpck_require__(59963); +const credential_provider_node_1 = __nccwpck_require__(75531); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(20258); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(94516); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 94516: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __nccwpck_require__(59963); +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const httpAuthSchemeProvider_1 = __nccwpck_require__(37983); +const endpointResolver_1 = __nccwpck_require__(55021); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2014-11-13", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultECSHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "ECS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 82522: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "NIL", ({ + enumerable: true, + get: function () { + return _nil.default; + } +})); +Object.defineProperty(exports, "parse", ({ + enumerable: true, + get: function () { + return _parse.default; + } +})); +Object.defineProperty(exports, "stringify", ({ + enumerable: true, + get: function () { + return _stringify.default; + } +})); +Object.defineProperty(exports, "v1", ({ + enumerable: true, + get: function () { + return _v.default; + } +})); +Object.defineProperty(exports, "v3", ({ + enumerable: true, + get: function () { + return _v2.default; + } +})); +Object.defineProperty(exports, "v4", ({ + enumerable: true, + get: function () { + return _v3.default; + } +})); +Object.defineProperty(exports, "v5", ({ + enumerable: true, + get: function () { + return _v4.default; + } +})); +Object.defineProperty(exports, "validate", ({ + enumerable: true, + get: function () { + return _validate.default; + } +})); +Object.defineProperty(exports, "version", ({ + enumerable: true, + get: function () { + return _version.default; + } +})); + +var _v = _interopRequireDefault(__nccwpck_require__(62597)); + +var _v2 = _interopRequireDefault(__nccwpck_require__(54331)); + +var _v3 = _interopRequireDefault(__nccwpck_require__(69334)); + +var _v4 = _interopRequireDefault(__nccwpck_require__(95586)); + +var _nil = _interopRequireDefault(__nccwpck_require__(61417)); + +var _version = _interopRequireDefault(__nccwpck_require__(11997)); + +var _validate = _interopRequireDefault(__nccwpck_require__(44718)); + +var _stringify = _interopRequireDefault(__nccwpck_require__(54045)); + +var _parse = _interopRequireDefault(__nccwpck_require__(12800)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/***/ }), + +/***/ 9874: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function md5(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('md5').update(bytes).digest(); +} + +var _default = md5; +exports["default"] = _default; + +/***/ }), + +/***/ 9731: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +var _default = { + randomUUID: _crypto.default.randomUUID +}; +exports["default"] = _default; + +/***/ }), + +/***/ 61417: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = '00000000-0000-0000-0000-000000000000'; +exports["default"] = _default; + +/***/ }), + +/***/ 12800: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(44718)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function parse(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + let v; + const arr = new Uint8Array(16); // Parse ########-....-....-....-............ + + arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; + arr[1] = v >>> 16 & 0xff; + arr[2] = v >>> 8 & 0xff; + arr[3] = v & 0xff; // Parse ........-####-....-....-............ + + arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; + arr[5] = v & 0xff; // Parse ........-....-####-....-............ + + arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; + arr[7] = v & 0xff; // Parse ........-....-....-####-............ + + arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; + arr[9] = v & 0xff; // Parse ........-....-....-....-############ + // (Use "/" to avoid 32-bit truncation when bit-shifting high-order bytes) + + arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 0x10000000000 & 0xff; + arr[11] = v / 0x100000000 & 0xff; + arr[12] = v >>> 24 & 0xff; + arr[13] = v >>> 16 & 0xff; + arr[14] = v >>> 8 & 0xff; + arr[15] = v & 0xff; + return arr; +} + +var _default = parse; +exports["default"] = _default; + +/***/ }), + +/***/ 55172: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; +exports["default"] = _default; + +/***/ }), + +/***/ 9180: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = rng; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const rnds8Pool = new Uint8Array(256); // # of random values to pre-allocate + +let poolPtr = rnds8Pool.length; + +function rng() { + if (poolPtr > rnds8Pool.length - 16) { + _crypto.default.randomFillSync(rnds8Pool); + + poolPtr = 0; + } + + return rnds8Pool.slice(poolPtr, poolPtr += 16); +} + +/***/ }), + +/***/ 89444: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function sha1(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('sha1').update(bytes).digest(); +} + +var _default = sha1; +exports["default"] = _default; + +/***/ }), + +/***/ 54045: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +exports.unsafeStringify = unsafeStringify; + +var _validate = _interopRequireDefault(__nccwpck_require__(44718)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +const byteToHex = []; + +for (let i = 0; i < 256; ++i) { + byteToHex.push((i + 0x100).toString(16).slice(1)); +} + +function unsafeStringify(arr, offset = 0) { + // Note: Be careful editing this code! It's been tuned for performance + // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434 + return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]; +} + +function stringify(arr, offset = 0) { + const uuid = unsafeStringify(arr, offset); // Consistency check for valid UUID. If this throws, it's likely due to one + // of the following: + // - One or more input array values don't map to a hex octet (leading to + // "undefined" in the uuid) + // - Invalid input values for the RFC `version` or `variant` fields + + if (!(0, _validate.default)(uuid)) { + throw TypeError('Stringified UUID is invalid'); + } + + return uuid; +} + +var _default = stringify; +exports["default"] = _default; + +/***/ }), + +/***/ 62597: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _rng = _interopRequireDefault(__nccwpck_require__(9180)); + +var _stringify = __nccwpck_require__(54045); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +// **`v1()` - Generate time-based UUID** +// +// Inspired by https://github.com/LiosK/UUID.js +// and http://docs.python.org/library/uuid.html +let _nodeId; + +let _clockseq; // Previous uuid creation time + + +let _lastMSecs = 0; +let _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details + +function v1(options, buf, offset) { + let i = buf && offset || 0; + const b = buf || new Array(16); + options = options || {}; + let node = options.node || _nodeId; + let clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not + // specified. We do this lazily to minimize issues related to insufficient + // system entropy. See #189 + + if (node == null || clockseq == null) { + const seedBytes = options.random || (options.rng || _rng.default)(); + + if (node == null) { + // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) + node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; + } + + if (clockseq == null) { + // Per 4.2.2, randomize (14 bit) clockseq + clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; + } + } // UUID timestamps are 100 nano-second units since the Gregorian epoch, + // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so + // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' + // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. + + + let msecs = options.msecs !== undefined ? options.msecs : Date.now(); // Per 4.2.1.2, use count of uuid's generated during the current clock + // cycle to simulate higher resolution clock + + let nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) + + const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression + + if (dt < 0 && options.clockseq === undefined) { + clockseq = clockseq + 1 & 0x3fff; + } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new + // time interval + + + if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { + nsecs = 0; + } // Per 4.2.1.2 Throw error if too many uuids are requested + + + if (nsecs >= 10000) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } + + _lastMSecs = msecs; + _lastNSecs = nsecs; + _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch + + msecs += 12219292800000; // `time_low` + + const tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; + b[i++] = tl >>> 24 & 0xff; + b[i++] = tl >>> 16 & 0xff; + b[i++] = tl >>> 8 & 0xff; + b[i++] = tl & 0xff; // `time_mid` + + const tmh = msecs / 0x100000000 * 10000 & 0xfffffff; + b[i++] = tmh >>> 8 & 0xff; + b[i++] = tmh & 0xff; // `time_high_and_version` + + b[i++] = tmh >>> 24 & 0xf | 0x10; // include version + + b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) + + b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` + + b[i++] = clockseq & 0xff; // `node` + + for (let n = 0; n < 6; ++n) { + b[i + n] = node[n]; + } + + return buf || (0, _stringify.unsafeStringify)(b); +} + +var _default = v1; +exports["default"] = _default; + +/***/ }), + +/***/ 54331: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(42991)); + +var _md = _interopRequireDefault(__nccwpck_require__(9874)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v3 = (0, _v.default)('v3', 0x30, _md.default); +var _default = v3; +exports["default"] = _default; + +/***/ }), + +/***/ 42991: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.URL = exports.DNS = void 0; +exports["default"] = v35; + +var _stringify = __nccwpck_require__(54045); + +var _parse = _interopRequireDefault(__nccwpck_require__(12800)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function stringToBytes(str) { + str = unescape(encodeURIComponent(str)); // UTF8 escape + + const bytes = []; + + for (let i = 0; i < str.length; ++i) { + bytes.push(str.charCodeAt(i)); + } + + return bytes; +} + +const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; +exports.DNS = DNS; +const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; +exports.URL = URL; + +function v35(name, version, hashfunc) { + function generateUUID(value, namespace, buf, offset) { + var _namespace; + + if (typeof value === 'string') { + value = stringToBytes(value); + } + + if (typeof namespace === 'string') { + namespace = (0, _parse.default)(namespace); + } + + if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { + throw TypeError('Namespace must be array-like (16 iterable integer values, 0-255)'); + } // Compute hash of namespace and value, Per 4.3 + // Future: Use spread syntax when supported on all platforms, e.g. `bytes = + // hashfunc([...namespace, ... value])` + + + let bytes = new Uint8Array(16 + value.length); + bytes.set(namespace); + bytes.set(value, namespace.length); + bytes = hashfunc(bytes); + bytes[6] = bytes[6] & 0x0f | version; + bytes[8] = bytes[8] & 0x3f | 0x80; + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = bytes[i]; + } + + return buf; + } + + return (0, _stringify.unsafeStringify)(bytes); + } // Function#name is not settable on some platforms (#270) + + + try { + generateUUID.name = name; // eslint-disable-next-line no-empty + } catch (err) {} // For CommonJS default export support + + + generateUUID.DNS = DNS; + generateUUID.URL = URL; + return generateUUID; +} + +/***/ }), + +/***/ 69334: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _native = _interopRequireDefault(__nccwpck_require__(9731)); + +var _rng = _interopRequireDefault(__nccwpck_require__(9180)); + +var _stringify = __nccwpck_require__(54045); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function v4(options, buf, offset) { + if (_native.default.randomUUID && !buf && !options) { + return _native.default.randomUUID(); + } + + options = options || {}; + + const rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` + + + rnds[6] = rnds[6] & 0x0f | 0x40; + rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = rnds[i]; + } + + return buf; + } + + return (0, _stringify.unsafeStringify)(rnds); +} + +var _default = v4; +exports["default"] = _default; + +/***/ }), + +/***/ 95586: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(42991)); + +var _sha = _interopRequireDefault(__nccwpck_require__(89444)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v5 = (0, _v.default)('v5', 0x50, _sha.default); +var _default = v5; +exports["default"] = _default; + +/***/ }), + +/***/ 44718: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _regex = _interopRequireDefault(__nccwpck_require__(55172)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function validate(uuid) { + return typeof uuid === 'string' && _regex.default.test(uuid); +} + +var _default = validate; +exports["default"] = _default; + +/***/ }), + +/***/ 11997: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(44718)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function version(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + return parseInt(uuid.slice(14, 15), 16); +} + +var _default = version; +exports["default"] = _default; + +/***/ }), + +/***/ 16948: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.defaultSSOOIDCHttpAuthSchemeProvider = exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = void 0; +const core_1 = __nccwpck_require__(59963); +const util_middleware_1 = __nccwpck_require__(2390); +const defaultSSOOIDCHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSSOOIDCHttpAuthSchemeParametersProvider = defaultSSOOIDCHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sso-oauth", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSSOOIDCHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "CreateToken": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "RegisterClient": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "StartDeviceAuthorization": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSSOOIDCHttpAuthSchemeProvider = defaultSSOOIDCHttpAuthSchemeProvider; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0, + }; +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 97604: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const util_endpoints_2 = __nccwpck_require__(45473); +const ruleset_1 = __nccwpck_require__(51756); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 51756: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const u = "required", v = "fn", w = "argv", x = "ref"; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://oidc.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://oidc-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://oidc.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://oidc.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 54527: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AccessDeniedException: () => AccessDeniedException, + AuthorizationPendingException: () => AuthorizationPendingException, + CreateTokenCommand: () => CreateTokenCommand, + CreateTokenRequestFilterSensitiveLog: () => CreateTokenRequestFilterSensitiveLog, + CreateTokenResponseFilterSensitiveLog: () => CreateTokenResponseFilterSensitiveLog, + CreateTokenWithIAMCommand: () => CreateTokenWithIAMCommand, + CreateTokenWithIAMRequestFilterSensitiveLog: () => CreateTokenWithIAMRequestFilterSensitiveLog, + CreateTokenWithIAMResponseFilterSensitiveLog: () => CreateTokenWithIAMResponseFilterSensitiveLog, + ExpiredTokenException: () => ExpiredTokenException, + InternalServerException: () => InternalServerException, + InvalidClientException: () => InvalidClientException, + InvalidClientMetadataException: () => InvalidClientMetadataException, + InvalidGrantException: () => InvalidGrantException, + InvalidRedirectUriException: () => InvalidRedirectUriException, + InvalidRequestException: () => InvalidRequestException, + InvalidRequestRegionException: () => InvalidRequestRegionException, + InvalidScopeException: () => InvalidScopeException, + RegisterClientCommand: () => RegisterClientCommand, + RegisterClientResponseFilterSensitiveLog: () => RegisterClientResponseFilterSensitiveLog, + SSOOIDC: () => SSOOIDC, + SSOOIDCClient: () => SSOOIDCClient, + SSOOIDCServiceException: () => SSOOIDCServiceException, + SlowDownException: () => SlowDownException, + StartDeviceAuthorizationCommand: () => StartDeviceAuthorizationCommand, + StartDeviceAuthorizationRequestFilterSensitiveLog: () => StartDeviceAuthorizationRequestFilterSensitiveLog, + UnauthorizedClientException: () => UnauthorizedClientException, + UnsupportedGrantTypeException: () => UnsupportedGrantTypeException, + __Client: () => import_smithy_client.Client +}); +module.exports = __toCommonJS(src_exports); + +// src/SSOOIDCClient.ts +var import_middleware_host_header = __nccwpck_require__(22545); +var import_middleware_logger = __nccwpck_require__(17415); +var import_middleware_recursion_detection = __nccwpck_require__(85525); +var import_middleware_user_agent = __nccwpck_require__(64688); +var import_config_resolver = __nccwpck_require__(53098); +var import_core = __nccwpck_require__(55829); +var import_middleware_content_length = __nccwpck_require__(82800); +var import_middleware_endpoint = __nccwpck_require__(82918); +var import_middleware_retry = __nccwpck_require__(96039); + +var import_httpAuthSchemeProvider = __nccwpck_require__(16948); + +// src/endpoint/EndpointParameters.ts +var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "sso-oauth" + }; +}, "resolveClientEndpointParameters"); +var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } +}; + +// src/SSOOIDCClient.ts +var import_runtimeConfig = __nccwpck_require__(25524); + +// src/runtimeExtensions.ts +var import_region_config_resolver = __nccwpck_require__(18156); +var import_protocol_http = __nccwpck_require__(64418); +var import_smithy_client = __nccwpck_require__(63570); + +// src/auth/httpAuthExtensionConfiguration.ts +var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + } + }; +}, "getHttpAuthExtensionConfiguration"); +var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; +}, "resolveHttpAuthRuntimeConfig"); + +// src/runtimeExtensions.ts +var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); +var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; +}, "resolveRuntimeExtensions"); + +// src/SSOOIDCClient.ts +var _SSOOIDCClient = class _SSOOIDCClient extends import_smithy_client.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_config_resolver.resolveRegionConfig)(_config_1); + const _config_3 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_2); + const _config_4 = (0, import_middleware_retry.resolveRetryConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: this.getDefaultHttpAuthSchemeParametersProvider(), + identityProviderConfigProvider: this.getIdentityProviderConfigProvider() + }) + ); + this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); + } + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); + } + getDefaultHttpAuthSchemeParametersProvider() { + return import_httpAuthSchemeProvider.defaultSSOOIDCHttpAuthSchemeParametersProvider; + } + getIdentityProviderConfigProvider() { + return async (config) => new import_core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }); + } +}; +__name(_SSOOIDCClient, "SSOOIDCClient"); +var SSOOIDCClient = _SSOOIDCClient; + +// src/SSOOIDC.ts + + +// src/commands/CreateTokenCommand.ts + +var import_middleware_serde = __nccwpck_require__(81238); + + +// src/models/models_0.ts + + +// src/models/SSOOIDCServiceException.ts + +var _SSOOIDCServiceException = class _SSOOIDCServiceException extends import_smithy_client.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _SSOOIDCServiceException.prototype); + } +}; +__name(_SSOOIDCServiceException, "SSOOIDCServiceException"); +var SSOOIDCServiceException = _SSOOIDCServiceException; + +// src/models/models_0.ts +var _AccessDeniedException = class _AccessDeniedException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AccessDeniedException", + $fault: "client", + ...opts + }); + this.name = "AccessDeniedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AccessDeniedException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_AccessDeniedException, "AccessDeniedException"); +var AccessDeniedException = _AccessDeniedException; +var _AuthorizationPendingException = class _AuthorizationPendingException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "AuthorizationPendingException", + $fault: "client", + ...opts + }); + this.name = "AuthorizationPendingException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _AuthorizationPendingException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_AuthorizationPendingException, "AuthorizationPendingException"); +var AuthorizationPendingException = _AuthorizationPendingException; +var _ExpiredTokenException = class _ExpiredTokenException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredTokenException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_ExpiredTokenException, "ExpiredTokenException"); +var ExpiredTokenException = _ExpiredTokenException; +var _InternalServerException = class _InternalServerException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InternalServerException", + $fault: "server", + ...opts + }); + this.name = "InternalServerException"; + this.$fault = "server"; + Object.setPrototypeOf(this, _InternalServerException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InternalServerException, "InternalServerException"); +var InternalServerException = _InternalServerException; +var _InvalidClientException = class _InvalidClientException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidClientException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidClientException, "InvalidClientException"); +var InvalidClientException = _InvalidClientException; +var _InvalidGrantException = class _InvalidGrantException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidGrantException", + $fault: "client", + ...opts + }); + this.name = "InvalidGrantException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidGrantException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidGrantException, "InvalidGrantException"); +var InvalidGrantException = _InvalidGrantException; +var _InvalidRequestException = class _InvalidRequestException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidRequestException, "InvalidRequestException"); +var InvalidRequestException = _InvalidRequestException; +var _InvalidScopeException = class _InvalidScopeException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidScopeException", + $fault: "client", + ...opts + }); + this.name = "InvalidScopeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidScopeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidScopeException, "InvalidScopeException"); +var InvalidScopeException = _InvalidScopeException; +var _SlowDownException = class _SlowDownException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "SlowDownException", + $fault: "client", + ...opts + }); + this.name = "SlowDownException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _SlowDownException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_SlowDownException, "SlowDownException"); +var SlowDownException = _SlowDownException; +var _UnauthorizedClientException = class _UnauthorizedClientException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnauthorizedClientException", + $fault: "client", + ...opts + }); + this.name = "UnauthorizedClientException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnauthorizedClientException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_UnauthorizedClientException, "UnauthorizedClientException"); +var UnauthorizedClientException = _UnauthorizedClientException; +var _UnsupportedGrantTypeException = class _UnsupportedGrantTypeException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnsupportedGrantTypeException", + $fault: "client", + ...opts + }); + this.name = "UnsupportedGrantTypeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnsupportedGrantTypeException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_UnsupportedGrantTypeException, "UnsupportedGrantTypeException"); +var UnsupportedGrantTypeException = _UnsupportedGrantTypeException; +var _InvalidRequestRegionException = class _InvalidRequestRegionException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestRegionException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestRegionException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestRegionException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + this.endpoint = opts.endpoint; + this.region = opts.region; + } +}; +__name(_InvalidRequestRegionException, "InvalidRequestRegionException"); +var InvalidRequestRegionException = _InvalidRequestRegionException; +var _InvalidClientMetadataException = class _InvalidClientMetadataException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidClientMetadataException", + $fault: "client", + ...opts + }); + this.name = "InvalidClientMetadataException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidClientMetadataException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidClientMetadataException, "InvalidClientMetadataException"); +var InvalidClientMetadataException = _InvalidClientMetadataException; +var _InvalidRedirectUriException = class _InvalidRedirectUriException extends SSOOIDCServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRedirectUriException", + $fault: "client", + ...opts + }); + this.name = "InvalidRedirectUriException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRedirectUriException.prototype); + this.error = opts.error; + this.error_description = opts.error_description; + } +}; +__name(_InvalidRedirectUriException, "InvalidRedirectUriException"); +var InvalidRedirectUriException = _InvalidRedirectUriException; +var CreateTokenRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client.SENSITIVE_STRING } +}), "CreateTokenRequestFilterSensitiveLog"); +var CreateTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client.SENSITIVE_STRING } +}), "CreateTokenResponseFilterSensitiveLog"); +var CreateTokenWithIAMRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.refreshToken && { refreshToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.assertion && { assertion: import_smithy_client.SENSITIVE_STRING }, + ...obj.subjectToken && { subjectToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.codeVerifier && { codeVerifier: import_smithy_client.SENSITIVE_STRING } +}), "CreateTokenWithIAMRequestFilterSensitiveLog"); +var CreateTokenWithIAMResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.refreshToken && { refreshToken: import_smithy_client.SENSITIVE_STRING }, + ...obj.idToken && { idToken: import_smithy_client.SENSITIVE_STRING } +}), "CreateTokenWithIAMResponseFilterSensitiveLog"); +var RegisterClientResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client.SENSITIVE_STRING } +}), "RegisterClientResponseFilterSensitiveLog"); +var StartDeviceAuthorizationRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.clientSecret && { clientSecret: import_smithy_client.SENSITIVE_STRING } +}), "StartDeviceAuthorizationRequestFilterSensitiveLog"); + +// src/protocols/Aws_restJson1.ts +var import_core2 = __nccwpck_require__(59963); + + +var se_CreateTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/token"); + let body; + body = JSON.stringify( + (0, import_smithy_client.take)(input, { + clientId: [], + clientSecret: [], + code: [], + codeVerifier: [], + deviceCode: [], + grantType: [], + redirectUri: [], + refreshToken: [], + scope: (_) => (0, import_smithy_client._json)(_) + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); +}, "se_CreateTokenCommand"); +var se_CreateTokenWithIAMCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/token"); + const query = (0, import_smithy_client.map)({ + [_ai]: [, "t"] + }); + let body; + body = JSON.stringify( + (0, import_smithy_client.take)(input, { + assertion: [], + clientId: [], + code: [], + codeVerifier: [], + grantType: [], + redirectUri: [], + refreshToken: [], + requestedTokenType: [], + scope: (_) => (0, import_smithy_client._json)(_), + subjectToken: [], + subjectTokenType: [] + }) + ); + b.m("POST").h(headers).q(query).b(body); + return b.build(); +}, "se_CreateTokenWithIAMCommand"); +var se_RegisterClientCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/client/register"); + let body; + body = JSON.stringify( + (0, import_smithy_client.take)(input, { + clientName: [], + clientType: [], + entitledApplicationArn: [], + grantTypes: (_) => (0, import_smithy_client._json)(_), + issuerUrl: [], + redirectUris: (_) => (0, import_smithy_client._json)(_), + scopes: (_) => (0, import_smithy_client._json)(_) + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); +}, "se_RegisterClientCommand"); +var se_StartDeviceAuthorizationCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = { + "content-type": "application/json" + }; + b.bp("/device_authorization"); + let body; + body = JSON.stringify( + (0, import_smithy_client.take)(input, { + clientId: [], + clientSecret: [], + startUrl: [] + }) + ); + b.m("POST").h(headers).b(body); + return b.build(); +}, "se_StartDeviceAuthorizationCommand"); +var de_CreateTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + accessToken: import_smithy_client.expectString, + expiresIn: import_smithy_client.expectInt32, + idToken: import_smithy_client.expectString, + refreshToken: import_smithy_client.expectString, + tokenType: import_smithy_client.expectString + }); + Object.assign(contents, doc); + return contents; +}, "de_CreateTokenCommand"); +var de_CreateTokenWithIAMCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + accessToken: import_smithy_client.expectString, + expiresIn: import_smithy_client.expectInt32, + idToken: import_smithy_client.expectString, + issuedTokenType: import_smithy_client.expectString, + refreshToken: import_smithy_client.expectString, + scope: import_smithy_client._json, + tokenType: import_smithy_client.expectString + }); + Object.assign(contents, doc); + return contents; +}, "de_CreateTokenWithIAMCommand"); +var de_RegisterClientCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + authorizationEndpoint: import_smithy_client.expectString, + clientId: import_smithy_client.expectString, + clientIdIssuedAt: import_smithy_client.expectLong, + clientSecret: import_smithy_client.expectString, + clientSecretExpiresAt: import_smithy_client.expectLong, + tokenEndpoint: import_smithy_client.expectString + }); + Object.assign(contents, doc); + return contents; +}, "de_RegisterClientCommand"); +var de_StartDeviceAuthorizationCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + deviceCode: import_smithy_client.expectString, + expiresIn: import_smithy_client.expectInt32, + interval: import_smithy_client.expectInt32, + userCode: import_smithy_client.expectString, + verificationUri: import_smithy_client.expectString, + verificationUriComplete: import_smithy_client.expectString + }); + Object.assign(contents, doc); + return contents; +}, "de_StartDeviceAuthorizationCommand"); +var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core2.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "AccessDeniedException": + case "com.amazonaws.ssooidc#AccessDeniedException": + throw await de_AccessDeniedExceptionRes(parsedOutput, context); + case "AuthorizationPendingException": + case "com.amazonaws.ssooidc#AuthorizationPendingException": + throw await de_AuthorizationPendingExceptionRes(parsedOutput, context); + case "ExpiredTokenException": + case "com.amazonaws.ssooidc#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "InternalServerException": + case "com.amazonaws.ssooidc#InternalServerException": + throw await de_InternalServerExceptionRes(parsedOutput, context); + case "InvalidClientException": + case "com.amazonaws.ssooidc#InvalidClientException": + throw await de_InvalidClientExceptionRes(parsedOutput, context); + case "InvalidGrantException": + case "com.amazonaws.ssooidc#InvalidGrantException": + throw await de_InvalidGrantExceptionRes(parsedOutput, context); + case "InvalidRequestException": + case "com.amazonaws.ssooidc#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "InvalidScopeException": + case "com.amazonaws.ssooidc#InvalidScopeException": + throw await de_InvalidScopeExceptionRes(parsedOutput, context); + case "SlowDownException": + case "com.amazonaws.ssooidc#SlowDownException": + throw await de_SlowDownExceptionRes(parsedOutput, context); + case "UnauthorizedClientException": + case "com.amazonaws.ssooidc#UnauthorizedClientException": + throw await de_UnauthorizedClientExceptionRes(parsedOutput, context); + case "UnsupportedGrantTypeException": + case "com.amazonaws.ssooidc#UnsupportedGrantTypeException": + throw await de_UnsupportedGrantTypeExceptionRes(parsedOutput, context); + case "InvalidRequestRegionException": + case "com.amazonaws.ssooidc#InvalidRequestRegionException": + throw await de_InvalidRequestRegionExceptionRes(parsedOutput, context); + case "InvalidClientMetadataException": + case "com.amazonaws.ssooidc#InvalidClientMetadataException": + throw await de_InvalidClientMetadataExceptionRes(parsedOutput, context); + case "InvalidRedirectUriException": + case "com.amazonaws.ssooidc#InvalidRedirectUriException": + throw await de_InvalidRedirectUriExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}, "de_CommandError"); +var throwDefaultError = (0, import_smithy_client.withBaseException)(SSOOIDCServiceException); +var de_AccessDeniedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new AccessDeniedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_AccessDeniedExceptionRes"); +var de_AuthorizationPendingExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new AuthorizationPendingException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_AuthorizationPendingExceptionRes"); +var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_ExpiredTokenExceptionRes"); +var de_InternalServerExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InternalServerException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InternalServerExceptionRes"); +var de_InvalidClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidClientExceptionRes"); +var de_InvalidClientMetadataExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidClientMetadataException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidClientMetadataExceptionRes"); +var de_InvalidGrantExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidGrantException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidGrantExceptionRes"); +var de_InvalidRedirectUriExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRedirectUriException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidRedirectUriExceptionRes"); +var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidRequestExceptionRes"); +var de_InvalidRequestRegionExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + endpoint: import_smithy_client.expectString, + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString, + region: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestRegionException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidRequestRegionExceptionRes"); +var de_InvalidScopeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidScopeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidScopeExceptionRes"); +var de_SlowDownExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new SlowDownException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_SlowDownExceptionRes"); +var de_UnauthorizedClientExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new UnauthorizedClientException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_UnauthorizedClientExceptionRes"); +var de_UnsupportedGrantTypeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + error: import_smithy_client.expectString, + error_description: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new UnsupportedGrantTypeException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_UnsupportedGrantTypeExceptionRes"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); +var _ai = "aws_iam"; + +// src/commands/CreateTokenCommand.ts +var _CreateTokenCommand = class _CreateTokenCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSSOOIDCService", "CreateToken", {}).n("SSOOIDCClient", "CreateTokenCommand").f(CreateTokenRequestFilterSensitiveLog, CreateTokenResponseFilterSensitiveLog).ser(se_CreateTokenCommand).de(de_CreateTokenCommand).build() { +}; +__name(_CreateTokenCommand, "CreateTokenCommand"); +var CreateTokenCommand = _CreateTokenCommand; + +// src/commands/CreateTokenWithIAMCommand.ts + + + +var _CreateTokenWithIAMCommand = class _CreateTokenWithIAMCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSSOOIDCService", "CreateTokenWithIAM", {}).n("SSOOIDCClient", "CreateTokenWithIAMCommand").f(CreateTokenWithIAMRequestFilterSensitiveLog, CreateTokenWithIAMResponseFilterSensitiveLog).ser(se_CreateTokenWithIAMCommand).de(de_CreateTokenWithIAMCommand).build() { +}; +__name(_CreateTokenWithIAMCommand, "CreateTokenWithIAMCommand"); +var CreateTokenWithIAMCommand = _CreateTokenWithIAMCommand; + +// src/commands/RegisterClientCommand.ts + + + +var _RegisterClientCommand = class _RegisterClientCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSSOOIDCService", "RegisterClient", {}).n("SSOOIDCClient", "RegisterClientCommand").f(void 0, RegisterClientResponseFilterSensitiveLog).ser(se_RegisterClientCommand).de(de_RegisterClientCommand).build() { +}; +__name(_RegisterClientCommand, "RegisterClientCommand"); +var RegisterClientCommand = _RegisterClientCommand; + +// src/commands/StartDeviceAuthorizationCommand.ts + + + +var _StartDeviceAuthorizationCommand = class _StartDeviceAuthorizationCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSSOOIDCService", "StartDeviceAuthorization", {}).n("SSOOIDCClient", "StartDeviceAuthorizationCommand").f(StartDeviceAuthorizationRequestFilterSensitiveLog, void 0).ser(se_StartDeviceAuthorizationCommand).de(de_StartDeviceAuthorizationCommand).build() { +}; +__name(_StartDeviceAuthorizationCommand, "StartDeviceAuthorizationCommand"); +var StartDeviceAuthorizationCommand = _StartDeviceAuthorizationCommand; + +// src/SSOOIDC.ts +var commands = { + CreateTokenCommand, + CreateTokenWithIAMCommand, + RegisterClientCommand, + StartDeviceAuthorizationCommand +}; +var _SSOOIDC = class _SSOOIDC extends SSOOIDCClient { +}; +__name(_SSOOIDC, "SSOOIDC"); +var SSOOIDC = _SSOOIDC; +(0, import_smithy_client.createAggregatedClient)(commands, SSOOIDC); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 25524: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(69722)); +const core_1 = __nccwpck_require__(59963); +const credential_provider_node_1 = __nccwpck_require__(75531); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(20258); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(68005); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 68005: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __nccwpck_require__(59963); +const core_2 = __nccwpck_require__(55829); +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const httpAuthSchemeProvider_1 = __nccwpck_require__(16948); +const endpointResolver_1 = __nccwpck_require__(97604); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOOIDCHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO OIDC", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 49344: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.defaultSSOHttpAuthSchemeProvider = exports.defaultSSOHttpAuthSchemeParametersProvider = void 0; +const core_1 = __nccwpck_require__(59963); +const util_middleware_1 = __nccwpck_require__(2390); +const defaultSSOHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSSOHttpAuthSchemeParametersProvider = defaultSSOHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "awsssoportal", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSSOHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "GetRoleCredentials": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccountRoles": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "ListAccounts": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "Logout": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSSOHttpAuthSchemeProvider = defaultSSOHttpAuthSchemeProvider; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, core_1.resolveAwsSdkSigV4Config)(config); + return { + ...config_0, + }; +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 30898: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const util_endpoints_2 = __nccwpck_require__(45473); +const ruleset_1 = __nccwpck_require__(13341); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 13341: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const u = "required", v = "fn", w = "argv", x = "ref"; +const a = true, b = "isSet", c = "booleanEquals", d = "error", e = "endpoint", f = "tree", g = "PartitionResult", h = "getAttr", i = { [u]: false, "type": "String" }, j = { [u]: true, "default": false, "type": "Boolean" }, k = { [x]: "Endpoint" }, l = { [v]: c, [w]: [{ [x]: "UseFIPS" }, true] }, m = { [v]: c, [w]: [{ [x]: "UseDualStack" }, true] }, n = {}, o = { [v]: h, [w]: [{ [x]: g }, "supportsFIPS"] }, p = { [x]: g }, q = { [v]: c, [w]: [true, { [v]: h, [w]: [p, "supportsDualStack"] }] }, r = [l], s = [m], t = [{ [x]: "Region" }]; +const _data = { version: "1.0", parameters: { Region: i, UseDualStack: j, UseFIPS: j, Endpoint: i }, rules: [{ conditions: [{ [v]: b, [w]: [k] }], rules: [{ conditions: r, error: "Invalid Configuration: FIPS and custom endpoint are not supported", type: d }, { conditions: s, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", type: d }, { endpoint: { url: k, properties: n, headers: n }, type: e }], type: f }, { conditions: [{ [v]: b, [w]: t }], rules: [{ conditions: [{ [v]: "aws.partition", [w]: t, assign: g }], rules: [{ conditions: [l, m], rules: [{ conditions: [{ [v]: c, [w]: [a, o] }, q], rules: [{ endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", type: d }], type: f }, { conditions: r, rules: [{ conditions: [{ [v]: c, [w]: [o, a] }], rules: [{ conditions: [{ [v]: "stringEquals", [w]: [{ [v]: h, [w]: [p, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://portal.sso.{Region}.amazonaws.com", properties: n, headers: n }, type: e }, { endpoint: { url: "https://portal.sso-fips.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "FIPS is enabled but this partition does not support FIPS", type: d }], type: f }, { conditions: s, rules: [{ conditions: [q], rules: [{ endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: n, headers: n }, type: e }], type: f }, { error: "DualStack is enabled but this partition does not support DualStack", type: d }], type: f }, { endpoint: { url: "https://portal.sso.{Region}.{PartitionResult#dnsSuffix}", properties: n, headers: n }, type: e }], type: f }], type: f }, { error: "Invalid Configuration: Missing Region", type: d }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 82666: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + GetRoleCredentialsCommand: () => GetRoleCredentialsCommand, + GetRoleCredentialsRequestFilterSensitiveLog: () => GetRoleCredentialsRequestFilterSensitiveLog, + GetRoleCredentialsResponseFilterSensitiveLog: () => GetRoleCredentialsResponseFilterSensitiveLog, + InvalidRequestException: () => InvalidRequestException, + ListAccountRolesCommand: () => ListAccountRolesCommand, + ListAccountRolesRequestFilterSensitiveLog: () => ListAccountRolesRequestFilterSensitiveLog, + ListAccountsCommand: () => ListAccountsCommand, + ListAccountsRequestFilterSensitiveLog: () => ListAccountsRequestFilterSensitiveLog, + LogoutCommand: () => LogoutCommand, + LogoutRequestFilterSensitiveLog: () => LogoutRequestFilterSensitiveLog, + ResourceNotFoundException: () => ResourceNotFoundException, + RoleCredentialsFilterSensitiveLog: () => RoleCredentialsFilterSensitiveLog, + SSO: () => SSO, + SSOClient: () => SSOClient, + SSOServiceException: () => SSOServiceException, + TooManyRequestsException: () => TooManyRequestsException, + UnauthorizedException: () => UnauthorizedException, + __Client: () => import_smithy_client.Client, + paginateListAccountRoles: () => paginateListAccountRoles, + paginateListAccounts: () => paginateListAccounts +}); +module.exports = __toCommonJS(src_exports); + +// src/SSOClient.ts +var import_middleware_host_header = __nccwpck_require__(22545); +var import_middleware_logger = __nccwpck_require__(17415); +var import_middleware_recursion_detection = __nccwpck_require__(85525); +var import_middleware_user_agent = __nccwpck_require__(64688); +var import_config_resolver = __nccwpck_require__(53098); +var import_core = __nccwpck_require__(55829); +var import_middleware_content_length = __nccwpck_require__(82800); +var import_middleware_endpoint = __nccwpck_require__(82918); +var import_middleware_retry = __nccwpck_require__(96039); + +var import_httpAuthSchemeProvider = __nccwpck_require__(49344); + +// src/endpoint/EndpointParameters.ts +var resolveClientEndpointParameters = /* @__PURE__ */ __name((options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + defaultSigningName: "awsssoportal" + }; +}, "resolveClientEndpointParameters"); +var commonParams = { + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" } +}; + +// src/SSOClient.ts +var import_runtimeConfig = __nccwpck_require__(19756); + +// src/runtimeExtensions.ts +var import_region_config_resolver = __nccwpck_require__(18156); +var import_protocol_http = __nccwpck_require__(64418); +var import_smithy_client = __nccwpck_require__(63570); + +// src/auth/httpAuthExtensionConfiguration.ts +var getHttpAuthExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + } + }; +}, "getHttpAuthExtensionConfiguration"); +var resolveHttpAuthRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials() + }; +}, "resolveHttpAuthRuntimeConfig"); + +// src/runtimeExtensions.ts +var asPartial = /* @__PURE__ */ __name((t) => t, "asPartial"); +var resolveRuntimeExtensions = /* @__PURE__ */ __name((runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, import_region_config_resolver.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_smithy_client.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, import_protocol_http.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial(getHttpAuthExtensionConfiguration(runtimeConfig)) + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, import_region_config_resolver.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, import_smithy_client.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, import_protocol_http.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...resolveHttpAuthRuntimeConfig(extensionConfiguration) + }; +}, "resolveRuntimeExtensions"); + +// src/SSOClient.ts +var _SSOClient = class _SSOClient extends import_smithy_client.Client { + constructor(...[configuration]) { + const _config_0 = (0, import_runtimeConfig.getRuntimeConfig)(configuration || {}); + const _config_1 = resolveClientEndpointParameters(_config_0); + const _config_2 = (0, import_config_resolver.resolveRegionConfig)(_config_1); + const _config_3 = (0, import_middleware_endpoint.resolveEndpointConfig)(_config_2); + const _config_4 = (0, import_middleware_retry.resolveRetryConfig)(_config_3); + const _config_5 = (0, import_middleware_host_header.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, import_middleware_user_agent.resolveUserAgentConfig)(_config_5); + const _config_7 = (0, import_httpAuthSchemeProvider.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = resolveRuntimeExtensions(_config_7, (configuration == null ? void 0 : configuration.extensions) || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, import_middleware_retry.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_content_length.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_host_header.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_logger.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_recursion_detection.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, import_middleware_user_agent.getUserAgentPlugin)(this.config)); + this.middlewareStack.use( + (0, import_core.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: this.getDefaultHttpAuthSchemeParametersProvider(), + identityProviderConfigProvider: this.getIdentityProviderConfigProvider() + }) + ); + this.middlewareStack.use((0, import_core.getHttpSigningPlugin)(this.config)); + } + /** + * Destroy underlying resources, like sockets. It's usually not necessary to do this. + * However in Node.js, it's best to explicitly shut down the client's agent when it is no longer needed. + * Otherwise, sockets might stay open for quite a long time before the server terminates them. + */ + destroy() { + super.destroy(); + } + getDefaultHttpAuthSchemeParametersProvider() { + return import_httpAuthSchemeProvider.defaultSSOHttpAuthSchemeParametersProvider; + } + getIdentityProviderConfigProvider() { + return async (config) => new import_core.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials + }); + } +}; +__name(_SSOClient, "SSOClient"); +var SSOClient = _SSOClient; + +// src/SSO.ts + + +// src/commands/GetRoleCredentialsCommand.ts + +var import_middleware_serde = __nccwpck_require__(81238); + + +// src/models/models_0.ts + + +// src/models/SSOServiceException.ts + +var _SSOServiceException = class _SSOServiceException extends import_smithy_client.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _SSOServiceException.prototype); + } +}; +__name(_SSOServiceException, "SSOServiceException"); +var SSOServiceException = _SSOServiceException; + +// src/models/models_0.ts +var _InvalidRequestException = class _InvalidRequestException extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidRequestException", + $fault: "client", + ...opts + }); + this.name = "InvalidRequestException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidRequestException.prototype); + } +}; +__name(_InvalidRequestException, "InvalidRequestException"); +var InvalidRequestException = _InvalidRequestException; +var _ResourceNotFoundException = class _ResourceNotFoundException extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ResourceNotFoundException", + $fault: "client", + ...opts + }); + this.name = "ResourceNotFoundException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ResourceNotFoundException.prototype); + } +}; +__name(_ResourceNotFoundException, "ResourceNotFoundException"); +var ResourceNotFoundException = _ResourceNotFoundException; +var _TooManyRequestsException = class _TooManyRequestsException extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "TooManyRequestsException", + $fault: "client", + ...opts + }); + this.name = "TooManyRequestsException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _TooManyRequestsException.prototype); + } +}; +__name(_TooManyRequestsException, "TooManyRequestsException"); +var TooManyRequestsException = _TooManyRequestsException; +var _UnauthorizedException = class _UnauthorizedException extends SSOServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "UnauthorizedException", + $fault: "client", + ...opts + }); + this.name = "UnauthorizedException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _UnauthorizedException.prototype); + } +}; +__name(_UnauthorizedException, "UnauthorizedException"); +var UnauthorizedException = _UnauthorizedException; +var GetRoleCredentialsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } +}), "GetRoleCredentialsRequestFilterSensitiveLog"); +var RoleCredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.secretAccessKey && { secretAccessKey: import_smithy_client.SENSITIVE_STRING }, + ...obj.sessionToken && { sessionToken: import_smithy_client.SENSITIVE_STRING } +}), "RoleCredentialsFilterSensitiveLog"); +var GetRoleCredentialsResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.roleCredentials && { roleCredentials: RoleCredentialsFilterSensitiveLog(obj.roleCredentials) } +}), "GetRoleCredentialsResponseFilterSensitiveLog"); +var ListAccountRolesRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } +}), "ListAccountRolesRequestFilterSensitiveLog"); +var ListAccountsRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } +}), "ListAccountsRequestFilterSensitiveLog"); +var LogoutRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.accessToken && { accessToken: import_smithy_client.SENSITIVE_STRING } +}), "LogoutRequestFilterSensitiveLog"); + +// src/protocols/Aws_restJson1.ts +var import_core2 = __nccwpck_require__(59963); + + +var se_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = (0, import_smithy_client.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/federation/credentials"); + const query = (0, import_smithy_client.map)({ + [_rn]: [, (0, import_smithy_client.expectNonNull)(input[_rN], `roleName`)], + [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}, "se_GetRoleCredentialsCommand"); +var se_ListAccountRolesCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = (0, import_smithy_client.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/assignment/roles"); + const query = (0, import_smithy_client.map)({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()], + [_ai]: [, (0, import_smithy_client.expectNonNull)(input[_aI], `accountId`)] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}, "se_ListAccountRolesCommand"); +var se_ListAccountsCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = (0, import_smithy_client.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/assignment/accounts"); + const query = (0, import_smithy_client.map)({ + [_nt]: [, input[_nT]], + [_mr]: [() => input.maxResults !== void 0, () => input[_mR].toString()] + }); + let body; + b.m("GET").h(headers).q(query).b(body); + return b.build(); +}, "se_ListAccountsCommand"); +var se_LogoutCommand = /* @__PURE__ */ __name(async (input, context) => { + const b = (0, import_core.requestBuilder)(input, context); + const headers = (0, import_smithy_client.map)({}, isSerializableHeaderValue, { + [_xasbt]: input[_aT] + }); + b.bp("/logout"); + let body; + b.m("POST").h(headers).b(body); + return b.build(); +}, "se_LogoutCommand"); +var de_GetRoleCredentialsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + roleCredentials: import_smithy_client._json + }); + Object.assign(contents, doc); + return contents; +}, "de_GetRoleCredentialsCommand"); +var de_ListAccountRolesCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + nextToken: import_smithy_client.expectString, + roleList: import_smithy_client._json + }); + Object.assign(contents, doc); + return contents; +}, "de_ListAccountRolesCommand"); +var de_ListAccountsCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + const data = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.expectObject)(await (0, import_core2.parseJsonBody)(output.body, context)), "body"); + const doc = (0, import_smithy_client.take)(data, { + accountList: import_smithy_client._json, + nextToken: import_smithy_client.expectString + }); + Object.assign(contents, doc); + return contents; +}, "de_ListAccountsCommand"); +var de_LogoutCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode !== 200 && output.statusCode >= 300) { + return de_CommandError(output, context); + } + const contents = (0, import_smithy_client.map)({ + $metadata: deserializeMetadata(output) + }); + await (0, import_smithy_client.collectBody)(output.body, context); + return contents; +}, "de_LogoutCommand"); +var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core2.parseJsonErrorBody)(output.body, context) + }; + const errorCode = (0, import_core2.loadRestJsonErrorCode)(output, parsedOutput.body); + switch (errorCode) { + case "InvalidRequestException": + case "com.amazonaws.sso#InvalidRequestException": + throw await de_InvalidRequestExceptionRes(parsedOutput, context); + case "ResourceNotFoundException": + case "com.amazonaws.sso#ResourceNotFoundException": + throw await de_ResourceNotFoundExceptionRes(parsedOutput, context); + case "TooManyRequestsException": + case "com.amazonaws.sso#TooManyRequestsException": + throw await de_TooManyRequestsExceptionRes(parsedOutput, context); + case "UnauthorizedException": + case "com.amazonaws.sso#UnauthorizedException": + throw await de_UnauthorizedExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody, + errorCode + }); + } +}, "de_CommandError"); +var throwDefaultError = (0, import_smithy_client.withBaseException)(SSOServiceException); +var de_InvalidRequestExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + message: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new InvalidRequestException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_InvalidRequestExceptionRes"); +var de_ResourceNotFoundExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + message: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new ResourceNotFoundException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_ResourceNotFoundExceptionRes"); +var de_TooManyRequestsExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + message: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new TooManyRequestsException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_TooManyRequestsExceptionRes"); +var de_UnauthorizedExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const contents = (0, import_smithy_client.map)({}); + const data = parsedOutput.body; + const doc = (0, import_smithy_client.take)(data, { + message: import_smithy_client.expectString + }); + Object.assign(contents, doc); + const exception = new UnauthorizedException({ + $metadata: deserializeMetadata(parsedOutput), + ...contents + }); + return (0, import_smithy_client.decorateServiceException)(exception, parsedOutput.body); +}, "de_UnauthorizedExceptionRes"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); +var isSerializableHeaderValue = /* @__PURE__ */ __name((value) => value !== void 0 && value !== null && value !== "" && (!Object.getOwnPropertyNames(value).includes("length") || value.length != 0) && (!Object.getOwnPropertyNames(value).includes("size") || value.size != 0), "isSerializableHeaderValue"); +var _aI = "accountId"; +var _aT = "accessToken"; +var _ai = "account_id"; +var _mR = "maxResults"; +var _mr = "max_result"; +var _nT = "nextToken"; +var _nt = "next_token"; +var _rN = "roleName"; +var _rn = "role_name"; +var _xasbt = "x-amz-sso_bearer_token"; + +// src/commands/GetRoleCredentialsCommand.ts +var _GetRoleCredentialsCommand = class _GetRoleCredentialsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("SWBPortalService", "GetRoleCredentials", {}).n("SSOClient", "GetRoleCredentialsCommand").f(GetRoleCredentialsRequestFilterSensitiveLog, GetRoleCredentialsResponseFilterSensitiveLog).ser(se_GetRoleCredentialsCommand).de(de_GetRoleCredentialsCommand).build() { +}; +__name(_GetRoleCredentialsCommand, "GetRoleCredentialsCommand"); +var GetRoleCredentialsCommand = _GetRoleCredentialsCommand; + +// src/commands/ListAccountRolesCommand.ts + + + +var _ListAccountRolesCommand = class _ListAccountRolesCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("SWBPortalService", "ListAccountRoles", {}).n("SSOClient", "ListAccountRolesCommand").f(ListAccountRolesRequestFilterSensitiveLog, void 0).ser(se_ListAccountRolesCommand).de(de_ListAccountRolesCommand).build() { +}; +__name(_ListAccountRolesCommand, "ListAccountRolesCommand"); +var ListAccountRolesCommand = _ListAccountRolesCommand; + +// src/commands/ListAccountsCommand.ts + + + +var _ListAccountsCommand = class _ListAccountsCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("SWBPortalService", "ListAccounts", {}).n("SSOClient", "ListAccountsCommand").f(ListAccountsRequestFilterSensitiveLog, void 0).ser(se_ListAccountsCommand).de(de_ListAccountsCommand).build() { +}; +__name(_ListAccountsCommand, "ListAccountsCommand"); +var ListAccountsCommand = _ListAccountsCommand; + +// src/commands/LogoutCommand.ts + + + +var _LogoutCommand = class _LogoutCommand extends import_smithy_client.Command.classBuilder().ep({ + ...commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("SWBPortalService", "Logout", {}).n("SSOClient", "LogoutCommand").f(LogoutRequestFilterSensitiveLog, void 0).ser(se_LogoutCommand).de(de_LogoutCommand).build() { +}; +__name(_LogoutCommand, "LogoutCommand"); +var LogoutCommand = _LogoutCommand; + +// src/SSO.ts +var commands = { + GetRoleCredentialsCommand, + ListAccountRolesCommand, + ListAccountsCommand, + LogoutCommand +}; +var _SSO = class _SSO extends SSOClient { +}; +__name(_SSO, "SSO"); +var SSO = _SSO; +(0, import_smithy_client.createAggregatedClient)(commands, SSO); + +// src/pagination/ListAccountRolesPaginator.ts + +var paginateListAccountRoles = (0, import_core.createPaginator)(SSOClient, ListAccountRolesCommand, "nextToken", "nextToken", "maxResults"); + +// src/pagination/ListAccountsPaginator.ts + +var paginateListAccounts = (0, import_core.createPaginator)(SSOClient, ListAccountsCommand, "nextToken", "nextToken", "maxResults"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 19756: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(91092)); +const core_1 = __nccwpck_require__(59963); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(20258); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(44809); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 44809: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __nccwpck_require__(59963); +const core_2 = __nccwpck_require__(55829); +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const httpAuthSchemeProvider_1 = __nccwpck_require__(49344); +const endpointResolver_1 = __nccwpck_require__(30898); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2019-06-10", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSSOHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "SSO", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 64195: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.STSClient = exports.__Client = void 0; +const middleware_host_header_1 = __nccwpck_require__(22545); +const middleware_logger_1 = __nccwpck_require__(17415); +const middleware_recursion_detection_1 = __nccwpck_require__(85525); +const middleware_user_agent_1 = __nccwpck_require__(64688); +const config_resolver_1 = __nccwpck_require__(53098); +const core_1 = __nccwpck_require__(55829); +const middleware_content_length_1 = __nccwpck_require__(82800); +const middleware_endpoint_1 = __nccwpck_require__(82918); +const middleware_retry_1 = __nccwpck_require__(96039); +const smithy_client_1 = __nccwpck_require__(63570); +Object.defineProperty(exports, "__Client", ({ enumerable: true, get: function () { return smithy_client_1.Client; } })); +const httpAuthSchemeProvider_1 = __nccwpck_require__(17145); +const EndpointParameters_1 = __nccwpck_require__(20510); +const runtimeConfig_1 = __nccwpck_require__(83405); +const runtimeExtensions_1 = __nccwpck_require__(32053); +class STSClient extends smithy_client_1.Client { + constructor(...[configuration]) { + const _config_0 = (0, runtimeConfig_1.getRuntimeConfig)(configuration || {}); + const _config_1 = (0, EndpointParameters_1.resolveClientEndpointParameters)(_config_0); + const _config_2 = (0, config_resolver_1.resolveRegionConfig)(_config_1); + const _config_3 = (0, middleware_endpoint_1.resolveEndpointConfig)(_config_2); + const _config_4 = (0, middleware_retry_1.resolveRetryConfig)(_config_3); + const _config_5 = (0, middleware_host_header_1.resolveHostHeaderConfig)(_config_4); + const _config_6 = (0, middleware_user_agent_1.resolveUserAgentConfig)(_config_5); + const _config_7 = (0, httpAuthSchemeProvider_1.resolveHttpAuthSchemeConfig)(_config_6); + const _config_8 = (0, runtimeExtensions_1.resolveRuntimeExtensions)(_config_7, configuration?.extensions || []); + super(_config_8); + this.config = _config_8; + this.middlewareStack.use((0, middleware_retry_1.getRetryPlugin)(this.config)); + this.middlewareStack.use((0, middleware_content_length_1.getContentLengthPlugin)(this.config)); + this.middlewareStack.use((0, middleware_host_header_1.getHostHeaderPlugin)(this.config)); + this.middlewareStack.use((0, middleware_logger_1.getLoggerPlugin)(this.config)); + this.middlewareStack.use((0, middleware_recursion_detection_1.getRecursionDetectionPlugin)(this.config)); + this.middlewareStack.use((0, middleware_user_agent_1.getUserAgentPlugin)(this.config)); + this.middlewareStack.use((0, core_1.getHttpAuthSchemeEndpointRuleSetPlugin)(this.config, { + httpAuthSchemeParametersProvider: this.getDefaultHttpAuthSchemeParametersProvider(), + identityProviderConfigProvider: this.getIdentityProviderConfigProvider(), + })); + this.middlewareStack.use((0, core_1.getHttpSigningPlugin)(this.config)); + } + destroy() { + super.destroy(); + } + getDefaultHttpAuthSchemeParametersProvider() { + return httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeParametersProvider; + } + getIdentityProviderConfigProvider() { + return async (config) => new core_1.DefaultIdentityProviderConfig({ + "aws.auth#sigv4": config.credentials, + }); + } +} +exports.STSClient = STSClient; + + +/***/ }), + +/***/ 28527: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthRuntimeConfig = exports.getHttpAuthExtensionConfiguration = void 0; +const getHttpAuthExtensionConfiguration = (runtimeConfig) => { + const _httpAuthSchemes = runtimeConfig.httpAuthSchemes; + let _httpAuthSchemeProvider = runtimeConfig.httpAuthSchemeProvider; + let _credentials = runtimeConfig.credentials; + return { + setHttpAuthScheme(httpAuthScheme) { + const index = _httpAuthSchemes.findIndex((scheme) => scheme.schemeId === httpAuthScheme.schemeId); + if (index === -1) { + _httpAuthSchemes.push(httpAuthScheme); + } + else { + _httpAuthSchemes.splice(index, 1, httpAuthScheme); + } + }, + httpAuthSchemes() { + return _httpAuthSchemes; + }, + setHttpAuthSchemeProvider(httpAuthSchemeProvider) { + _httpAuthSchemeProvider = httpAuthSchemeProvider; + }, + httpAuthSchemeProvider() { + return _httpAuthSchemeProvider; + }, + setCredentials(credentials) { + _credentials = credentials; + }, + credentials() { + return _credentials; + }, + }; +}; +exports.getHttpAuthExtensionConfiguration = getHttpAuthExtensionConfiguration; +const resolveHttpAuthRuntimeConfig = (config) => { + return { + httpAuthSchemes: config.httpAuthSchemes(), + httpAuthSchemeProvider: config.httpAuthSchemeProvider(), + credentials: config.credentials(), + }; +}; +exports.resolveHttpAuthRuntimeConfig = resolveHttpAuthRuntimeConfig; + + +/***/ }), + +/***/ 17145: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveHttpAuthSchemeConfig = exports.resolveStsAuthConfig = exports.defaultSTSHttpAuthSchemeProvider = exports.defaultSTSHttpAuthSchemeParametersProvider = void 0; +const core_1 = __nccwpck_require__(59963); +const util_middleware_1 = __nccwpck_require__(2390); +const STSClient_1 = __nccwpck_require__(64195); +const defaultSTSHttpAuthSchemeParametersProvider = async (config, context, input) => { + return { + operation: (0, util_middleware_1.getSmithyContext)(context).operation, + region: (await (0, util_middleware_1.normalizeProvider)(config.region)()) || + (() => { + throw new Error("expected `region` to be configured for `aws.auth#sigv4`"); + })(), + }; +}; +exports.defaultSTSHttpAuthSchemeParametersProvider = defaultSTSHttpAuthSchemeParametersProvider; +function createAwsAuthSigv4HttpAuthOption(authParameters) { + return { + schemeId: "aws.auth#sigv4", + signingProperties: { + name: "sts", + region: authParameters.region, + }, + propertiesExtractor: (config, context) => ({ + signingProperties: { + config, + context, + }, + }), + }; +} +function createSmithyApiNoAuthHttpAuthOption(authParameters) { + return { + schemeId: "smithy.api#noAuth", + }; +} +const defaultSTSHttpAuthSchemeProvider = (authParameters) => { + const options = []; + switch (authParameters.operation) { + case "AssumeRoleWithSAML": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + case "AssumeRoleWithWebIdentity": { + options.push(createSmithyApiNoAuthHttpAuthOption(authParameters)); + break; + } + default: { + options.push(createAwsAuthSigv4HttpAuthOption(authParameters)); + } + } + return options; +}; +exports.defaultSTSHttpAuthSchemeProvider = defaultSTSHttpAuthSchemeProvider; +const resolveStsAuthConfig = (input) => ({ + ...input, + stsClientCtor: STSClient_1.STSClient, +}); +exports.resolveStsAuthConfig = resolveStsAuthConfig; +const resolveHttpAuthSchemeConfig = (config) => { + const config_0 = (0, exports.resolveStsAuthConfig)(config); + const config_1 = (0, core_1.resolveAwsSdkSigV4Config)(config_0); + return { + ...config_1, + }; +}; +exports.resolveHttpAuthSchemeConfig = resolveHttpAuthSchemeConfig; + + +/***/ }), + +/***/ 20510: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.commonParams = exports.resolveClientEndpointParameters = void 0; +const resolveClientEndpointParameters = (options) => { + return { + ...options, + useDualstackEndpoint: options.useDualstackEndpoint ?? false, + useFipsEndpoint: options.useFipsEndpoint ?? false, + useGlobalEndpoint: options.useGlobalEndpoint ?? false, + defaultSigningName: "sts", + }; +}; +exports.resolveClientEndpointParameters = resolveClientEndpointParameters; +exports.commonParams = { + UseGlobalEndpoint: { type: "builtInParams", name: "useGlobalEndpoint" }, + UseFIPS: { type: "builtInParams", name: "useFipsEndpoint" }, + Endpoint: { type: "builtInParams", name: "endpoint" }, + Region: { type: "builtInParams", name: "region" }, + UseDualStack: { type: "builtInParams", name: "useDualstackEndpoint" }, +}; + + +/***/ }), + +/***/ 41203: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.defaultEndpointResolver = void 0; +const util_endpoints_1 = __nccwpck_require__(13350); +const util_endpoints_2 = __nccwpck_require__(45473); +const ruleset_1 = __nccwpck_require__(86882); +const defaultEndpointResolver = (endpointParams, context = {}) => { + return (0, util_endpoints_2.resolveEndpoint)(ruleset_1.ruleSet, { + endpointParams: endpointParams, + logger: context.logger, + }); +}; +exports.defaultEndpointResolver = defaultEndpointResolver; +util_endpoints_2.customEndpointFunctions.aws = util_endpoints_1.awsEndpointFunctions; + + +/***/ }), + +/***/ 86882: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.ruleSet = void 0; +const F = "required", G = "type", H = "fn", I = "argv", J = "ref"; +const a = false, b = true, c = "booleanEquals", d = "stringEquals", e = "sigv4", f = "sts", g = "us-east-1", h = "endpoint", i = "https://sts.{Region}.{PartitionResult#dnsSuffix}", j = "tree", k = "error", l = "getAttr", m = { [F]: false, [G]: "String" }, n = { [F]: true, "default": false, [G]: "Boolean" }, o = { [J]: "Endpoint" }, p = { [H]: "isSet", [I]: [{ [J]: "Region" }] }, q = { [J]: "Region" }, r = { [H]: "aws.partition", [I]: [q], "assign": "PartitionResult" }, s = { [J]: "UseFIPS" }, t = { [J]: "UseDualStack" }, u = { "url": "https://sts.amazonaws.com", "properties": { "authSchemes": [{ "name": e, "signingName": f, "signingRegion": g }] }, "headers": {} }, v = {}, w = { "conditions": [{ [H]: d, [I]: [q, "aws-global"] }], [h]: u, [G]: h }, x = { [H]: c, [I]: [s, true] }, y = { [H]: c, [I]: [t, true] }, z = { [H]: l, [I]: [{ [J]: "PartitionResult" }, "supportsFIPS"] }, A = { [J]: "PartitionResult" }, B = { [H]: c, [I]: [true, { [H]: l, [I]: [A, "supportsDualStack"] }] }, C = [{ [H]: "isSet", [I]: [o] }], D = [x], E = [y]; +const _data = { version: "1.0", parameters: { Region: m, UseDualStack: n, UseFIPS: n, Endpoint: m, UseGlobalEndpoint: n }, rules: [{ conditions: [{ [H]: c, [I]: [{ [J]: "UseGlobalEndpoint" }, b] }, { [H]: "not", [I]: C }, p, r, { [H]: c, [I]: [s, a] }, { [H]: c, [I]: [t, a] }], rules: [{ conditions: [{ [H]: d, [I]: [q, "ap-northeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-south-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "ap-southeast-2"] }], endpoint: u, [G]: h }, w, { conditions: [{ [H]: d, [I]: [q, "ca-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-central-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-north-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "eu-west-3"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "sa-east-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, g] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-east-2"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-1"] }], endpoint: u, [G]: h }, { conditions: [{ [H]: d, [I]: [q, "us-west-2"] }], endpoint: u, [G]: h }, { endpoint: { url: i, properties: { authSchemes: [{ name: e, signingName: f, signingRegion: "{Region}" }] }, headers: v }, [G]: h }], [G]: j }, { conditions: C, rules: [{ conditions: D, error: "Invalid Configuration: FIPS and custom endpoint are not supported", [G]: k }, { conditions: E, error: "Invalid Configuration: Dualstack and custom endpoint are not supported", [G]: k }, { endpoint: { url: o, properties: v, headers: v }, [G]: h }], [G]: j }, { conditions: [p], rules: [{ conditions: [r], rules: [{ conditions: [x, y], rules: [{ conditions: [{ [H]: c, [I]: [b, z] }, B], rules: [{ endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS and DualStack are enabled, but this partition does not support one or both", [G]: k }], [G]: j }, { conditions: D, rules: [{ conditions: [{ [H]: c, [I]: [z, b] }], rules: [{ conditions: [{ [H]: d, [I]: [{ [H]: l, [I]: [A, "name"] }, "aws-us-gov"] }], endpoint: { url: "https://sts.{Region}.amazonaws.com", properties: v, headers: v }, [G]: h }, { endpoint: { url: "https://sts-fips.{Region}.{PartitionResult#dnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "FIPS is enabled but this partition does not support FIPS", [G]: k }], [G]: j }, { conditions: E, rules: [{ conditions: [B], rules: [{ endpoint: { url: "https://sts.{Region}.{PartitionResult#dualStackDnsSuffix}", properties: v, headers: v }, [G]: h }], [G]: j }, { error: "DualStack is enabled but this partition does not support DualStack", [G]: k }], [G]: j }, w, { endpoint: { url: i, properties: v, headers: v }, [G]: h }], [G]: j }], [G]: j }, { error: "Invalid Configuration: Missing Region", [G]: k }] }; +exports.ruleSet = _data; + + +/***/ }), + +/***/ 52209: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AssumeRoleCommand: () => AssumeRoleCommand, + AssumeRoleResponseFilterSensitiveLog: () => AssumeRoleResponseFilterSensitiveLog, + AssumeRoleWithSAMLCommand: () => AssumeRoleWithSAMLCommand, + AssumeRoleWithSAMLRequestFilterSensitiveLog: () => AssumeRoleWithSAMLRequestFilterSensitiveLog, + AssumeRoleWithSAMLResponseFilterSensitiveLog: () => AssumeRoleWithSAMLResponseFilterSensitiveLog, + AssumeRoleWithWebIdentityCommand: () => AssumeRoleWithWebIdentityCommand, + AssumeRoleWithWebIdentityRequestFilterSensitiveLog: () => AssumeRoleWithWebIdentityRequestFilterSensitiveLog, + AssumeRoleWithWebIdentityResponseFilterSensitiveLog: () => AssumeRoleWithWebIdentityResponseFilterSensitiveLog, + ClientInputEndpointParameters: () => import_EndpointParameters9.ClientInputEndpointParameters, + CredentialsFilterSensitiveLog: () => CredentialsFilterSensitiveLog, + DecodeAuthorizationMessageCommand: () => DecodeAuthorizationMessageCommand, + ExpiredTokenException: () => ExpiredTokenException, + GetAccessKeyInfoCommand: () => GetAccessKeyInfoCommand, + GetCallerIdentityCommand: () => GetCallerIdentityCommand, + GetFederationTokenCommand: () => GetFederationTokenCommand, + GetFederationTokenResponseFilterSensitiveLog: () => GetFederationTokenResponseFilterSensitiveLog, + GetSessionTokenCommand: () => GetSessionTokenCommand, + GetSessionTokenResponseFilterSensitiveLog: () => GetSessionTokenResponseFilterSensitiveLog, + IDPCommunicationErrorException: () => IDPCommunicationErrorException, + IDPRejectedClaimException: () => IDPRejectedClaimException, + InvalidAuthorizationMessageException: () => InvalidAuthorizationMessageException, + InvalidIdentityTokenException: () => InvalidIdentityTokenException, + MalformedPolicyDocumentException: () => MalformedPolicyDocumentException, + PackedPolicyTooLargeException: () => PackedPolicyTooLargeException, + RegionDisabledException: () => RegionDisabledException, + STS: () => STS, + STSServiceException: () => STSServiceException, + decorateDefaultCredentialProvider: () => decorateDefaultCredentialProvider, + getDefaultRoleAssumer: () => getDefaultRoleAssumer2, + getDefaultRoleAssumerWithWebIdentity: () => getDefaultRoleAssumerWithWebIdentity2 +}); +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(64195), module.exports); + +// src/STS.ts + + +// src/commands/AssumeRoleCommand.ts +var import_middleware_endpoint = __nccwpck_require__(82918); +var import_middleware_serde = __nccwpck_require__(81238); + +var import_EndpointParameters = __nccwpck_require__(20510); + +// src/models/models_0.ts + + +// src/models/STSServiceException.ts +var import_smithy_client = __nccwpck_require__(63570); +var _STSServiceException = class _STSServiceException extends import_smithy_client.ServiceException { + /** + * @internal + */ + constructor(options) { + super(options); + Object.setPrototypeOf(this, _STSServiceException.prototype); + } +}; +__name(_STSServiceException, "STSServiceException"); +var STSServiceException = _STSServiceException; + +// src/models/models_0.ts +var _ExpiredTokenException = class _ExpiredTokenException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "ExpiredTokenException", + $fault: "client", + ...opts + }); + this.name = "ExpiredTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _ExpiredTokenException.prototype); + } +}; +__name(_ExpiredTokenException, "ExpiredTokenException"); +var ExpiredTokenException = _ExpiredTokenException; +var _MalformedPolicyDocumentException = class _MalformedPolicyDocumentException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "MalformedPolicyDocumentException", + $fault: "client", + ...opts + }); + this.name = "MalformedPolicyDocumentException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _MalformedPolicyDocumentException.prototype); + } +}; +__name(_MalformedPolicyDocumentException, "MalformedPolicyDocumentException"); +var MalformedPolicyDocumentException = _MalformedPolicyDocumentException; +var _PackedPolicyTooLargeException = class _PackedPolicyTooLargeException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "PackedPolicyTooLargeException", + $fault: "client", + ...opts + }); + this.name = "PackedPolicyTooLargeException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _PackedPolicyTooLargeException.prototype); + } +}; +__name(_PackedPolicyTooLargeException, "PackedPolicyTooLargeException"); +var PackedPolicyTooLargeException = _PackedPolicyTooLargeException; +var _RegionDisabledException = class _RegionDisabledException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "RegionDisabledException", + $fault: "client", + ...opts + }); + this.name = "RegionDisabledException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _RegionDisabledException.prototype); + } +}; +__name(_RegionDisabledException, "RegionDisabledException"); +var RegionDisabledException = _RegionDisabledException; +var _IDPRejectedClaimException = class _IDPRejectedClaimException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IDPRejectedClaimException", + $fault: "client", + ...opts + }); + this.name = "IDPRejectedClaimException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IDPRejectedClaimException.prototype); + } +}; +__name(_IDPRejectedClaimException, "IDPRejectedClaimException"); +var IDPRejectedClaimException = _IDPRejectedClaimException; +var _InvalidIdentityTokenException = class _InvalidIdentityTokenException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidIdentityTokenException", + $fault: "client", + ...opts + }); + this.name = "InvalidIdentityTokenException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidIdentityTokenException.prototype); + } +}; +__name(_InvalidIdentityTokenException, "InvalidIdentityTokenException"); +var InvalidIdentityTokenException = _InvalidIdentityTokenException; +var _IDPCommunicationErrorException = class _IDPCommunicationErrorException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "IDPCommunicationErrorException", + $fault: "client", + ...opts + }); + this.name = "IDPCommunicationErrorException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _IDPCommunicationErrorException.prototype); + } +}; +__name(_IDPCommunicationErrorException, "IDPCommunicationErrorException"); +var IDPCommunicationErrorException = _IDPCommunicationErrorException; +var _InvalidAuthorizationMessageException = class _InvalidAuthorizationMessageException extends STSServiceException { + /** + * @internal + */ + constructor(opts) { + super({ + name: "InvalidAuthorizationMessageException", + $fault: "client", + ...opts + }); + this.name = "InvalidAuthorizationMessageException"; + this.$fault = "client"; + Object.setPrototypeOf(this, _InvalidAuthorizationMessageException.prototype); + } +}; +__name(_InvalidAuthorizationMessageException, "InvalidAuthorizationMessageException"); +var InvalidAuthorizationMessageException = _InvalidAuthorizationMessageException; +var CredentialsFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.SecretAccessKey && { SecretAccessKey: import_smithy_client.SENSITIVE_STRING } +}), "CredentialsFilterSensitiveLog"); +var AssumeRoleResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } +}), "AssumeRoleResponseFilterSensitiveLog"); +var AssumeRoleWithSAMLRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.SAMLAssertion && { SAMLAssertion: import_smithy_client.SENSITIVE_STRING } +}), "AssumeRoleWithSAMLRequestFilterSensitiveLog"); +var AssumeRoleWithSAMLResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } +}), "AssumeRoleWithSAMLResponseFilterSensitiveLog"); +var AssumeRoleWithWebIdentityRequestFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.WebIdentityToken && { WebIdentityToken: import_smithy_client.SENSITIVE_STRING } +}), "AssumeRoleWithWebIdentityRequestFilterSensitiveLog"); +var AssumeRoleWithWebIdentityResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } +}), "AssumeRoleWithWebIdentityResponseFilterSensitiveLog"); +var GetFederationTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } +}), "GetFederationTokenResponseFilterSensitiveLog"); +var GetSessionTokenResponseFilterSensitiveLog = /* @__PURE__ */ __name((obj) => ({ + ...obj, + ...obj.Credentials && { Credentials: CredentialsFilterSensitiveLog(obj.Credentials) } +}), "GetSessionTokenResponseFilterSensitiveLog"); + +// src/protocols/Aws_query.ts +var import_core = __nccwpck_require__(59963); +var import_protocol_http = __nccwpck_require__(64418); + +var se_AssumeRoleCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleRequest(input, context), + [_A]: _AR, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_AssumeRoleCommand"); +var se_AssumeRoleWithSAMLCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithSAMLRequest(input, context), + [_A]: _ARWSAML, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_AssumeRoleWithSAMLCommand"); +var se_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_AssumeRoleWithWebIdentityRequest(input, context), + [_A]: _ARWWI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_AssumeRoleWithWebIdentityCommand"); +var se_DecodeAuthorizationMessageCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_DecodeAuthorizationMessageRequest(input, context), + [_A]: _DAM, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_DecodeAuthorizationMessageCommand"); +var se_GetAccessKeyInfoCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetAccessKeyInfoRequest(input, context), + [_A]: _GAKI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_GetAccessKeyInfoCommand"); +var se_GetCallerIdentityCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetCallerIdentityRequest(input, context), + [_A]: _GCI, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_GetCallerIdentityCommand"); +var se_GetFederationTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetFederationTokenRequest(input, context), + [_A]: _GFT, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_GetFederationTokenCommand"); +var se_GetSessionTokenCommand = /* @__PURE__ */ __name(async (input, context) => { + const headers = SHARED_HEADERS; + let body; + body = buildFormUrlencodedString({ + ...se_GetSessionTokenRequest(input, context), + [_A]: _GST, + [_V]: _ + }); + return buildHttpRpcRequest(context, headers, "/", void 0, body); +}, "se_GetSessionTokenCommand"); +var de_AssumeRoleCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleResponse(data.AssumeRoleResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_AssumeRoleCommand"); +var de_AssumeRoleWithSAMLCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithSAMLResponse(data.AssumeRoleWithSAMLResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_AssumeRoleWithSAMLCommand"); +var de_AssumeRoleWithWebIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_AssumeRoleWithWebIdentityResponse(data.AssumeRoleWithWebIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_AssumeRoleWithWebIdentityCommand"); +var de_DecodeAuthorizationMessageCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_DecodeAuthorizationMessageResponse(data.DecodeAuthorizationMessageResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_DecodeAuthorizationMessageCommand"); +var de_GetAccessKeyInfoCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetAccessKeyInfoResponse(data.GetAccessKeyInfoResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_GetAccessKeyInfoCommand"); +var de_GetCallerIdentityCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetCallerIdentityResponse(data.GetCallerIdentityResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_GetCallerIdentityCommand"); +var de_GetFederationTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetFederationTokenResponse(data.GetFederationTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_GetFederationTokenCommand"); +var de_GetSessionTokenCommand = /* @__PURE__ */ __name(async (output, context) => { + if (output.statusCode >= 300) { + return de_CommandError(output, context); + } + const data = await (0, import_core.parseXmlBody)(output.body, context); + let contents = {}; + contents = de_GetSessionTokenResponse(data.GetSessionTokenResult, context); + const response = { + $metadata: deserializeMetadata(output), + ...contents + }; + return response; +}, "de_GetSessionTokenCommand"); +var de_CommandError = /* @__PURE__ */ __name(async (output, context) => { + const parsedOutput = { + ...output, + body: await (0, import_core.parseXmlErrorBody)(output.body, context) + }; + const errorCode = loadQueryErrorCode(output, parsedOutput.body); + switch (errorCode) { + case "ExpiredTokenException": + case "com.amazonaws.sts#ExpiredTokenException": + throw await de_ExpiredTokenExceptionRes(parsedOutput, context); + case "MalformedPolicyDocument": + case "com.amazonaws.sts#MalformedPolicyDocumentException": + throw await de_MalformedPolicyDocumentExceptionRes(parsedOutput, context); + case "PackedPolicyTooLarge": + case "com.amazonaws.sts#PackedPolicyTooLargeException": + throw await de_PackedPolicyTooLargeExceptionRes(parsedOutput, context); + case "RegionDisabledException": + case "com.amazonaws.sts#RegionDisabledException": + throw await de_RegionDisabledExceptionRes(parsedOutput, context); + case "IDPRejectedClaim": + case "com.amazonaws.sts#IDPRejectedClaimException": + throw await de_IDPRejectedClaimExceptionRes(parsedOutput, context); + case "InvalidIdentityToken": + case "com.amazonaws.sts#InvalidIdentityTokenException": + throw await de_InvalidIdentityTokenExceptionRes(parsedOutput, context); + case "IDPCommunicationError": + case "com.amazonaws.sts#IDPCommunicationErrorException": + throw await de_IDPCommunicationErrorExceptionRes(parsedOutput, context); + case "InvalidAuthorizationMessageException": + case "com.amazonaws.sts#InvalidAuthorizationMessageException": + throw await de_InvalidAuthorizationMessageExceptionRes(parsedOutput, context); + default: + const parsedBody = parsedOutput.body; + return throwDefaultError({ + output, + parsedBody: parsedBody.Error, + errorCode + }); + } +}, "de_CommandError"); +var de_ExpiredTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_ExpiredTokenException(body.Error, context); + const exception = new ExpiredTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_ExpiredTokenExceptionRes"); +var de_IDPCommunicationErrorExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPCommunicationErrorException(body.Error, context); + const exception = new IDPCommunicationErrorException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_IDPCommunicationErrorExceptionRes"); +var de_IDPRejectedClaimExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_IDPRejectedClaimException(body.Error, context); + const exception = new IDPRejectedClaimException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_IDPRejectedClaimExceptionRes"); +var de_InvalidAuthorizationMessageExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidAuthorizationMessageException(body.Error, context); + const exception = new InvalidAuthorizationMessageException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_InvalidAuthorizationMessageExceptionRes"); +var de_InvalidIdentityTokenExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_InvalidIdentityTokenException(body.Error, context); + const exception = new InvalidIdentityTokenException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_InvalidIdentityTokenExceptionRes"); +var de_MalformedPolicyDocumentExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_MalformedPolicyDocumentException(body.Error, context); + const exception = new MalformedPolicyDocumentException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_MalformedPolicyDocumentExceptionRes"); +var de_PackedPolicyTooLargeExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_PackedPolicyTooLargeException(body.Error, context); + const exception = new PackedPolicyTooLargeException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_PackedPolicyTooLargeExceptionRes"); +var de_RegionDisabledExceptionRes = /* @__PURE__ */ __name(async (parsedOutput, context) => { + const body = parsedOutput.body; + const deserialized = de_RegionDisabledException(body.Error, context); + const exception = new RegionDisabledException({ + $metadata: deserializeMetadata(parsedOutput), + ...deserialized + }); + return (0, import_smithy_client.decorateServiceException)(exception, body); +}, "de_RegionDisabledExceptionRes"); +var se_AssumeRoleRequest = /* @__PURE__ */ __name((input, context) => { + var _a2, _b, _c, _d; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_T] != null) { + const memberEntries = se_tagListType(input[_T], context); + if (((_b = input[_T]) == null ? void 0 : _b.length) === 0) { + entries.Tags = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + if (input[_TTK] != null) { + const memberEntries = se_tagKeyListType(input[_TTK], context); + if (((_c = input[_TTK]) == null ? void 0 : _c.length) === 0) { + entries.TransitiveTagKeys = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `TransitiveTagKeys.${key}`; + entries[loc] = value; + }); + } + if (input[_EI] != null) { + entries[_EI] = input[_EI]; + } + if (input[_SN] != null) { + entries[_SN] = input[_SN]; + } + if (input[_TC] != null) { + entries[_TC] = input[_TC]; + } + if (input[_SI] != null) { + entries[_SI] = input[_SI]; + } + if (input[_PC] != null) { + const memberEntries = se_ProvidedContextsListType(input[_PC], context); + if (((_d = input[_PC]) == null ? void 0 : _d.length) === 0) { + entries.ProvidedContexts = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `ProvidedContexts.${key}`; + entries[loc] = value; + }); + } + return entries; +}, "se_AssumeRoleRequest"); +var se_AssumeRoleWithSAMLRequest = /* @__PURE__ */ __name((input, context) => { + var _a2; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_PAr] != null) { + entries[_PAr] = input[_PAr]; + } + if (input[_SAMLA] != null) { + entries[_SAMLA] = input[_SAMLA]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + return entries; +}, "se_AssumeRoleWithSAMLRequest"); +var se_AssumeRoleWithWebIdentityRequest = /* @__PURE__ */ __name((input, context) => { + var _a2; + const entries = {}; + if (input[_RA] != null) { + entries[_RA] = input[_RA]; + } + if (input[_RSN] != null) { + entries[_RSN] = input[_RSN]; + } + if (input[_WIT] != null) { + entries[_WIT] = input[_WIT]; + } + if (input[_PI] != null) { + entries[_PI] = input[_PI]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + return entries; +}, "se_AssumeRoleWithWebIdentityRequest"); +var se_DecodeAuthorizationMessageRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_EM] != null) { + entries[_EM] = input[_EM]; + } + return entries; +}, "se_DecodeAuthorizationMessageRequest"); +var se_GetAccessKeyInfoRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_AKI] != null) { + entries[_AKI] = input[_AKI]; + } + return entries; +}, "se_GetAccessKeyInfoRequest"); +var se_GetCallerIdentityRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + return entries; +}, "se_GetCallerIdentityRequest"); +var se_GetFederationTokenRequest = /* @__PURE__ */ __name((input, context) => { + var _a2, _b; + const entries = {}; + if (input[_N] != null) { + entries[_N] = input[_N]; + } + if (input[_P] != null) { + entries[_P] = input[_P]; + } + if (input[_PA] != null) { + const memberEntries = se_policyDescriptorListType(input[_PA], context); + if (((_a2 = input[_PA]) == null ? void 0 : _a2.length) === 0) { + entries.PolicyArns = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `PolicyArns.${key}`; + entries[loc] = value; + }); + } + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_T] != null) { + const memberEntries = se_tagListType(input[_T], context); + if (((_b = input[_T]) == null ? void 0 : _b.length) === 0) { + entries.Tags = []; + } + Object.entries(memberEntries).forEach(([key, value]) => { + const loc = `Tags.${key}`; + entries[loc] = value; + }); + } + return entries; +}, "se_GetFederationTokenRequest"); +var se_GetSessionTokenRequest = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_DS] != null) { + entries[_DS] = input[_DS]; + } + if (input[_SN] != null) { + entries[_SN] = input[_SN]; + } + if (input[_TC] != null) { + entries[_TC] = input[_TC]; + } + return entries; +}, "se_GetSessionTokenRequest"); +var se_policyDescriptorListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_PolicyDescriptorType(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}, "se_policyDescriptorListType"); +var se_PolicyDescriptorType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_a] != null) { + entries[_a] = input[_a]; + } + return entries; +}, "se_PolicyDescriptorType"); +var se_ProvidedContext = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_PAro] != null) { + entries[_PAro] = input[_PAro]; + } + if (input[_CA] != null) { + entries[_CA] = input[_CA]; + } + return entries; +}, "se_ProvidedContext"); +var se_ProvidedContextsListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_ProvidedContext(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}, "se_ProvidedContextsListType"); +var se_Tag = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + if (input[_K] != null) { + entries[_K] = input[_K]; + } + if (input[_Va] != null) { + entries[_Va] = input[_Va]; + } + return entries; +}, "se_Tag"); +var se_tagKeyListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + entries[`member.${counter}`] = entry; + counter++; + } + return entries; +}, "se_tagKeyListType"); +var se_tagListType = /* @__PURE__ */ __name((input, context) => { + const entries = {}; + let counter = 1; + for (const entry of input) { + if (entry === null) { + continue; + } + const memberEntries = se_Tag(entry, context); + Object.entries(memberEntries).forEach(([key, value]) => { + entries[`member.${counter}.${key}`] = value; + }); + counter++; + } + return entries; +}, "se_tagListType"); +var de_AssumedRoleUser = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_ARI] != null) { + contents[_ARI] = (0, import_smithy_client.expectString)(output[_ARI]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client.expectString)(output[_Ar]); + } + return contents; +}, "de_AssumedRoleUser"); +var de_AssumeRoleResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client.strictParseInt32)(output[_PPS]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client.expectString)(output[_SI]); + } + return contents; +}, "de_AssumeRoleResponse"); +var de_AssumeRoleWithSAMLResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client.strictParseInt32)(output[_PPS]); + } + if (output[_S] != null) { + contents[_S] = (0, import_smithy_client.expectString)(output[_S]); + } + if (output[_ST] != null) { + contents[_ST] = (0, import_smithy_client.expectString)(output[_ST]); + } + if (output[_I] != null) { + contents[_I] = (0, import_smithy_client.expectString)(output[_I]); + } + if (output[_Au] != null) { + contents[_Au] = (0, import_smithy_client.expectString)(output[_Au]); + } + if (output[_NQ] != null) { + contents[_NQ] = (0, import_smithy_client.expectString)(output[_NQ]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client.expectString)(output[_SI]); + } + return contents; +}, "de_AssumeRoleWithSAMLResponse"); +var de_AssumeRoleWithWebIdentityResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_SFWIT] != null) { + contents[_SFWIT] = (0, import_smithy_client.expectString)(output[_SFWIT]); + } + if (output[_ARU] != null) { + contents[_ARU] = de_AssumedRoleUser(output[_ARU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client.strictParseInt32)(output[_PPS]); + } + if (output[_Pr] != null) { + contents[_Pr] = (0, import_smithy_client.expectString)(output[_Pr]); + } + if (output[_Au] != null) { + contents[_Au] = (0, import_smithy_client.expectString)(output[_Au]); + } + if (output[_SI] != null) { + contents[_SI] = (0, import_smithy_client.expectString)(output[_SI]); + } + return contents; +}, "de_AssumeRoleWithWebIdentityResponse"); +var de_Credentials = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_AKI] != null) { + contents[_AKI] = (0, import_smithy_client.expectString)(output[_AKI]); + } + if (output[_SAK] != null) { + contents[_SAK] = (0, import_smithy_client.expectString)(output[_SAK]); + } + if (output[_STe] != null) { + contents[_STe] = (0, import_smithy_client.expectString)(output[_STe]); + } + if (output[_E] != null) { + contents[_E] = (0, import_smithy_client.expectNonNull)((0, import_smithy_client.parseRfc3339DateTimeWithOffset)(output[_E])); + } + return contents; +}, "de_Credentials"); +var de_DecodeAuthorizationMessageResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_DM] != null) { + contents[_DM] = (0, import_smithy_client.expectString)(output[_DM]); + } + return contents; +}, "de_DecodeAuthorizationMessageResponse"); +var de_ExpiredTokenException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_ExpiredTokenException"); +var de_FederatedUser = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_FUI] != null) { + contents[_FUI] = (0, import_smithy_client.expectString)(output[_FUI]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client.expectString)(output[_Ar]); + } + return contents; +}, "de_FederatedUser"); +var de_GetAccessKeyInfoResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_Ac] != null) { + contents[_Ac] = (0, import_smithy_client.expectString)(output[_Ac]); + } + return contents; +}, "de_GetAccessKeyInfoResponse"); +var de_GetCallerIdentityResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_UI] != null) { + contents[_UI] = (0, import_smithy_client.expectString)(output[_UI]); + } + if (output[_Ac] != null) { + contents[_Ac] = (0, import_smithy_client.expectString)(output[_Ac]); + } + if (output[_Ar] != null) { + contents[_Ar] = (0, import_smithy_client.expectString)(output[_Ar]); + } + return contents; +}, "de_GetCallerIdentityResponse"); +var de_GetFederationTokenResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + if (output[_FU] != null) { + contents[_FU] = de_FederatedUser(output[_FU], context); + } + if (output[_PPS] != null) { + contents[_PPS] = (0, import_smithy_client.strictParseInt32)(output[_PPS]); + } + return contents; +}, "de_GetFederationTokenResponse"); +var de_GetSessionTokenResponse = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_C] != null) { + contents[_C] = de_Credentials(output[_C], context); + } + return contents; +}, "de_GetSessionTokenResponse"); +var de_IDPCommunicationErrorException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_IDPCommunicationErrorException"); +var de_IDPRejectedClaimException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_IDPRejectedClaimException"); +var de_InvalidAuthorizationMessageException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_InvalidAuthorizationMessageException"); +var de_InvalidIdentityTokenException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_InvalidIdentityTokenException"); +var de_MalformedPolicyDocumentException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_MalformedPolicyDocumentException"); +var de_PackedPolicyTooLargeException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_PackedPolicyTooLargeException"); +var de_RegionDisabledException = /* @__PURE__ */ __name((output, context) => { + const contents = {}; + if (output[_m] != null) { + contents[_m] = (0, import_smithy_client.expectString)(output[_m]); + } + return contents; +}, "de_RegionDisabledException"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); +var throwDefaultError = (0, import_smithy_client.withBaseException)(STSServiceException); +var buildHttpRpcRequest = /* @__PURE__ */ __name(async (context, headers, path, resolvedHostname, body) => { + const { hostname, protocol = "https", port, path: basePath } = await context.endpoint(); + const contents = { + protocol, + hostname, + port, + method: "POST", + path: basePath.endsWith("/") ? basePath.slice(0, -1) + path : basePath + path, + headers + }; + if (resolvedHostname !== void 0) { + contents.hostname = resolvedHostname; + } + if (body !== void 0) { + contents.body = body; + } + return new import_protocol_http.HttpRequest(contents); +}, "buildHttpRpcRequest"); +var SHARED_HEADERS = { + "content-type": "application/x-www-form-urlencoded" +}; +var _ = "2011-06-15"; +var _A = "Action"; +var _AKI = "AccessKeyId"; +var _AR = "AssumeRole"; +var _ARI = "AssumedRoleId"; +var _ARU = "AssumedRoleUser"; +var _ARWSAML = "AssumeRoleWithSAML"; +var _ARWWI = "AssumeRoleWithWebIdentity"; +var _Ac = "Account"; +var _Ar = "Arn"; +var _Au = "Audience"; +var _C = "Credentials"; +var _CA = "ContextAssertion"; +var _DAM = "DecodeAuthorizationMessage"; +var _DM = "DecodedMessage"; +var _DS = "DurationSeconds"; +var _E = "Expiration"; +var _EI = "ExternalId"; +var _EM = "EncodedMessage"; +var _FU = "FederatedUser"; +var _FUI = "FederatedUserId"; +var _GAKI = "GetAccessKeyInfo"; +var _GCI = "GetCallerIdentity"; +var _GFT = "GetFederationToken"; +var _GST = "GetSessionToken"; +var _I = "Issuer"; +var _K = "Key"; +var _N = "Name"; +var _NQ = "NameQualifier"; +var _P = "Policy"; +var _PA = "PolicyArns"; +var _PAr = "PrincipalArn"; +var _PAro = "ProviderArn"; +var _PC = "ProvidedContexts"; +var _PI = "ProviderId"; +var _PPS = "PackedPolicySize"; +var _Pr = "Provider"; +var _RA = "RoleArn"; +var _RSN = "RoleSessionName"; +var _S = "Subject"; +var _SAK = "SecretAccessKey"; +var _SAMLA = "SAMLAssertion"; +var _SFWIT = "SubjectFromWebIdentityToken"; +var _SI = "SourceIdentity"; +var _SN = "SerialNumber"; +var _ST = "SubjectType"; +var _STe = "SessionToken"; +var _T = "Tags"; +var _TC = "TokenCode"; +var _TTK = "TransitiveTagKeys"; +var _UI = "UserId"; +var _V = "Version"; +var _Va = "Value"; +var _WIT = "WebIdentityToken"; +var _a = "arn"; +var _m = "message"; +var buildFormUrlencodedString = /* @__PURE__ */ __name((formEntries) => Object.entries(formEntries).map(([key, value]) => (0, import_smithy_client.extendedEncodeURIComponent)(key) + "=" + (0, import_smithy_client.extendedEncodeURIComponent)(value)).join("&"), "buildFormUrlencodedString"); +var loadQueryErrorCode = /* @__PURE__ */ __name((output, data) => { + var _a2; + if (((_a2 = data.Error) == null ? void 0 : _a2.Code) !== void 0) { + return data.Error.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}, "loadQueryErrorCode"); + +// src/commands/AssumeRoleCommand.ts +var _AssumeRoleCommand = class _AssumeRoleCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "AssumeRole", {}).n("STSClient", "AssumeRoleCommand").f(void 0, AssumeRoleResponseFilterSensitiveLog).ser(se_AssumeRoleCommand).de(de_AssumeRoleCommand).build() { +}; +__name(_AssumeRoleCommand, "AssumeRoleCommand"); +var AssumeRoleCommand = _AssumeRoleCommand; + +// src/commands/AssumeRoleWithSAMLCommand.ts + + + +var import_EndpointParameters2 = __nccwpck_require__(20510); +var _AssumeRoleWithSAMLCommand = class _AssumeRoleWithSAMLCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters2.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithSAML", {}).n("STSClient", "AssumeRoleWithSAMLCommand").f(AssumeRoleWithSAMLRequestFilterSensitiveLog, AssumeRoleWithSAMLResponseFilterSensitiveLog).ser(se_AssumeRoleWithSAMLCommand).de(de_AssumeRoleWithSAMLCommand).build() { +}; +__name(_AssumeRoleWithSAMLCommand, "AssumeRoleWithSAMLCommand"); +var AssumeRoleWithSAMLCommand = _AssumeRoleWithSAMLCommand; + +// src/commands/AssumeRoleWithWebIdentityCommand.ts + + + +var import_EndpointParameters3 = __nccwpck_require__(20510); +var _AssumeRoleWithWebIdentityCommand = class _AssumeRoleWithWebIdentityCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters3.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "AssumeRoleWithWebIdentity", {}).n("STSClient", "AssumeRoleWithWebIdentityCommand").f(AssumeRoleWithWebIdentityRequestFilterSensitiveLog, AssumeRoleWithWebIdentityResponseFilterSensitiveLog).ser(se_AssumeRoleWithWebIdentityCommand).de(de_AssumeRoleWithWebIdentityCommand).build() { +}; +__name(_AssumeRoleWithWebIdentityCommand, "AssumeRoleWithWebIdentityCommand"); +var AssumeRoleWithWebIdentityCommand = _AssumeRoleWithWebIdentityCommand; + +// src/commands/DecodeAuthorizationMessageCommand.ts + + + +var import_EndpointParameters4 = __nccwpck_require__(20510); +var _DecodeAuthorizationMessageCommand = class _DecodeAuthorizationMessageCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters4.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "DecodeAuthorizationMessage", {}).n("STSClient", "DecodeAuthorizationMessageCommand").f(void 0, void 0).ser(se_DecodeAuthorizationMessageCommand).de(de_DecodeAuthorizationMessageCommand).build() { +}; +__name(_DecodeAuthorizationMessageCommand, "DecodeAuthorizationMessageCommand"); +var DecodeAuthorizationMessageCommand = _DecodeAuthorizationMessageCommand; + +// src/commands/GetAccessKeyInfoCommand.ts + + + +var import_EndpointParameters5 = __nccwpck_require__(20510); +var _GetAccessKeyInfoCommand = class _GetAccessKeyInfoCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters5.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "GetAccessKeyInfo", {}).n("STSClient", "GetAccessKeyInfoCommand").f(void 0, void 0).ser(se_GetAccessKeyInfoCommand).de(de_GetAccessKeyInfoCommand).build() { +}; +__name(_GetAccessKeyInfoCommand, "GetAccessKeyInfoCommand"); +var GetAccessKeyInfoCommand = _GetAccessKeyInfoCommand; + +// src/commands/GetCallerIdentityCommand.ts + + + +var import_EndpointParameters6 = __nccwpck_require__(20510); +var _GetCallerIdentityCommand = class _GetCallerIdentityCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters6.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "GetCallerIdentity", {}).n("STSClient", "GetCallerIdentityCommand").f(void 0, void 0).ser(se_GetCallerIdentityCommand).de(de_GetCallerIdentityCommand).build() { +}; +__name(_GetCallerIdentityCommand, "GetCallerIdentityCommand"); +var GetCallerIdentityCommand = _GetCallerIdentityCommand; + +// src/commands/GetFederationTokenCommand.ts + + + +var import_EndpointParameters7 = __nccwpck_require__(20510); +var _GetFederationTokenCommand = class _GetFederationTokenCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters7.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "GetFederationToken", {}).n("STSClient", "GetFederationTokenCommand").f(void 0, GetFederationTokenResponseFilterSensitiveLog).ser(se_GetFederationTokenCommand).de(de_GetFederationTokenCommand).build() { +}; +__name(_GetFederationTokenCommand, "GetFederationTokenCommand"); +var GetFederationTokenCommand = _GetFederationTokenCommand; + +// src/commands/GetSessionTokenCommand.ts + + + +var import_EndpointParameters8 = __nccwpck_require__(20510); +var _GetSessionTokenCommand = class _GetSessionTokenCommand extends import_smithy_client.Command.classBuilder().ep({ + ...import_EndpointParameters8.commonParams +}).m(function(Command, cs, config, o) { + return [ + (0, import_middleware_serde.getSerdePlugin)(config, this.serialize, this.deserialize), + (0, import_middleware_endpoint.getEndpointPlugin)(config, Command.getEndpointParameterInstructions()) + ]; +}).s("AWSSecurityTokenServiceV20110615", "GetSessionToken", {}).n("STSClient", "GetSessionTokenCommand").f(void 0, GetSessionTokenResponseFilterSensitiveLog).ser(se_GetSessionTokenCommand).de(de_GetSessionTokenCommand).build() { +}; +__name(_GetSessionTokenCommand, "GetSessionTokenCommand"); +var GetSessionTokenCommand = _GetSessionTokenCommand; + +// src/STS.ts +var import_STSClient = __nccwpck_require__(64195); +var commands = { + AssumeRoleCommand, + AssumeRoleWithSAMLCommand, + AssumeRoleWithWebIdentityCommand, + DecodeAuthorizationMessageCommand, + GetAccessKeyInfoCommand, + GetCallerIdentityCommand, + GetFederationTokenCommand, + GetSessionTokenCommand +}; +var _STS = class _STS extends import_STSClient.STSClient { +}; +__name(_STS, "STS"); +var STS = _STS; +(0, import_smithy_client.createAggregatedClient)(commands, STS); + +// src/index.ts +var import_EndpointParameters9 = __nccwpck_require__(20510); + +// src/defaultStsRoleAssumers.ts +var ASSUME_ROLE_DEFAULT_REGION = "us-east-1"; +var resolveRegion = /* @__PURE__ */ __name(async (_region, _parentRegion, credentialProviderLogger) => { + var _a2; + const region = typeof _region === "function" ? await _region() : _region; + const parentRegion = typeof _parentRegion === "function" ? await _parentRegion() : _parentRegion; + (_a2 = credentialProviderLogger == null ? void 0 : credentialProviderLogger.debug) == null ? void 0 : _a2.call( + credentialProviderLogger, + "@aws-sdk/client-sts::resolveRegion", + "accepting first of:", + `${region} (provider)`, + `${parentRegion} (parent client)`, + `${ASSUME_ROLE_DEFAULT_REGION} (STS default)` + ); + return region ?? parentRegion ?? ASSUME_ROLE_DEFAULT_REGION; +}, "resolveRegion"); +var getDefaultRoleAssumer = /* @__PURE__ */ __name((stsOptions, stsClientCtor) => { + let stsClient; + let closureSourceCreds; + return async (sourceCreds, params) => { + var _a2, _b, _c; + closureSourceCreds = sourceCreds; + if (!stsClient) { + const { + logger = (_a2 = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _a2.logger, + region, + requestHandler = (_b = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _b.requestHandler, + credentialProviderLogger + } = stsOptions; + const resolvedRegion = await resolveRegion( + region, + (_c = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _c.region, + credentialProviderLogger + ); + stsClient = new stsClientCtor({ + // A hack to make sts client uses the credential in current closure. + credentialDefaultProvider: () => async () => closureSourceCreds, + region: resolvedRegion, + requestHandler, + logger + }); + } + const { Credentials: Credentials2 } = await stsClient.send(new AssumeRoleCommand(params)); + if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRole call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials2.AccessKeyId, + secretAccessKey: Credentials2.SecretAccessKey, + sessionToken: Credentials2.SessionToken, + expiration: Credentials2.Expiration, + // TODO(credentialScope): access normally when shape is updated. + credentialScope: Credentials2.CredentialScope + }; + }; +}, "getDefaultRoleAssumer"); +var getDefaultRoleAssumerWithWebIdentity = /* @__PURE__ */ __name((stsOptions, stsClientCtor) => { + let stsClient; + return async (params) => { + var _a2, _b, _c; + if (!stsClient) { + const { + logger = (_a2 = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _a2.logger, + region, + requestHandler = (_b = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _b.requestHandler, + credentialProviderLogger + } = stsOptions; + const resolvedRegion = await resolveRegion( + region, + (_c = stsOptions == null ? void 0 : stsOptions.parentClientConfig) == null ? void 0 : _c.region, + credentialProviderLogger + ); + stsClient = new stsClientCtor({ + region: resolvedRegion, + requestHandler, + logger + }); + } + const { Credentials: Credentials2 } = await stsClient.send(new AssumeRoleWithWebIdentityCommand(params)); + if (!Credentials2 || !Credentials2.AccessKeyId || !Credentials2.SecretAccessKey) { + throw new Error(`Invalid response from STS.assumeRoleWithWebIdentity call with role ${params.RoleArn}`); + } + return { + accessKeyId: Credentials2.AccessKeyId, + secretAccessKey: Credentials2.SecretAccessKey, + sessionToken: Credentials2.SessionToken, + expiration: Credentials2.Expiration, + // TODO(credentialScope): access normally when shape is updated. + credentialScope: Credentials2.CredentialScope + }; + }; +}, "getDefaultRoleAssumerWithWebIdentity"); + +// src/defaultRoleAssumers.ts +var import_STSClient2 = __nccwpck_require__(64195); +var getCustomizableStsClientCtor = /* @__PURE__ */ __name((baseCtor, customizations) => { + var _a2; + if (!customizations) + return baseCtor; + else + return _a2 = class extends baseCtor { + constructor(config) { + super(config); + for (const customization of customizations) { + this.middlewareStack.use(customization); + } + } + }, __name(_a2, "CustomizableSTSClient"), _a2; +}, "getCustomizableStsClientCtor"); +var getDefaultRoleAssumer2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumer(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumer"); +var getDefaultRoleAssumerWithWebIdentity2 = /* @__PURE__ */ __name((stsOptions = {}, stsPlugins) => getDefaultRoleAssumerWithWebIdentity(stsOptions, getCustomizableStsClientCtor(import_STSClient2.STSClient, stsPlugins)), "getDefaultRoleAssumerWithWebIdentity"); +var decorateDefaultCredentialProvider = /* @__PURE__ */ __name((provider) => (input) => provider({ + roleAssumer: getDefaultRoleAssumer2(input), + roleAssumerWithWebIdentity: getDefaultRoleAssumerWithWebIdentity2(input), + ...input +}), "decorateDefaultCredentialProvider"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 83405: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const tslib_1 = __nccwpck_require__(4351); +const package_json_1 = tslib_1.__importDefault(__nccwpck_require__(7947)); +const core_1 = __nccwpck_require__(59963); +const credential_provider_node_1 = __nccwpck_require__(75531); +const util_user_agent_node_1 = __nccwpck_require__(98095); +const config_resolver_1 = __nccwpck_require__(53098); +const core_2 = __nccwpck_require__(55829); +const hash_node_1 = __nccwpck_require__(3081); +const middleware_retry_1 = __nccwpck_require__(96039); +const node_config_provider_1 = __nccwpck_require__(33461); +const node_http_handler_1 = __nccwpck_require__(20258); +const util_body_length_node_1 = __nccwpck_require__(68075); +const util_retry_1 = __nccwpck_require__(84902); +const runtimeConfig_shared_1 = __nccwpck_require__(81528); +const smithy_client_1 = __nccwpck_require__(63570); +const util_defaults_mode_node_1 = __nccwpck_require__(72429); +const smithy_client_2 = __nccwpck_require__(63570); +const getRuntimeConfig = (config) => { + (0, smithy_client_2.emitWarningIfUnsupportedVersion)(process.version); + const defaultsMode = (0, util_defaults_mode_node_1.resolveDefaultsModeConfig)(config); + const defaultConfigProvider = () => defaultsMode().then(smithy_client_1.loadConfigsForDefaultMode); + const clientSharedValues = (0, runtimeConfig_shared_1.getRuntimeConfig)(config); + (0, core_1.emitWarningIfUnsupportedVersion)(process.version); + return { + ...clientSharedValues, + ...config, + runtime: "node", + defaultsMode, + bodyLengthChecker: config?.bodyLengthChecker ?? util_body_length_node_1.calculateBodyLength, + credentialDefaultProvider: config?.credentialDefaultProvider ?? credential_provider_node_1.defaultProvider, + defaultUserAgentProvider: config?.defaultUserAgentProvider ?? + (0, util_user_agent_node_1.defaultUserAgent)({ serviceId: clientSharedValues.serviceId, clientVersion: package_json_1.default.version }), + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4") || + (async (idProps) => await (0, credential_provider_node_1.defaultProvider)(idProps?.__config || {})()), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + maxAttempts: config?.maxAttempts ?? (0, node_config_provider_1.loadConfig)(middleware_retry_1.NODE_MAX_ATTEMPT_CONFIG_OPTIONS), + region: config?.region ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_REGION_CONFIG_OPTIONS, config_resolver_1.NODE_REGION_CONFIG_FILE_OPTIONS), + requestHandler: node_http_handler_1.NodeHttpHandler.create(config?.requestHandler ?? defaultConfigProvider), + retryMode: config?.retryMode ?? + (0, node_config_provider_1.loadConfig)({ + ...middleware_retry_1.NODE_RETRY_MODE_CONFIG_OPTIONS, + default: async () => (await defaultConfigProvider()).retryMode || util_retry_1.DEFAULT_RETRY_MODE, + }), + sha256: config?.sha256 ?? hash_node_1.Hash.bind(null, "sha256"), + streamCollector: config?.streamCollector ?? node_http_handler_1.streamCollector, + useDualstackEndpoint: config?.useDualstackEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS), + useFipsEndpoint: config?.useFipsEndpoint ?? (0, node_config_provider_1.loadConfig)(config_resolver_1.NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS), + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 81528: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getRuntimeConfig = void 0; +const core_1 = __nccwpck_require__(59963); +const core_2 = __nccwpck_require__(55829); +const smithy_client_1 = __nccwpck_require__(63570); +const url_parser_1 = __nccwpck_require__(14681); +const util_base64_1 = __nccwpck_require__(75600); +const util_utf8_1 = __nccwpck_require__(41895); +const httpAuthSchemeProvider_1 = __nccwpck_require__(17145); +const endpointResolver_1 = __nccwpck_require__(41203); +const getRuntimeConfig = (config) => { + return { + apiVersion: "2011-06-15", + base64Decoder: config?.base64Decoder ?? util_base64_1.fromBase64, + base64Encoder: config?.base64Encoder ?? util_base64_1.toBase64, + disableHostPrefix: config?.disableHostPrefix ?? false, + endpointProvider: config?.endpointProvider ?? endpointResolver_1.defaultEndpointResolver, + extensions: config?.extensions ?? [], + httpAuthSchemeProvider: config?.httpAuthSchemeProvider ?? httpAuthSchemeProvider_1.defaultSTSHttpAuthSchemeProvider, + httpAuthSchemes: config?.httpAuthSchemes ?? [ + { + schemeId: "aws.auth#sigv4", + identityProvider: (ipc) => ipc.getIdentityProvider("aws.auth#sigv4"), + signer: new core_1.AwsSdkSigV4Signer(), + }, + { + schemeId: "smithy.api#noAuth", + identityProvider: (ipc) => ipc.getIdentityProvider("smithy.api#noAuth") || (async () => ({})), + signer: new core_2.NoAuthSigner(), + }, + ], + logger: config?.logger ?? new smithy_client_1.NoOpLogger(), + serviceId: config?.serviceId ?? "STS", + urlParser: config?.urlParser ?? url_parser_1.parseUrl, + utf8Decoder: config?.utf8Decoder ?? util_utf8_1.fromUtf8, + utf8Encoder: config?.utf8Encoder ?? util_utf8_1.toUtf8, + }; +}; +exports.getRuntimeConfig = getRuntimeConfig; + + +/***/ }), + +/***/ 32053: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.resolveRuntimeExtensions = void 0; +const region_config_resolver_1 = __nccwpck_require__(18156); +const protocol_http_1 = __nccwpck_require__(64418); +const smithy_client_1 = __nccwpck_require__(63570); +const httpAuthExtensionConfiguration_1 = __nccwpck_require__(28527); +const asPartial = (t) => t; +const resolveRuntimeExtensions = (runtimeConfig, extensions) => { + const extensionConfiguration = { + ...asPartial((0, region_config_resolver_1.getAwsRegionExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, smithy_client_1.getDefaultExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, protocol_http_1.getHttpHandlerExtensionConfiguration)(runtimeConfig)), + ...asPartial((0, httpAuthExtensionConfiguration_1.getHttpAuthExtensionConfiguration)(runtimeConfig)), + }; + extensions.forEach((extension) => extension.configure(extensionConfiguration)); + return { + ...runtimeConfig, + ...(0, region_config_resolver_1.resolveAwsRegionExtensionConfiguration)(extensionConfiguration), + ...(0, smithy_client_1.resolveDefaultRuntimeConfig)(extensionConfiguration), + ...(0, protocol_http_1.resolveHttpHandlerRuntimeConfig)(extensionConfiguration), + ...(0, httpAuthExtensionConfiguration_1.resolveHttpAuthRuntimeConfig)(extensionConfiguration), + }; +}; +exports.resolveRuntimeExtensions = resolveRuntimeExtensions; + + +/***/ }), + +/***/ 59963: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +const tslib_1 = __nccwpck_require__(4351); +tslib_1.__exportStar(__nccwpck_require__(2825), exports); +tslib_1.__exportStar(__nccwpck_require__(27862), exports); +tslib_1.__exportStar(__nccwpck_require__(50785), exports); + + +/***/ }), + +/***/ 2825: +/***/ ((module) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/submodules/client/index.ts +var client_exports = {}; +__export(client_exports, { + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion +}); +module.exports = __toCommonJS(client_exports); + +// src/submodules/client/emitWarningIfUnsupportedVersion.ts +var warningEmitted = false; +var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { + if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 18) { + warningEmitted = true; + process.emitWarning( + `NodeDeprecationWarning: The AWS SDK for JavaScript (v3) will +no longer support Node.js 16.x on January 6, 2025. + +To continue receiving updates to AWS services, bug fixes, and security +updates please upgrade to a supported Node.js LTS version. + +More information can be found at: https://a.co/74kJMmI` + ); + } +}, "emitWarningIfUnsupportedVersion"); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); + + +/***/ }), + +/***/ 27862: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/submodules/httpAuthSchemes/index.ts +var httpAuthSchemes_exports = {}; +__export(httpAuthSchemes_exports, { + AWSSDKSigV4Signer: () => AWSSDKSigV4Signer, + AwsSdkSigV4Signer: () => AwsSdkSigV4Signer, + resolveAWSSDKSigV4Config: () => resolveAWSSDKSigV4Config, + resolveAwsSdkSigV4Config: () => resolveAwsSdkSigV4Config +}); +module.exports = __toCommonJS(httpAuthSchemes_exports); + +// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts +var import_protocol_http2 = __nccwpck_require__(64418); + +// src/submodules/httpAuthSchemes/utils/getDateHeader.ts +var import_protocol_http = __nccwpck_require__(64418); +var getDateHeader = /* @__PURE__ */ __name((response) => { + var _a, _b; + return import_protocol_http.HttpResponse.isInstance(response) ? ((_a = response.headers) == null ? void 0 : _a.date) ?? ((_b = response.headers) == null ? void 0 : _b.Date) : void 0; +}, "getDateHeader"); + +// src/submodules/httpAuthSchemes/utils/getSkewCorrectedDate.ts +var getSkewCorrectedDate = /* @__PURE__ */ __name((systemClockOffset) => new Date(Date.now() + systemClockOffset), "getSkewCorrectedDate"); + +// src/submodules/httpAuthSchemes/utils/isClockSkewed.ts +var isClockSkewed = /* @__PURE__ */ __name((clockTime, systemClockOffset) => Math.abs(getSkewCorrectedDate(systemClockOffset).getTime() - clockTime) >= 3e5, "isClockSkewed"); + +// src/submodules/httpAuthSchemes/utils/getUpdatedSystemClockOffset.ts +var getUpdatedSystemClockOffset = /* @__PURE__ */ __name((clockTime, currentSystemClockOffset) => { + const clockTimeInMs = Date.parse(clockTime); + if (isClockSkewed(clockTimeInMs, currentSystemClockOffset)) { + return clockTimeInMs - Date.now(); + } + return currentSystemClockOffset; +}, "getUpdatedSystemClockOffset"); + +// src/submodules/httpAuthSchemes/aws_sdk/AwsSdkSigV4Signer.ts +var throwSigningPropertyError = /* @__PURE__ */ __name((name, property) => { + if (!property) { + throw new Error(`Property \`${name}\` is not resolved for AWS SDK SigV4Auth`); + } + return property; +}, "throwSigningPropertyError"); +var validateSigningProperties = /* @__PURE__ */ __name(async (signingProperties) => { + var _a, _b, _c; + const context = throwSigningPropertyError( + "context", + signingProperties.context + ); + const config = throwSigningPropertyError("config", signingProperties.config); + const authScheme = (_c = (_b = (_a = context.endpointV2) == null ? void 0 : _a.properties) == null ? void 0 : _b.authSchemes) == null ? void 0 : _c[0]; + const signerFunction = throwSigningPropertyError( + "signer", + config.signer + ); + const signer = await signerFunction(authScheme); + const signingRegion = signingProperties == null ? void 0 : signingProperties.signingRegion; + const signingName = signingProperties == null ? void 0 : signingProperties.signingName; + return { + config, + signer, + signingRegion, + signingName + }; +}, "validateSigningProperties"); +var _AwsSdkSigV4Signer = class _AwsSdkSigV4Signer { + async sign(httpRequest, identity, signingProperties) { + if (!import_protocol_http2.HttpRequest.isInstance(httpRequest)) { + throw new Error("The request is not an instance of `HttpRequest` and cannot be signed"); + } + const { config, signer, signingRegion, signingName } = await validateSigningProperties(signingProperties); + const signedRequest = await signer.sign(httpRequest, { + signingDate: getSkewCorrectedDate(config.systemClockOffset), + signingRegion, + signingService: signingName + }); + return signedRequest; + } + errorHandler(signingProperties) { + return (error) => { + const serverTime = error.ServerTime ?? getDateHeader(error.$response); + if (serverTime) { + const config = throwSigningPropertyError("config", signingProperties.config); + const initialSystemClockOffset = config.systemClockOffset; + config.systemClockOffset = getUpdatedSystemClockOffset(serverTime, config.systemClockOffset); + const clockSkewCorrected = config.systemClockOffset !== initialSystemClockOffset; + if (clockSkewCorrected && error.$metadata) { + error.$metadata.clockSkewCorrected = true; + } + } + throw error; + }; + } + successHandler(httpResponse, signingProperties) { + const dateHeader = getDateHeader(httpResponse); + if (dateHeader) { + const config = throwSigningPropertyError("config", signingProperties.config); + config.systemClockOffset = getUpdatedSystemClockOffset(dateHeader, config.systemClockOffset); + } + } +}; +__name(_AwsSdkSigV4Signer, "AwsSdkSigV4Signer"); +var AwsSdkSigV4Signer = _AwsSdkSigV4Signer; +var AWSSDKSigV4Signer = AwsSdkSigV4Signer; + +// src/submodules/httpAuthSchemes/aws_sdk/resolveAwsSdkSigV4Config.ts +var import_core = __nccwpck_require__(55829); +var import_signature_v4 = __nccwpck_require__(11528); +var resolveAwsSdkSigV4Config = /* @__PURE__ */ __name((config) => { + let normalizedCreds; + if (config.credentials) { + normalizedCreds = (0, import_core.memoizeIdentityProvider)(config.credentials, import_core.isIdentityExpired, import_core.doesIdentityRequireRefresh); + } + if (!normalizedCreds) { + if (config.credentialDefaultProvider) { + normalizedCreds = (0, import_core.normalizeProvider)( + config.credentialDefaultProvider( + Object.assign({}, config, { + parentClientConfig: config + }) + ) + ); + } else { + normalizedCreds = /* @__PURE__ */ __name(async () => { + throw new Error("`credentials` is missing"); + }, "normalizedCreds"); + } + } + const { + // Default for signingEscapePath + signingEscapePath = true, + // Default for systemClockOffset + systemClockOffset = config.systemClockOffset || 0, + // No default for sha256 since it is platform dependent + sha256 + } = config; + let signer; + if (config.signer) { + signer = (0, import_core.normalizeProvider)(config.signer); + } else if (config.regionInfoProvider) { + signer = /* @__PURE__ */ __name(() => (0, import_core.normalizeProvider)(config.region)().then( + async (region) => [ + await config.regionInfoProvider(region, { + useFipsEndpoint: await config.useFipsEndpoint(), + useDualstackEndpoint: await config.useDualstackEndpoint() + }) || {}, + region + ] + ).then(([regionInfo, region]) => { + const { signingRegion, signingService } = regionInfo; + config.signingRegion = config.signingRegion || signingRegion || region; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath + }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); + }), "signer"); + } else { + signer = /* @__PURE__ */ __name(async (authScheme) => { + authScheme = Object.assign( + {}, + { + name: "sigv4", + signingName: config.signingName || config.defaultSigningName, + signingRegion: await (0, import_core.normalizeProvider)(config.region)(), + properties: {} + }, + authScheme + ); + const signingRegion = authScheme.signingRegion; + const signingService = authScheme.signingName; + config.signingRegion = config.signingRegion || signingRegion; + config.signingName = config.signingName || signingService || config.serviceId; + const params = { + ...config, + credentials: normalizedCreds, + region: config.signingRegion, + service: config.signingName, + sha256, + uriEscapePath: signingEscapePath + }; + const SignerCtor = config.signerConstructor || import_signature_v4.SignatureV4; + return new SignerCtor(params); + }, "signer"); + } + return { + ...config, + systemClockOffset, + signingEscapePath, + credentials: normalizedCreds, + signer + }; +}, "resolveAwsSdkSigV4Config"); +var resolveAWSSDKSigV4Config = resolveAwsSdkSigV4Config; +// Annotate the CommonJS export names for ESM import in node: +0 && (0); + + +/***/ }), + +/***/ 50785: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/submodules/protocols/index.ts +var protocols_exports = {}; +__export(protocols_exports, { + _toBool: () => _toBool, + _toNum: () => _toNum, + _toStr: () => _toStr, + awsExpectUnion: () => awsExpectUnion, + loadRestJsonErrorCode: () => loadRestJsonErrorCode, + loadRestXmlErrorCode: () => loadRestXmlErrorCode, + parseJsonBody: () => parseJsonBody, + parseJsonErrorBody: () => parseJsonErrorBody, + parseXmlBody: () => parseXmlBody, + parseXmlErrorBody: () => parseXmlErrorBody +}); +module.exports = __toCommonJS(protocols_exports); + +// src/submodules/protocols/coercing-serializers.ts +var _toStr = /* @__PURE__ */ __name((val) => { + if (val == null) { + return val; + } + if (typeof val === "number" || typeof val === "bigint") { + const warning = new Error(`Received number ${val} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val); + } + if (typeof val === "boolean") { + const warning = new Error(`Received boolean ${val} where a string was expected.`); + warning.name = "Warning"; + console.warn(warning); + return String(val); + } + return val; +}, "_toStr"); +var _toBool = /* @__PURE__ */ __name((val) => { + if (val == null) { + return val; + } + if (typeof val === "number") { + } + if (typeof val === "string") { + const lowercase = val.toLowerCase(); + if (val !== "" && lowercase !== "false" && lowercase !== "true") { + const warning = new Error(`Received string "${val}" where a boolean was expected.`); + warning.name = "Warning"; + console.warn(warning); + } + return val !== "" && lowercase !== "false"; + } + return val; +}, "_toBool"); +var _toNum = /* @__PURE__ */ __name((val) => { + if (val == null) { + return val; + } + if (typeof val === "boolean") { + } + if (typeof val === "string") { + const num = Number(val); + if (num.toString() !== val) { + const warning = new Error(`Received string "${val}" where a number was expected.`); + warning.name = "Warning"; + console.warn(warning); + return val; + } + return num; + } + return val; +}, "_toNum"); + +// src/submodules/protocols/json/awsExpectUnion.ts +var import_smithy_client = __nccwpck_require__(63570); +var awsExpectUnion = /* @__PURE__ */ __name((value) => { + if (value == null) { + return void 0; + } + if (typeof value === "object" && "__type" in value) { + delete value.__type; + } + return (0, import_smithy_client.expectUnion)(value); +}, "awsExpectUnion"); + +// src/submodules/protocols/common.ts +var import_smithy_client2 = __nccwpck_require__(63570); +var collectBodyString = /* @__PURE__ */ __name((streamBody, context) => (0, import_smithy_client2.collectBody)(streamBody, context).then((body) => context.utf8Encoder(body)), "collectBodyString"); + +// src/submodules/protocols/json/parseJsonBody.ts +var parseJsonBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + try { + return JSON.parse(encoded); + } catch (e) { + if ((e == null ? void 0 : e.name) === "SyntaxError") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); + } + throw e; + } + } + return {}; +}), "parseJsonBody"); +var parseJsonErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { + const value = await parseJsonBody(errorBody, context); + value.message = value.message ?? value.Message; + return value; +}, "parseJsonErrorBody"); +var loadRestJsonErrorCode = /* @__PURE__ */ __name((output, data) => { + const findKey = /* @__PURE__ */ __name((object, key) => Object.keys(object).find((k) => k.toLowerCase() === key.toLowerCase()), "findKey"); + const sanitizeErrorCode = /* @__PURE__ */ __name((rawValue) => { + let cleanValue = rawValue; + if (typeof cleanValue === "number") { + cleanValue = cleanValue.toString(); + } + if (cleanValue.indexOf(",") >= 0) { + cleanValue = cleanValue.split(",")[0]; + } + if (cleanValue.indexOf(":") >= 0) { + cleanValue = cleanValue.split(":")[0]; + } + if (cleanValue.indexOf("#") >= 0) { + cleanValue = cleanValue.split("#")[1]; + } + return cleanValue; + }, "sanitizeErrorCode"); + const headerKey = findKey(output.headers, "x-amzn-errortype"); + if (headerKey !== void 0) { + return sanitizeErrorCode(output.headers[headerKey]); + } + if (data.code !== void 0) { + return sanitizeErrorCode(data.code); + } + if (data["__type"] !== void 0) { + return sanitizeErrorCode(data["__type"]); + } +}, "loadRestJsonErrorCode"); + +// src/submodules/protocols/xml/parseXmlBody.ts +var import_smithy_client3 = __nccwpck_require__(63570); +var import_fast_xml_parser = __nccwpck_require__(12603); +var parseXmlBody = /* @__PURE__ */ __name((streamBody, context) => collectBodyString(streamBody, context).then((encoded) => { + if (encoded.length) { + const parser = new import_fast_xml_parser.XMLParser({ + attributeNamePrefix: "", + htmlEntities: true, + ignoreAttributes: false, + ignoreDeclaration: true, + parseTagValue: false, + trimValues: false, + tagValueProcessor: (_, val) => val.trim() === "" && val.includes("\n") ? "" : void 0 + }); + parser.addEntity("#xD", "\r"); + parser.addEntity("#10", "\n"); + let parsedObj; + try { + parsedObj = parser.parse(encoded, true); + } catch (e) { + if (e && typeof e === "object") { + Object.defineProperty(e, "$responseBodyText", { + value: encoded + }); + } + throw e; + } + const textNodeName = "#text"; + const key = Object.keys(parsedObj)[0]; + const parsedObjToReturn = parsedObj[key]; + if (parsedObjToReturn[textNodeName]) { + parsedObjToReturn[key] = parsedObjToReturn[textNodeName]; + delete parsedObjToReturn[textNodeName]; + } + return (0, import_smithy_client3.getValueFromTextNode)(parsedObjToReturn); + } + return {}; +}), "parseXmlBody"); +var parseXmlErrorBody = /* @__PURE__ */ __name(async (errorBody, context) => { + const value = await parseXmlBody(errorBody, context); + if (value.Error) { + value.Error.message = value.Error.message ?? value.Error.Message; + } + return value; +}, "parseXmlErrorBody"); +var loadRestXmlErrorCode = /* @__PURE__ */ __name((output, data) => { + var _a; + if (((_a = data == null ? void 0 : data.Error) == null ? void 0 : _a.Code) !== void 0) { + return data.Error.Code; + } + if ((data == null ? void 0 : data.Code) !== void 0) { + return data.Code; + } + if (output.statusCode == 404) { + return "NotFound"; + } +}, "loadRestXmlErrorCode"); +// Annotate the CommonJS export names for ESM import in node: +0 && (0); + + +/***/ }), + +/***/ 15972: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + ENV_CREDENTIAL_SCOPE: () => ENV_CREDENTIAL_SCOPE, + ENV_EXPIRATION: () => ENV_EXPIRATION, + ENV_KEY: () => ENV_KEY, + ENV_SECRET: () => ENV_SECRET, + ENV_SESSION: () => ENV_SESSION, + fromEnv: () => fromEnv +}); +module.exports = __toCommonJS(src_exports); + +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(79721); +var ENV_KEY = "AWS_ACCESS_KEY_ID"; +var ENV_SECRET = "AWS_SECRET_ACCESS_KEY"; +var ENV_SESSION = "AWS_SESSION_TOKEN"; +var ENV_EXPIRATION = "AWS_CREDENTIAL_EXPIRATION"; +var ENV_CREDENTIAL_SCOPE = "AWS_CREDENTIAL_SCOPE"; +var fromEnv = /* @__PURE__ */ __name((init) => async () => { + var _a; + (_a = init == null ? void 0 : init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-env - fromEnv"); + const accessKeyId = process.env[ENV_KEY]; + const secretAccessKey = process.env[ENV_SECRET]; + const sessionToken = process.env[ENV_SESSION]; + const expiry = process.env[ENV_EXPIRATION]; + const credentialScope = process.env[ENV_CREDENTIAL_SCOPE]; + if (accessKeyId && secretAccessKey) { + return { + accessKeyId, + secretAccessKey, + ...sessionToken && { sessionToken }, + ...expiry && { expiration: new Date(expiry) }, + ...credentialScope && { credentialScope } + }; + } + throw new import_property_provider.CredentialsProviderError("Unable to find environment variable credentials.", { logger: init == null ? void 0 : init.logger }); +}, "fromEnv"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 10383: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.checkUrl = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const LOOPBACK_CIDR_IPv4 = "127.0.0.0/8"; +const LOOPBACK_CIDR_IPv6 = "::1/128"; +const ECS_CONTAINER_HOST = "169.254.170.2"; +const EKS_CONTAINER_HOST_IPv4 = "169.254.170.23"; +const EKS_CONTAINER_HOST_IPv6 = "[fd00:ec2::23]"; +const checkUrl = (url, logger) => { + if (url.protocol === "https:") { + return; + } + if (url.hostname === ECS_CONTAINER_HOST || + url.hostname === EKS_CONTAINER_HOST_IPv4 || + url.hostname === EKS_CONTAINER_HOST_IPv6) { + return; + } + if (url.hostname.includes("[")) { + if (url.hostname === "[::1]" || url.hostname === "[0000:0000:0000:0000:0000:0000:0000:0001]") { + return; + } + } + else { + if (url.hostname === "localhost") { + return; + } + const ipComponents = url.hostname.split("."); + const inRange = (component) => { + const num = parseInt(component, 10); + return 0 <= num && num <= 255; + }; + if (ipComponents[0] === "127" && + inRange(ipComponents[1]) && + inRange(ipComponents[2]) && + inRange(ipComponents[3]) && + ipComponents.length === 4) { + return; + } + } + throw new property_provider_1.CredentialsProviderError(`URL not accepted. It must either be HTTPS or match one of the following: + - loopback CIDR 127.0.0.0/8 or [::1/128] + - ECS container host 169.254.170.2 + - EKS container host 169.254.170.23 or [fd00:ec2::23]`, { logger }); +}; +exports.checkUrl = checkUrl; + + +/***/ }), + +/***/ 56070: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromHttp = void 0; +const tslib_1 = __nccwpck_require__(4351); +const node_http_handler_1 = __nccwpck_require__(20258); +const property_provider_1 = __nccwpck_require__(79721); +const promises_1 = tslib_1.__importDefault(__nccwpck_require__(73292)); +const checkUrl_1 = __nccwpck_require__(10383); +const requestHelpers_1 = __nccwpck_require__(79287); +const retry_wrapper_1 = __nccwpck_require__(79921); +const AWS_CONTAINER_CREDENTIALS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +const DEFAULT_LINK_LOCAL_HOST = "http://169.254.170.2"; +const AWS_CONTAINER_CREDENTIALS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +const AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE = "AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE"; +const AWS_CONTAINER_AUTHORIZATION_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +const fromHttp = (options = {}) => { + options.logger?.debug("@aws-sdk/credential-provider-http - fromHttp"); + let host; + const relative = options.awsContainerCredentialsRelativeUri ?? process.env[AWS_CONTAINER_CREDENTIALS_RELATIVE_URI]; + const full = options.awsContainerCredentialsFullUri ?? process.env[AWS_CONTAINER_CREDENTIALS_FULL_URI]; + const token = options.awsContainerAuthorizationToken ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN]; + const tokenFile = options.awsContainerAuthorizationTokenFile ?? process.env[AWS_CONTAINER_AUTHORIZATION_TOKEN_FILE]; + const warn = options.logger?.constructor?.name === "NoOpLogger" || !options.logger ? console.warn : options.logger.warn; + if (relative && full) { + warn("@aws-sdk/credential-provider-http: " + + "you have set both awsContainerCredentialsRelativeUri and awsContainerCredentialsFullUri."); + warn("awsContainerCredentialsFullUri will take precedence."); + } + if (token && tokenFile) { + warn("@aws-sdk/credential-provider-http: " + + "you have set both awsContainerAuthorizationToken and awsContainerAuthorizationTokenFile."); + warn("awsContainerAuthorizationToken will take precedence."); + } + if (full) { + host = full; + } + else if (relative) { + host = `${DEFAULT_LINK_LOCAL_HOST}${relative}`; + } + else { + throw new property_provider_1.CredentialsProviderError(`No HTTP credential provider host provided. +Set AWS_CONTAINER_CREDENTIALS_FULL_URI or AWS_CONTAINER_CREDENTIALS_RELATIVE_URI.`, { logger: options.logger }); + } + const url = new URL(host); + (0, checkUrl_1.checkUrl)(url, options.logger); + const requestHandler = new node_http_handler_1.NodeHttpHandler({ + requestTimeout: options.timeout ?? 1000, + connectionTimeout: options.timeout ?? 1000, + }); + return (0, retry_wrapper_1.retryWrapper)(async () => { + const request = (0, requestHelpers_1.createGetRequest)(url); + if (token) { + request.headers.Authorization = token; + } + else if (tokenFile) { + request.headers.Authorization = (await promises_1.default.readFile(tokenFile)).toString(); + } + try { + const result = await requestHandler.handle(request); + return (0, requestHelpers_1.getCredentials)(result.response); + } + catch (e) { + throw new property_provider_1.CredentialsProviderError(String(e), { logger: options.logger }); + } + }, options.maxRetries ?? 3, options.timeout ?? 1000); +}; +exports.fromHttp = fromHttp; + + +/***/ }), + +/***/ 79287: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getCredentials = exports.createGetRequest = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const protocol_http_1 = __nccwpck_require__(64418); +const smithy_client_1 = __nccwpck_require__(63570); +const util_stream_1 = __nccwpck_require__(96607); +function createGetRequest(url) { + return new protocol_http_1.HttpRequest({ + protocol: url.protocol, + hostname: url.hostname, + port: Number(url.port), + path: url.pathname, + query: Array.from(url.searchParams.entries()).reduce((acc, [k, v]) => { + acc[k] = v; + return acc; + }, {}), + fragment: url.hash, + }); +} +exports.createGetRequest = createGetRequest; +async function getCredentials(response, logger) { + const stream = (0, util_stream_1.sdkStreamMixin)(response.body); + const str = await stream.transformToString(); + if (response.statusCode === 200) { + const parsed = JSON.parse(str); + if (typeof parsed.AccessKeyId !== "string" || + typeof parsed.SecretAccessKey !== "string" || + typeof parsed.Token !== "string" || + typeof parsed.Expiration !== "string") { + throw new property_provider_1.CredentialsProviderError("HTTP credential provider response not of the required format, an object matching: " + + "{ AccessKeyId: string, SecretAccessKey: string, Token: string, Expiration: string(rfc3339) }", { logger }); + } + return { + accessKeyId: parsed.AccessKeyId, + secretAccessKey: parsed.SecretAccessKey, + sessionToken: parsed.Token, + expiration: (0, smithy_client_1.parseRfc3339DateTime)(parsed.Expiration), + }; + } + if (response.statusCode >= 400 && response.statusCode < 500) { + let parsedBody = {}; + try { + parsedBody = JSON.parse(str); + } + catch (e) { } + throw Object.assign(new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }), { + Code: parsedBody.Code, + Message: parsedBody.Message, + }); + } + throw new property_provider_1.CredentialsProviderError(`Server responded with status: ${response.statusCode}`, { logger }); +} +exports.getCredentials = getCredentials; + + +/***/ }), + +/***/ 79921: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.retryWrapper = void 0; +const retryWrapper = (toRetry, maxRetries, delayMs) => { + return async () => { + for (let i = 0; i < maxRetries; ++i) { + try { + return await toRetry(); + } + catch (e) { + await new Promise((resolve) => setTimeout(resolve, delayMs)); + } + } + return await toRetry(); + }; +}; +exports.retryWrapper = retryWrapper; + + +/***/ }), + +/***/ 17290: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromHttp = void 0; +var fromHttp_1 = __nccwpck_require__(56070); +Object.defineProperty(exports, "fromHttp", ({ enumerable: true, get: function () { return fromHttp_1.fromHttp; } })); + + +/***/ }), + +/***/ 74203: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromIni: () => fromIni +}); +module.exports = __toCommonJS(src_exports); + +// src/fromIni.ts + + +// src/resolveProfileData.ts + + +// src/resolveAssumeRoleCredentials.ts + +var import_shared_ini_file_loader = __nccwpck_require__(43507); + +// src/resolveCredentialSource.ts +var import_property_provider = __nccwpck_require__(79721); +var resolveCredentialSource = /* @__PURE__ */ __name((credentialSource, profileName, logger) => { + const sourceProvidersMap = { + EcsContainer: async (options) => { + const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(17290))); + const { fromContainerMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(7477))); + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is EcsContainer"); + return (0, import_property_provider.chain)(fromHttp(options ?? {}), fromContainerMetadata(options)); + }, + Ec2InstanceMetadata: async (options) => { + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Ec2InstanceMetadata"); + const { fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(7477))); + return fromInstanceMetadata(options); + }, + Environment: async (options) => { + logger == null ? void 0 : logger.debug("@aws-sdk/credential-provider-ini - credential_source is Environment"); + const { fromEnv } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(15972))); + return fromEnv(options); + } + }; + if (credentialSource in sourceProvidersMap) { + return sourceProvidersMap[credentialSource]; + } else { + throw new import_property_provider.CredentialsProviderError( + `Unsupported credential source in profile ${profileName}. Got ${credentialSource}, expected EcsContainer or Ec2InstanceMetadata or Environment.`, + { logger } + ); + } +}, "resolveCredentialSource"); + +// src/resolveAssumeRoleCredentials.ts +var isAssumeRoleProfile = /* @__PURE__ */ __name((arg, { profile = "default", logger } = {}) => { + return Boolean(arg) && typeof arg === "object" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1 && ["undefined", "string"].indexOf(typeof arg.external_id) > -1 && ["undefined", "string"].indexOf(typeof arg.mfa_serial) > -1 && (isAssumeRoleWithSourceProfile(arg, { profile, logger }) || isCredentialSourceProfile(arg, { profile, logger })); +}, "isAssumeRoleProfile"); +var isAssumeRoleWithSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { + var _a; + const withSourceProfile = typeof arg.source_profile === "string" && typeof arg.credential_source === "undefined"; + if (withSourceProfile) { + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, ` ${profile} isAssumeRoleWithSourceProfile source_profile=${arg.source_profile}`); + } + return withSourceProfile; +}, "isAssumeRoleWithSourceProfile"); +var isCredentialSourceProfile = /* @__PURE__ */ __name((arg, { profile, logger }) => { + var _a; + const withProviderProfile = typeof arg.credential_source === "string" && typeof arg.source_profile === "undefined"; + if (withProviderProfile) { + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, ` ${profile} isCredentialSourceProfile credential_source=${arg.credential_source}`); + } + return withProviderProfile; +}, "isCredentialSourceProfile"); +var resolveAssumeRoleCredentials = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { + var _a, _b; + (_a = options.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - resolveAssumeRoleCredentials (STS)"); + const data = profiles[profileName]; + if (!options.roleAssumer) { + const { getDefaultRoleAssumer } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(52209))); + options.roleAssumer = getDefaultRoleAssumer( + { + ...options.clientConfig, + credentialProviderLogger: options.logger, + parentClientConfig: options == null ? void 0 : options.parentClientConfig + }, + options.clientPlugins + ); + } + const { source_profile } = data; + if (source_profile && source_profile in visitedProfiles) { + throw new import_property_provider.CredentialsProviderError( + `Detected a cycle attempting to resolve credentials for profile ${(0, import_shared_ini_file_loader.getProfileName)(options)}. Profiles visited: ` + Object.keys(visitedProfiles).join(", "), + { logger: options.logger } + ); + } + (_b = options.logger) == null ? void 0 : _b.debug( + `@aws-sdk/credential-provider-ini - finding credential resolver using ${source_profile ? `source_profile=[${source_profile}]` : `profile=[${profileName}]`}` + ); + const sourceCredsProvider = source_profile ? resolveProfileData( + source_profile, + { + ...profiles, + [source_profile]: { + ...profiles[source_profile], + // This assigns the role_arn of the "root" profile + // to the credential_source profile so this recursive call knows + // what role to assume. + role_arn: data.role_arn ?? profiles[source_profile].role_arn + } + }, + options, + { + ...visitedProfiles, + [source_profile]: true + } + ) : (await resolveCredentialSource(data.credential_source, profileName, options.logger)(options))(); + const params = { + RoleArn: data.role_arn, + RoleSessionName: data.role_session_name || `aws-sdk-js-${Date.now()}`, + ExternalId: data.external_id, + DurationSeconds: parseInt(data.duration_seconds || "3600", 10) + }; + const { mfa_serial } = data; + if (mfa_serial) { + if (!options.mfaCodeProvider) { + throw new import_property_provider.CredentialsProviderError( + `Profile ${profileName} requires multi-factor authentication, but no MFA code callback was provided.`, + { logger: options.logger, tryNextLink: false } + ); + } + params.SerialNumber = mfa_serial; + params.TokenCode = await options.mfaCodeProvider(mfa_serial); + } + const sourceCreds = await sourceCredsProvider; + return options.roleAssumer(sourceCreds, params); +}, "resolveAssumeRoleCredentials"); + +// src/resolveProcessCredentials.ts +var isProcessProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.credential_process === "string", "isProcessProfile"); +var resolveProcessCredentials = /* @__PURE__ */ __name(async (options, profile) => Promise.resolve().then(() => __toESM(__nccwpck_require__(89969))).then( + ({ fromProcess }) => fromProcess({ + ...options, + profile + })() +), "resolveProcessCredentials"); + +// src/resolveSsoCredentials.ts +var resolveSsoCredentials = /* @__PURE__ */ __name(async (profile, options = {}) => { + const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(26414))); + return fromSSO({ + profile, + logger: options.logger + })(); +}, "resolveSsoCredentials"); +var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); + +// src/resolveStaticCredentials.ts +var isStaticCredsProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.aws_access_key_id === "string" && typeof arg.aws_secret_access_key === "string" && ["undefined", "string"].indexOf(typeof arg.aws_session_token) > -1, "isStaticCredsProfile"); +var resolveStaticCredentials = /* @__PURE__ */ __name((profile, options) => { + var _a; + (_a = options == null ? void 0 : options.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - resolveStaticCredentials"); + return Promise.resolve({ + accessKeyId: profile.aws_access_key_id, + secretAccessKey: profile.aws_secret_access_key, + sessionToken: profile.aws_session_token, + credentialScope: profile.aws_credential_scope + }); +}, "resolveStaticCredentials"); + +// src/resolveWebIdentityCredentials.ts +var isWebIdentityProfile = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.web_identity_token_file === "string" && typeof arg.role_arn === "string" && ["undefined", "string"].indexOf(typeof arg.role_session_name) > -1, "isWebIdentityProfile"); +var resolveWebIdentityCredentials = /* @__PURE__ */ __name(async (profile, options) => Promise.resolve().then(() => __toESM(__nccwpck_require__(15646))).then( + ({ fromTokenFile }) => fromTokenFile({ + webIdentityTokenFile: profile.web_identity_token_file, + roleArn: profile.role_arn, + roleSessionName: profile.role_session_name, + roleAssumerWithWebIdentity: options.roleAssumerWithWebIdentity, + logger: options.logger, + parentClientConfig: options.parentClientConfig + })() +), "resolveWebIdentityCredentials"); + +// src/resolveProfileData.ts +var resolveProfileData = /* @__PURE__ */ __name(async (profileName, profiles, options, visitedProfiles = {}) => { + const data = profiles[profileName]; + if (Object.keys(visitedProfiles).length > 0 && isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isAssumeRoleProfile(data, { profile: profileName, logger: options.logger })) { + return resolveAssumeRoleCredentials(profileName, profiles, options, visitedProfiles); + } + if (isStaticCredsProfile(data)) { + return resolveStaticCredentials(data, options); + } + if (isWebIdentityProfile(data)) { + return resolveWebIdentityCredentials(data, options); + } + if (isProcessProfile(data)) { + return resolveProcessCredentials(options, profileName); + } + if (isSsoProfile(data)) { + return await resolveSsoCredentials(profileName, options); + } + throw new import_property_provider.CredentialsProviderError( + `Could not resolve credentials using profile: [${profileName}] in configuration/credentials file(s).`, + { logger: options.logger } + ); +}, "resolveProfileData"); + +// src/fromIni.ts +var fromIni = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-ini - fromIni"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + return resolveProfileData((0, import_shared_ini_file_loader.getProfileName)(init), profiles, init); +}, "fromIni"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 75531: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + credentialsTreatedAsExpired: () => credentialsTreatedAsExpired, + credentialsWillNeedRefresh: () => credentialsWillNeedRefresh, + defaultProvider: () => defaultProvider +}); +module.exports = __toCommonJS(src_exports); + +// src/defaultProvider.ts +var import_credential_provider_env = __nccwpck_require__(15972); + +var import_shared_ini_file_loader = __nccwpck_require__(43507); + +// src/remoteProvider.ts +var import_property_provider = __nccwpck_require__(79721); +var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +var remoteProvider = /* @__PURE__ */ __name(async (init) => { + var _a, _b; + const { ENV_CMDS_FULL_URI, ENV_CMDS_RELATIVE_URI, fromContainerMetadata, fromInstanceMetadata } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(7477))); + if (process.env[ENV_CMDS_RELATIVE_URI] || process.env[ENV_CMDS_FULL_URI]) { + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - remoteProvider::fromHttp/fromContainerMetadata"); + const { fromHttp } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(17290))); + return (0, import_property_provider.chain)(fromHttp(init), fromContainerMetadata(init)); + } + if (process.env[ENV_IMDS_DISABLED]) { + return async () => { + throw new import_property_provider.CredentialsProviderError("EC2 Instance Metadata Service access disabled", { logger: init.logger }); + }; + } + (_b = init.logger) == null ? void 0 : _b.debug("@aws-sdk/credential-provider-node - remoteProvider::fromInstanceMetadata"); + return fromInstanceMetadata(init); +}, "remoteProvider"); + +// src/defaultProvider.ts +var defaultProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + ...init.profile || process.env[import_shared_ini_file_loader.ENV_PROFILE] ? [] : [ + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromEnv"); + return (0, import_credential_provider_env.fromEnv)(init)(); + } + ], + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + throw new import_property_provider.CredentialsProviderError( + "Skipping SSO provider in default chain (inputs do not include SSO fields).", + { logger: init.logger } + ); + } + const { fromSSO } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(26414))); + return fromSSO(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromIni"); + const { fromIni } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(74203))); + return fromIni(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromProcess"); + const { fromProcess } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(89969))); + return fromProcess(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::fromTokenFile"); + const { fromTokenFile } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(15646))); + return fromTokenFile(init)(); + }, + async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-node - defaultProvider::remoteProvider"); + return (await remoteProvider(init))(); + }, + async () => { + throw new import_property_provider.CredentialsProviderError("Could not load credentials from any providers", { + tryNextLink: false, + logger: init.logger + }); + } + ), + credentialsTreatedAsExpired, + credentialsWillNeedRefresh +), "defaultProvider"); +var credentialsWillNeedRefresh = /* @__PURE__ */ __name((credentials) => (credentials == null ? void 0 : credentials.expiration) !== void 0, "credentialsWillNeedRefresh"); +var credentialsTreatedAsExpired = /* @__PURE__ */ __name((credentials) => (credentials == null ? void 0 : credentials.expiration) !== void 0 && credentials.expiration.getTime() - Date.now() < 3e5, "credentialsTreatedAsExpired"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 89969: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromProcess: () => fromProcess +}); +module.exports = __toCommonJS(src_exports); + +// src/fromProcess.ts +var import_shared_ini_file_loader = __nccwpck_require__(43507); + +// src/resolveProcessCredentials.ts +var import_property_provider = __nccwpck_require__(79721); +var import_child_process = __nccwpck_require__(32081); +var import_util = __nccwpck_require__(73837); + +// src/getValidatedProcessCredentials.ts +var getValidatedProcessCredentials = /* @__PURE__ */ __name((profileName, data) => { + if (data.Version !== 1) { + throw Error(`Profile ${profileName} credential_process did not return Version 1.`); + } + if (data.AccessKeyId === void 0 || data.SecretAccessKey === void 0) { + throw Error(`Profile ${profileName} credential_process returned invalid credentials.`); + } + if (data.Expiration) { + const currentTime = /* @__PURE__ */ new Date(); + const expireTime = new Date(data.Expiration); + if (expireTime < currentTime) { + throw Error(`Profile ${profileName} credential_process returned expired credentials.`); + } + } + return { + accessKeyId: data.AccessKeyId, + secretAccessKey: data.SecretAccessKey, + ...data.SessionToken && { sessionToken: data.SessionToken }, + ...data.Expiration && { expiration: new Date(data.Expiration) }, + ...data.CredentialScope && { credentialScope: data.CredentialScope } + }; +}, "getValidatedProcessCredentials"); + +// src/resolveProcessCredentials.ts +var resolveProcessCredentials = /* @__PURE__ */ __name(async (profileName, profiles, logger) => { + const profile = profiles[profileName]; + if (profiles[profileName]) { + const credentialProcess = profile["credential_process"]; + if (credentialProcess !== void 0) { + const execPromise = (0, import_util.promisify)(import_child_process.exec); + try { + const { stdout } = await execPromise(credentialProcess); + let data; + try { + data = JSON.parse(stdout.trim()); + } catch { + throw Error(`Profile ${profileName} credential_process returned invalid JSON.`); + } + return getValidatedProcessCredentials(profileName, data); + } catch (error) { + throw new import_property_provider.CredentialsProviderError(error.message, { logger }); + } + } else { + throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} did not contain credential_process.`, { logger }); + } + } else { + throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} could not be found in shared credentials file.`, { + logger + }); + } +}, "resolveProcessCredentials"); + +// src/fromProcess.ts +var fromProcess = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-process - fromProcess"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + return resolveProcessCredentials((0, import_shared_ini_file_loader.getProfileName)(init), profiles, init.logger); +}, "fromProcess"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 26414: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __esm = (fn, res) => function __init() { + return fn && (res = (0, fn[__getOwnPropNames(fn)[0]])(fn = 0)), res; +}; +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/loadSso.ts +var loadSso_exports = {}; +__export(loadSso_exports, { + GetRoleCredentialsCommand: () => import_client_sso.GetRoleCredentialsCommand, + SSOClient: () => import_client_sso.SSOClient +}); +var import_client_sso; +var init_loadSso = __esm({ + "src/loadSso.ts"() { + "use strict"; + import_client_sso = __nccwpck_require__(82666); + } +}); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromSSO: () => fromSSO, + isSsoProfile: () => isSsoProfile, + validateSsoProfile: () => validateSsoProfile +}); +module.exports = __toCommonJS(src_exports); + +// src/fromSSO.ts + + + +// src/isSsoProfile.ts +var isSsoProfile = /* @__PURE__ */ __name((arg) => arg && (typeof arg.sso_start_url === "string" || typeof arg.sso_account_id === "string" || typeof arg.sso_session === "string" || typeof arg.sso_region === "string" || typeof arg.sso_role_name === "string"), "isSsoProfile"); + +// src/resolveSSOCredentials.ts +var import_token_providers = __nccwpck_require__(52843); +var import_property_provider = __nccwpck_require__(79721); +var import_shared_ini_file_loader = __nccwpck_require__(43507); +var SHOULD_FAIL_CREDENTIAL_CHAIN = false; +var resolveSSOCredentials = /* @__PURE__ */ __name(async ({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + clientConfig, + profile, + logger +}) => { + let token; + const refreshMessage = `To refresh this SSO session run aws sso login with the corresponding profile.`; + if (ssoSession) { + try { + const _token = await (0, import_token_providers.fromSso)({ profile })(); + token = { + accessToken: _token.token, + expiresAt: new Date(_token.expiration).toISOString() + }; + } catch (e) { + throw new import_property_provider.CredentialsProviderError(e.message, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); + } + } else { + try { + token = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoStartUrl); + } catch (e) { + throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile is invalid. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); + } + } + if (new Date(token.expiresAt).getTime() - Date.now() <= 0) { + throw new import_property_provider.CredentialsProviderError(`The SSO session associated with this profile has expired. ${refreshMessage}`, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); + } + const { accessToken } = token; + const { SSOClient: SSOClient2, GetRoleCredentialsCommand: GetRoleCredentialsCommand2 } = await Promise.resolve().then(() => (init_loadSso(), loadSso_exports)); + const sso = ssoClient || new SSOClient2( + Object.assign({}, clientConfig ?? {}, { + region: (clientConfig == null ? void 0 : clientConfig.region) ?? ssoRegion + }) + ); + let ssoResp; + try { + ssoResp = await sso.send( + new GetRoleCredentialsCommand2({ + accountId: ssoAccountId, + roleName: ssoRoleName, + accessToken + }) + ); + } catch (e) { + throw new import_property_provider.CredentialsProviderError(e, { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); + } + const { roleCredentials: { accessKeyId, secretAccessKey, sessionToken, expiration, credentialScope } = {} } = ssoResp; + if (!accessKeyId || !secretAccessKey || !sessionToken || !expiration) { + throw new import_property_provider.CredentialsProviderError("SSO returns an invalid temporary credential.", { + tryNextLink: SHOULD_FAIL_CREDENTIAL_CHAIN, + logger + }); + } + return { accessKeyId, secretAccessKey, sessionToken, expiration: new Date(expiration), credentialScope }; +}, "resolveSSOCredentials"); + +// src/validateSsoProfile.ts + +var validateSsoProfile = /* @__PURE__ */ __name((profile, logger) => { + const { sso_start_url, sso_account_id, sso_region, sso_role_name } = profile; + if (!sso_start_url || !sso_account_id || !sso_region || !sso_role_name) { + throw new import_property_provider.CredentialsProviderError( + `Profile is configured with invalid SSO credentials. Required parameters "sso_account_id", "sso_region", "sso_role_name", "sso_start_url". Got ${Object.keys(profile).join( + ", " + )} +Reference: https://docs.aws.amazon.com/cli/latest/userguide/cli-configure-sso.html`, + { tryNextLink: false, logger } + ); + } + return profile; +}, "validateSsoProfile"); + +// src/fromSSO.ts +var fromSSO = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/credential-provider-sso - fromSSO"); + const { ssoStartUrl, ssoAccountId, ssoRegion, ssoRoleName, ssoSession } = init; + const { ssoClient } = init; + const profileName = (0, import_shared_ini_file_loader.getProfileName)(init); + if (!ssoStartUrl && !ssoAccountId && !ssoRegion && !ssoRoleName && !ssoSession) { + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} was not found.`, { logger: init.logger }); + } + if (!isSsoProfile(profile)) { + throw new import_property_provider.CredentialsProviderError(`Profile ${profileName} is not configured with SSO credentials.`, { + logger: init.logger + }); + } + if (profile == null ? void 0 : profile.sso_session) { + const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); + const session = ssoSessions[profile.sso_session]; + const conflictMsg = ` configurations in profile ${profileName} and sso-session ${profile.sso_session}`; + if (ssoRegion && ssoRegion !== session.sso_region) { + throw new import_property_provider.CredentialsProviderError(`Conflicting SSO region` + conflictMsg, { + tryNextLink: false, + logger: init.logger + }); + } + if (ssoStartUrl && ssoStartUrl !== session.sso_start_url) { + throw new import_property_provider.CredentialsProviderError(`Conflicting SSO start_url` + conflictMsg, { + tryNextLink: false, + logger: init.logger + }); + } + profile.sso_region = session.sso_region; + profile.sso_start_url = session.sso_start_url; + } + const { sso_start_url, sso_account_id, sso_region, sso_role_name, sso_session } = validateSsoProfile( + profile, + init.logger + ); + return resolveSSOCredentials({ + ssoStartUrl: sso_start_url, + ssoSession: sso_session, + ssoAccountId: sso_account_id, + ssoRegion: sso_region, + ssoRoleName: sso_role_name, + ssoClient, + clientConfig: init.clientConfig, + profile: profileName + }); + } else if (!ssoStartUrl || !ssoAccountId || !ssoRegion || !ssoRoleName) { + throw new import_property_provider.CredentialsProviderError( + 'Incomplete configuration. The fromSSO() argument hash must include "ssoStartUrl", "ssoAccountId", "ssoRegion", "ssoRoleName"', + { tryNextLink: false, logger: init.logger } + ); + } else { + return resolveSSOCredentials({ + ssoStartUrl, + ssoSession, + ssoAccountId, + ssoRegion, + ssoRoleName, + ssoClient, + clientConfig: init.clientConfig, + profile: profileName + }); + } +}, "fromSSO"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 35614: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromTokenFile = void 0; +const property_provider_1 = __nccwpck_require__(79721); +const fs_1 = __nccwpck_require__(57147); +const fromWebToken_1 = __nccwpck_require__(47905); +const ENV_TOKEN_FILE = "AWS_WEB_IDENTITY_TOKEN_FILE"; +const ENV_ROLE_ARN = "AWS_ROLE_ARN"; +const ENV_ROLE_SESSION_NAME = "AWS_ROLE_SESSION_NAME"; +const fromTokenFile = (init = {}) => async () => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromTokenFile"); + const webIdentityTokenFile = init?.webIdentityTokenFile ?? process.env[ENV_TOKEN_FILE]; + const roleArn = init?.roleArn ?? process.env[ENV_ROLE_ARN]; + const roleSessionName = init?.roleSessionName ?? process.env[ENV_ROLE_SESSION_NAME]; + if (!webIdentityTokenFile || !roleArn) { + throw new property_provider_1.CredentialsProviderError("Web identity configuration not specified", { + logger: init.logger, + }); + } + return (0, fromWebToken_1.fromWebToken)({ + ...init, + webIdentityToken: (0, fs_1.readFileSync)(webIdentityTokenFile, { encoding: "ascii" }), + roleArn, + roleSessionName, + })(); +}; +exports.fromTokenFile = fromTokenFile; + + +/***/ }), + +/***/ 47905: +/***/ (function(__unused_webpack_module, exports, __nccwpck_require__) { + +"use strict"; + +var __createBinding = (this && this.__createBinding) || (Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); +}) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; +})); +var __setModuleDefault = (this && this.__setModuleDefault) || (Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); +}) : function(o, v) { + o["default"] = v; +}); +var __importStar = (this && this.__importStar) || function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; +}; +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromWebToken = void 0; +const fromWebToken = (init) => async () => { + init.logger?.debug("@aws-sdk/credential-provider-web-identity - fromWebToken"); + const { roleArn, roleSessionName, webIdentityToken, providerId, policyArns, policy, durationSeconds } = init; + let { roleAssumerWithWebIdentity } = init; + if (!roleAssumerWithWebIdentity) { + const { getDefaultRoleAssumerWithWebIdentity } = await Promise.resolve().then(() => __importStar(__nccwpck_require__(52209))); + roleAssumerWithWebIdentity = getDefaultRoleAssumerWithWebIdentity({ + ...init.clientConfig, + credentialProviderLogger: init.logger, + parentClientConfig: init.parentClientConfig, + }, init.clientPlugins); + } + return roleAssumerWithWebIdentity({ + RoleArn: roleArn, + RoleSessionName: roleSessionName ?? `aws-sdk-js-session-${Date.now()}`, + WebIdentityToken: webIdentityToken, + ProviderId: providerId, + PolicyArns: policyArns, + Policy: policy, + DurationSeconds: durationSeconds, + }); +}; +exports.fromWebToken = fromWebToken; + + +/***/ }), + +/***/ 15646: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(35614), module.exports); +__reExport(src_exports, __nccwpck_require__(47905), module.exports); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 22545: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + getHostHeaderPlugin: () => getHostHeaderPlugin, + hostHeaderMiddleware: () => hostHeaderMiddleware, + hostHeaderMiddlewareOptions: () => hostHeaderMiddlewareOptions, + resolveHostHeaderConfig: () => resolveHostHeaderConfig +}); +module.exports = __toCommonJS(src_exports); +var import_protocol_http = __nccwpck_require__(64418); +function resolveHostHeaderConfig(input) { + return input; +} +__name(resolveHostHeaderConfig, "resolveHostHeaderConfig"); +var hostHeaderMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) + return next(args); + const { request } = args; + const { handlerProtocol = "" } = options.requestHandler.metadata || {}; + if (handlerProtocol.indexOf("h2") >= 0 && !request.headers[":authority"]) { + delete request.headers["host"]; + request.headers[":authority"] = request.hostname + (request.port ? ":" + request.port : ""); + } else if (!request.headers["host"]) { + let host = request.hostname; + if (request.port != null) + host += `:${request.port}`; + request.headers["host"] = host; + } + return next(args); +}, "hostHeaderMiddleware"); +var hostHeaderMiddlewareOptions = { + name: "hostHeaderMiddleware", + step: "build", + priority: "low", + tags: ["HOST"], + override: true +}; +var getHostHeaderPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(hostHeaderMiddleware(options), hostHeaderMiddlewareOptions); + } +}), "getHostHeaderPlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 17415: +/***/ ((module) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + getLoggerPlugin: () => getLoggerPlugin, + loggerMiddleware: () => loggerMiddleware, + loggerMiddlewareOptions: () => loggerMiddlewareOptions +}); +module.exports = __toCommonJS(src_exports); + +// src/loggerMiddleware.ts +var loggerMiddleware = /* @__PURE__ */ __name(() => (next, context) => async (args) => { + var _a, _b; + try { + const response = await next(args); + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog, overrideOutputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + const outputFilterSensitiveLog = overrideOutputFilterSensitiveLog ?? context.outputFilterSensitiveLog; + const { $metadata, ...outputWithoutMetadata } = response.output; + (_a = logger == null ? void 0 : logger.info) == null ? void 0 : _a.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + output: outputFilterSensitiveLog(outputWithoutMetadata), + metadata: $metadata + }); + return response; + } catch (error) { + const { clientName, commandName, logger, dynamoDbDocumentClientOptions = {} } = context; + const { overrideInputFilterSensitiveLog } = dynamoDbDocumentClientOptions; + const inputFilterSensitiveLog = overrideInputFilterSensitiveLog ?? context.inputFilterSensitiveLog; + (_b = logger == null ? void 0 : logger.error) == null ? void 0 : _b.call(logger, { + clientName, + commandName, + input: inputFilterSensitiveLog(args.input), + error, + metadata: error.$metadata + }); + throw error; + } +}, "loggerMiddleware"); +var loggerMiddlewareOptions = { + name: "loggerMiddleware", + tags: ["LOGGER"], + step: "initialize", + override: true +}; +var getLoggerPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(loggerMiddleware(), loggerMiddlewareOptions); + } +}), "getLoggerPlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 85525: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + addRecursionDetectionMiddlewareOptions: () => addRecursionDetectionMiddlewareOptions, + getRecursionDetectionPlugin: () => getRecursionDetectionPlugin, + recursionDetectionMiddleware: () => recursionDetectionMiddleware +}); +module.exports = __toCommonJS(src_exports); +var import_protocol_http = __nccwpck_require__(64418); +var TRACE_ID_HEADER_NAME = "X-Amzn-Trace-Id"; +var ENV_LAMBDA_FUNCTION_NAME = "AWS_LAMBDA_FUNCTION_NAME"; +var ENV_TRACE_ID = "_X_AMZN_TRACE_ID"; +var recursionDetectionMiddleware = /* @__PURE__ */ __name((options) => (next) => async (args) => { + const { request } = args; + if (!import_protocol_http.HttpRequest.isInstance(request) || options.runtime !== "node" || request.headers.hasOwnProperty(TRACE_ID_HEADER_NAME)) { + return next(args); + } + const functionName = process.env[ENV_LAMBDA_FUNCTION_NAME]; + const traceId = process.env[ENV_TRACE_ID]; + const nonEmptyString = /* @__PURE__ */ __name((str) => typeof str === "string" && str.length > 0, "nonEmptyString"); + if (nonEmptyString(functionName) && nonEmptyString(traceId)) { + request.headers[TRACE_ID_HEADER_NAME] = traceId; + } + return next({ + ...args, + request + }); +}, "recursionDetectionMiddleware"); +var addRecursionDetectionMiddlewareOptions = { + step: "build", + tags: ["RECURSION_DETECTION"], + name: "recursionDetectionMiddleware", + override: true, + priority: "low" +}; +var getRecursionDetectionPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(recursionDetectionMiddleware(options), addRecursionDetectionMiddlewareOptions); + } +}), "getRecursionDetectionPlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 64688: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + getUserAgentMiddlewareOptions: () => getUserAgentMiddlewareOptions, + getUserAgentPlugin: () => getUserAgentPlugin, + resolveUserAgentConfig: () => resolveUserAgentConfig, + userAgentMiddleware: () => userAgentMiddleware +}); +module.exports = __toCommonJS(src_exports); + +// src/configurations.ts +function resolveUserAgentConfig(input) { + return { + ...input, + customUserAgent: typeof input.customUserAgent === "string" ? [[input.customUserAgent]] : input.customUserAgent + }; +} +__name(resolveUserAgentConfig, "resolveUserAgentConfig"); + +// src/user-agent-middleware.ts +var import_util_endpoints = __nccwpck_require__(13350); +var import_protocol_http = __nccwpck_require__(64418); + +// src/constants.ts +var USER_AGENT = "user-agent"; +var X_AMZ_USER_AGENT = "x-amz-user-agent"; +var SPACE = " "; +var UA_NAME_SEPARATOR = "/"; +var UA_NAME_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w]/g; +var UA_VALUE_ESCAPE_REGEX = /[^\!\$\%\&\'\*\+\-\.\^\_\`\|\~\d\w\#]/g; +var UA_ESCAPE_CHAR = "-"; + +// src/user-agent-middleware.ts +var userAgentMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + var _a, _b; + const { request } = args; + if (!import_protocol_http.HttpRequest.isInstance(request)) + return next(args); + const { headers } = request; + const userAgent = ((_a = context == null ? void 0 : context.userAgent) == null ? void 0 : _a.map(escapeUserAgent)) || []; + const defaultUserAgent = (await options.defaultUserAgentProvider()).map(escapeUserAgent); + const customUserAgent = ((_b = options == null ? void 0 : options.customUserAgent) == null ? void 0 : _b.map(escapeUserAgent)) || []; + const prefix = (0, import_util_endpoints.getUserAgentPrefix)(); + const sdkUserAgentValue = (prefix ? [prefix] : []).concat([...defaultUserAgent, ...userAgent, ...customUserAgent]).join(SPACE); + const normalUAValue = [ + ...defaultUserAgent.filter((section) => section.startsWith("aws-sdk-")), + ...customUserAgent + ].join(SPACE); + if (options.runtime !== "browser") { + if (normalUAValue) { + headers[X_AMZ_USER_AGENT] = headers[X_AMZ_USER_AGENT] ? `${headers[USER_AGENT]} ${normalUAValue}` : normalUAValue; + } + headers[USER_AGENT] = sdkUserAgentValue; + } else { + headers[X_AMZ_USER_AGENT] = sdkUserAgentValue; + } + return next({ + ...args, + request + }); +}, "userAgentMiddleware"); +var escapeUserAgent = /* @__PURE__ */ __name((userAgentPair) => { + var _a; + const name = userAgentPair[0].split(UA_NAME_SEPARATOR).map((part) => part.replace(UA_NAME_ESCAPE_REGEX, UA_ESCAPE_CHAR)).join(UA_NAME_SEPARATOR); + const version = (_a = userAgentPair[1]) == null ? void 0 : _a.replace(UA_VALUE_ESCAPE_REGEX, UA_ESCAPE_CHAR); + const prefixSeparatorIndex = name.indexOf(UA_NAME_SEPARATOR); + const prefix = name.substring(0, prefixSeparatorIndex); + let uaName = name.substring(prefixSeparatorIndex + 1); + if (prefix === "api") { + uaName = uaName.toLowerCase(); + } + return [prefix, uaName, version].filter((item) => item && item.length > 0).reduce((acc, item, index) => { + switch (index) { + case 0: + return item; + case 1: + return `${acc}/${item}`; + default: + return `${acc}#${item}`; + } + }, ""); +}, "escapeUserAgent"); +var getUserAgentMiddlewareOptions = { + name: "getUserAgentMiddleware", + step: "build", + priority: "low", + tags: ["SET_USER_AGENT", "USER_AGENT"], + override: true +}; +var getUserAgentPlugin = /* @__PURE__ */ __name((config) => ({ + applyToStack: (clientStack) => { + clientStack.add(userAgentMiddleware(config), getUserAgentMiddlewareOptions); + } +}), "getUserAgentPlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 18156: +/***/ ((module) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getAwsRegionExtensionConfiguration: () => getAwsRegionExtensionConfiguration, + resolveAwsRegionExtensionConfiguration: () => resolveAwsRegionExtensionConfiguration, + resolveRegionConfig: () => resolveRegionConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/extensions/index.ts +var getAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let runtimeConfigRegion = /* @__PURE__ */ __name(async () => { + if (runtimeConfig.region === void 0) { + throw new Error("Region is missing from runtimeConfig"); + } + const region = runtimeConfig.region; + if (typeof region === "string") { + return region; + } + return region(); + }, "runtimeConfigRegion"); + return { + setRegion(region) { + runtimeConfigRegion = region; + }, + region() { + return runtimeConfigRegion; + } + }; +}, "getAwsRegionExtensionConfiguration"); +var resolveAwsRegionExtensionConfiguration = /* @__PURE__ */ __name((awsRegionExtensionConfiguration) => { + return { + region: awsRegionExtensionConfiguration.region() + }; +}, "resolveAwsRegionExtensionConfiguration"); + +// src/regionConfig/config.ts +var REGION_ENV_NAME = "AWS_REGION"; +var REGION_INI_NAME = "region"; +var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + } +}; +var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" +}; + +// src/regionConfig/isFipsRegion.ts +var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); + +// src/regionConfig/getRealRegion.ts +var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); + +// src/regionConfig/resolveRegionConfig.ts +var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return { + ...input, + region: async () => { + if (typeof region === "string") { + return getRealRegion(region); + } + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + } + }; +}, "resolveRegionConfig"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 52843: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromSso: () => fromSso, + fromStatic: () => fromStatic, + nodeProvider: () => nodeProvider +}); +module.exports = __toCommonJS(src_exports); + +// src/fromSso.ts + + + +// src/constants.ts +var EXPIRE_WINDOW_MS = 5 * 60 * 1e3; +var REFRESH_MESSAGE = `To refresh this SSO session run 'aws sso login' with the corresponding profile.`; + +// src/getSsoOidcClient.ts +var ssoOidcClientsHash = {}; +var getSsoOidcClient = /* @__PURE__ */ __name(async (ssoRegion) => { + const { SSOOIDCClient } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(54527))); + if (ssoOidcClientsHash[ssoRegion]) { + return ssoOidcClientsHash[ssoRegion]; + } + const ssoOidcClient = new SSOOIDCClient({ region: ssoRegion }); + ssoOidcClientsHash[ssoRegion] = ssoOidcClient; + return ssoOidcClient; +}, "getSsoOidcClient"); + +// src/getNewSsoOidcToken.ts +var getNewSsoOidcToken = /* @__PURE__ */ __name(async (ssoToken, ssoRegion) => { + const { CreateTokenCommand } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(54527))); + const ssoOidcClient = await getSsoOidcClient(ssoRegion); + return ssoOidcClient.send( + new CreateTokenCommand({ + clientId: ssoToken.clientId, + clientSecret: ssoToken.clientSecret, + refreshToken: ssoToken.refreshToken, + grantType: "refresh_token" + }) + ); +}, "getNewSsoOidcToken"); + +// src/validateTokenExpiry.ts +var import_property_provider = __nccwpck_require__(79721); +var validateTokenExpiry = /* @__PURE__ */ __name((token) => { + if (token.expiration && token.expiration.getTime() < Date.now()) { + throw new import_property_provider.TokenProviderError(`Token is expired. ${REFRESH_MESSAGE}`, false); + } +}, "validateTokenExpiry"); + +// src/validateTokenKey.ts + +var validateTokenKey = /* @__PURE__ */ __name((key, value, forRefresh = false) => { + if (typeof value === "undefined") { + throw new import_property_provider.TokenProviderError( + `Value not present for '${key}' in SSO Token${forRefresh ? ". Cannot refresh" : ""}. ${REFRESH_MESSAGE}`, + false + ); + } +}, "validateTokenKey"); + +// src/writeSSOTokenToFile.ts +var import_shared_ini_file_loader = __nccwpck_require__(43507); +var import_fs = __nccwpck_require__(57147); +var { writeFile } = import_fs.promises; +var writeSSOTokenToFile = /* @__PURE__ */ __name((id, ssoToken) => { + const tokenFilepath = (0, import_shared_ini_file_loader.getSSOTokenFilepath)(id); + const tokenString = JSON.stringify(ssoToken, null, 2); + return writeFile(tokenFilepath, tokenString); +}, "writeSSOTokenToFile"); + +// src/fromSso.ts +var lastRefreshAttemptTime = /* @__PURE__ */ new Date(0); +var fromSso = /* @__PURE__ */ __name((init = {}) => async () => { + var _a; + (_a = init.logger) == null ? void 0 : _a.debug("@aws-sdk/token-providers - fromSso"); + const profiles = await (0, import_shared_ini_file_loader.parseKnownFiles)(init); + const profileName = (0, import_shared_ini_file_loader.getProfileName)(init); + const profile = profiles[profileName]; + if (!profile) { + throw new import_property_provider.TokenProviderError(`Profile '${profileName}' could not be found in shared credentials file.`, false); + } else if (!profile["sso_session"]) { + throw new import_property_provider.TokenProviderError(`Profile '${profileName}' is missing required property 'sso_session'.`); + } + const ssoSessionName = profile["sso_session"]; + const ssoSessions = await (0, import_shared_ini_file_loader.loadSsoSessionData)(init); + const ssoSession = ssoSessions[ssoSessionName]; + if (!ssoSession) { + throw new import_property_provider.TokenProviderError( + `Sso session '${ssoSessionName}' could not be found in shared credentials file.`, + false + ); + } + for (const ssoSessionRequiredKey of ["sso_start_url", "sso_region"]) { + if (!ssoSession[ssoSessionRequiredKey]) { + throw new import_property_provider.TokenProviderError( + `Sso session '${ssoSessionName}' is missing required property '${ssoSessionRequiredKey}'.`, + false + ); + } + } + const ssoStartUrl = ssoSession["sso_start_url"]; + const ssoRegion = ssoSession["sso_region"]; + let ssoToken; + try { + ssoToken = await (0, import_shared_ini_file_loader.getSSOTokenFromFile)(ssoSessionName); + } catch (e) { + throw new import_property_provider.TokenProviderError( + `The SSO session token associated with profile=${profileName} was not found or is invalid. ${REFRESH_MESSAGE}`, + false + ); + } + validateTokenKey("accessToken", ssoToken.accessToken); + validateTokenKey("expiresAt", ssoToken.expiresAt); + const { accessToken, expiresAt } = ssoToken; + const existingToken = { token: accessToken, expiration: new Date(expiresAt) }; + if (existingToken.expiration.getTime() - Date.now() > EXPIRE_WINDOW_MS) { + return existingToken; + } + if (Date.now() - lastRefreshAttemptTime.getTime() < 30 * 1e3) { + validateTokenExpiry(existingToken); + return existingToken; + } + validateTokenKey("clientId", ssoToken.clientId, true); + validateTokenKey("clientSecret", ssoToken.clientSecret, true); + validateTokenKey("refreshToken", ssoToken.refreshToken, true); + try { + lastRefreshAttemptTime.setTime(Date.now()); + const newSsoOidcToken = await getNewSsoOidcToken(ssoToken, ssoRegion); + validateTokenKey("accessToken", newSsoOidcToken.accessToken); + validateTokenKey("expiresIn", newSsoOidcToken.expiresIn); + const newTokenExpiration = new Date(Date.now() + newSsoOidcToken.expiresIn * 1e3); + try { + await writeSSOTokenToFile(ssoSessionName, { + ...ssoToken, + accessToken: newSsoOidcToken.accessToken, + expiresAt: newTokenExpiration.toISOString(), + refreshToken: newSsoOidcToken.refreshToken + }); + } catch (error) { + } + return { + token: newSsoOidcToken.accessToken, + expiration: newTokenExpiration + }; + } catch (error) { + validateTokenExpiry(existingToken); + return existingToken; + } +}, "fromSso"); + +// src/fromStatic.ts + +var fromStatic = /* @__PURE__ */ __name(({ token, logger }) => async () => { + logger == null ? void 0 : logger.debug("@aws-sdk/token-providers - fromStatic"); + if (!token || !token.token) { + throw new import_property_provider.TokenProviderError(`Please pass a valid token to fromStatic`, false); + } + return token; +}, "fromStatic"); + +// src/nodeProvider.ts + +var nodeProvider = /* @__PURE__ */ __name((init = {}) => (0, import_property_provider.memoize)( + (0, import_property_provider.chain)(fromSso(init), async () => { + throw new import_property_provider.TokenProviderError("Could not load token from any providers", false); + }), + (token) => token.expiration !== void 0 && token.expiration.getTime() - Date.now() < 3e5, + (token) => token.expiration !== void 0 +), "nodeProvider"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 13350: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + ConditionObject: () => import_util_endpoints.ConditionObject, + DeprecatedObject: () => import_util_endpoints.DeprecatedObject, + EndpointError: () => import_util_endpoints.EndpointError, + EndpointObject: () => import_util_endpoints.EndpointObject, + EndpointObjectHeaders: () => import_util_endpoints.EndpointObjectHeaders, + EndpointObjectProperties: () => import_util_endpoints.EndpointObjectProperties, + EndpointParams: () => import_util_endpoints.EndpointParams, + EndpointResolverOptions: () => import_util_endpoints.EndpointResolverOptions, + EndpointRuleObject: () => import_util_endpoints.EndpointRuleObject, + ErrorRuleObject: () => import_util_endpoints.ErrorRuleObject, + EvaluateOptions: () => import_util_endpoints.EvaluateOptions, + Expression: () => import_util_endpoints.Expression, + FunctionArgv: () => import_util_endpoints.FunctionArgv, + FunctionObject: () => import_util_endpoints.FunctionObject, + FunctionReturn: () => import_util_endpoints.FunctionReturn, + ParameterObject: () => import_util_endpoints.ParameterObject, + ReferenceObject: () => import_util_endpoints.ReferenceObject, + ReferenceRecord: () => import_util_endpoints.ReferenceRecord, + RuleSetObject: () => import_util_endpoints.RuleSetObject, + RuleSetRules: () => import_util_endpoints.RuleSetRules, + TreeRuleObject: () => import_util_endpoints.TreeRuleObject, + awsEndpointFunctions: () => awsEndpointFunctions, + getUserAgentPrefix: () => getUserAgentPrefix, + isIpAddress: () => import_util_endpoints.isIpAddress, + partition: () => partition, + resolveEndpoint: () => import_util_endpoints.resolveEndpoint, + setPartitionInfo: () => setPartitionInfo, + useDefaultPartitionInfo: () => useDefaultPartitionInfo +}); +module.exports = __toCommonJS(src_exports); + +// src/aws.ts + + +// src/lib/aws/isVirtualHostableS3Bucket.ts + + +// src/lib/isIpAddress.ts +var import_util_endpoints = __nccwpck_require__(45473); + +// src/lib/aws/isVirtualHostableS3Bucket.ts +var isVirtualHostableS3Bucket = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (allowSubDomains) { + for (const label of value.split(".")) { + if (!isVirtualHostableS3Bucket(label)) { + return false; + } + } + return true; + } + if (!(0, import_util_endpoints.isValidHostLabel)(value)) { + return false; + } + if (value.length < 3 || value.length > 63) { + return false; + } + if (value !== value.toLowerCase()) { + return false; + } + if ((0, import_util_endpoints.isIpAddress)(value)) { + return false; + } + return true; +}, "isVirtualHostableS3Bucket"); + +// src/lib/aws/parseArn.ts +var parseArn = /* @__PURE__ */ __name((value) => { + const segments = value.split(":"); + if (segments.length < 6) + return null; + const [arn, partition2, service, region, accountId, ...resourceId] = segments; + if (arn !== "arn" || partition2 === "" || service === "" || resourceId[0] === "") + return null; + return { + partition: partition2, + service, + region, + accountId, + resourceId: resourceId[0].includes("/") ? resourceId[0].split("/") : resourceId + }; +}, "parseArn"); + +// src/lib/aws/partitions.json +var partitions_default = { + partitions: [{ + id: "aws", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-east-1", + name: "aws", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^(us|eu|ap|sa|ca|me|af|il)\\-\\w+\\-\\d+$", + regions: { + "af-south-1": { + description: "Africa (Cape Town)" + }, + "ap-east-1": { + description: "Asia Pacific (Hong Kong)" + }, + "ap-northeast-1": { + description: "Asia Pacific (Tokyo)" + }, + "ap-northeast-2": { + description: "Asia Pacific (Seoul)" + }, + "ap-northeast-3": { + description: "Asia Pacific (Osaka)" + }, + "ap-south-1": { + description: "Asia Pacific (Mumbai)" + }, + "ap-south-2": { + description: "Asia Pacific (Hyderabad)" + }, + "ap-southeast-1": { + description: "Asia Pacific (Singapore)" + }, + "ap-southeast-2": { + description: "Asia Pacific (Sydney)" + }, + "ap-southeast-3": { + description: "Asia Pacific (Jakarta)" + }, + "ap-southeast-4": { + description: "Asia Pacific (Melbourne)" + }, + "aws-global": { + description: "AWS Standard global region" + }, + "ca-central-1": { + description: "Canada (Central)" + }, + "ca-west-1": { + description: "Canada West (Calgary)" + }, + "eu-central-1": { + description: "Europe (Frankfurt)" + }, + "eu-central-2": { + description: "Europe (Zurich)" + }, + "eu-north-1": { + description: "Europe (Stockholm)" + }, + "eu-south-1": { + description: "Europe (Milan)" + }, + "eu-south-2": { + description: "Europe (Spain)" + }, + "eu-west-1": { + description: "Europe (Ireland)" + }, + "eu-west-2": { + description: "Europe (London)" + }, + "eu-west-3": { + description: "Europe (Paris)" + }, + "il-central-1": { + description: "Israel (Tel Aviv)" + }, + "me-central-1": { + description: "Middle East (UAE)" + }, + "me-south-1": { + description: "Middle East (Bahrain)" + }, + "sa-east-1": { + description: "South America (Sao Paulo)" + }, + "us-east-1": { + description: "US East (N. Virginia)" + }, + "us-east-2": { + description: "US East (Ohio)" + }, + "us-west-1": { + description: "US West (N. California)" + }, + "us-west-2": { + description: "US West (Oregon)" + } + } + }, { + id: "aws-cn", + outputs: { + dnsSuffix: "amazonaws.com.cn", + dualStackDnsSuffix: "api.amazonwebservices.com.cn", + implicitGlobalRegion: "cn-northwest-1", + name: "aws-cn", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^cn\\-\\w+\\-\\d+$", + regions: { + "aws-cn-global": { + description: "AWS China global region" + }, + "cn-north-1": { + description: "China (Beijing)" + }, + "cn-northwest-1": { + description: "China (Ningxia)" + } + } + }, { + id: "aws-us-gov", + outputs: { + dnsSuffix: "amazonaws.com", + dualStackDnsSuffix: "api.aws", + implicitGlobalRegion: "us-gov-west-1", + name: "aws-us-gov", + supportsDualStack: true, + supportsFIPS: true + }, + regionRegex: "^us\\-gov\\-\\w+\\-\\d+$", + regions: { + "aws-us-gov-global": { + description: "AWS GovCloud (US) global region" + }, + "us-gov-east-1": { + description: "AWS GovCloud (US-East)" + }, + "us-gov-west-1": { + description: "AWS GovCloud (US-West)" + } + } + }, { + id: "aws-iso", + outputs: { + dnsSuffix: "c2s.ic.gov", + dualStackDnsSuffix: "c2s.ic.gov", + implicitGlobalRegion: "us-iso-east-1", + name: "aws-iso", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-iso\\-\\w+\\-\\d+$", + regions: { + "aws-iso-global": { + description: "AWS ISO (US) global region" + }, + "us-iso-east-1": { + description: "US ISO East" + }, + "us-iso-west-1": { + description: "US ISO WEST" + } + } + }, { + id: "aws-iso-b", + outputs: { + dnsSuffix: "sc2s.sgov.gov", + dualStackDnsSuffix: "sc2s.sgov.gov", + implicitGlobalRegion: "us-isob-east-1", + name: "aws-iso-b", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isob\\-\\w+\\-\\d+$", + regions: { + "aws-iso-b-global": { + description: "AWS ISOB (US) global region" + }, + "us-isob-east-1": { + description: "US ISOB East (Ohio)" + } + } + }, { + id: "aws-iso-e", + outputs: { + dnsSuffix: "cloud.adc-e.uk", + dualStackDnsSuffix: "cloud.adc-e.uk", + implicitGlobalRegion: "eu-isoe-west-1", + name: "aws-iso-e", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^eu\\-isoe\\-\\w+\\-\\d+$", + regions: { + "eu-isoe-west-1": { + description: "EU ISOE West" + } + } + }, { + id: "aws-iso-f", + outputs: { + dnsSuffix: "csp.hci.ic.gov", + dualStackDnsSuffix: "csp.hci.ic.gov", + implicitGlobalRegion: "us-isof-south-1", + name: "aws-iso-f", + supportsDualStack: false, + supportsFIPS: true + }, + regionRegex: "^us\\-isof\\-\\w+\\-\\d+$", + regions: {} + }], + version: "1.1" +}; + +// src/lib/aws/partition.ts +var selectedPartitionsInfo = partitions_default; +var selectedUserAgentPrefix = ""; +var partition = /* @__PURE__ */ __name((value) => { + const { partitions } = selectedPartitionsInfo; + for (const partition2 of partitions) { + const { regions, outputs } = partition2; + for (const [region, regionData] of Object.entries(regions)) { + if (region === value) { + return { + ...outputs, + ...regionData + }; + } + } + } + for (const partition2 of partitions) { + const { regionRegex, outputs } = partition2; + if (new RegExp(regionRegex).test(value)) { + return { + ...outputs + }; + } + } + const DEFAULT_PARTITION = partitions.find((partition2) => partition2.id === "aws"); + if (!DEFAULT_PARTITION) { + throw new Error( + "Provided region was not found in the partition array or regex, and default partition with id 'aws' doesn't exist." + ); + } + return { + ...DEFAULT_PARTITION.outputs + }; +}, "partition"); +var setPartitionInfo = /* @__PURE__ */ __name((partitionsInfo, userAgentPrefix = "") => { + selectedPartitionsInfo = partitionsInfo; + selectedUserAgentPrefix = userAgentPrefix; +}, "setPartitionInfo"); +var useDefaultPartitionInfo = /* @__PURE__ */ __name(() => { + setPartitionInfo(partitions_default, ""); +}, "useDefaultPartitionInfo"); +var getUserAgentPrefix = /* @__PURE__ */ __name(() => selectedUserAgentPrefix, "getUserAgentPrefix"); + +// src/aws.ts +var awsEndpointFunctions = { + isVirtualHostableS3Bucket, + parseArn, + partition +}; +import_util_endpoints.customEndpointFunctions.aws = awsEndpointFunctions; + +// src/resolveEndpoint.ts + + +// src/types/EndpointError.ts + + +// src/types/EndpointRuleObject.ts + + +// src/types/ErrorRuleObject.ts + + +// src/types/RuleSetObject.ts + + +// src/types/TreeRuleObject.ts + + +// src/types/shared.ts + +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 98095: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +"use strict"; + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + UA_APP_ID_ENV_NAME: () => UA_APP_ID_ENV_NAME, + UA_APP_ID_INI_NAME: () => UA_APP_ID_INI_NAME, + crtAvailability: () => crtAvailability, + defaultUserAgent: () => defaultUserAgent +}); +module.exports = __toCommonJS(src_exports); +var import_node_config_provider = __nccwpck_require__(33461); +var import_os = __nccwpck_require__(22037); +var import_process = __nccwpck_require__(77282); + +// src/crt-availability.ts +var crtAvailability = { + isCrtAvailable: false +}; + +// src/is-crt-available.ts +var isCrtAvailable = /* @__PURE__ */ __name(() => { + if (crtAvailability.isCrtAvailable) { + return ["md/crt-avail"]; + } + return null; +}, "isCrtAvailable"); + +// src/index.ts +var UA_APP_ID_ENV_NAME = "AWS_SDK_UA_APP_ID"; +var UA_APP_ID_INI_NAME = "sdk-ua-app-id"; +var defaultUserAgent = /* @__PURE__ */ __name(({ serviceId, clientVersion }) => { + const sections = [ + // sdk-metadata + ["aws-sdk-js", clientVersion], + // ua-metadata + ["ua", "2.0"], + // os-metadata + [`os/${(0, import_os.platform)()}`, (0, import_os.release)()], + // language-metadata + // ECMAScript edition doesn't matter in JS, so no version needed. + ["lang/js"], + ["md/nodejs", `${import_process.versions.node}`] + ]; + const crtAvailable = isCrtAvailable(); + if (crtAvailable) { + sections.push(crtAvailable); + } + if (serviceId) { + sections.push([`api/${serviceId}`, clientVersion]); + } + if (import_process.env.AWS_EXECUTION_ENV) { + sections.push([`exec-env/${import_process.env.AWS_EXECUTION_ENV}`]); + } + const appIdPromise = (0, import_node_config_provider.loadConfig)({ + environmentVariableSelector: (env2) => env2[UA_APP_ID_ENV_NAME], + configFileSelector: (profile) => profile[UA_APP_ID_INI_NAME], + default: void 0 + })(); + let resolvedUserAgent = void 0; + return async () => { + if (!resolvedUserAgent) { + const appId = await appIdPromise; + resolvedUserAgent = appId ? [...sections, [`app/${appId}`]] : [...sections]; + } + return resolvedUserAgent; + }; +}, "defaultUserAgent"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 53098: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CONFIG_USE_DUALSTACK_ENDPOINT: () => CONFIG_USE_DUALSTACK_ENDPOINT, + CONFIG_USE_FIPS_ENDPOINT: () => CONFIG_USE_FIPS_ENDPOINT, + DEFAULT_USE_DUALSTACK_ENDPOINT: () => DEFAULT_USE_DUALSTACK_ENDPOINT, + DEFAULT_USE_FIPS_ENDPOINT: () => DEFAULT_USE_FIPS_ENDPOINT, + ENV_USE_DUALSTACK_ENDPOINT: () => ENV_USE_DUALSTACK_ENDPOINT, + ENV_USE_FIPS_ENDPOINT: () => ENV_USE_FIPS_ENDPOINT, + NODE_REGION_CONFIG_FILE_OPTIONS: () => NODE_REGION_CONFIG_FILE_OPTIONS, + NODE_REGION_CONFIG_OPTIONS: () => NODE_REGION_CONFIG_OPTIONS, + NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS, + NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS: () => NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS, + REGION_ENV_NAME: () => REGION_ENV_NAME, + REGION_INI_NAME: () => REGION_INI_NAME, + getRegionInfo: () => getRegionInfo, + resolveCustomEndpointsConfig: () => resolveCustomEndpointsConfig, + resolveEndpointsConfig: () => resolveEndpointsConfig, + resolveRegionConfig: () => resolveRegionConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/endpointsConfig/NodeUseDualstackEndpointConfigOptions.ts +var import_util_config_provider = __nccwpck_require__(83375); +var ENV_USE_DUALSTACK_ENDPOINT = "AWS_USE_DUALSTACK_ENDPOINT"; +var CONFIG_USE_DUALSTACK_ENDPOINT = "use_dualstack_endpoint"; +var DEFAULT_USE_DUALSTACK_ENDPOINT = false; +var NODE_USE_DUALSTACK_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_DUALSTACK_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false +}; + +// src/endpointsConfig/NodeUseFipsEndpointConfigOptions.ts + +var ENV_USE_FIPS_ENDPOINT = "AWS_USE_FIPS_ENDPOINT"; +var CONFIG_USE_FIPS_ENDPOINT = "use_fips_endpoint"; +var DEFAULT_USE_FIPS_ENDPOINT = false; +var NODE_USE_FIPS_ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => (0, import_util_config_provider.booleanSelector)(env, ENV_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.ENV), + configFileSelector: (profile) => (0, import_util_config_provider.booleanSelector)(profile, CONFIG_USE_FIPS_ENDPOINT, import_util_config_provider.SelectorType.CONFIG), + default: false +}; + +// src/endpointsConfig/resolveCustomEndpointsConfig.ts +var import_util_middleware = __nccwpck_require__(2390); +var resolveCustomEndpointsConfig = /* @__PURE__ */ __name((input) => { + const { endpoint, urlParser } = input; + return { + ...input, + tls: input.tls ?? true, + endpoint: (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint), + isCustomEndpoint: true, + useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false) + }; +}, "resolveCustomEndpointsConfig"); + +// src/endpointsConfig/resolveEndpointsConfig.ts + + +// src/endpointsConfig/utils/getEndpointFromRegion.ts +var getEndpointFromRegion = /* @__PURE__ */ __name(async (input) => { + const { tls = true } = input; + const region = await input.region(); + const dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(region)) { + throw new Error("Invalid region in client config"); + } + const useDualstackEndpoint = await input.useDualstackEndpoint(); + const useFipsEndpoint = await input.useFipsEndpoint(); + const { hostname } = await input.regionInfoProvider(region, { useDualstackEndpoint, useFipsEndpoint }) ?? {}; + if (!hostname) { + throw new Error("Cannot resolve hostname from client config"); + } + return input.urlParser(`${tls ? "https:" : "http:"}//${hostname}`); +}, "getEndpointFromRegion"); + +// src/endpointsConfig/resolveEndpointsConfig.ts +var resolveEndpointsConfig = /* @__PURE__ */ __name((input) => { + const useDualstackEndpoint = (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false); + const { endpoint, useFipsEndpoint, urlParser } = input; + return { + ...input, + tls: input.tls ?? true, + endpoint: endpoint ? (0, import_util_middleware.normalizeProvider)(typeof endpoint === "string" ? urlParser(endpoint) : endpoint) : () => getEndpointFromRegion({ ...input, useDualstackEndpoint, useFipsEndpoint }), + isCustomEndpoint: !!endpoint, + useDualstackEndpoint + }; +}, "resolveEndpointsConfig"); + +// src/regionConfig/config.ts +var REGION_ENV_NAME = "AWS_REGION"; +var REGION_INI_NAME = "region"; +var NODE_REGION_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[REGION_ENV_NAME], + configFileSelector: (profile) => profile[REGION_INI_NAME], + default: () => { + throw new Error("Region is missing"); + } +}; +var NODE_REGION_CONFIG_FILE_OPTIONS = { + preferredFile: "credentials" +}; + +// src/regionConfig/isFipsRegion.ts +var isFipsRegion = /* @__PURE__ */ __name((region) => typeof region === "string" && (region.startsWith("fips-") || region.endsWith("-fips")), "isFipsRegion"); + +// src/regionConfig/getRealRegion.ts +var getRealRegion = /* @__PURE__ */ __name((region) => isFipsRegion(region) ? ["fips-aws-global", "aws-fips"].includes(region) ? "us-east-1" : region.replace(/fips-(dkr-|prod-)?|-fips/, "") : region, "getRealRegion"); + +// src/regionConfig/resolveRegionConfig.ts +var resolveRegionConfig = /* @__PURE__ */ __name((input) => { + const { region, useFipsEndpoint } = input; + if (!region) { + throw new Error("Region is missing"); + } + return { + ...input, + region: async () => { + if (typeof region === "string") { + return getRealRegion(region); + } + const providedRegion = await region(); + return getRealRegion(providedRegion); + }, + useFipsEndpoint: async () => { + const providedRegion = typeof region === "string" ? region : await region(); + if (isFipsRegion(providedRegion)) { + return true; + } + return typeof useFipsEndpoint !== "function" ? Promise.resolve(!!useFipsEndpoint) : useFipsEndpoint(); + } + }; +}, "resolveRegionConfig"); + +// src/regionInfo/getHostnameFromVariants.ts +var getHostnameFromVariants = /* @__PURE__ */ __name((variants = [], { useFipsEndpoint, useDualstackEndpoint }) => { + var _a; + return (_a = variants.find( + ({ tags }) => useFipsEndpoint === tags.includes("fips") && useDualstackEndpoint === tags.includes("dualstack") + )) == null ? void 0 : _a.hostname; +}, "getHostnameFromVariants"); + +// src/regionInfo/getResolvedHostname.ts +var getResolvedHostname = /* @__PURE__ */ __name((resolvedRegion, { regionHostname, partitionHostname }) => regionHostname ? regionHostname : partitionHostname ? partitionHostname.replace("{region}", resolvedRegion) : void 0, "getResolvedHostname"); + +// src/regionInfo/getResolvedPartition.ts +var getResolvedPartition = /* @__PURE__ */ __name((region, { partitionHash }) => Object.keys(partitionHash || {}).find((key) => partitionHash[key].regions.includes(region)) ?? "aws", "getResolvedPartition"); + +// src/regionInfo/getResolvedSigningRegion.ts +var getResolvedSigningRegion = /* @__PURE__ */ __name((hostname, { signingRegion, regionRegex, useFipsEndpoint }) => { + if (signingRegion) { + return signingRegion; + } else if (useFipsEndpoint) { + const regionRegexJs = regionRegex.replace("\\\\", "\\").replace(/^\^/g, "\\.").replace(/\$$/g, "\\."); + const regionRegexmatchArray = hostname.match(regionRegexJs); + if (regionRegexmatchArray) { + return regionRegexmatchArray[0].slice(1, -1); + } + } +}, "getResolvedSigningRegion"); + +// src/regionInfo/getRegionInfo.ts +var getRegionInfo = /* @__PURE__ */ __name((region, { + useFipsEndpoint = false, + useDualstackEndpoint = false, + signingService, + regionHash, + partitionHash +}) => { + var _a, _b, _c, _d, _e; + const partition = getResolvedPartition(region, { partitionHash }); + const resolvedRegion = region in regionHash ? region : ((_a = partitionHash[partition]) == null ? void 0 : _a.endpoint) ?? region; + const hostnameOptions = { useFipsEndpoint, useDualstackEndpoint }; + const regionHostname = getHostnameFromVariants((_b = regionHash[resolvedRegion]) == null ? void 0 : _b.variants, hostnameOptions); + const partitionHostname = getHostnameFromVariants((_c = partitionHash[partition]) == null ? void 0 : _c.variants, hostnameOptions); + const hostname = getResolvedHostname(resolvedRegion, { regionHostname, partitionHostname }); + if (hostname === void 0) { + throw new Error(`Endpoint resolution failed for: ${{ resolvedRegion, useFipsEndpoint, useDualstackEndpoint }}`); + } + const signingRegion = getResolvedSigningRegion(hostname, { + signingRegion: (_d = regionHash[resolvedRegion]) == null ? void 0 : _d.signingRegion, + regionRegex: partitionHash[partition].regionRegex, + useFipsEndpoint + }); + return { + partition, + signingService, + hostname, + ...signingRegion && { signingRegion }, + ...((_e = regionHash[resolvedRegion]) == null ? void 0 : _e.signingService) && { + signingService: regionHash[resolvedRegion].signingService + } + }; +}, "getRegionInfo"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 55829: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + DefaultIdentityProviderConfig: () => DefaultIdentityProviderConfig, + EXPIRATION_MS: () => EXPIRATION_MS, + HttpApiKeyAuthSigner: () => HttpApiKeyAuthSigner, + HttpBearerAuthSigner: () => HttpBearerAuthSigner, + NoAuthSigner: () => NoAuthSigner, + RequestBuilder: () => RequestBuilder, + createIsIdentityExpiredFunction: () => createIsIdentityExpiredFunction, + createPaginator: () => createPaginator, + doesIdentityRequireRefresh: () => doesIdentityRequireRefresh, + getHttpAuthSchemeEndpointRuleSetPlugin: () => getHttpAuthSchemeEndpointRuleSetPlugin, + getHttpAuthSchemePlugin: () => getHttpAuthSchemePlugin, + getHttpSigningPlugin: () => getHttpSigningPlugin, + getSmithyContext: () => getSmithyContext3, + httpAuthSchemeEndpointRuleSetMiddlewareOptions: () => httpAuthSchemeEndpointRuleSetMiddlewareOptions, + httpAuthSchemeMiddleware: () => httpAuthSchemeMiddleware, + httpAuthSchemeMiddlewareOptions: () => httpAuthSchemeMiddlewareOptions, + httpSigningMiddleware: () => httpSigningMiddleware, + httpSigningMiddlewareOptions: () => httpSigningMiddlewareOptions, + isIdentityExpired: () => isIdentityExpired, + memoizeIdentityProvider: () => memoizeIdentityProvider, + normalizeProvider: () => normalizeProvider, + requestBuilder: () => requestBuilder +}); +module.exports = __toCommonJS(src_exports); + +// src/middleware-http-auth-scheme/httpAuthSchemeMiddleware.ts +var import_util_middleware = __nccwpck_require__(2390); +function convertHttpAuthSchemesToMap(httpAuthSchemes) { + const map = /* @__PURE__ */ new Map(); + for (const scheme of httpAuthSchemes) { + map.set(scheme.schemeId, scheme); + } + return map; +} +__name(convertHttpAuthSchemesToMap, "convertHttpAuthSchemesToMap"); +var httpAuthSchemeMiddleware = /* @__PURE__ */ __name((config, mwOptions) => (next, context) => async (args) => { + var _a; + const options = config.httpAuthSchemeProvider( + await mwOptions.httpAuthSchemeParametersProvider(config, context, args.input) + ); + const authSchemes = convertHttpAuthSchemesToMap(config.httpAuthSchemes); + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const failureReasons = []; + for (const option of options) { + const scheme = authSchemes.get(option.schemeId); + if (!scheme) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` was not enabled for this service.`); + continue; + } + const identityProvider = scheme.identityProvider(await mwOptions.identityProviderConfigProvider(config)); + if (!identityProvider) { + failureReasons.push(`HttpAuthScheme \`${option.schemeId}\` did not have an IdentityProvider configured.`); + continue; + } + const { identityProperties = {}, signingProperties = {} } = ((_a = option.propertiesExtractor) == null ? void 0 : _a.call(option, config, context)) || {}; + option.identityProperties = Object.assign(option.identityProperties || {}, identityProperties); + option.signingProperties = Object.assign(option.signingProperties || {}, signingProperties); + smithyContext.selectedHttpAuthScheme = { + httpAuthOption: option, + identity: await identityProvider(option.identityProperties), + signer: scheme.signer + }; + break; + } + if (!smithyContext.selectedHttpAuthScheme) { + throw new Error(failureReasons.join("\n")); + } + return next(args); +}, "httpAuthSchemeMiddleware"); + +// src/middleware-http-auth-scheme/getHttpAuthSchemeEndpointRuleSetPlugin.ts +var import_middleware_endpoint = __nccwpck_require__(82918); +var httpAuthSchemeEndpointRuleSetMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_endpoint.endpointMiddlewareOptions.name +}; +var getHttpAuthSchemeEndpointRuleSetPlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeEndpointRuleSetMiddlewareOptions + ); + } +}), "getHttpAuthSchemeEndpointRuleSetPlugin"); + +// src/middleware-http-auth-scheme/getHttpAuthSchemePlugin.ts +var import_middleware_serde = __nccwpck_require__(81238); +var httpAuthSchemeMiddlewareOptions = { + step: "serialize", + tags: ["HTTP_AUTH_SCHEME"], + name: "httpAuthSchemeMiddleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name +}; +var getHttpAuthSchemePlugin = /* @__PURE__ */ __name((config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider +}) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + httpAuthSchemeMiddleware(config, { + httpAuthSchemeParametersProvider, + identityProviderConfigProvider + }), + httpAuthSchemeMiddlewareOptions + ); + } +}), "getHttpAuthSchemePlugin"); + +// src/middleware-http-signing/httpSigningMiddleware.ts +var import_protocol_http = __nccwpck_require__(64418); + +var defaultErrorHandler = /* @__PURE__ */ __name((signingProperties) => (error) => { + throw error; +}, "defaultErrorHandler"); +var defaultSuccessHandler = /* @__PURE__ */ __name((httpResponse, signingProperties) => { +}, "defaultSuccessHandler"); +var httpSigningMiddleware = /* @__PURE__ */ __name((config) => (next, context) => async (args) => { + if (!import_protocol_http.HttpRequest.isInstance(args.request)) { + return next(args); + } + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const scheme = smithyContext.selectedHttpAuthScheme; + if (!scheme) { + throw new Error(`No HttpAuthScheme was selected: unable to sign request`); + } + const { + httpAuthOption: { signingProperties = {} }, + identity, + signer + } = scheme; + const output = await next({ + ...args, + request: await signer.sign(args.request, identity, signingProperties) + }).catch((signer.errorHandler || defaultErrorHandler)(signingProperties)); + (signer.successHandler || defaultSuccessHandler)(output.response, signingProperties); + return output; +}, "httpSigningMiddleware"); + +// src/middleware-http-signing/getHttpSigningMiddleware.ts +var import_middleware_retry = __nccwpck_require__(96039); +var httpSigningMiddlewareOptions = { + step: "finalizeRequest", + tags: ["HTTP_SIGNING"], + name: "httpSigningMiddleware", + aliases: ["apiKeyMiddleware", "tokenMiddleware", "awsAuthMiddleware"], + override: true, + relation: "after", + toMiddleware: import_middleware_retry.retryMiddlewareOptions.name +}; +var getHttpSigningPlugin = /* @__PURE__ */ __name((config) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(httpSigningMiddleware(config), httpSigningMiddlewareOptions); + } +}), "getHttpSigningPlugin"); + +// src/util-identity-and-auth/DefaultIdentityProviderConfig.ts +var _DefaultIdentityProviderConfig = class _DefaultIdentityProviderConfig { + /** + * Creates an IdentityProviderConfig with a record of scheme IDs to identity providers. + * + * @param config scheme IDs and identity providers to configure + */ + constructor(config) { + this.authSchemes = /* @__PURE__ */ new Map(); + for (const [key, value] of Object.entries(config)) { + if (value !== void 0) { + this.authSchemes.set(key, value); + } + } + } + getIdentityProvider(schemeId) { + return this.authSchemes.get(schemeId); + } +}; +__name(_DefaultIdentityProviderConfig, "DefaultIdentityProviderConfig"); +var DefaultIdentityProviderConfig = _DefaultIdentityProviderConfig; + +// src/util-identity-and-auth/httpAuthSchemes/httpApiKeyAuth.ts +var import_types = __nccwpck_require__(55756); +var _HttpApiKeyAuthSigner = class _HttpApiKeyAuthSigner { + async sign(httpRequest, identity, signingProperties) { + if (!signingProperties) { + throw new Error( + "request could not be signed with `apiKey` since the `name` and `in` signer properties are missing" + ); + } + if (!signingProperties.name) { + throw new Error("request could not be signed with `apiKey` since the `name` signer property is missing"); + } + if (!signingProperties.in) { + throw new Error("request could not be signed with `apiKey` since the `in` signer property is missing"); + } + if (!identity.apiKey) { + throw new Error("request could not be signed with `apiKey` since the `apiKey` is not defined"); + } + const clonedRequest = httpRequest.clone(); + if (signingProperties.in === import_types.HttpApiKeyAuthLocation.QUERY) { + clonedRequest.query[signingProperties.name] = identity.apiKey; + } else if (signingProperties.in === import_types.HttpApiKeyAuthLocation.HEADER) { + clonedRequest.headers[signingProperties.name] = signingProperties.scheme ? `${signingProperties.scheme} ${identity.apiKey}` : identity.apiKey; + } else { + throw new Error( + "request can only be signed with `apiKey` locations `query` or `header`, but found: `" + signingProperties.in + "`" + ); + } + return clonedRequest; + } +}; +__name(_HttpApiKeyAuthSigner, "HttpApiKeyAuthSigner"); +var HttpApiKeyAuthSigner = _HttpApiKeyAuthSigner; + +// src/util-identity-and-auth/httpAuthSchemes/httpBearerAuth.ts +var _HttpBearerAuthSigner = class _HttpBearerAuthSigner { + async sign(httpRequest, identity, signingProperties) { + const clonedRequest = httpRequest.clone(); + if (!identity.token) { + throw new Error("request could not be signed with `token` since the `token` is not defined"); + } + clonedRequest.headers["Authorization"] = `Bearer ${identity.token}`; + return clonedRequest; + } +}; +__name(_HttpBearerAuthSigner, "HttpBearerAuthSigner"); +var HttpBearerAuthSigner = _HttpBearerAuthSigner; + +// src/util-identity-and-auth/httpAuthSchemes/noAuth.ts +var _NoAuthSigner = class _NoAuthSigner { + async sign(httpRequest, identity, signingProperties) { + return httpRequest; + } +}; +__name(_NoAuthSigner, "NoAuthSigner"); +var NoAuthSigner = _NoAuthSigner; + +// src/util-identity-and-auth/memoizeIdentityProvider.ts +var createIsIdentityExpiredFunction = /* @__PURE__ */ __name((expirationMs) => (identity) => doesIdentityRequireRefresh(identity) && identity.expiration.getTime() - Date.now() < expirationMs, "createIsIdentityExpiredFunction"); +var EXPIRATION_MS = 3e5; +var isIdentityExpired = createIsIdentityExpiredFunction(EXPIRATION_MS); +var doesIdentityRequireRefresh = /* @__PURE__ */ __name((identity) => identity.expiration !== void 0, "doesIdentityRequireRefresh"); +var memoizeIdentityProvider = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + if (provider === void 0) { + return void 0; + } + const normalizedProvider = typeof provider !== "function" ? async () => Promise.resolve(provider) : provider; + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async (options) => { + if (!pending) { + pending = normalizedProvider(options); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(options); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(options); + } + if (isConstant) { + return resolved; + } + if (!requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(options); + return resolved; + } + return resolved; + }; +}, "memoizeIdentityProvider"); + +// src/getSmithyContext.ts + +var getSmithyContext3 = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); + +// src/protocols/requestBuilder.ts + +var import_smithy_client = __nccwpck_require__(63570); +function requestBuilder(input, context) { + return new RequestBuilder(input, context); +} +__name(requestBuilder, "requestBuilder"); +var _RequestBuilder = class _RequestBuilder { + constructor(input, context) { + this.input = input; + this.context = context; + this.query = {}; + this.method = ""; + this.headers = {}; + this.path = ""; + this.body = null; + this.hostname = ""; + this.resolvePathStack = []; + } + async build() { + const { hostname, protocol = "https", port, path: basePath } = await this.context.endpoint(); + this.path = basePath; + for (const resolvePath of this.resolvePathStack) { + resolvePath(this.path); + } + return new import_protocol_http.HttpRequest({ + protocol, + hostname: this.hostname || hostname, + port, + method: this.method, + path: this.path, + query: this.query, + body: this.body, + headers: this.headers + }); + } + /** + * Brevity setter for "hostname". + */ + hn(hostname) { + this.hostname = hostname; + return this; + } + /** + * Brevity initial builder for "basepath". + */ + bp(uriLabel) { + this.resolvePathStack.push((basePath) => { + this.path = `${(basePath == null ? void 0 : basePath.endsWith("/")) ? basePath.slice(0, -1) : basePath || ""}` + uriLabel; + }); + return this; + } + /** + * Brevity incremental builder for "path". + */ + p(memberName, labelValueProvider, uriLabel, isGreedyLabel) { + this.resolvePathStack.push((path) => { + this.path = (0, import_smithy_client.resolvedPath)(path, this.input, memberName, labelValueProvider, uriLabel, isGreedyLabel); + }); + return this; + } + /** + * Brevity setter for "headers". + */ + h(headers) { + this.headers = headers; + return this; + } + /** + * Brevity setter for "query". + */ + q(query) { + this.query = query; + return this; + } + /** + * Brevity setter for "body". + */ + b(body) { + this.body = body; + return this; + } + /** + * Brevity setter for "method". + */ + m(method) { + this.method = method; + return this; + } +}; +__name(_RequestBuilder, "RequestBuilder"); +var RequestBuilder = _RequestBuilder; + +// src/pagination/createPaginator.ts +var makePagedClientRequest = /* @__PURE__ */ __name(async (CommandCtor, client, input, ...args) => { + return await client.send(new CommandCtor(input), ...args); +}, "makePagedClientRequest"); +function createPaginator(ClientCtor, CommandCtor, inputTokenName, outputTokenName, pageSizeTokenName) { + return /* @__PURE__ */ __name(async function* paginateOperation(config, input, ...additionalArguments) { + let token = config.startingToken || void 0; + let hasNext = true; + let page; + while (hasNext) { + input[inputTokenName] = token; + if (pageSizeTokenName) { + input[pageSizeTokenName] = input[pageSizeTokenName] ?? config.pageSize; + } + if (config.client instanceof ClientCtor) { + page = await makePagedClientRequest(CommandCtor, config.client, input, ...additionalArguments); + } else { + throw new Error(`Invalid client, expected instance of ${ClientCtor.name}`); + } + yield page; + const prevToken = token; + token = get(page, outputTokenName); + hasNext = !!(token && (!config.stopOnSameToken || token !== prevToken)); + } + return void 0; + }, "paginateOperation"); +} +__name(createPaginator, "createPaginator"); +var get = /* @__PURE__ */ __name((fromObject, path) => { + let cursor = fromObject; + const pathComponents = path.split("."); + for (const step of pathComponents) { + if (!cursor || typeof cursor !== "object") { + return void 0; + } + cursor = cursor[step]; + } + return cursor; +}, "get"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 7477: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + DEFAULT_MAX_RETRIES: () => DEFAULT_MAX_RETRIES, + DEFAULT_TIMEOUT: () => DEFAULT_TIMEOUT, + ENV_CMDS_AUTH_TOKEN: () => ENV_CMDS_AUTH_TOKEN, + ENV_CMDS_FULL_URI: () => ENV_CMDS_FULL_URI, + ENV_CMDS_RELATIVE_URI: () => ENV_CMDS_RELATIVE_URI, + Endpoint: () => Endpoint, + fromContainerMetadata: () => fromContainerMetadata, + fromInstanceMetadata: () => fromInstanceMetadata, + getInstanceMetadataEndpoint: () => getInstanceMetadataEndpoint, + httpRequest: () => httpRequest, + providerConfigFromInit: () => providerConfigFromInit +}); +module.exports = __toCommonJS(src_exports); + +// src/fromContainerMetadata.ts + +var import_url = __nccwpck_require__(57310); + +// src/remoteProvider/httpRequest.ts +var import_property_provider = __nccwpck_require__(79721); +var import_buffer = __nccwpck_require__(14300); +var import_http = __nccwpck_require__(13685); +function httpRequest(options) { + return new Promise((resolve, reject) => { + var _a; + const req = (0, import_http.request)({ + method: "GET", + ...options, + // Node.js http module doesn't accept hostname with square brackets + // Refs: https://github.com/nodejs/node/issues/39738 + hostname: (_a = options.hostname) == null ? void 0 : _a.replace(/^\[(.+)\]$/, "$1") + }); + req.on("error", (err) => { + reject(Object.assign(new import_property_provider.ProviderError("Unable to connect to instance metadata service"), err)); + req.destroy(); + }); + req.on("timeout", () => { + reject(new import_property_provider.ProviderError("TimeoutError from instance metadata service")); + req.destroy(); + }); + req.on("response", (res) => { + const { statusCode = 400 } = res; + if (statusCode < 200 || 300 <= statusCode) { + reject( + Object.assign(new import_property_provider.ProviderError("Error response received from instance metadata service"), { statusCode }) + ); + req.destroy(); + } + const chunks = []; + res.on("data", (chunk) => { + chunks.push(chunk); + }); + res.on("end", () => { + resolve(import_buffer.Buffer.concat(chunks)); + req.destroy(); + }); + }); + req.end(); + }); +} +__name(httpRequest, "httpRequest"); + +// src/remoteProvider/ImdsCredentials.ts +var isImdsCredentials = /* @__PURE__ */ __name((arg) => Boolean(arg) && typeof arg === "object" && typeof arg.AccessKeyId === "string" && typeof arg.SecretAccessKey === "string" && typeof arg.Token === "string" && typeof arg.Expiration === "string", "isImdsCredentials"); +var fromImdsCredentials = /* @__PURE__ */ __name((creds) => ({ + accessKeyId: creds.AccessKeyId, + secretAccessKey: creds.SecretAccessKey, + sessionToken: creds.Token, + expiration: new Date(creds.Expiration) +}), "fromImdsCredentials"); + +// src/remoteProvider/RemoteProviderInit.ts +var DEFAULT_TIMEOUT = 1e3; +var DEFAULT_MAX_RETRIES = 0; +var providerConfigFromInit = /* @__PURE__ */ __name(({ + maxRetries = DEFAULT_MAX_RETRIES, + timeout = DEFAULT_TIMEOUT +}) => ({ maxRetries, timeout }), "providerConfigFromInit"); + +// src/remoteProvider/retry.ts +var retry = /* @__PURE__ */ __name((toRetry, maxRetries) => { + let promise = toRetry(); + for (let i = 0; i < maxRetries; i++) { + promise = promise.catch(toRetry); + } + return promise; +}, "retry"); + +// src/fromContainerMetadata.ts +var ENV_CMDS_FULL_URI = "AWS_CONTAINER_CREDENTIALS_FULL_URI"; +var ENV_CMDS_RELATIVE_URI = "AWS_CONTAINER_CREDENTIALS_RELATIVE_URI"; +var ENV_CMDS_AUTH_TOKEN = "AWS_CONTAINER_AUTHORIZATION_TOKEN"; +var fromContainerMetadata = /* @__PURE__ */ __name((init = {}) => { + const { timeout, maxRetries } = providerConfigFromInit(init); + return () => retry(async () => { + const requestOptions = await getCmdsUri({ logger: init.logger }); + const credsResponse = JSON.parse(await requestFromEcsImds(timeout, requestOptions)); + if (!isImdsCredentials(credsResponse)) { + throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); + } + return fromImdsCredentials(credsResponse); + }, maxRetries); +}, "fromContainerMetadata"); +var requestFromEcsImds = /* @__PURE__ */ __name(async (timeout, options) => { + if (process.env[ENV_CMDS_AUTH_TOKEN]) { + options.headers = { + ...options.headers, + Authorization: process.env[ENV_CMDS_AUTH_TOKEN] + }; + } + const buffer = await httpRequest({ + ...options, + timeout + }); + return buffer.toString(); +}, "requestFromEcsImds"); +var CMDS_IP = "169.254.170.2"; +var GREENGRASS_HOSTS = { + localhost: true, + "127.0.0.1": true +}; +var GREENGRASS_PROTOCOLS = { + "http:": true, + "https:": true +}; +var getCmdsUri = /* @__PURE__ */ __name(async ({ logger }) => { + if (process.env[ENV_CMDS_RELATIVE_URI]) { + return { + hostname: CMDS_IP, + path: process.env[ENV_CMDS_RELATIVE_URI] + }; + } + if (process.env[ENV_CMDS_FULL_URI]) { + const parsed = (0, import_url.parse)(process.env[ENV_CMDS_FULL_URI]); + if (!parsed.hostname || !(parsed.hostname in GREENGRASS_HOSTS)) { + throw new import_property_provider.CredentialsProviderError(`${parsed.hostname} is not a valid container metadata service hostname`, { + tryNextLink: false, + logger + }); + } + if (!parsed.protocol || !(parsed.protocol in GREENGRASS_PROTOCOLS)) { + throw new import_property_provider.CredentialsProviderError(`${parsed.protocol} is not a valid container metadata service protocol`, { + tryNextLink: false, + logger + }); + } + return { + ...parsed, + port: parsed.port ? parseInt(parsed.port, 10) : void 0 + }; + } + throw new import_property_provider.CredentialsProviderError( + `The container metadata credential provider cannot be used unless the ${ENV_CMDS_RELATIVE_URI} or ${ENV_CMDS_FULL_URI} environment variable is set`, + { + tryNextLink: false, + logger + } + ); +}, "getCmdsUri"); + +// src/fromInstanceMetadata.ts + + + +// src/error/InstanceMetadataV1FallbackError.ts + +var _InstanceMetadataV1FallbackError = class _InstanceMetadataV1FallbackError extends import_property_provider.CredentialsProviderError { + constructor(message, tryNextLink = true) { + super(message, tryNextLink); + this.tryNextLink = tryNextLink; + this.name = "InstanceMetadataV1FallbackError"; + Object.setPrototypeOf(this, _InstanceMetadataV1FallbackError.prototype); + } +}; +__name(_InstanceMetadataV1FallbackError, "InstanceMetadataV1FallbackError"); +var InstanceMetadataV1FallbackError = _InstanceMetadataV1FallbackError; + +// src/utils/getInstanceMetadataEndpoint.ts +var import_node_config_provider = __nccwpck_require__(33461); +var import_url_parser = __nccwpck_require__(14681); + +// src/config/Endpoint.ts +var Endpoint = /* @__PURE__ */ ((Endpoint2) => { + Endpoint2["IPv4"] = "http://169.254.169.254"; + Endpoint2["IPv6"] = "http://[fd00:ec2::254]"; + return Endpoint2; +})(Endpoint || {}); + +// src/config/EndpointConfigOptions.ts +var ENV_ENDPOINT_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT"; +var CONFIG_ENDPOINT_NAME = "ec2_metadata_service_endpoint"; +var ENDPOINT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_NAME], + default: void 0 +}; + +// src/config/EndpointMode.ts +var EndpointMode = /* @__PURE__ */ ((EndpointMode2) => { + EndpointMode2["IPv4"] = "IPv4"; + EndpointMode2["IPv6"] = "IPv6"; + return EndpointMode2; +})(EndpointMode || {}); + +// src/config/EndpointModeConfigOptions.ts +var ENV_ENDPOINT_MODE_NAME = "AWS_EC2_METADATA_SERVICE_ENDPOINT_MODE"; +var CONFIG_ENDPOINT_MODE_NAME = "ec2_metadata_service_endpoint_mode"; +var ENDPOINT_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_ENDPOINT_MODE_NAME], + configFileSelector: (profile) => profile[CONFIG_ENDPOINT_MODE_NAME], + default: "IPv4" /* IPv4 */ +}; + +// src/utils/getInstanceMetadataEndpoint.ts +var getInstanceMetadataEndpoint = /* @__PURE__ */ __name(async () => (0, import_url_parser.parseUrl)(await getFromEndpointConfig() || await getFromEndpointModeConfig()), "getInstanceMetadataEndpoint"); +var getFromEndpointConfig = /* @__PURE__ */ __name(async () => (0, import_node_config_provider.loadConfig)(ENDPOINT_CONFIG_OPTIONS)(), "getFromEndpointConfig"); +var getFromEndpointModeConfig = /* @__PURE__ */ __name(async () => { + const endpointMode = await (0, import_node_config_provider.loadConfig)(ENDPOINT_MODE_CONFIG_OPTIONS)(); + switch (endpointMode) { + case "IPv4" /* IPv4 */: + return "http://169.254.169.254" /* IPv4 */; + case "IPv6" /* IPv6 */: + return "http://[fd00:ec2::254]" /* IPv6 */; + default: + throw new Error(`Unsupported endpoint mode: ${endpointMode}. Select from ${Object.values(EndpointMode)}`); + } +}, "getFromEndpointModeConfig"); + +// src/utils/getExtendedInstanceMetadataCredentials.ts +var STATIC_STABILITY_REFRESH_INTERVAL_SECONDS = 5 * 60; +var STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS = 5 * 60; +var STATIC_STABILITY_DOC_URL = "https://docs.aws.amazon.com/sdkref/latest/guide/feature-static-credentials.html"; +var getExtendedInstanceMetadataCredentials = /* @__PURE__ */ __name((credentials, logger) => { + const refreshInterval = STATIC_STABILITY_REFRESH_INTERVAL_SECONDS + Math.floor(Math.random() * STATIC_STABILITY_REFRESH_INTERVAL_JITTER_WINDOW_SECONDS); + const newExpiration = new Date(Date.now() + refreshInterval * 1e3); + logger.warn( + `Attempting credential expiration extension due to a credential service availability issue. A refresh of these credentials will be attempted after ${new Date(newExpiration)}. +For more information, please visit: ` + STATIC_STABILITY_DOC_URL + ); + const originalExpiration = credentials.originalExpiration ?? credentials.expiration; + return { + ...credentials, + ...originalExpiration ? { originalExpiration } : {}, + expiration: newExpiration + }; +}, "getExtendedInstanceMetadataCredentials"); + +// src/utils/staticStabilityProvider.ts +var staticStabilityProvider = /* @__PURE__ */ __name((provider, options = {}) => { + const logger = (options == null ? void 0 : options.logger) || console; + let pastCredentials; + return async () => { + let credentials; + try { + credentials = await provider(); + if (credentials.expiration && credentials.expiration.getTime() < Date.now()) { + credentials = getExtendedInstanceMetadataCredentials(credentials, logger); + } + } catch (e) { + if (pastCredentials) { + logger.warn("Credential renew failed: ", e); + credentials = getExtendedInstanceMetadataCredentials(pastCredentials, logger); + } else { + throw e; + } + } + pastCredentials = credentials; + return credentials; + }; +}, "staticStabilityProvider"); + +// src/fromInstanceMetadata.ts +var IMDS_PATH = "/latest/meta-data/iam/security-credentials/"; +var IMDS_TOKEN_PATH = "/latest/api/token"; +var AWS_EC2_METADATA_V1_DISABLED = "AWS_EC2_METADATA_V1_DISABLED"; +var PROFILE_AWS_EC2_METADATA_V1_DISABLED = "ec2_metadata_v1_disabled"; +var X_AWS_EC2_METADATA_TOKEN = "x-aws-ec2-metadata-token"; +var fromInstanceMetadata = /* @__PURE__ */ __name((init = {}) => staticStabilityProvider(getInstanceMetadataProvider(init), { logger: init.logger }), "fromInstanceMetadata"); +var getInstanceMetadataProvider = /* @__PURE__ */ __name((init = {}) => { + let disableFetchToken = false; + const { logger, profile } = init; + const { timeout, maxRetries } = providerConfigFromInit(init); + const getCredentials = /* @__PURE__ */ __name(async (maxRetries2, options) => { + var _a; + const isImdsV1Fallback = disableFetchToken || ((_a = options.headers) == null ? void 0 : _a[X_AWS_EC2_METADATA_TOKEN]) == null; + if (isImdsV1Fallback) { + let fallbackBlockedFromProfile = false; + let fallbackBlockedFromProcessEnv = false; + const configValue = await (0, import_node_config_provider.loadConfig)( + { + environmentVariableSelector: (env) => { + const envValue = env[AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProcessEnv = !!envValue && envValue !== "false"; + if (envValue === void 0) { + throw new import_property_provider.CredentialsProviderError( + `${AWS_EC2_METADATA_V1_DISABLED} not set in env, checking config file next.`, + { logger: init.logger } + ); + } + return fallbackBlockedFromProcessEnv; + }, + configFileSelector: (profile2) => { + const profileValue = profile2[PROFILE_AWS_EC2_METADATA_V1_DISABLED]; + fallbackBlockedFromProfile = !!profileValue && profileValue !== "false"; + return fallbackBlockedFromProfile; + }, + default: false + }, + { + profile + } + )(); + if (init.ec2MetadataV1Disabled || configValue) { + const causes = []; + if (init.ec2MetadataV1Disabled) + causes.push("credential provider initialization (runtime option ec2MetadataV1Disabled)"); + if (fallbackBlockedFromProfile) + causes.push(`config file profile (${PROFILE_AWS_EC2_METADATA_V1_DISABLED})`); + if (fallbackBlockedFromProcessEnv) + causes.push(`process environment variable (${AWS_EC2_METADATA_V1_DISABLED})`); + throw new InstanceMetadataV1FallbackError( + `AWS EC2 Metadata v1 fallback has been blocked by AWS SDK configuration in the following: [${causes.join( + ", " + )}].` + ); + } + } + const imdsProfile = (await retry(async () => { + let profile2; + try { + profile2 = await getProfile(options); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return profile2; + }, maxRetries2)).trim(); + return retry(async () => { + let creds; + try { + creds = await getCredentialsFromProfile(imdsProfile, options, init); + } catch (err) { + if (err.statusCode === 401) { + disableFetchToken = false; + } + throw err; + } + return creds; + }, maxRetries2); + }, "getCredentials"); + return async () => { + const endpoint = await getInstanceMetadataEndpoint(); + if (disableFetchToken) { + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (no token fetch)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } else { + let token; + try { + token = (await getMetadataToken({ ...endpoint, timeout })).toString(); + } catch (error) { + if ((error == null ? void 0 : error.statusCode) === 400) { + throw Object.assign(error, { + message: "EC2 Metadata token request returned error" + }); + } else if (error.message === "TimeoutError" || [403, 404, 405].includes(error.statusCode)) { + disableFetchToken = true; + } + logger == null ? void 0 : logger.debug("AWS SDK Instance Metadata", "using v1 fallback (initial)"); + return getCredentials(maxRetries, { ...endpoint, timeout }); + } + return getCredentials(maxRetries, { + ...endpoint, + headers: { + [X_AWS_EC2_METADATA_TOKEN]: token + }, + timeout + }); + } + }; +}, "getInstanceMetadataProvider"); +var getMetadataToken = /* @__PURE__ */ __name(async (options) => httpRequest({ + ...options, + path: IMDS_TOKEN_PATH, + method: "PUT", + headers: { + "x-aws-ec2-metadata-token-ttl-seconds": "21600" + } +}), "getMetadataToken"); +var getProfile = /* @__PURE__ */ __name(async (options) => (await httpRequest({ ...options, path: IMDS_PATH })).toString(), "getProfile"); +var getCredentialsFromProfile = /* @__PURE__ */ __name(async (profile, options, init) => { + const credentialsResponse = JSON.parse( + (await httpRequest({ + ...options, + path: IMDS_PATH + profile + })).toString() + ); + if (!isImdsCredentials(credentialsResponse)) { + throw new import_property_provider.CredentialsProviderError("Invalid response received from instance metadata service.", { + logger: init.logger + }); + } + return fromImdsCredentials(credentialsResponse); +}, "getCredentialsFromProfile"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 82687: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + FetchHttpHandler: () => FetchHttpHandler, + keepAliveSupport: () => keepAliveSupport, + streamCollector: () => streamCollector +}); +module.exports = __toCommonJS(src_exports); + +// src/fetch-http-handler.ts +var import_protocol_http = __nccwpck_require__(64418); +var import_querystring_builder = __nccwpck_require__(68031); + +// src/request-timeout.ts +function requestTimeout(timeoutInMs = 0) { + return new Promise((resolve, reject) => { + if (timeoutInMs) { + setTimeout(() => { + const timeoutError = new Error(`Request did not complete within ${timeoutInMs} ms`); + timeoutError.name = "TimeoutError"; + reject(timeoutError); + }, timeoutInMs); + } + }); +} +__name(requestTimeout, "requestTimeout"); + +// src/fetch-http-handler.ts +var keepAliveSupport = { + supported: void 0 +}; +var _FetchHttpHandler = class _FetchHttpHandler { + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; + } + return new _FetchHttpHandler(instanceOrOptions); + } + constructor(options) { + if (typeof options === "function") { + this.configProvider = options().then((opts) => opts || {}); + } else { + this.config = options ?? {}; + this.configProvider = Promise.resolve(this.config); + } + if (keepAliveSupport.supported === void 0) { + keepAliveSupport.supported = Boolean( + typeof Request !== "undefined" && "keepalive" in new Request("https://[::1]") + ); + } + } + destroy() { + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + const requestTimeoutInMs = this.config.requestTimeout; + const keepAlive = this.config.keepAlive === true; + const credentials = this.config.credentials; + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + return Promise.reject(abortError); + } + let path = request.path; + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const { port, method } = request; + const url = `${request.protocol}//${auth}${request.hostname}${port ? `:${port}` : ""}${path}`; + const body = method === "GET" || method === "HEAD" ? void 0 : request.body; + const requestOptions = { + body, + headers: new Headers(request.headers), + method, + credentials + }; + if (body) { + requestOptions.duplex = "half"; + } + if (typeof AbortController !== "undefined") { + requestOptions.signal = abortSignal; + } + if (keepAliveSupport.supported) { + requestOptions.keepalive = keepAlive; + } + const fetchRequest = new Request(url, requestOptions); + const raceOfPromises = [ + fetch(fetchRequest).then((response) => { + const fetchHeaders = response.headers; + const transformedHeaders = {}; + for (const pair of fetchHeaders.entries()) { + transformedHeaders[pair[0]] = pair[1]; + } + const hasReadableStream = response.body != void 0; + if (!hasReadableStream) { + return response.blob().then((body2) => ({ + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: body2 + }) + })); + } + return { + response: new import_protocol_http.HttpResponse({ + headers: transformedHeaders, + reason: response.statusText, + statusCode: response.status, + body: response.body + }) + }; + }), + requestTimeout(requestTimeoutInMs) + ]; + if (abortSignal) { + raceOfPromises.push( + new Promise((resolve, reject) => { + const onAbort = /* @__PURE__ */ __name(() => { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + abortSignal.addEventListener("abort", onAbort); + } else { + abortSignal.onabort = onAbort; + } + }) + ); + } + return Promise.race(raceOfPromises); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + config[key] = value; + return config; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } +}; +__name(_FetchHttpHandler, "FetchHttpHandler"); +var FetchHttpHandler = _FetchHttpHandler; + +// src/stream-collector.ts +var import_util_base64 = __nccwpck_require__(75600); +var streamCollector = /* @__PURE__ */ __name((stream) => { + if (typeof Blob === "function" && stream instanceof Blob) { + return collectBlob(stream); + } + return collectStream(stream); +}, "streamCollector"); +async function collectBlob(blob) { + const base64 = await readToBase64(blob); + const arrayBuffer = (0, import_util_base64.fromBase64)(base64); + return new Uint8Array(arrayBuffer); +} +__name(collectBlob, "collectBlob"); +async function collectStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectStream, "collectStream"); +function readToBase64(blob) { + return new Promise((resolve, reject) => { + const reader = new FileReader(); + reader.onloadend = () => { + if (reader.readyState !== 2) { + return reject(new Error("Reader aborted too early")); + } + const result = reader.result ?? ""; + const commaIndex = result.indexOf(","); + const dataOffset = commaIndex > -1 ? commaIndex + 1 : result.length; + resolve(result.substring(dataOffset)); + }; + reader.onabort = () => reject(new Error("Read aborted")); + reader.onerror = () => reject(reader.error); + reader.readAsDataURL(blob); + }); +} +__name(readToBase64, "readToBase64"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 3081: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Hash: () => Hash +}); +module.exports = __toCommonJS(src_exports); +var import_util_buffer_from = __nccwpck_require__(31381); +var import_util_utf8 = __nccwpck_require__(41895); +var import_buffer = __nccwpck_require__(14300); +var import_crypto = __nccwpck_require__(6113); +var _Hash = class _Hash { + constructor(algorithmIdentifier, secret) { + this.algorithmIdentifier = algorithmIdentifier; + this.secret = secret; + this.reset(); + } + update(toHash, encoding) { + this.hash.update((0, import_util_utf8.toUint8Array)(castSourceData(toHash, encoding))); + } + digest() { + return Promise.resolve(this.hash.digest()); + } + reset() { + this.hash = this.secret ? (0, import_crypto.createHmac)(this.algorithmIdentifier, castSourceData(this.secret)) : (0, import_crypto.createHash)(this.algorithmIdentifier); + } +}; +__name(_Hash, "Hash"); +var Hash = _Hash; +function castSourceData(toCast, encoding) { + if (import_buffer.Buffer.isBuffer(toCast)) { + return toCast; + } + if (typeof toCast === "string") { + return (0, import_util_buffer_from.fromString)(toCast, encoding); + } + if (ArrayBuffer.isView(toCast)) { + return (0, import_util_buffer_from.fromArrayBuffer)(toCast.buffer, toCast.byteOffset, toCast.byteLength); + } + return (0, import_util_buffer_from.fromArrayBuffer)(toCast); +} +__name(castSourceData, "castSourceData"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 10780: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isArrayBuffer: () => isArrayBuffer +}); +module.exports = __toCommonJS(src_exports); +var isArrayBuffer = /* @__PURE__ */ __name((arg) => typeof ArrayBuffer === "function" && arg instanceof ArrayBuffer || Object.prototype.toString.call(arg) === "[object ArrayBuffer]", "isArrayBuffer"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 82800: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + contentLengthMiddleware: () => contentLengthMiddleware, + contentLengthMiddlewareOptions: () => contentLengthMiddlewareOptions, + getContentLengthPlugin: () => getContentLengthPlugin +}); +module.exports = __toCommonJS(src_exports); +var import_protocol_http = __nccwpck_require__(64418); +var CONTENT_LENGTH_HEADER = "content-length"; +function contentLengthMiddleware(bodyLengthChecker) { + return (next) => async (args) => { + const request = args.request; + if (import_protocol_http.HttpRequest.isInstance(request)) { + const { body, headers } = request; + if (body && Object.keys(headers).map((str) => str.toLowerCase()).indexOf(CONTENT_LENGTH_HEADER) === -1) { + try { + const length = bodyLengthChecker(body); + request.headers = { + ...request.headers, + [CONTENT_LENGTH_HEADER]: String(length) + }; + } catch (error) { + } + } + } + return next({ + ...args, + request + }); + }; +} +__name(contentLengthMiddleware, "contentLengthMiddleware"); +var contentLengthMiddlewareOptions = { + step: "build", + tags: ["SET_CONTENT_LENGTH", "CONTENT_LENGTH"], + name: "contentLengthMiddleware", + override: true +}; +var getContentLengthPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(contentLengthMiddleware(options.bodyLengthChecker), contentLengthMiddlewareOptions); + } +}), "getContentLengthPlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 31518: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointFromConfig = void 0; +const node_config_provider_1 = __nccwpck_require__(33461); +const getEndpointUrlConfig_1 = __nccwpck_require__(7574); +const getEndpointFromConfig = async (serviceId) => (0, node_config_provider_1.loadConfig)((0, getEndpointUrlConfig_1.getEndpointUrlConfig)(serviceId))(); +exports.getEndpointFromConfig = getEndpointFromConfig; + + +/***/ }), + +/***/ 7574: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getEndpointUrlConfig = void 0; +const shared_ini_file_loader_1 = __nccwpck_require__(43507); +const ENV_ENDPOINT_URL = "AWS_ENDPOINT_URL"; +const CONFIG_ENDPOINT_URL = "endpoint_url"; +const getEndpointUrlConfig = (serviceId) => ({ + environmentVariableSelector: (env) => { + const serviceSuffixParts = serviceId.split(" ").map((w) => w.toUpperCase()); + const serviceEndpointUrl = env[[ENV_ENDPOINT_URL, ...serviceSuffixParts].join("_")]; + if (serviceEndpointUrl) + return serviceEndpointUrl; + const endpointUrl = env[ENV_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + configFileSelector: (profile, config) => { + if (config && profile.services) { + const servicesSection = config[["services", profile.services].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (servicesSection) { + const servicePrefixParts = serviceId.split(" ").map((w) => w.toLowerCase()); + const endpointUrl = servicesSection[[servicePrefixParts.join("_"), CONFIG_ENDPOINT_URL].join(shared_ini_file_loader_1.CONFIG_PREFIX_SEPARATOR)]; + if (endpointUrl) + return endpointUrl; + } + } + const endpointUrl = profile[CONFIG_ENDPOINT_URL]; + if (endpointUrl) + return endpointUrl; + return undefined; + }, + default: undefined, +}); +exports.getEndpointUrlConfig = getEndpointUrlConfig; + + +/***/ }), + +/***/ 82918: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + endpointMiddleware: () => endpointMiddleware, + endpointMiddlewareOptions: () => endpointMiddlewareOptions, + getEndpointFromInstructions: () => getEndpointFromInstructions, + getEndpointPlugin: () => getEndpointPlugin, + resolveEndpointConfig: () => resolveEndpointConfig, + resolveParams: () => resolveParams, + toEndpointV1: () => toEndpointV1 +}); +module.exports = __toCommonJS(src_exports); + +// src/service-customizations/s3.ts +var resolveParamsForS3 = /* @__PURE__ */ __name(async (endpointParams) => { + const bucket = (endpointParams == null ? void 0 : endpointParams.Bucket) || ""; + if (typeof endpointParams.Bucket === "string") { + endpointParams.Bucket = bucket.replace(/#/g, encodeURIComponent("#")).replace(/\?/g, encodeURIComponent("?")); + } + if (isArnBucketName(bucket)) { + if (endpointParams.ForcePathStyle === true) { + throw new Error("Path-style addressing cannot be used with ARN buckets"); + } + } else if (!isDnsCompatibleBucketName(bucket) || bucket.indexOf(".") !== -1 && !String(endpointParams.Endpoint).startsWith("http:") || bucket.toLowerCase() !== bucket || bucket.length < 3) { + endpointParams.ForcePathStyle = true; + } + if (endpointParams.DisableMultiRegionAccessPoints) { + endpointParams.disableMultiRegionAccessPoints = true; + endpointParams.DisableMRAP = true; + } + return endpointParams; +}, "resolveParamsForS3"); +var DOMAIN_PATTERN = /^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/; +var IP_ADDRESS_PATTERN = /(\d+\.){3}\d+/; +var DOTS_PATTERN = /\.\./; +var isDnsCompatibleBucketName = /* @__PURE__ */ __name((bucketName) => DOMAIN_PATTERN.test(bucketName) && !IP_ADDRESS_PATTERN.test(bucketName) && !DOTS_PATTERN.test(bucketName), "isDnsCompatibleBucketName"); +var isArnBucketName = /* @__PURE__ */ __name((bucketName) => { + const [arn, partition, service, , , bucket] = bucketName.split(":"); + const isArn = arn === "arn" && bucketName.split(":").length >= 6; + const isValidArn = Boolean(isArn && partition && service && bucket); + if (isArn && !isValidArn) { + throw new Error(`Invalid ARN: ${bucketName} was an invalid ARN.`); + } + return isValidArn; +}, "isArnBucketName"); + +// src/adaptors/createConfigValueProvider.ts +var createConfigValueProvider = /* @__PURE__ */ __name((configKey, canonicalEndpointParamKey, config) => { + const configProvider = /* @__PURE__ */ __name(async () => { + const configValue = config[configKey] ?? config[canonicalEndpointParamKey]; + if (typeof configValue === "function") { + return configValue(); + } + return configValue; + }, "configProvider"); + if (configKey === "credentialScope" || canonicalEndpointParamKey === "CredentialScope") { + return async () => { + const credentials = typeof config.credentials === "function" ? await config.credentials() : config.credentials; + const configValue = (credentials == null ? void 0 : credentials.credentialScope) ?? (credentials == null ? void 0 : credentials.CredentialScope); + return configValue; + }; + } + if (configKey === "endpoint" || canonicalEndpointParamKey === "endpoint") { + return async () => { + const endpoint = await configProvider(); + if (endpoint && typeof endpoint === "object") { + if ("url" in endpoint) { + return endpoint.url.href; + } + if ("hostname" in endpoint) { + const { protocol, hostname, port, path } = endpoint; + return `${protocol}//${hostname}${port ? ":" + port : ""}${path}`; + } + } + return endpoint; + }; + } + return configProvider; +}, "createConfigValueProvider"); + +// src/adaptors/getEndpointFromInstructions.ts +var import_getEndpointFromConfig = __nccwpck_require__(31518); + +// src/adaptors/toEndpointV1.ts +var import_url_parser = __nccwpck_require__(14681); +var toEndpointV1 = /* @__PURE__ */ __name((endpoint) => { + if (typeof endpoint === "object") { + if ("url" in endpoint) { + return (0, import_url_parser.parseUrl)(endpoint.url); + } + return endpoint; + } + return (0, import_url_parser.parseUrl)(endpoint); +}, "toEndpointV1"); + +// src/adaptors/getEndpointFromInstructions.ts +var getEndpointFromInstructions = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig, context) => { + if (!clientConfig.endpoint) { + const endpointFromConfig = await (0, import_getEndpointFromConfig.getEndpointFromConfig)(clientConfig.serviceId || ""); + if (endpointFromConfig) { + clientConfig.endpoint = () => Promise.resolve(toEndpointV1(endpointFromConfig)); + } + } + const endpointParams = await resolveParams(commandInput, instructionsSupplier, clientConfig); + if (typeof clientConfig.endpointProvider !== "function") { + throw new Error("config.endpointProvider is not set."); + } + const endpoint = clientConfig.endpointProvider(endpointParams, context); + return endpoint; +}, "getEndpointFromInstructions"); +var resolveParams = /* @__PURE__ */ __name(async (commandInput, instructionsSupplier, clientConfig) => { + var _a; + const endpointParams = {}; + const instructions = ((_a = instructionsSupplier == null ? void 0 : instructionsSupplier.getEndpointParameterInstructions) == null ? void 0 : _a.call(instructionsSupplier)) || {}; + for (const [name, instruction] of Object.entries(instructions)) { + switch (instruction.type) { + case "staticContextParams": + endpointParams[name] = instruction.value; + break; + case "contextParams": + endpointParams[name] = commandInput[instruction.name]; + break; + case "clientContextParams": + case "builtInParams": + endpointParams[name] = await createConfigValueProvider(instruction.name, name, clientConfig)(); + break; + default: + throw new Error("Unrecognized endpoint parameter instruction: " + JSON.stringify(instruction)); + } + } + if (Object.keys(instructions).length === 0) { + Object.assign(endpointParams, clientConfig); + } + if (String(clientConfig.serviceId).toLowerCase() === "s3") { + await resolveParamsForS3(endpointParams); + } + return endpointParams; +}, "resolveParams"); + +// src/endpointMiddleware.ts +var import_util_middleware = __nccwpck_require__(2390); +var endpointMiddleware = /* @__PURE__ */ __name(({ + config, + instructions +}) => { + return (next, context) => async (args) => { + var _a, _b, _c; + const endpoint = await getEndpointFromInstructions( + args.input, + { + getEndpointParameterInstructions() { + return instructions; + } + }, + { ...config }, + context + ); + context.endpointV2 = endpoint; + context.authSchemes = (_a = endpoint.properties) == null ? void 0 : _a.authSchemes; + const authScheme = (_b = context.authSchemes) == null ? void 0 : _b[0]; + if (authScheme) { + context["signing_region"] = authScheme.signingRegion; + context["signing_service"] = authScheme.signingName; + const smithyContext = (0, import_util_middleware.getSmithyContext)(context); + const httpAuthOption = (_c = smithyContext == null ? void 0 : smithyContext.selectedHttpAuthScheme) == null ? void 0 : _c.httpAuthOption; + if (httpAuthOption) { + httpAuthOption.signingProperties = Object.assign( + httpAuthOption.signingProperties || {}, + { + signing_region: authScheme.signingRegion, + signingRegion: authScheme.signingRegion, + signing_service: authScheme.signingName, + signingName: authScheme.signingName, + signingRegionSet: authScheme.signingRegionSet + }, + authScheme.properties + ); + } + } + return next({ + ...args + }); + }; +}, "endpointMiddleware"); + +// src/getEndpointPlugin.ts +var import_middleware_serde = __nccwpck_require__(81238); +var endpointMiddlewareOptions = { + step: "serialize", + tags: ["ENDPOINT_PARAMETERS", "ENDPOINT_V2", "ENDPOINT"], + name: "endpointV2Middleware", + override: true, + relation: "before", + toMiddleware: import_middleware_serde.serializerMiddlewareOption.name +}; +var getEndpointPlugin = /* @__PURE__ */ __name((config, instructions) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo( + endpointMiddleware({ + config, + instructions + }), + endpointMiddlewareOptions + ); + } +}), "getEndpointPlugin"); + +// src/resolveEndpointConfig.ts + +var resolveEndpointConfig = /* @__PURE__ */ __name((input) => { + const tls = input.tls ?? true; + const { endpoint } = input; + const customEndpointProvider = endpoint != null ? async () => toEndpointV1(await (0, import_util_middleware.normalizeProvider)(endpoint)()) : void 0; + const isCustomEndpoint = !!endpoint; + return { + ...input, + endpoint: customEndpointProvider, + tls, + isCustomEndpoint, + useDualstackEndpoint: (0, import_util_middleware.normalizeProvider)(input.useDualstackEndpoint ?? false), + useFipsEndpoint: (0, import_util_middleware.normalizeProvider)(input.useFipsEndpoint ?? false) + }; +}, "resolveEndpointConfig"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 96039: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + CONFIG_MAX_ATTEMPTS: () => CONFIG_MAX_ATTEMPTS, + CONFIG_RETRY_MODE: () => CONFIG_RETRY_MODE, + ENV_MAX_ATTEMPTS: () => ENV_MAX_ATTEMPTS, + ENV_RETRY_MODE: () => ENV_RETRY_MODE, + NODE_MAX_ATTEMPT_CONFIG_OPTIONS: () => NODE_MAX_ATTEMPT_CONFIG_OPTIONS, + NODE_RETRY_MODE_CONFIG_OPTIONS: () => NODE_RETRY_MODE_CONFIG_OPTIONS, + StandardRetryStrategy: () => StandardRetryStrategy, + defaultDelayDecider: () => defaultDelayDecider, + defaultRetryDecider: () => defaultRetryDecider, + getOmitRetryHeadersPlugin: () => getOmitRetryHeadersPlugin, + getRetryAfterHint: () => getRetryAfterHint, + getRetryPlugin: () => getRetryPlugin, + omitRetryHeadersMiddleware: () => omitRetryHeadersMiddleware, + omitRetryHeadersMiddlewareOptions: () => omitRetryHeadersMiddlewareOptions, + resolveRetryConfig: () => resolveRetryConfig, + retryMiddleware: () => retryMiddleware, + retryMiddlewareOptions: () => retryMiddlewareOptions +}); +module.exports = __toCommonJS(src_exports); + +// src/AdaptiveRetryStrategy.ts + + +// src/StandardRetryStrategy.ts +var import_protocol_http = __nccwpck_require__(64418); + + +var import_uuid = __nccwpck_require__(7761); + +// src/defaultRetryQuota.ts +var import_util_retry = __nccwpck_require__(84902); +var getDefaultRetryQuota = /* @__PURE__ */ __name((initialRetryTokens, options) => { + const MAX_CAPACITY = initialRetryTokens; + const noRetryIncrement = (options == null ? void 0 : options.noRetryIncrement) ?? import_util_retry.NO_RETRY_INCREMENT; + const retryCost = (options == null ? void 0 : options.retryCost) ?? import_util_retry.RETRY_COST; + const timeoutRetryCost = (options == null ? void 0 : options.timeoutRetryCost) ?? import_util_retry.TIMEOUT_RETRY_COST; + let availableCapacity = initialRetryTokens; + const getCapacityAmount = /* @__PURE__ */ __name((error) => error.name === "TimeoutError" ? timeoutRetryCost : retryCost, "getCapacityAmount"); + const hasRetryTokens = /* @__PURE__ */ __name((error) => getCapacityAmount(error) <= availableCapacity, "hasRetryTokens"); + const retrieveRetryTokens = /* @__PURE__ */ __name((error) => { + if (!hasRetryTokens(error)) { + throw new Error("No retry token available"); + } + const capacityAmount = getCapacityAmount(error); + availableCapacity -= capacityAmount; + return capacityAmount; + }, "retrieveRetryTokens"); + const releaseRetryTokens = /* @__PURE__ */ __name((capacityReleaseAmount) => { + availableCapacity += capacityReleaseAmount ?? noRetryIncrement; + availableCapacity = Math.min(availableCapacity, MAX_CAPACITY); + }, "releaseRetryTokens"); + return Object.freeze({ + hasRetryTokens, + retrieveRetryTokens, + releaseRetryTokens + }); +}, "getDefaultRetryQuota"); + +// src/delayDecider.ts + +var defaultDelayDecider = /* @__PURE__ */ __name((delayBase, attempts) => Math.floor(Math.min(import_util_retry.MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)), "defaultDelayDecider"); + +// src/retryDecider.ts +var import_service_error_classification = __nccwpck_require__(6375); +var defaultRetryDecider = /* @__PURE__ */ __name((error) => { + if (!error) { + return false; + } + return (0, import_service_error_classification.isRetryableByTrait)(error) || (0, import_service_error_classification.isClockSkewError)(error) || (0, import_service_error_classification.isThrottlingError)(error) || (0, import_service_error_classification.isTransientError)(error); +}, "defaultRetryDecider"); + +// src/util.ts +var asSdkError = /* @__PURE__ */ __name((error) => { + if (error instanceof Error) + return error; + if (error instanceof Object) + return Object.assign(new Error(), error); + if (typeof error === "string") + return new Error(error); + return new Error(`AWS SDK error wrapper for ${error}`); +}, "asSdkError"); + +// src/StandardRetryStrategy.ts +var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = import_util_retry.RETRY_MODES.STANDARD; + this.retryDecider = (options == null ? void 0 : options.retryDecider) ?? defaultRetryDecider; + this.delayDecider = (options == null ? void 0 : options.delayDecider) ?? defaultDelayDecider; + this.retryQuota = (options == null ? void 0 : options.retryQuota) ?? getDefaultRetryQuota(import_util_retry.INITIAL_RETRY_TOKENS); + } + shouldRetry(error, attempts, maxAttempts) { + return attempts < maxAttempts && this.retryDecider(error) && this.retryQuota.hasRetryTokens(error); + } + async getMaxAttempts() { + let maxAttempts; + try { + maxAttempts = await this.maxAttemptsProvider(); + } catch (error) { + maxAttempts = import_util_retry.DEFAULT_MAX_ATTEMPTS; + } + return maxAttempts; + } + async retry(next, args, options) { + let retryTokenAmount; + let attempts = 0; + let totalDelay = 0; + const maxAttempts = await this.getMaxAttempts(); + const { request } = args; + if (import_protocol_http.HttpRequest.isInstance(request)) { + request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + } + while (true) { + try { + if (import_protocol_http.HttpRequest.isInstance(request)) { + request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + if (options == null ? void 0 : options.beforeRequest) { + await options.beforeRequest(); + } + const { response, output } = await next(args); + if (options == null ? void 0 : options.afterRequest) { + options.afterRequest(response); + } + this.retryQuota.releaseRetryTokens(retryTokenAmount); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalDelay; + return { response, output }; + } catch (e) { + const err = asSdkError(e); + attempts++; + if (this.shouldRetry(err, attempts, maxAttempts)) { + retryTokenAmount = this.retryQuota.retrieveRetryTokens(err); + const delayFromDecider = this.delayDecider( + (0, import_service_error_classification.isThrottlingError)(err) ? import_util_retry.THROTTLING_RETRY_DELAY_BASE : import_util_retry.DEFAULT_RETRY_DELAY_BASE, + attempts + ); + const delayFromResponse = getDelayFromRetryAfterHeader(err.$response); + const delay = Math.max(delayFromResponse || 0, delayFromDecider); + totalDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + continue; + } + if (!err.$metadata) { + err.$metadata = {}; + } + err.$metadata.attempts = attempts; + err.$metadata.totalRetryDelay = totalDelay; + throw err; + } + } + } +}; +__name(_StandardRetryStrategy, "StandardRetryStrategy"); +var StandardRetryStrategy = _StandardRetryStrategy; +var getDelayFromRetryAfterHeader = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return retryAfterSeconds * 1e3; + const retryAfterDate = new Date(retryAfter); + return retryAfterDate.getTime() - Date.now(); +}, "getDelayFromRetryAfterHeader"); + +// src/AdaptiveRetryStrategy.ts +var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy extends StandardRetryStrategy { + constructor(maxAttemptsProvider, options) { + const { rateLimiter, ...superOptions } = options ?? {}; + super(maxAttemptsProvider, superOptions); + this.rateLimiter = rateLimiter ?? new import_util_retry.DefaultRateLimiter(); + this.mode = import_util_retry.RETRY_MODES.ADAPTIVE; + } + async retry(next, args) { + return super.retry(next, args, { + beforeRequest: async () => { + return this.rateLimiter.getSendToken(); + }, + afterRequest: (response) => { + this.rateLimiter.updateClientSendingRate(response); + } + }); + } +}; +__name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); +var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + +// src/configurations.ts +var import_util_middleware = __nccwpck_require__(2390); + +var ENV_MAX_ATTEMPTS = "AWS_MAX_ATTEMPTS"; +var CONFIG_MAX_ATTEMPTS = "max_attempts"; +var NODE_MAX_ATTEMPT_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + const value = env[ENV_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Environment variable ${ENV_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + configFileSelector: (profile) => { + const value = profile[CONFIG_MAX_ATTEMPTS]; + if (!value) + return void 0; + const maxAttempt = parseInt(value); + if (Number.isNaN(maxAttempt)) { + throw new Error(`Shared config file entry ${CONFIG_MAX_ATTEMPTS} mast be a number, got "${value}"`); + } + return maxAttempt; + }, + default: import_util_retry.DEFAULT_MAX_ATTEMPTS +}; +var resolveRetryConfig = /* @__PURE__ */ __name((input) => { + const { retryStrategy } = input; + const maxAttempts = (0, import_util_middleware.normalizeProvider)(input.maxAttempts ?? import_util_retry.DEFAULT_MAX_ATTEMPTS); + return { + ...input, + maxAttempts, + retryStrategy: async () => { + if (retryStrategy) { + return retryStrategy; + } + const retryMode = await (0, import_util_middleware.normalizeProvider)(input.retryMode)(); + if (retryMode === import_util_retry.RETRY_MODES.ADAPTIVE) { + return new import_util_retry.AdaptiveRetryStrategy(maxAttempts); + } + return new import_util_retry.StandardRetryStrategy(maxAttempts); + } + }; +}, "resolveRetryConfig"); +var ENV_RETRY_MODE = "AWS_RETRY_MODE"; +var CONFIG_RETRY_MODE = "retry_mode"; +var NODE_RETRY_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => env[ENV_RETRY_MODE], + configFileSelector: (profile) => profile[CONFIG_RETRY_MODE], + default: import_util_retry.DEFAULT_RETRY_MODE +}; + +// src/omitRetryHeadersMiddleware.ts + + +var omitRetryHeadersMiddleware = /* @__PURE__ */ __name(() => (next) => async (args) => { + const { request } = args; + if (import_protocol_http.HttpRequest.isInstance(request)) { + delete request.headers[import_util_retry.INVOCATION_ID_HEADER]; + delete request.headers[import_util_retry.REQUEST_HEADER]; + } + return next(args); +}, "omitRetryHeadersMiddleware"); +var omitRetryHeadersMiddlewareOptions = { + name: "omitRetryHeadersMiddleware", + tags: ["RETRY", "HEADERS", "OMIT_RETRY_HEADERS"], + relation: "before", + toMiddleware: "awsAuthMiddleware", + override: true +}; +var getOmitRetryHeadersPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.addRelativeTo(omitRetryHeadersMiddleware(), omitRetryHeadersMiddlewareOptions); + } +}), "getOmitRetryHeadersPlugin"); + +// src/retryMiddleware.ts + + +var import_smithy_client = __nccwpck_require__(63570); + + +var import_isStreamingPayload = __nccwpck_require__(18977); +var retryMiddleware = /* @__PURE__ */ __name((options) => (next, context) => async (args) => { + var _a; + let retryStrategy = await options.retryStrategy(); + const maxAttempts = await options.maxAttempts(); + if (isRetryStrategyV2(retryStrategy)) { + retryStrategy = retryStrategy; + let retryToken = await retryStrategy.acquireInitialRetryToken(context["partition_id"]); + let lastError = new Error(); + let attempts = 0; + let totalRetryDelay = 0; + const { request } = args; + const isRequest = import_protocol_http.HttpRequest.isInstance(request); + if (isRequest) { + request.headers[import_util_retry.INVOCATION_ID_HEADER] = (0, import_uuid.v4)(); + } + while (true) { + try { + if (isRequest) { + request.headers[import_util_retry.REQUEST_HEADER] = `attempt=${attempts + 1}; max=${maxAttempts}`; + } + const { response, output } = await next(args); + retryStrategy.recordSuccess(retryToken); + output.$metadata.attempts = attempts + 1; + output.$metadata.totalRetryDelay = totalRetryDelay; + return { response, output }; + } catch (e) { + const retryErrorInfo = getRetryErrorInfo(e); + lastError = asSdkError(e); + if (isRequest && (0, import_isStreamingPayload.isStreamingPayload)(request)) { + (_a = context.logger instanceof import_smithy_client.NoOpLogger ? console : context.logger) == null ? void 0 : _a.warn( + "An error was encountered in a non-retryable streaming request." + ); + throw lastError; + } + try { + retryToken = await retryStrategy.refreshRetryTokenForRetry(retryToken, retryErrorInfo); + } catch (refreshError) { + if (!lastError.$metadata) { + lastError.$metadata = {}; + } + lastError.$metadata.attempts = attempts + 1; + lastError.$metadata.totalRetryDelay = totalRetryDelay; + throw lastError; + } + attempts = retryToken.getRetryCount(); + const delay = retryToken.getRetryDelay(); + totalRetryDelay += delay; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + } + } else { + retryStrategy = retryStrategy; + if (retryStrategy == null ? void 0 : retryStrategy.mode) + context.userAgent = [...context.userAgent || [], ["cfg/retry-mode", retryStrategy.mode]]; + return retryStrategy.retry(next, args); + } +}, "retryMiddleware"); +var isRetryStrategyV2 = /* @__PURE__ */ __name((retryStrategy) => typeof retryStrategy.acquireInitialRetryToken !== "undefined" && typeof retryStrategy.refreshRetryTokenForRetry !== "undefined" && typeof retryStrategy.recordSuccess !== "undefined", "isRetryStrategyV2"); +var getRetryErrorInfo = /* @__PURE__ */ __name((error) => { + const errorInfo = { + error, + errorType: getRetryErrorType(error) + }; + const retryAfterHint = getRetryAfterHint(error.$response); + if (retryAfterHint) { + errorInfo.retryAfterHint = retryAfterHint; + } + return errorInfo; +}, "getRetryErrorInfo"); +var getRetryErrorType = /* @__PURE__ */ __name((error) => { + if ((0, import_service_error_classification.isThrottlingError)(error)) + return "THROTTLING"; + if ((0, import_service_error_classification.isTransientError)(error)) + return "TRANSIENT"; + if ((0, import_service_error_classification.isServerError)(error)) + return "SERVER_ERROR"; + return "CLIENT_ERROR"; +}, "getRetryErrorType"); +var retryMiddlewareOptions = { + name: "retryMiddleware", + tags: ["RETRY"], + step: "finalizeRequest", + priority: "high", + override: true +}; +var getRetryPlugin = /* @__PURE__ */ __name((options) => ({ + applyToStack: (clientStack) => { + clientStack.add(retryMiddleware(options), retryMiddlewareOptions); + } +}), "getRetryPlugin"); +var getRetryAfterHint = /* @__PURE__ */ __name((response) => { + if (!import_protocol_http.HttpResponse.isInstance(response)) + return; + const retryAfterHeaderName = Object.keys(response.headers).find((key) => key.toLowerCase() === "retry-after"); + if (!retryAfterHeaderName) + return; + const retryAfter = response.headers[retryAfterHeaderName]; + const retryAfterSeconds = Number(retryAfter); + if (!Number.isNaN(retryAfterSeconds)) + return new Date(retryAfterSeconds * 1e3); + const retryAfterDate = new Date(retryAfter); + return retryAfterDate; +}, "getRetryAfterHint"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 18977: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.isStreamingPayload = void 0; +const stream_1 = __nccwpck_require__(12781); +const isStreamingPayload = (request) => (request === null || request === void 0 ? void 0 : request.body) instanceof stream_1.Readable || + (typeof ReadableStream !== "undefined" && (request === null || request === void 0 ? void 0 : request.body) instanceof ReadableStream); +exports.isStreamingPayload = isStreamingPayload; + + +/***/ }), + +/***/ 7761: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +Object.defineProperty(exports, "NIL", ({ + enumerable: true, + get: function () { + return _nil.default; + } +})); +Object.defineProperty(exports, "parse", ({ + enumerable: true, + get: function () { + return _parse.default; + } +})); +Object.defineProperty(exports, "stringify", ({ + enumerable: true, + get: function () { + return _stringify.default; + } +})); +Object.defineProperty(exports, "v1", ({ + enumerable: true, + get: function () { + return _v.default; + } +})); +Object.defineProperty(exports, "v3", ({ + enumerable: true, + get: function () { + return _v2.default; + } +})); +Object.defineProperty(exports, "v4", ({ + enumerable: true, + get: function () { + return _v3.default; + } +})); +Object.defineProperty(exports, "v5", ({ + enumerable: true, + get: function () { + return _v4.default; + } +})); +Object.defineProperty(exports, "validate", ({ + enumerable: true, + get: function () { + return _validate.default; + } +})); +Object.defineProperty(exports, "version", ({ + enumerable: true, + get: function () { + return _version.default; + } +})); + +var _v = _interopRequireDefault(__nccwpck_require__(36310)); + +var _v2 = _interopRequireDefault(__nccwpck_require__(9465)); + +var _v3 = _interopRequireDefault(__nccwpck_require__(86001)); + +var _v4 = _interopRequireDefault(__nccwpck_require__(38310)); + +var _nil = _interopRequireDefault(__nccwpck_require__(3436)); + +var _version = _interopRequireDefault(__nccwpck_require__(17780)); + +var _validate = _interopRequireDefault(__nccwpck_require__(66992)); + +var _stringify = _interopRequireDefault(__nccwpck_require__(79618)); + +var _parse = _interopRequireDefault(__nccwpck_require__(40086)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/***/ }), + +/***/ 11380: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function md5(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('md5').update(bytes).digest(); +} + +var _default = md5; +exports["default"] = _default; + +/***/ }), + +/***/ 34672: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +var _default = { + randomUUID: _crypto.default.randomUUID +}; +exports["default"] = _default; + +/***/ }), + +/***/ 3436: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = '00000000-0000-0000-0000-000000000000'; +exports["default"] = _default; + +/***/ }), + +/***/ 40086: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(66992)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function parse(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + let v; + const arr = new Uint8Array(16); // Parse ########-....-....-....-............ + + arr[0] = (v = parseInt(uuid.slice(0, 8), 16)) >>> 24; + arr[1] = v >>> 16 & 0xff; + arr[2] = v >>> 8 & 0xff; + arr[3] = v & 0xff; // Parse ........-####-....-....-............ + + arr[4] = (v = parseInt(uuid.slice(9, 13), 16)) >>> 8; + arr[5] = v & 0xff; // Parse ........-....-####-....-............ + + arr[6] = (v = parseInt(uuid.slice(14, 18), 16)) >>> 8; + arr[7] = v & 0xff; // Parse ........-....-....-####-............ + + arr[8] = (v = parseInt(uuid.slice(19, 23), 16)) >>> 8; + arr[9] = v & 0xff; // Parse ........-....-....-....-############ + // (Use "/" to avoid 32-bit truncation when bit-shifting high-order bytes) + + arr[10] = (v = parseInt(uuid.slice(24, 36), 16)) / 0x10000000000 & 0xff; + arr[11] = v / 0x100000000 & 0xff; + arr[12] = v >>> 24 & 0xff; + arr[13] = v >>> 16 & 0xff; + arr[14] = v >>> 8 & 0xff; + arr[15] = v & 0xff; + return arr; +} + +var _default = parse; +exports["default"] = _default; + +/***/ }), + +/***/ 3194: +/***/ ((__unused_webpack_module, exports) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +var _default = /^(?:[0-9a-f]{8}-[0-9a-f]{4}-[1-5][0-9a-f]{3}-[89ab][0-9a-f]{3}-[0-9a-f]{12}|00000000-0000-0000-0000-000000000000)$/i; +exports["default"] = _default; + +/***/ }), + +/***/ 68136: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = rng; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const rnds8Pool = new Uint8Array(256); // # of random values to pre-allocate + +let poolPtr = rnds8Pool.length; + +function rng() { + if (poolPtr > rnds8Pool.length - 16) { + _crypto.default.randomFillSync(rnds8Pool); + + poolPtr = 0; + } + + return rnds8Pool.slice(poolPtr, poolPtr += 16); +} + +/***/ }), + +/***/ 46679: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function sha1(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } + + return _crypto.default.createHash('sha1').update(bytes).digest(); +} + +var _default = sha1; +exports["default"] = _default; + +/***/ }), + +/***/ 79618: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; +exports.unsafeStringify = unsafeStringify; + +var _validate = _interopRequireDefault(__nccwpck_require__(66992)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +const byteToHex = []; + +for (let i = 0; i < 256; ++i) { + byteToHex.push((i + 0x100).toString(16).slice(1)); +} + +function unsafeStringify(arr, offset = 0) { + // Note: Be careful editing this code! It's been tuned for performance + // and works in ways you may not expect. See https://github.com/uuidjs/uuid/pull/434 + return byteToHex[arr[offset + 0]] + byteToHex[arr[offset + 1]] + byteToHex[arr[offset + 2]] + byteToHex[arr[offset + 3]] + '-' + byteToHex[arr[offset + 4]] + byteToHex[arr[offset + 5]] + '-' + byteToHex[arr[offset + 6]] + byteToHex[arr[offset + 7]] + '-' + byteToHex[arr[offset + 8]] + byteToHex[arr[offset + 9]] + '-' + byteToHex[arr[offset + 10]] + byteToHex[arr[offset + 11]] + byteToHex[arr[offset + 12]] + byteToHex[arr[offset + 13]] + byteToHex[arr[offset + 14]] + byteToHex[arr[offset + 15]]; +} + +function stringify(arr, offset = 0) { + const uuid = unsafeStringify(arr, offset); // Consistency check for valid UUID. If this throws, it's likely due to one + // of the following: + // - One or more input array values don't map to a hex octet (leading to + // "undefined" in the uuid) + // - Invalid input values for the RFC `version` or `variant` fields + + if (!(0, _validate.default)(uuid)) { + throw TypeError('Stringified UUID is invalid'); + } + + return uuid; +} + +var _default = stringify; +exports["default"] = _default; + +/***/ }), + +/***/ 36310: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _rng = _interopRequireDefault(__nccwpck_require__(68136)); + +var _stringify = __nccwpck_require__(79618); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +// **`v1()` - Generate time-based UUID** +// +// Inspired by https://github.com/LiosK/UUID.js +// and http://docs.python.org/library/uuid.html +let _nodeId; + +let _clockseq; // Previous uuid creation time + + +let _lastMSecs = 0; +let _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details + +function v1(options, buf, offset) { + let i = buf && offset || 0; + const b = buf || new Array(16); + options = options || {}; + let node = options.node || _nodeId; + let clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not + // specified. We do this lazily to minimize issues related to insufficient + // system entropy. See #189 + + if (node == null || clockseq == null) { + const seedBytes = options.random || (options.rng || _rng.default)(); + + if (node == null) { + // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) + node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; + } + + if (clockseq == null) { + // Per 4.2.2, randomize (14 bit) clockseq + clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; + } + } // UUID timestamps are 100 nano-second units since the Gregorian epoch, + // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so + // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' + // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. + + + let msecs = options.msecs !== undefined ? options.msecs : Date.now(); // Per 4.2.1.2, use count of uuid's generated during the current clock + // cycle to simulate higher resolution clock + + let nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) + + const dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression + + if (dt < 0 && options.clockseq === undefined) { + clockseq = clockseq + 1 & 0x3fff; + } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new + // time interval + + + if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { + nsecs = 0; + } // Per 4.2.1.2 Throw error if too many uuids are requested + + + if (nsecs >= 10000) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } + + _lastMSecs = msecs; + _lastNSecs = nsecs; + _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch + + msecs += 12219292800000; // `time_low` + + const tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; + b[i++] = tl >>> 24 & 0xff; + b[i++] = tl >>> 16 & 0xff; + b[i++] = tl >>> 8 & 0xff; + b[i++] = tl & 0xff; // `time_mid` + + const tmh = msecs / 0x100000000 * 10000 & 0xfffffff; + b[i++] = tmh >>> 8 & 0xff; + b[i++] = tmh & 0xff; // `time_high_and_version` + + b[i++] = tmh >>> 24 & 0xf | 0x10; // include version + + b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) + + b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` + + b[i++] = clockseq & 0xff; // `node` + + for (let n = 0; n < 6; ++n) { + b[i + n] = node[n]; + } + + return buf || (0, _stringify.unsafeStringify)(b); +} + +var _default = v1; +exports["default"] = _default; + +/***/ }), + +/***/ 9465: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(2568)); + +var _md = _interopRequireDefault(__nccwpck_require__(11380)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v3 = (0, _v.default)('v3', 0x30, _md.default); +var _default = v3; +exports["default"] = _default; + +/***/ }), + +/***/ 2568: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports.URL = exports.DNS = void 0; +exports["default"] = v35; + +var _stringify = __nccwpck_require__(79618); + +var _parse = _interopRequireDefault(__nccwpck_require__(40086)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function stringToBytes(str) { + str = unescape(encodeURIComponent(str)); // UTF8 escape + + const bytes = []; + + for (let i = 0; i < str.length; ++i) { + bytes.push(str.charCodeAt(i)); + } + + return bytes; +} + +const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; +exports.DNS = DNS; +const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; +exports.URL = URL; + +function v35(name, version, hashfunc) { + function generateUUID(value, namespace, buf, offset) { + var _namespace; + + if (typeof value === 'string') { + value = stringToBytes(value); + } + + if (typeof namespace === 'string') { + namespace = (0, _parse.default)(namespace); + } + + if (((_namespace = namespace) === null || _namespace === void 0 ? void 0 : _namespace.length) !== 16) { + throw TypeError('Namespace must be array-like (16 iterable integer values, 0-255)'); + } // Compute hash of namespace and value, Per 4.3 + // Future: Use spread syntax when supported on all platforms, e.g. `bytes = + // hashfunc([...namespace, ... value])` + + + let bytes = new Uint8Array(16 + value.length); + bytes.set(namespace); + bytes.set(value, namespace.length); + bytes = hashfunc(bytes); + bytes[6] = bytes[6] & 0x0f | version; + bytes[8] = bytes[8] & 0x3f | 0x80; + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = bytes[i]; + } + + return buf; + } + + return (0, _stringify.unsafeStringify)(bytes); + } // Function#name is not settable on some platforms (#270) + + + try { + generateUUID.name = name; // eslint-disable-next-line no-empty + } catch (err) {} // For CommonJS default export support + + + generateUUID.DNS = DNS; + generateUUID.URL = URL; + return generateUUID; +} + +/***/ }), + +/***/ 86001: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _native = _interopRequireDefault(__nccwpck_require__(34672)); + +var _rng = _interopRequireDefault(__nccwpck_require__(68136)); + +var _stringify = __nccwpck_require__(79618); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function v4(options, buf, offset) { + if (_native.default.randomUUID && !buf && !options) { + return _native.default.randomUUID(); + } + + options = options || {}; + + const rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` + + + rnds[6] = rnds[6] & 0x0f | 0x40; + rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided + + if (buf) { + offset = offset || 0; + + for (let i = 0; i < 16; ++i) { + buf[offset + i] = rnds[i]; + } + + return buf; + } + + return (0, _stringify.unsafeStringify)(rnds); +} + +var _default = v4; +exports["default"] = _default; + +/***/ }), + +/***/ 38310: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(2568)); + +var _sha = _interopRequireDefault(__nccwpck_require__(46679)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v5 = (0, _v.default)('v5', 0x50, _sha.default); +var _default = v5; +exports["default"] = _default; + +/***/ }), + +/***/ 66992: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _regex = _interopRequireDefault(__nccwpck_require__(3194)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function validate(uuid) { + return typeof uuid === 'string' && _regex.default.test(uuid); +} + +var _default = validate; +exports["default"] = _default; + +/***/ }), + +/***/ 17780: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _validate = _interopRequireDefault(__nccwpck_require__(66992)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function version(uuid) { + if (!(0, _validate.default)(uuid)) { + throw TypeError('Invalid UUID'); + } + + return parseInt(uuid.slice(14, 15), 16); +} + +var _default = version; +exports["default"] = _default; + +/***/ }), + +/***/ 81238: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + deserializerMiddleware: () => deserializerMiddleware, + deserializerMiddlewareOption: () => deserializerMiddlewareOption, + getSerdePlugin: () => getSerdePlugin, + serializerMiddleware: () => serializerMiddleware, + serializerMiddlewareOption: () => serializerMiddlewareOption +}); +module.exports = __toCommonJS(src_exports); + +// src/deserializerMiddleware.ts +var deserializerMiddleware = /* @__PURE__ */ __name((options, deserializer) => (next) => async (args) => { + const { response } = await next(args); + try { + const parsed = await deserializer(response, options); + return { + response, + output: parsed + }; + } catch (error) { + Object.defineProperty(error, "$response", { + value: response + }); + if (!("$metadata" in error)) { + const hint = `Deserialization error: to see the raw response, inspect the hidden field {error}.$response on this object.`; + error.message += "\n " + hint; + if (typeof error.$responseBodyText !== "undefined") { + if (error.$response) { + error.$response.body = error.$responseBodyText; + } + } + } + throw error; + } +}, "deserializerMiddleware"); + +// src/serializerMiddleware.ts +var serializerMiddleware = /* @__PURE__ */ __name((options, serializer) => (next, context) => async (args) => { + var _a; + const endpoint = ((_a = context.endpointV2) == null ? void 0 : _a.url) && options.urlParser ? async () => options.urlParser(context.endpointV2.url) : options.endpoint; + if (!endpoint) { + throw new Error("No valid endpoint provider available."); + } + const request = await serializer(args.input, { ...options, endpoint }); + return next({ + ...args, + request + }); +}, "serializerMiddleware"); + +// src/serdePlugin.ts +var deserializerMiddlewareOption = { + name: "deserializerMiddleware", + step: "deserialize", + tags: ["DESERIALIZER"], + override: true +}; +var serializerMiddlewareOption = { + name: "serializerMiddleware", + step: "serialize", + tags: ["SERIALIZER"], + override: true +}; +function getSerdePlugin(config, serializer, deserializer) { + return { + applyToStack: (commandStack) => { + commandStack.add(deserializerMiddleware(config, deserializer), deserializerMiddlewareOption); + commandStack.add(serializerMiddleware(config, serializer), serializerMiddlewareOption); + } + }; +} +__name(getSerdePlugin, "getSerdePlugin"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 97911: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + constructStack: () => constructStack +}); +module.exports = __toCommonJS(src_exports); + +// src/MiddlewareStack.ts +var getAllAliases = /* @__PURE__ */ __name((name, aliases) => { + const _aliases = []; + if (name) { + _aliases.push(name); + } + if (aliases) { + for (const alias of aliases) { + _aliases.push(alias); + } + } + return _aliases; +}, "getAllAliases"); +var getMiddlewareNameWithAliases = /* @__PURE__ */ __name((name, aliases) => { + return `${name || "anonymous"}${aliases && aliases.length > 0 ? ` (a.k.a. ${aliases.join(",")})` : ""}`; +}, "getMiddlewareNameWithAliases"); +var constructStack = /* @__PURE__ */ __name(() => { + let absoluteEntries = []; + let relativeEntries = []; + let identifyOnResolve = false; + const entriesNameSet = /* @__PURE__ */ new Set(); + const sort = /* @__PURE__ */ __name((entries) => entries.sort( + (a, b) => stepWeights[b.step] - stepWeights[a.step] || priorityWeights[b.priority || "normal"] - priorityWeights[a.priority || "normal"] + ), "sort"); + const removeByName = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const aliases = getAllAliases(entry.name, entry.aliases); + if (aliases.includes(toRemove)) { + isRemoved = true; + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByName"); + const removeByReference = /* @__PURE__ */ __name((toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + if (entry.middleware === toRemove) { + isRemoved = true; + for (const alias of getAllAliases(entry.name, entry.aliases)) { + entriesNameSet.delete(alias); + } + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, "removeByReference"); + const cloneTo = /* @__PURE__ */ __name((toStack) => { + var _a; + absoluteEntries.forEach((entry) => { + toStack.add(entry.middleware, { ...entry }); + }); + relativeEntries.forEach((entry) => { + toStack.addRelativeTo(entry.middleware, { ...entry }); + }); + (_a = toStack.identifyOnResolve) == null ? void 0 : _a.call(toStack, stack.identifyOnResolve()); + return toStack; + }, "cloneTo"); + const expandRelativeMiddlewareList = /* @__PURE__ */ __name((from) => { + const expandedMiddlewareList = []; + from.before.forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + expandedMiddlewareList.push(from); + from.after.reverse().forEach((entry) => { + if (entry.before.length === 0 && entry.after.length === 0) { + expandedMiddlewareList.push(entry); + } else { + expandedMiddlewareList.push(...expandRelativeMiddlewareList(entry)); + } + }); + return expandedMiddlewareList; + }, "expandRelativeMiddlewareList"); + const getMiddlewareList = /* @__PURE__ */ __name((debug = false) => { + const normalizedAbsoluteEntries = []; + const normalizedRelativeEntries = []; + const normalizedEntriesNameMap = {}; + absoluteEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedAbsoluteEntries.push(normalizedEntry); + }); + relativeEntries.forEach((entry) => { + const normalizedEntry = { + ...entry, + before: [], + after: [] + }; + for (const alias of getAllAliases(normalizedEntry.name, normalizedEntry.aliases)) { + normalizedEntriesNameMap[alias] = normalizedEntry; + } + normalizedRelativeEntries.push(normalizedEntry); + }); + normalizedRelativeEntries.forEach((entry) => { + if (entry.toMiddleware) { + const toMiddleware = normalizedEntriesNameMap[entry.toMiddleware]; + if (toMiddleware === void 0) { + if (debug) { + return; + } + throw new Error( + `${entry.toMiddleware} is not found when adding ${getMiddlewareNameWithAliases(entry.name, entry.aliases)} middleware ${entry.relation} ${entry.toMiddleware}` + ); + } + if (entry.relation === "after") { + toMiddleware.after.push(entry); + } + if (entry.relation === "before") { + toMiddleware.before.push(entry); + } + } + }); + const mainChain = sort(normalizedAbsoluteEntries).map(expandRelativeMiddlewareList).reduce( + (wholeList, expandedMiddlewareList) => { + wholeList.push(...expandedMiddlewareList); + return wholeList; + }, + [] + ); + return mainChain; + }, "getMiddlewareList"); + const stack = { + add: (middleware, options = {}) => { + const { name, override, aliases: _aliases } = options; + const entry = { + step: "initialize", + priority: "normal", + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = absoluteEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = absoluteEntries[toOverrideIndex]; + if (toOverride.step !== entry.step || entry.priority !== toOverride.priority) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware with ${toOverride.priority} priority in ${toOverride.step} step cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware with ${entry.priority} priority in ${entry.step} step.` + ); + } + absoluteEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + absoluteEntries.push(entry); + }, + addRelativeTo: (middleware, options) => { + const { name, override, aliases: _aliases } = options; + const entry = { + middleware, + ...options + }; + const aliases = getAllAliases(name, _aliases); + if (aliases.length > 0) { + if (aliases.some((alias) => entriesNameSet.has(alias))) { + if (!override) + throw new Error(`Duplicate middleware name '${getMiddlewareNameWithAliases(name, _aliases)}'`); + for (const alias of aliases) { + const toOverrideIndex = relativeEntries.findIndex( + (entry2) => { + var _a; + return entry2.name === alias || ((_a = entry2.aliases) == null ? void 0 : _a.some((a) => a === alias)); + } + ); + if (toOverrideIndex === -1) { + continue; + } + const toOverride = relativeEntries[toOverrideIndex]; + if (toOverride.toMiddleware !== entry.toMiddleware || toOverride.relation !== entry.relation) { + throw new Error( + `"${getMiddlewareNameWithAliases(toOverride.name, toOverride.aliases)}" middleware ${toOverride.relation} "${toOverride.toMiddleware}" middleware cannot be overridden by "${getMiddlewareNameWithAliases(name, _aliases)}" middleware ${entry.relation} "${entry.toMiddleware}" middleware.` + ); + } + relativeEntries.splice(toOverrideIndex, 1); + } + } + for (const alias of aliases) { + entriesNameSet.add(alias); + } + } + relativeEntries.push(entry); + }, + clone: () => cloneTo(constructStack()), + use: (plugin) => { + plugin.applyToStack(stack); + }, + remove: (toRemove) => { + if (typeof toRemove === "string") + return removeByName(toRemove); + else + return removeByReference(toRemove); + }, + removeByTag: (toRemove) => { + let isRemoved = false; + const filterCb = /* @__PURE__ */ __name((entry) => { + const { tags, name, aliases: _aliases } = entry; + if (tags && tags.includes(toRemove)) { + const aliases = getAllAliases(name, _aliases); + for (const alias of aliases) { + entriesNameSet.delete(alias); + } + isRemoved = true; + return false; + } + return true; + }, "filterCb"); + absoluteEntries = absoluteEntries.filter(filterCb); + relativeEntries = relativeEntries.filter(filterCb); + return isRemoved; + }, + concat: (from) => { + var _a; + const cloned = cloneTo(constructStack()); + cloned.use(from); + cloned.identifyOnResolve( + identifyOnResolve || cloned.identifyOnResolve() || (((_a = from.identifyOnResolve) == null ? void 0 : _a.call(from)) ?? false) + ); + return cloned; + }, + applyToStack: cloneTo, + identify: () => { + return getMiddlewareList(true).map((mw) => { + const step = mw.step ?? mw.relation + " " + mw.toMiddleware; + return getMiddlewareNameWithAliases(mw.name, mw.aliases) + " - " + step; + }); + }, + identifyOnResolve(toggle) { + if (typeof toggle === "boolean") + identifyOnResolve = toggle; + return identifyOnResolve; + }, + resolve: (handler, context) => { + for (const middleware of getMiddlewareList().map((entry) => entry.middleware).reverse()) { + handler = middleware(handler, context); + } + if (identifyOnResolve) { + console.log(stack.identify()); + } + return handler; + } + }; + return stack; +}, "constructStack"); +var stepWeights = { + initialize: 5, + serialize: 4, + build: 3, + finalizeRequest: 2, + deserialize: 1 +}; +var priorityWeights = { + high: 3, + normal: 2, + low: 1 +}; +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 33461: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + loadConfig: () => loadConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/configLoader.ts + + +// src/fromEnv.ts +var import_property_provider = __nccwpck_require__(79721); + +// src/getSelectorName.ts +function getSelectorName(functionString) { + try { + const constants = new Set(Array.from(functionString.match(/([A-Z_]){3,}/g) ?? [])); + constants.delete("CONFIG"); + constants.delete("CONFIG_PREFIX_SEPARATOR"); + constants.delete("ENV"); + return [...constants].join(", "); + } catch (e) { + return functionString; + } +} +__name(getSelectorName, "getSelectorName"); + +// src/fromEnv.ts +var fromEnv = /* @__PURE__ */ __name((envVarSelector, logger) => async () => { + try { + const config = envVarSelector(process.env); + if (config === void 0) { + throw new Error(); + } + return config; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in ENV: ${getSelectorName(envVarSelector.toString())}`, + { logger } + ); + } +}, "fromEnv"); + +// src/fromSharedConfigFiles.ts + +var import_shared_ini_file_loader = __nccwpck_require__(43507); +var fromSharedConfigFiles = /* @__PURE__ */ __name((configSelector, { preferredFile = "config", ...init } = {}) => async () => { + const profile = (0, import_shared_ini_file_loader.getProfileName)(init); + const { configFile, credentialsFile } = await (0, import_shared_ini_file_loader.loadSharedConfigFiles)(init); + const profileFromCredentials = credentialsFile[profile] || {}; + const profileFromConfig = configFile[profile] || {}; + const mergedProfile = preferredFile === "config" ? { ...profileFromCredentials, ...profileFromConfig } : { ...profileFromConfig, ...profileFromCredentials }; + try { + const cfgFile = preferredFile === "config" ? configFile : credentialsFile; + const configValue = configSelector(mergedProfile, cfgFile); + if (configValue === void 0) { + throw new Error(); + } + return configValue; + } catch (e) { + throw new import_property_provider.CredentialsProviderError( + e.message || `Not found in config files w/ profile [${profile}]: ${getSelectorName(configSelector.toString())}`, + { logger: init.logger } + ); + } +}, "fromSharedConfigFiles"); + +// src/fromStatic.ts + +var isFunction = /* @__PURE__ */ __name((func) => typeof func === "function", "isFunction"); +var fromStatic = /* @__PURE__ */ __name((defaultValue) => isFunction(defaultValue) ? async () => await defaultValue() : (0, import_property_provider.fromStatic)(defaultValue), "fromStatic"); + +// src/configLoader.ts +var loadConfig = /* @__PURE__ */ __name(({ environmentVariableSelector, configFileSelector, default: defaultValue }, configuration = {}) => (0, import_property_provider.memoize)( + (0, import_property_provider.chain)( + fromEnv(environmentVariableSelector), + fromSharedConfigFiles(configFileSelector, configuration), + fromStatic(defaultValue) + ) +), "loadConfig"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 20258: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + DEFAULT_REQUEST_TIMEOUT: () => DEFAULT_REQUEST_TIMEOUT, + NodeHttp2Handler: () => NodeHttp2Handler, + NodeHttpHandler: () => NodeHttpHandler, + streamCollector: () => streamCollector +}); +module.exports = __toCommonJS(src_exports); + +// src/node-http-handler.ts +var import_protocol_http = __nccwpck_require__(64418); +var import_querystring_builder = __nccwpck_require__(68031); +var import_http = __nccwpck_require__(13685); +var import_https = __nccwpck_require__(95687); + +// src/constants.ts +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "EPIPE", "ETIMEDOUT"]; + +// src/get-transformed-headers.ts +var getTransformedHeaders = /* @__PURE__ */ __name((headers) => { + const transformedHeaders = {}; + for (const name of Object.keys(headers)) { + const headerValues = headers[name]; + transformedHeaders[name] = Array.isArray(headerValues) ? headerValues.join(",") : headerValues; + } + return transformedHeaders; +}, "getTransformedHeaders"); + +// src/set-connection-timeout.ts +var setConnectionTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + if (!timeoutInMs) { + return; + } + const timeoutId = setTimeout(() => { + request.destroy(); + reject( + Object.assign(new Error(`Socket timed out without establishing a connection within ${timeoutInMs} ms`), { + name: "TimeoutError" + }) + ); + }, timeoutInMs); + request.on("socket", (socket) => { + if (socket.connecting) { + socket.on("connect", () => { + clearTimeout(timeoutId); + }); + } else { + clearTimeout(timeoutId); + } + }); +}, "setConnectionTimeout"); + +// src/set-socket-keep-alive.ts +var setSocketKeepAlive = /* @__PURE__ */ __name((request, { keepAlive, keepAliveMsecs }) => { + if (keepAlive !== true) { + return; + } + request.on("socket", (socket) => { + socket.setKeepAlive(keepAlive, keepAliveMsecs || 0); + }); +}, "setSocketKeepAlive"); + +// src/set-socket-timeout.ts +var setSocketTimeout = /* @__PURE__ */ __name((request, reject, timeoutInMs = 0) => { + request.setTimeout(timeoutInMs, () => { + request.destroy(); + reject(Object.assign(new Error(`Connection timed out after ${timeoutInMs} ms`), { name: "TimeoutError" })); + }); +}, "setSocketTimeout"); + +// src/write-request-body.ts +var import_stream = __nccwpck_require__(12781); +var MIN_WAIT_TIME = 1e3; +async function writeRequestBody(httpRequest, request, maxContinueTimeoutMs = MIN_WAIT_TIME) { + const headers = request.headers ?? {}; + const expect = headers["Expect"] || headers["expect"]; + let timeoutId = -1; + let hasError = false; + if (expect === "100-continue") { + await Promise.race([ + new Promise((resolve) => { + timeoutId = Number(setTimeout(resolve, Math.max(MIN_WAIT_TIME, maxContinueTimeoutMs))); + }), + new Promise((resolve) => { + httpRequest.on("continue", () => { + clearTimeout(timeoutId); + resolve(); + }); + httpRequest.on("error", () => { + hasError = true; + clearTimeout(timeoutId); + resolve(); + }); + }) + ]); + } + if (!hasError) { + writeBody(httpRequest, request.body); + } +} +__name(writeRequestBody, "writeRequestBody"); +function writeBody(httpRequest, body) { + if (body instanceof import_stream.Readable) { + body.pipe(httpRequest); + return; + } + if (body) { + if (Buffer.isBuffer(body) || typeof body === "string") { + httpRequest.end(body); + return; + } + const uint8 = body; + if (typeof uint8 === "object" && uint8.buffer && typeof uint8.byteOffset === "number" && typeof uint8.byteLength === "number") { + httpRequest.end(Buffer.from(uint8.buffer, uint8.byteOffset, uint8.byteLength)); + return; + } + httpRequest.end(Buffer.from(body)); + return; + } + httpRequest.end(); +} +__name(writeBody, "writeBody"); + +// src/node-http-handler.ts +var DEFAULT_REQUEST_TIMEOUT = 0; +var _NodeHttpHandler = class _NodeHttpHandler { + constructor(options) { + this.socketWarningTimestamp = 0; + // Node http handler is hard-coded to http/1.1: https://github.com/nodejs/node/blob/ff5664b83b89c55e4ab5d5f60068fb457f1f5872/lib/_http_server.js#L286 + this.metadata = { handlerProtocol: "http/1.1" }; + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((_options) => { + resolve(this.resolveDefaultConfig(_options)); + }).catch(reject); + } else { + resolve(this.resolveDefaultConfig(options)); + } + }); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; + } + return new _NodeHttpHandler(instanceOrOptions); + } + /** + * @internal + * + * @param agent - http(s) agent in use by the NodeHttpHandler instance. + * @param socketWarningTimestamp - last socket usage check timestamp. + * @param logger - channel for the warning. + * @returns timestamp of last emitted warning. + */ + static checkSocketUsage(agent, socketWarningTimestamp, logger = console) { + var _a, _b, _c; + const { sockets, requests, maxSockets } = agent; + if (typeof maxSockets !== "number" || maxSockets === Infinity) { + return socketWarningTimestamp; + } + const interval = 15e3; + if (Date.now() - interval < socketWarningTimestamp) { + return socketWarningTimestamp; + } + if (sockets && requests) { + for (const origin in sockets) { + const socketsInUse = ((_a = sockets[origin]) == null ? void 0 : _a.length) ?? 0; + const requestsEnqueued = ((_b = requests[origin]) == null ? void 0 : _b.length) ?? 0; + if (socketsInUse >= maxSockets && requestsEnqueued >= 2 * maxSockets) { + (_c = logger == null ? void 0 : logger.warn) == null ? void 0 : _c.call( + logger, + `@smithy/node-http-handler:WARN - socket usage at capacity=${socketsInUse} and ${requestsEnqueued} additional requests are enqueued. +See https://docs.aws.amazon.com/sdk-for-javascript/v3/developer-guide/node-configuring-maxsockets.html +or increase socketAcquisitionWarningTimeout=(millis) in the NodeHttpHandler config.` + ); + return Date.now(); + } + } + } + return socketWarningTimestamp; + } + resolveDefaultConfig(options) { + const { requestTimeout, connectionTimeout, socketTimeout, httpAgent, httpsAgent } = options || {}; + const keepAlive = true; + const maxSockets = 50; + return { + connectionTimeout, + requestTimeout: requestTimeout ?? socketTimeout, + httpAgent: (() => { + if (httpAgent instanceof import_http.Agent || typeof (httpAgent == null ? void 0 : httpAgent.destroy) === "function") { + return httpAgent; + } + return new import_http.Agent({ keepAlive, maxSockets, ...httpAgent }); + })(), + httpsAgent: (() => { + if (httpsAgent instanceof import_https.Agent || typeof (httpsAgent == null ? void 0 : httpsAgent.destroy) === "function") { + return httpsAgent; + } + return new import_https.Agent({ keepAlive, maxSockets, ...httpsAgent }); + })(), + logger: console + }; + } + destroy() { + var _a, _b, _c, _d; + (_b = (_a = this.config) == null ? void 0 : _a.httpAgent) == null ? void 0 : _b.destroy(); + (_d = (_c = this.config) == null ? void 0 : _c.httpsAgent) == null ? void 0 : _d.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + } + let socketCheckTimeoutId; + return new Promise((_resolve, _reject) => { + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + clearTimeout(socketCheckTimeoutId); + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + clearTimeout(socketCheckTimeoutId); + _reject(arg); + }, "reject"); + if (!this.config) { + throw new Error("Node HTTP request handler config is not resolved"); + } + if (abortSignal == null ? void 0 : abortSignal.aborted) { + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const isSSL = request.protocol === "https:"; + const agent = isSSL ? this.config.httpsAgent : this.config.httpAgent; + socketCheckTimeoutId = setTimeout( + () => { + this.socketWarningTimestamp = _NodeHttpHandler.checkSocketUsage( + agent, + this.socketWarningTimestamp, + this.config.logger + ); + }, + this.config.socketAcquisitionWarningTimeout ?? (this.config.requestTimeout ?? 2e3) + (this.config.connectionTimeout ?? 1e3) + ); + const queryString = (0, import_querystring_builder.buildQueryString)(request.query || {}); + let auth = void 0; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}`; + } + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const nodeHttpsOptions = { + headers: request.headers, + host: request.hostname, + method: request.method, + path, + port: request.port, + agent, + auth + }; + const requestFunc = isSSL ? import_https.request : import_http.request; + const req = requestFunc(nodeHttpsOptions, (res) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: res.statusCode || -1, + reason: res.statusMessage, + headers: getTransformedHeaders(res.headers), + body: res + }); + resolve({ response: httpResponse }); + }); + req.on("error", (err) => { + if (NODEJS_TIMEOUT_ERROR_CODES.includes(err.code)) { + reject(Object.assign(err, { name: "TimeoutError" })); + } else { + reject(err); + } + }); + setConnectionTimeout(req, reject, this.config.connectionTimeout); + setSocketTimeout(req, reject, this.config.requestTimeout); + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.destroy(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + abortSignal.addEventListener("abort", onAbort); + } else { + abortSignal.onabort = onAbort; + } + } + const httpAgent = nodeHttpsOptions.agent; + if (typeof httpAgent === "object" && "keepAlive" in httpAgent) { + setSocketKeepAlive(req, { + // @ts-expect-error keepAlive is not public on httpAgent. + keepAlive: httpAgent.keepAlive, + // @ts-expect-error keepAliveMsecs is not public on httpAgent. + keepAliveMsecs: httpAgent.keepAliveMsecs + }); + } + writeRequestBodyPromise = writeRequestBody(req, request, this.config.requestTimeout).catch((e) => { + clearTimeout(socketCheckTimeoutId); + return _reject(e); + }); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } +}; +__name(_NodeHttpHandler, "NodeHttpHandler"); +var NodeHttpHandler = _NodeHttpHandler; + +// src/node-http2-handler.ts + + +var import_http22 = __nccwpck_require__(85158); + +// src/node-http2-connection-manager.ts +var import_http2 = __toESM(__nccwpck_require__(85158)); + +// src/node-http2-connection-pool.ts +var _NodeHttp2ConnectionPool = class _NodeHttp2ConnectionPool { + constructor(sessions) { + this.sessions = []; + this.sessions = sessions ?? []; + } + poll() { + if (this.sessions.length > 0) { + return this.sessions.shift(); + } + } + offerLast(session) { + this.sessions.push(session); + } + contains(session) { + return this.sessions.includes(session); + } + remove(session) { + this.sessions = this.sessions.filter((s) => s !== session); + } + [Symbol.iterator]() { + return this.sessions[Symbol.iterator](); + } + destroy(connection) { + for (const session of this.sessions) { + if (session === connection) { + if (!session.destroyed) { + session.destroy(); + } + } + } + } +}; +__name(_NodeHttp2ConnectionPool, "NodeHttp2ConnectionPool"); +var NodeHttp2ConnectionPool = _NodeHttp2ConnectionPool; + +// src/node-http2-connection-manager.ts +var _NodeHttp2ConnectionManager = class _NodeHttp2ConnectionManager { + constructor(config) { + this.sessionCache = /* @__PURE__ */ new Map(); + this.config = config; + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrency must be greater than zero."); + } + } + lease(requestContext, connectionConfiguration) { + const url = this.getUrlString(requestContext); + const existingPool = this.sessionCache.get(url); + if (existingPool) { + const existingSession = existingPool.poll(); + if (existingSession && !this.config.disableConcurrency) { + return existingSession; + } + } + const session = import_http2.default.connect(url); + if (this.config.maxConcurrency) { + session.settings({ maxConcurrentStreams: this.config.maxConcurrency }, (err) => { + if (err) { + throw new Error( + "Fail to set maxConcurrentStreams to " + this.config.maxConcurrency + "when creating new session for " + requestContext.destination.toString() + ); + } + }); + } + session.unref(); + const destroySessionCb = /* @__PURE__ */ __name(() => { + session.destroy(); + this.deleteSession(url, session); + }, "destroySessionCb"); + session.on("goaway", destroySessionCb); + session.on("error", destroySessionCb); + session.on("frameError", destroySessionCb); + session.on("close", () => this.deleteSession(url, session)); + if (connectionConfiguration.requestTimeout) { + session.setTimeout(connectionConfiguration.requestTimeout, destroySessionCb); + } + const connectionPool = this.sessionCache.get(url) || new NodeHttp2ConnectionPool(); + connectionPool.offerLast(session); + this.sessionCache.set(url, connectionPool); + return session; + } + /** + * Delete a session from the connection pool. + * @param authority The authority of the session to delete. + * @param session The session to delete. + */ + deleteSession(authority, session) { + const existingConnectionPool = this.sessionCache.get(authority); + if (!existingConnectionPool) { + return; + } + if (!existingConnectionPool.contains(session)) { + return; + } + existingConnectionPool.remove(session); + this.sessionCache.set(authority, existingConnectionPool); + } + release(requestContext, session) { + var _a; + const cacheKey = this.getUrlString(requestContext); + (_a = this.sessionCache.get(cacheKey)) == null ? void 0 : _a.offerLast(session); + } + destroy() { + for (const [key, connectionPool] of this.sessionCache) { + for (const session of connectionPool) { + if (!session.destroyed) { + session.destroy(); + } + connectionPool.remove(session); + } + this.sessionCache.delete(key); + } + } + setMaxConcurrentStreams(maxConcurrentStreams) { + if (this.config.maxConcurrency && this.config.maxConcurrency <= 0) { + throw new RangeError("maxConcurrentStreams must be greater than zero."); + } + this.config.maxConcurrency = maxConcurrentStreams; + } + setDisableConcurrentStreams(disableConcurrentStreams) { + this.config.disableConcurrency = disableConcurrentStreams; + } + getUrlString(request) { + return request.destination.toString(); + } +}; +__name(_NodeHttp2ConnectionManager, "NodeHttp2ConnectionManager"); +var NodeHttp2ConnectionManager = _NodeHttp2ConnectionManager; + +// src/node-http2-handler.ts +var _NodeHttp2Handler = class _NodeHttp2Handler { + constructor(options) { + this.metadata = { handlerProtocol: "h2" }; + this.connectionManager = new NodeHttp2ConnectionManager({}); + this.configProvider = new Promise((resolve, reject) => { + if (typeof options === "function") { + options().then((opts) => { + resolve(opts || {}); + }).catch(reject); + } else { + resolve(options || {}); + } + }); + } + /** + * @returns the input if it is an HttpHandler of any class, + * or instantiates a new instance of this handler. + */ + static create(instanceOrOptions) { + if (typeof (instanceOrOptions == null ? void 0 : instanceOrOptions.handle) === "function") { + return instanceOrOptions; + } + return new _NodeHttp2Handler(instanceOrOptions); + } + destroy() { + this.connectionManager.destroy(); + } + async handle(request, { abortSignal } = {}) { + if (!this.config) { + this.config = await this.configProvider; + this.connectionManager.setDisableConcurrentStreams(this.config.disableConcurrentStreams || false); + if (this.config.maxConcurrentStreams) { + this.connectionManager.setMaxConcurrentStreams(this.config.maxConcurrentStreams); + } + } + const { requestTimeout, disableConcurrentStreams } = this.config; + return new Promise((_resolve, _reject) => { + var _a; + let fulfilled = false; + let writeRequestBodyPromise = void 0; + const resolve = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _resolve(arg); + }, "resolve"); + const reject = /* @__PURE__ */ __name(async (arg) => { + await writeRequestBodyPromise; + _reject(arg); + }, "reject"); + if (abortSignal == null ? void 0 : abortSignal.aborted) { + fulfilled = true; + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + reject(abortError); + return; + } + const { hostname, method, port, protocol, query } = request; + let auth = ""; + if (request.username != null || request.password != null) { + const username = request.username ?? ""; + const password = request.password ?? ""; + auth = `${username}:${password}@`; + } + const authority = `${protocol}//${auth}${hostname}${port ? `:${port}` : ""}`; + const requestContext = { destination: new URL(authority) }; + const session = this.connectionManager.lease(requestContext, { + requestTimeout: (_a = this.config) == null ? void 0 : _a.sessionTimeout, + disableConcurrentStreams: disableConcurrentStreams || false + }); + const rejectWithDestroy = /* @__PURE__ */ __name((err) => { + if (disableConcurrentStreams) { + this.destroySession(session); + } + fulfilled = true; + reject(err); + }, "rejectWithDestroy"); + const queryString = (0, import_querystring_builder.buildQueryString)(query || {}); + let path = request.path; + if (queryString) { + path += `?${queryString}`; + } + if (request.fragment) { + path += `#${request.fragment}`; + } + const req = session.request({ + ...request.headers, + [import_http22.constants.HTTP2_HEADER_PATH]: path, + [import_http22.constants.HTTP2_HEADER_METHOD]: method + }); + session.ref(); + req.on("response", (headers) => { + const httpResponse = new import_protocol_http.HttpResponse({ + statusCode: headers[":status"] || -1, + headers: getTransformedHeaders(headers), + body: req + }); + fulfilled = true; + resolve({ response: httpResponse }); + if (disableConcurrentStreams) { + session.close(); + this.connectionManager.deleteSession(authority, session); + } + }); + if (requestTimeout) { + req.setTimeout(requestTimeout, () => { + req.close(); + const timeoutError = new Error(`Stream timed out because of no activity for ${requestTimeout} ms`); + timeoutError.name = "TimeoutError"; + rejectWithDestroy(timeoutError); + }); + } + if (abortSignal) { + const onAbort = /* @__PURE__ */ __name(() => { + req.close(); + const abortError = new Error("Request aborted"); + abortError.name = "AbortError"; + rejectWithDestroy(abortError); + }, "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + abortSignal.addEventListener("abort", onAbort); + } else { + abortSignal.onabort = onAbort; + } + } + req.on("frameError", (type, code, id) => { + rejectWithDestroy(new Error(`Frame type id ${type} in stream id ${id} has failed with code ${code}.`)); + }); + req.on("error", rejectWithDestroy); + req.on("aborted", () => { + rejectWithDestroy( + new Error(`HTTP/2 stream is abnormally aborted in mid-communication with result code ${req.rstCode}.`) + ); + }); + req.on("close", () => { + session.unref(); + if (disableConcurrentStreams) { + session.destroy(); + } + if (!fulfilled) { + rejectWithDestroy(new Error("Unexpected error: http2 request did not get a response")); + } + }); + writeRequestBodyPromise = writeRequestBody(req, request, requestTimeout); + }); + } + updateHttpClientConfig(key, value) { + this.config = void 0; + this.configProvider = this.configProvider.then((config) => { + return { + ...config, + [key]: value + }; + }); + } + httpHandlerConfigs() { + return this.config ?? {}; + } + /** + * Destroys a session. + * @param session The session to destroy. + */ + destroySession(session) { + if (!session.destroyed) { + session.destroy(); + } + } +}; +__name(_NodeHttp2Handler, "NodeHttp2Handler"); +var NodeHttp2Handler = _NodeHttp2Handler; + +// src/stream-collector/collector.ts + +var _Collector = class _Collector extends import_stream.Writable { + constructor() { + super(...arguments); + this.bufferedBytes = []; + } + _write(chunk, encoding, callback) { + this.bufferedBytes.push(chunk); + callback(); + } +}; +__name(_Collector, "Collector"); +var Collector = _Collector; + +// src/stream-collector/index.ts +var streamCollector = /* @__PURE__ */ __name((stream) => { + if (isReadableStreamInstance(stream)) { + return collectReadableStream(stream); + } + return new Promise((resolve, reject) => { + const collector = new Collector(); + stream.pipe(collector); + stream.on("error", (err) => { + collector.end(); + reject(err); + }); + collector.on("error", reject); + collector.on("finish", function() { + const bytes = new Uint8Array(Buffer.concat(this.bufferedBytes)); + resolve(bytes); + }); + }); +}, "streamCollector"); +var isReadableStreamInstance = /* @__PURE__ */ __name((stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream, "isReadableStreamInstance"); +async function collectReadableStream(stream) { + const chunks = []; + const reader = stream.getReader(); + let isDone = false; + let length = 0; + while (!isDone) { + const { done, value } = await reader.read(); + if (value) { + chunks.push(value); + length += value.length; + } + isDone = done; + } + const collected = new Uint8Array(length); + let offset = 0; + for (const chunk of chunks) { + collected.set(chunk, offset); + offset += chunk.length; + } + return collected; +} +__name(collectReadableStream, "collectReadableStream"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 79721: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CredentialsProviderError: () => CredentialsProviderError, + ProviderError: () => ProviderError, + TokenProviderError: () => TokenProviderError, + chain: () => chain, + fromStatic: () => fromStatic, + memoize: () => memoize +}); +module.exports = __toCommonJS(src_exports); + +// src/ProviderError.ts +var _ProviderError = class _ProviderError extends Error { + constructor(message, options = true) { + var _a; + let logger; + let tryNextLink = true; + if (typeof options === "boolean") { + logger = void 0; + tryNextLink = options; + } else if (options != null && typeof options === "object") { + logger = options.logger; + tryNextLink = options.tryNextLink ?? true; + } + super(message); + this.name = "ProviderError"; + this.tryNextLink = tryNextLink; + Object.setPrototypeOf(this, _ProviderError.prototype); + (_a = logger == null ? void 0 : logger.debug) == null ? void 0 : _a.call(logger, `@smithy/property-provider ${tryNextLink ? "->" : "(!)"} ${message}`); + } + /** + * @deprecated use new operator. + */ + static from(error, options = true) { + return Object.assign(new this(error.message, options), error); + } +}; +__name(_ProviderError, "ProviderError"); +var ProviderError = _ProviderError; + +// src/CredentialsProviderError.ts +var _CredentialsProviderError = class _CredentialsProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "CredentialsProviderError"; + Object.setPrototypeOf(this, _CredentialsProviderError.prototype); + } +}; +__name(_CredentialsProviderError, "CredentialsProviderError"); +var CredentialsProviderError = _CredentialsProviderError; + +// src/TokenProviderError.ts +var _TokenProviderError = class _TokenProviderError extends ProviderError { + /** + * @override + */ + constructor(message, options = true) { + super(message, options); + this.name = "TokenProviderError"; + Object.setPrototypeOf(this, _TokenProviderError.prototype); + } +}; +__name(_TokenProviderError, "TokenProviderError"); +var TokenProviderError = _TokenProviderError; + +// src/chain.ts +var chain = /* @__PURE__ */ __name((...providers) => async () => { + if (providers.length === 0) { + throw new ProviderError("No providers in chain"); + } + let lastProviderError; + for (const provider of providers) { + try { + const credentials = await provider(); + return credentials; + } catch (err) { + lastProviderError = err; + if (err == null ? void 0 : err.tryNextLink) { + continue; + } + throw err; + } + } + throw lastProviderError; +}, "chain"); + +// src/fromStatic.ts +var fromStatic = /* @__PURE__ */ __name((staticValue) => () => Promise.resolve(staticValue), "fromStatic"); + +// src/memoize.ts +var memoize = /* @__PURE__ */ __name((provider, isExpired, requiresRefresh) => { + let resolved; + let pending; + let hasResult; + let isConstant = false; + const coalesceProvider = /* @__PURE__ */ __name(async () => { + if (!pending) { + pending = provider(); + } + try { + resolved = await pending; + hasResult = true; + isConstant = false; + } finally { + pending = void 0; + } + return resolved; + }, "coalesceProvider"); + if (isExpired === void 0) { + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + return resolved; + }; + } + return async (options) => { + if (!hasResult || (options == null ? void 0 : options.forceRefresh)) { + resolved = await coalesceProvider(); + } + if (isConstant) { + return resolved; + } + if (requiresRefresh && !requiresRefresh(resolved)) { + isConstant = true; + return resolved; + } + if (isExpired(resolved)) { + await coalesceProvider(); + return resolved; + } + return resolved; + }; +}, "memoize"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 64418: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Field: () => Field, + Fields: () => Fields, + HttpRequest: () => HttpRequest, + HttpResponse: () => HttpResponse, + getHttpHandlerExtensionConfiguration: () => getHttpHandlerExtensionConfiguration, + isValidHostname: () => isValidHostname, + resolveHttpHandlerRuntimeConfig: () => resolveHttpHandlerRuntimeConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/extensions/httpExtensionConfiguration.ts +var getHttpHandlerExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let httpHandler = runtimeConfig.httpHandler; + return { + setHttpHandler(handler) { + httpHandler = handler; + }, + httpHandler() { + return httpHandler; + }, + updateHttpClientConfig(key, value) { + httpHandler.updateHttpClientConfig(key, value); + }, + httpHandlerConfigs() { + return httpHandler.httpHandlerConfigs(); + } + }; +}, "getHttpHandlerExtensionConfiguration"); +var resolveHttpHandlerRuntimeConfig = /* @__PURE__ */ __name((httpHandlerExtensionConfiguration) => { + return { + httpHandler: httpHandlerExtensionConfiguration.httpHandler() + }; +}, "resolveHttpHandlerRuntimeConfig"); + +// src/Field.ts +var import_types = __nccwpck_require__(55756); +var _Field = class _Field { + constructor({ name, kind = import_types.FieldPosition.HEADER, values = [] }) { + this.name = name; + this.kind = kind; + this.values = values; + } + /** + * Appends a value to the field. + * + * @param value The value to append. + */ + add(value) { + this.values.push(value); + } + /** + * Overwrite existing field values. + * + * @param values The new field values. + */ + set(values) { + this.values = values; + } + /** + * Remove all matching entries from list. + * + * @param value Value to remove. + */ + remove(value) { + this.values = this.values.filter((v) => v !== value); + } + /** + * Get comma-delimited string. + * + * @returns String representation of {@link Field}. + */ + toString() { + return this.values.map((v) => v.includes(",") || v.includes(" ") ? `"${v}"` : v).join(", "); + } + /** + * Get string values as a list + * + * @returns Values in {@link Field} as a list. + */ + get() { + return this.values; + } +}; +__name(_Field, "Field"); +var Field = _Field; + +// src/Fields.ts +var _Fields = class _Fields { + constructor({ fields = [], encoding = "utf-8" }) { + this.entries = {}; + fields.forEach(this.setField.bind(this)); + this.encoding = encoding; + } + /** + * Set entry for a {@link Field} name. The `name` + * attribute will be used to key the collection. + * + * @param field The {@link Field} to set. + */ + setField(field) { + this.entries[field.name.toLowerCase()] = field; + } + /** + * Retrieve {@link Field} entry by name. + * + * @param name The name of the {@link Field} entry + * to retrieve + * @returns The {@link Field} if it exists. + */ + getField(name) { + return this.entries[name.toLowerCase()]; + } + /** + * Delete entry from collection. + * + * @param name Name of the entry to delete. + */ + removeField(name) { + delete this.entries[name.toLowerCase()]; + } + /** + * Helper function for retrieving specific types of fields. + * Used to grab all headers or all trailers. + * + * @param kind {@link FieldPosition} of entries to retrieve. + * @returns The {@link Field} entries with the specified + * {@link FieldPosition}. + */ + getByType(kind) { + return Object.values(this.entries).filter((field) => field.kind === kind); + } +}; +__name(_Fields, "Fields"); +var Fields = _Fields; + +// src/httpRequest.ts +var _HttpRequest = class _HttpRequest { + constructor(options) { + this.method = options.method || "GET"; + this.hostname = options.hostname || "localhost"; + this.port = options.port; + this.query = options.query || {}; + this.headers = options.headers || {}; + this.body = options.body; + this.protocol = options.protocol ? options.protocol.slice(-1) !== ":" ? `${options.protocol}:` : options.protocol : "https:"; + this.path = options.path ? options.path.charAt(0) !== "/" ? `/${options.path}` : options.path : "/"; + this.username = options.username; + this.password = options.password; + this.fragment = options.fragment; + } + static isInstance(request) { + if (!request) + return false; + const req = request; + return "method" in req && "protocol" in req && "hostname" in req && "path" in req && typeof req["query"] === "object" && typeof req["headers"] === "object"; + } + clone() { + const cloned = new _HttpRequest({ + ...this, + headers: { ...this.headers } + }); + if (cloned.query) + cloned.query = cloneQuery(cloned.query); + return cloned; + } +}; +__name(_HttpRequest, "HttpRequest"); +var HttpRequest = _HttpRequest; +function cloneQuery(query) { + return Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; + }, {}); +} +__name(cloneQuery, "cloneQuery"); + +// src/httpResponse.ts +var _HttpResponse = class _HttpResponse { + constructor(options) { + this.statusCode = options.statusCode; + this.reason = options.reason; + this.headers = options.headers || {}; + this.body = options.body; + } + static isInstance(response) { + if (!response) + return false; + const resp = response; + return typeof resp.statusCode === "number" && typeof resp.headers === "object"; + } +}; +__name(_HttpResponse, "HttpResponse"); +var HttpResponse = _HttpResponse; + +// src/isValidHostname.ts +function isValidHostname(hostname) { + const hostPattern = /^[a-z0-9][a-z0-9\.\-]*[a-z0-9]$/; + return hostPattern.test(hostname); +} +__name(isValidHostname, "isValidHostname"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 68031: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + buildQueryString: () => buildQueryString +}); +module.exports = __toCommonJS(src_exports); +var import_util_uri_escape = __nccwpck_require__(54197); +function buildQueryString(query) { + const parts = []; + for (let key of Object.keys(query).sort()) { + const value = query[key]; + key = (0, import_util_uri_escape.escapeUri)(key); + if (Array.isArray(value)) { + for (let i = 0, iLen = value.length; i < iLen; i++) { + parts.push(`${key}=${(0, import_util_uri_escape.escapeUri)(value[i])}`); + } + } else { + let qsEntry = key; + if (value || typeof value === "string") { + qsEntry += `=${(0, import_util_uri_escape.escapeUri)(value)}`; + } + parts.push(qsEntry); + } + } + return parts.join("&"); +} +__name(buildQueryString, "buildQueryString"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 4769: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + parseQueryString: () => parseQueryString +}); +module.exports = __toCommonJS(src_exports); +function parseQueryString(querystring) { + const query = {}; + querystring = querystring.replace(/^\?/, ""); + if (querystring) { + for (const pair of querystring.split("&")) { + let [key, value = null] = pair.split("="); + key = decodeURIComponent(key); + if (value) { + value = decodeURIComponent(value); + } + if (!(key in query)) { + query[key] = value; + } else if (Array.isArray(query[key])) { + query[key].push(value); + } else { + query[key] = [query[key], value]; + } + } + } + return query; +} +__name(parseQueryString, "parseQueryString"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 6375: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + isClockSkewCorrectedError: () => isClockSkewCorrectedError, + isClockSkewError: () => isClockSkewError, + isRetryableByTrait: () => isRetryableByTrait, + isServerError: () => isServerError, + isThrottlingError: () => isThrottlingError, + isTransientError: () => isTransientError +}); +module.exports = __toCommonJS(src_exports); + +// src/constants.ts +var CLOCK_SKEW_ERROR_CODES = [ + "AuthFailure", + "InvalidSignatureException", + "RequestExpired", + "RequestInTheFuture", + "RequestTimeTooSkewed", + "SignatureDoesNotMatch" +]; +var THROTTLING_ERROR_CODES = [ + "BandwidthLimitExceeded", + "EC2ThrottledException", + "LimitExceededException", + "PriorRequestNotComplete", + "ProvisionedThroughputExceededException", + "RequestLimitExceeded", + "RequestThrottled", + "RequestThrottledException", + "SlowDown", + "ThrottledException", + "Throttling", + "ThrottlingException", + "TooManyRequestsException", + "TransactionInProgressException" + // DynamoDB +]; +var TRANSIENT_ERROR_CODES = ["TimeoutError", "RequestTimeout", "RequestTimeoutException"]; +var TRANSIENT_ERROR_STATUS_CODES = [500, 502, 503, 504]; +var NODEJS_TIMEOUT_ERROR_CODES = ["ECONNRESET", "ECONNREFUSED", "EPIPE", "ETIMEDOUT"]; + +// src/index.ts +var isRetryableByTrait = /* @__PURE__ */ __name((error) => error.$retryable !== void 0, "isRetryableByTrait"); +var isClockSkewError = /* @__PURE__ */ __name((error) => CLOCK_SKEW_ERROR_CODES.includes(error.name), "isClockSkewError"); +var isClockSkewCorrectedError = /* @__PURE__ */ __name((error) => { + var _a; + return (_a = error.$metadata) == null ? void 0 : _a.clockSkewCorrected; +}, "isClockSkewCorrectedError"); +var isThrottlingError = /* @__PURE__ */ __name((error) => { + var _a, _b; + return ((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) === 429 || THROTTLING_ERROR_CODES.includes(error.name) || ((_b = error.$retryable) == null ? void 0 : _b.throttling) == true; +}, "isThrottlingError"); +var isTransientError = /* @__PURE__ */ __name((error) => { + var _a; + return isClockSkewCorrectedError(error) || TRANSIENT_ERROR_CODES.includes(error.name) || NODEJS_TIMEOUT_ERROR_CODES.includes((error == null ? void 0 : error.code) || "") || TRANSIENT_ERROR_STATUS_CODES.includes(((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) || 0); +}, "isTransientError"); +var isServerError = /* @__PURE__ */ __name((error) => { + var _a; + if (((_a = error.$metadata) == null ? void 0 : _a.httpStatusCode) !== void 0) { + const statusCode = error.$metadata.httpStatusCode; + if (500 <= statusCode && statusCode <= 599 && !isTransientError(error)) { + return true; + } + return false; + } + return false; +}, "isServerError"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 68340: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getHomeDir = void 0; +const os_1 = __nccwpck_require__(22037); +const path_1 = __nccwpck_require__(71017); +const homeDirCache = {}; +const getHomeDirCacheKey = () => { + if (process && process.geteuid) { + return `${process.geteuid()}`; + } + return "DEFAULT"; +}; +const getHomeDir = () => { + const { HOME, USERPROFILE, HOMEPATH, HOMEDRIVE = `C:${path_1.sep}` } = process.env; + if (HOME) + return HOME; + if (USERPROFILE) + return USERPROFILE; + if (HOMEPATH) + return `${HOMEDRIVE}${HOMEPATH}`; + const homeDirCacheKey = getHomeDirCacheKey(); + if (!homeDirCache[homeDirCacheKey]) + homeDirCache[homeDirCacheKey] = (0, os_1.homedir)(); + return homeDirCache[homeDirCacheKey]; +}; +exports.getHomeDir = getHomeDir; + + +/***/ }), + +/***/ 24740: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFilepath = void 0; +const crypto_1 = __nccwpck_require__(6113); +const path_1 = __nccwpck_require__(71017); +const getHomeDir_1 = __nccwpck_require__(68340); +const getSSOTokenFilepath = (id) => { + const hasher = (0, crypto_1.createHash)("sha1"); + const cacheName = hasher.update(id).digest("hex"); + return (0, path_1.join)((0, getHomeDir_1.getHomeDir)(), ".aws", "sso", "cache", `${cacheName}.json`); +}; +exports.getSSOTokenFilepath = getSSOTokenFilepath; + + +/***/ }), + +/***/ 69678: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getSSOTokenFromFile = void 0; +const fs_1 = __nccwpck_require__(57147); +const getSSOTokenFilepath_1 = __nccwpck_require__(24740); +const { readFile } = fs_1.promises; +const getSSOTokenFromFile = async (id) => { + const ssoTokenFilepath = (0, getSSOTokenFilepath_1.getSSOTokenFilepath)(id); + const ssoTokenText = await readFile(ssoTokenFilepath, "utf8"); + return JSON.parse(ssoTokenText); +}; +exports.getSSOTokenFromFile = getSSOTokenFromFile; + + +/***/ }), + +/***/ 43507: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + CONFIG_PREFIX_SEPARATOR: () => CONFIG_PREFIX_SEPARATOR, + DEFAULT_PROFILE: () => DEFAULT_PROFILE, + ENV_PROFILE: () => ENV_PROFILE, + getProfileName: () => getProfileName, + loadSharedConfigFiles: () => loadSharedConfigFiles, + loadSsoSessionData: () => loadSsoSessionData, + parseKnownFiles: () => parseKnownFiles +}); +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(68340), module.exports); + +// src/getProfileName.ts +var ENV_PROFILE = "AWS_PROFILE"; +var DEFAULT_PROFILE = "default"; +var getProfileName = /* @__PURE__ */ __name((init) => init.profile || process.env[ENV_PROFILE] || DEFAULT_PROFILE, "getProfileName"); + +// src/index.ts +__reExport(src_exports, __nccwpck_require__(24740), module.exports); +__reExport(src_exports, __nccwpck_require__(69678), module.exports); + +// src/getConfigData.ts +var import_types = __nccwpck_require__(55756); +var getConfigData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + if (indexOfSeparator === -1) { + return false; + } + return Object.values(import_types.IniSectionType).includes(key.substring(0, indexOfSeparator)); +}).reduce( + (acc, [key, value]) => { + const indexOfSeparator = key.indexOf(CONFIG_PREFIX_SEPARATOR); + const updatedKey = key.substring(0, indexOfSeparator) === import_types.IniSectionType.PROFILE ? key.substring(indexOfSeparator + 1) : key; + acc[updatedKey] = value; + return acc; + }, + { + // Populate default profile, if present. + ...data.default && { default: data.default } + } +), "getConfigData"); + +// src/getConfigFilepath.ts +var import_path = __nccwpck_require__(71017); +var import_getHomeDir = __nccwpck_require__(68340); +var ENV_CONFIG_PATH = "AWS_CONFIG_FILE"; +var getConfigFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CONFIG_PATH] || (0, import_path.join)((0, import_getHomeDir.getHomeDir)(), ".aws", "config"), "getConfigFilepath"); + +// src/getCredentialsFilepath.ts + +var import_getHomeDir2 = __nccwpck_require__(68340); +var ENV_CREDENTIALS_PATH = "AWS_SHARED_CREDENTIALS_FILE"; +var getCredentialsFilepath = /* @__PURE__ */ __name(() => process.env[ENV_CREDENTIALS_PATH] || (0, import_path.join)((0, import_getHomeDir2.getHomeDir)(), ".aws", "credentials"), "getCredentialsFilepath"); + +// src/parseIni.ts + +var prefixKeyRegex = /^([\w-]+)\s(["'])?([\w-@\+\.%:/]+)\2$/; +var profileNameBlockList = ["__proto__", "profile __proto__"]; +var parseIni = /* @__PURE__ */ __name((iniData) => { + const map = {}; + let currentSection; + let currentSubSection; + for (const iniLine of iniData.split(/\r?\n/)) { + const trimmedLine = iniLine.split(/(^|\s)[;#]/)[0].trim(); + const isSection = trimmedLine[0] === "[" && trimmedLine[trimmedLine.length - 1] === "]"; + if (isSection) { + currentSection = void 0; + currentSubSection = void 0; + const sectionName = trimmedLine.substring(1, trimmedLine.length - 1); + const matches = prefixKeyRegex.exec(sectionName); + if (matches) { + const [, prefix, , name] = matches; + if (Object.values(import_types.IniSectionType).includes(prefix)) { + currentSection = [prefix, name].join(CONFIG_PREFIX_SEPARATOR); + } + } else { + currentSection = sectionName; + } + if (profileNameBlockList.includes(sectionName)) { + throw new Error(`Found invalid profile name "${sectionName}"`); + } + } else if (currentSection) { + const indexOfEqualsSign = trimmedLine.indexOf("="); + if (![0, -1].includes(indexOfEqualsSign)) { + const [name, value] = [ + trimmedLine.substring(0, indexOfEqualsSign).trim(), + trimmedLine.substring(indexOfEqualsSign + 1).trim() + ]; + if (value === "") { + currentSubSection = name; + } else { + if (currentSubSection && iniLine.trimStart() === iniLine) { + currentSubSection = void 0; + } + map[currentSection] = map[currentSection] || {}; + const key = currentSubSection ? [currentSubSection, name].join(CONFIG_PREFIX_SEPARATOR) : name; + map[currentSection][key] = value; + } + } + } + } + return map; +}, "parseIni"); + +// src/loadSharedConfigFiles.ts +var import_slurpFile = __nccwpck_require__(19155); +var swallowError = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var CONFIG_PREFIX_SEPARATOR = "."; +var loadSharedConfigFiles = /* @__PURE__ */ __name(async (init = {}) => { + const { filepath = getCredentialsFilepath(), configFilepath = getConfigFilepath() } = init; + const parsedFiles = await Promise.all([ + (0, import_slurpFile.slurpFile)(configFilepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).then(getConfigData).catch(swallowError), + (0, import_slurpFile.slurpFile)(filepath, { + ignoreCache: init.ignoreCache + }).then(parseIni).catch(swallowError) + ]); + return { + configFile: parsedFiles[0], + credentialsFile: parsedFiles[1] + }; +}, "loadSharedConfigFiles"); + +// src/getSsoSessionData.ts + +var getSsoSessionData = /* @__PURE__ */ __name((data) => Object.entries(data).filter(([key]) => key.startsWith(import_types.IniSectionType.SSO_SESSION + CONFIG_PREFIX_SEPARATOR)).reduce((acc, [key, value]) => ({ ...acc, [key.substring(key.indexOf(CONFIG_PREFIX_SEPARATOR) + 1)]: value }), {}), "getSsoSessionData"); + +// src/loadSsoSessionData.ts +var import_slurpFile2 = __nccwpck_require__(19155); +var swallowError2 = /* @__PURE__ */ __name(() => ({}), "swallowError"); +var loadSsoSessionData = /* @__PURE__ */ __name(async (init = {}) => (0, import_slurpFile2.slurpFile)(init.configFilepath ?? getConfigFilepath()).then(parseIni).then(getSsoSessionData).catch(swallowError2), "loadSsoSessionData"); + +// src/mergeConfigFiles.ts +var mergeConfigFiles = /* @__PURE__ */ __name((...files) => { + const merged = {}; + for (const file of files) { + for (const [key, values] of Object.entries(file)) { + if (merged[key] !== void 0) { + Object.assign(merged[key], values); + } else { + merged[key] = values; + } + } + } + return merged; +}, "mergeConfigFiles"); + +// src/parseKnownFiles.ts +var parseKnownFiles = /* @__PURE__ */ __name(async (init) => { + const parsedFiles = await loadSharedConfigFiles(init); + return mergeConfigFiles(parsedFiles.configFile, parsedFiles.credentialsFile); +}, "parseKnownFiles"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 19155: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.slurpFile = void 0; +const fs_1 = __nccwpck_require__(57147); +const { readFile } = fs_1.promises; +const filePromisesHash = {}; +const slurpFile = (path, options) => { + if (!filePromisesHash[path] || (options === null || options === void 0 ? void 0 : options.ignoreCache)) { + filePromisesHash[path] = readFile(path, "utf8"); + } + return filePromisesHash[path]; +}; +exports.slurpFile = slurpFile; + + +/***/ }), + +/***/ 11528: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + SignatureV4: () => SignatureV4, + clearCredentialCache: () => clearCredentialCache, + createScope: () => createScope, + getCanonicalHeaders: () => getCanonicalHeaders, + getCanonicalQuery: () => getCanonicalQuery, + getPayloadHash: () => getPayloadHash, + getSigningKey: () => getSigningKey, + moveHeadersToQuery: () => moveHeadersToQuery, + prepareRequest: () => prepareRequest +}); +module.exports = __toCommonJS(src_exports); + +// src/SignatureV4.ts + +var import_util_middleware = __nccwpck_require__(2390); + +var import_util_utf84 = __nccwpck_require__(41895); + +// src/constants.ts +var ALGORITHM_QUERY_PARAM = "X-Amz-Algorithm"; +var CREDENTIAL_QUERY_PARAM = "X-Amz-Credential"; +var AMZ_DATE_QUERY_PARAM = "X-Amz-Date"; +var SIGNED_HEADERS_QUERY_PARAM = "X-Amz-SignedHeaders"; +var EXPIRES_QUERY_PARAM = "X-Amz-Expires"; +var SIGNATURE_QUERY_PARAM = "X-Amz-Signature"; +var TOKEN_QUERY_PARAM = "X-Amz-Security-Token"; +var AUTH_HEADER = "authorization"; +var AMZ_DATE_HEADER = AMZ_DATE_QUERY_PARAM.toLowerCase(); +var DATE_HEADER = "date"; +var GENERATED_HEADERS = [AUTH_HEADER, AMZ_DATE_HEADER, DATE_HEADER]; +var SIGNATURE_HEADER = SIGNATURE_QUERY_PARAM.toLowerCase(); +var SHA256_HEADER = "x-amz-content-sha256"; +var TOKEN_HEADER = TOKEN_QUERY_PARAM.toLowerCase(); +var ALWAYS_UNSIGNABLE_HEADERS = { + authorization: true, + "cache-control": true, + connection: true, + expect: true, + from: true, + "keep-alive": true, + "max-forwards": true, + pragma: true, + referer: true, + te: true, + trailer: true, + "transfer-encoding": true, + upgrade: true, + "user-agent": true, + "x-amzn-trace-id": true +}; +var PROXY_HEADER_PATTERN = /^proxy-/; +var SEC_HEADER_PATTERN = /^sec-/; +var ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256"; +var EVENT_ALGORITHM_IDENTIFIER = "AWS4-HMAC-SHA256-PAYLOAD"; +var UNSIGNED_PAYLOAD = "UNSIGNED-PAYLOAD"; +var MAX_CACHE_SIZE = 50; +var KEY_TYPE_IDENTIFIER = "aws4_request"; +var MAX_PRESIGNED_TTL = 60 * 60 * 24 * 7; + +// src/credentialDerivation.ts +var import_util_hex_encoding = __nccwpck_require__(45364); +var import_util_utf8 = __nccwpck_require__(41895); +var signingKeyCache = {}; +var cacheQueue = []; +var createScope = /* @__PURE__ */ __name((shortDate, region, service) => `${shortDate}/${region}/${service}/${KEY_TYPE_IDENTIFIER}`, "createScope"); +var getSigningKey = /* @__PURE__ */ __name(async (sha256Constructor, credentials, shortDate, region, service) => { + const credsHash = await hmac(sha256Constructor, credentials.secretAccessKey, credentials.accessKeyId); + const cacheKey = `${shortDate}:${region}:${service}:${(0, import_util_hex_encoding.toHex)(credsHash)}:${credentials.sessionToken}`; + if (cacheKey in signingKeyCache) { + return signingKeyCache[cacheKey]; + } + cacheQueue.push(cacheKey); + while (cacheQueue.length > MAX_CACHE_SIZE) { + delete signingKeyCache[cacheQueue.shift()]; + } + let key = `AWS4${credentials.secretAccessKey}`; + for (const signable of [shortDate, region, service, KEY_TYPE_IDENTIFIER]) { + key = await hmac(sha256Constructor, key, signable); + } + return signingKeyCache[cacheKey] = key; +}, "getSigningKey"); +var clearCredentialCache = /* @__PURE__ */ __name(() => { + cacheQueue.length = 0; + Object.keys(signingKeyCache).forEach((cacheKey) => { + delete signingKeyCache[cacheKey]; + }); +}, "clearCredentialCache"); +var hmac = /* @__PURE__ */ __name((ctor, secret, data) => { + const hash = new ctor(secret); + hash.update((0, import_util_utf8.toUint8Array)(data)); + return hash.digest(); +}, "hmac"); + +// src/getCanonicalHeaders.ts +var getCanonicalHeaders = /* @__PURE__ */ __name(({ headers }, unsignableHeaders, signableHeaders) => { + const canonical = {}; + for (const headerName of Object.keys(headers).sort()) { + if (headers[headerName] == void 0) { + continue; + } + const canonicalHeaderName = headerName.toLowerCase(); + if (canonicalHeaderName in ALWAYS_UNSIGNABLE_HEADERS || (unsignableHeaders == null ? void 0 : unsignableHeaders.has(canonicalHeaderName)) || PROXY_HEADER_PATTERN.test(canonicalHeaderName) || SEC_HEADER_PATTERN.test(canonicalHeaderName)) { + if (!signableHeaders || signableHeaders && !signableHeaders.has(canonicalHeaderName)) { + continue; + } + } + canonical[canonicalHeaderName] = headers[headerName].trim().replace(/\s+/g, " "); + } + return canonical; +}, "getCanonicalHeaders"); + +// src/getCanonicalQuery.ts +var import_util_uri_escape = __nccwpck_require__(54197); +var getCanonicalQuery = /* @__PURE__ */ __name(({ query = {} }) => { + const keys = []; + const serialized = {}; + for (const key of Object.keys(query).sort()) { + if (key.toLowerCase() === SIGNATURE_HEADER) { + continue; + } + keys.push(key); + const value = query[key]; + if (typeof value === "string") { + serialized[key] = `${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value)}`; + } else if (Array.isArray(value)) { + serialized[key] = value.slice(0).reduce( + (encoded, value2) => encoded.concat([`${(0, import_util_uri_escape.escapeUri)(key)}=${(0, import_util_uri_escape.escapeUri)(value2)}`]), + [] + ).sort().join("&"); + } + } + return keys.map((key) => serialized[key]).filter((serialized2) => serialized2).join("&"); +}, "getCanonicalQuery"); + +// src/getPayloadHash.ts +var import_is_array_buffer = __nccwpck_require__(10780); + +var import_util_utf82 = __nccwpck_require__(41895); +var getPayloadHash = /* @__PURE__ */ __name(async ({ headers, body }, hashConstructor) => { + for (const headerName of Object.keys(headers)) { + if (headerName.toLowerCase() === SHA256_HEADER) { + return headers[headerName]; + } + } + if (body == void 0) { + return "e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855"; + } else if (typeof body === "string" || ArrayBuffer.isView(body) || (0, import_is_array_buffer.isArrayBuffer)(body)) { + const hashCtor = new hashConstructor(); + hashCtor.update((0, import_util_utf82.toUint8Array)(body)); + return (0, import_util_hex_encoding.toHex)(await hashCtor.digest()); + } + return UNSIGNED_PAYLOAD; +}, "getPayloadHash"); + +// src/HeaderFormatter.ts + +var import_util_utf83 = __nccwpck_require__(41895); +var _HeaderFormatter = class _HeaderFormatter { + format(headers) { + const chunks = []; + for (const headerName of Object.keys(headers)) { + const bytes = (0, import_util_utf83.fromUtf8)(headerName); + chunks.push(Uint8Array.from([bytes.byteLength]), bytes, this.formatHeaderValue(headers[headerName])); + } + const out = new Uint8Array(chunks.reduce((carry, bytes) => carry + bytes.byteLength, 0)); + let position = 0; + for (const chunk of chunks) { + out.set(chunk, position); + position += chunk.byteLength; + } + return out; + } + formatHeaderValue(header) { + switch (header.type) { + case "boolean": + return Uint8Array.from([header.value ? 0 /* boolTrue */ : 1 /* boolFalse */]); + case "byte": + return Uint8Array.from([2 /* byte */, header.value]); + case "short": + const shortView = new DataView(new ArrayBuffer(3)); + shortView.setUint8(0, 3 /* short */); + shortView.setInt16(1, header.value, false); + return new Uint8Array(shortView.buffer); + case "integer": + const intView = new DataView(new ArrayBuffer(5)); + intView.setUint8(0, 4 /* integer */); + intView.setInt32(1, header.value, false); + return new Uint8Array(intView.buffer); + case "long": + const longBytes = new Uint8Array(9); + longBytes[0] = 5 /* long */; + longBytes.set(header.value.bytes, 1); + return longBytes; + case "binary": + const binView = new DataView(new ArrayBuffer(3 + header.value.byteLength)); + binView.setUint8(0, 6 /* byteArray */); + binView.setUint16(1, header.value.byteLength, false); + const binBytes = new Uint8Array(binView.buffer); + binBytes.set(header.value, 3); + return binBytes; + case "string": + const utf8Bytes = (0, import_util_utf83.fromUtf8)(header.value); + const strView = new DataView(new ArrayBuffer(3 + utf8Bytes.byteLength)); + strView.setUint8(0, 7 /* string */); + strView.setUint16(1, utf8Bytes.byteLength, false); + const strBytes = new Uint8Array(strView.buffer); + strBytes.set(utf8Bytes, 3); + return strBytes; + case "timestamp": + const tsBytes = new Uint8Array(9); + tsBytes[0] = 8 /* timestamp */; + tsBytes.set(Int64.fromNumber(header.value.valueOf()).bytes, 1); + return tsBytes; + case "uuid": + if (!UUID_PATTERN.test(header.value)) { + throw new Error(`Invalid UUID received: ${header.value}`); + } + const uuidBytes = new Uint8Array(17); + uuidBytes[0] = 9 /* uuid */; + uuidBytes.set((0, import_util_hex_encoding.fromHex)(header.value.replace(/\-/g, "")), 1); + return uuidBytes; + } + } +}; +__name(_HeaderFormatter, "HeaderFormatter"); +var HeaderFormatter = _HeaderFormatter; +var UUID_PATTERN = /^[a-f0-9]{8}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{4}-[a-f0-9]{12}$/; +var _Int64 = class _Int64 { + constructor(bytes) { + this.bytes = bytes; + if (bytes.byteLength !== 8) { + throw new Error("Int64 buffers must be exactly 8 bytes"); + } + } + static fromNumber(number) { + if (number > 9223372036854776e3 || number < -9223372036854776e3) { + throw new Error(`${number} is too large (or, if negative, too small) to represent as an Int64`); + } + const bytes = new Uint8Array(8); + for (let i = 7, remaining = Math.abs(Math.round(number)); i > -1 && remaining > 0; i--, remaining /= 256) { + bytes[i] = remaining; + } + if (number < 0) { + negate(bytes); + } + return new _Int64(bytes); + } + /** + * Called implicitly by infix arithmetic operators. + */ + valueOf() { + const bytes = this.bytes.slice(0); + const negative = bytes[0] & 128; + if (negative) { + negate(bytes); + } + return parseInt((0, import_util_hex_encoding.toHex)(bytes), 16) * (negative ? -1 : 1); + } + toString() { + return String(this.valueOf()); + } +}; +__name(_Int64, "Int64"); +var Int64 = _Int64; +function negate(bytes) { + for (let i = 0; i < 8; i++) { + bytes[i] ^= 255; + } + for (let i = 7; i > -1; i--) { + bytes[i]++; + if (bytes[i] !== 0) + break; + } +} +__name(negate, "negate"); + +// src/headerUtil.ts +var hasHeader = /* @__PURE__ */ __name((soughtHeader, headers) => { + soughtHeader = soughtHeader.toLowerCase(); + for (const headerName of Object.keys(headers)) { + if (soughtHeader === headerName.toLowerCase()) { + return true; + } + } + return false; +}, "hasHeader"); + +// src/cloneRequest.ts +var cloneRequest = /* @__PURE__ */ __name(({ headers, query, ...rest }) => ({ + ...rest, + headers: { ...headers }, + query: query ? cloneQuery(query) : void 0 +}), "cloneRequest"); +var cloneQuery = /* @__PURE__ */ __name((query) => Object.keys(query).reduce((carry, paramName) => { + const param = query[paramName]; + return { + ...carry, + [paramName]: Array.isArray(param) ? [...param] : param + }; +}, {}), "cloneQuery"); + +// src/moveHeadersToQuery.ts +var moveHeadersToQuery = /* @__PURE__ */ __name((request, options = {}) => { + var _a; + const { headers, query = {} } = typeof request.clone === "function" ? request.clone() : cloneRequest(request); + for (const name of Object.keys(headers)) { + const lname = name.toLowerCase(); + if (lname.slice(0, 6) === "x-amz-" && !((_a = options.unhoistableHeaders) == null ? void 0 : _a.has(lname))) { + query[name] = headers[name]; + delete headers[name]; + } + } + return { + ...request, + headers, + query + }; +}, "moveHeadersToQuery"); + +// src/prepareRequest.ts +var prepareRequest = /* @__PURE__ */ __name((request) => { + request = typeof request.clone === "function" ? request.clone() : cloneRequest(request); + for (const headerName of Object.keys(request.headers)) { + if (GENERATED_HEADERS.indexOf(headerName.toLowerCase()) > -1) { + delete request.headers[headerName]; + } + } + return request; +}, "prepareRequest"); + +// src/utilDate.ts +var iso8601 = /* @__PURE__ */ __name((time) => toDate(time).toISOString().replace(/\.\d{3}Z$/, "Z"), "iso8601"); +var toDate = /* @__PURE__ */ __name((time) => { + if (typeof time === "number") { + return new Date(time * 1e3); + } + if (typeof time === "string") { + if (Number(time)) { + return new Date(Number(time) * 1e3); + } + return new Date(time); + } + return time; +}, "toDate"); + +// src/SignatureV4.ts +var _SignatureV4 = class _SignatureV4 { + constructor({ + applyChecksum, + credentials, + region, + service, + sha256, + uriEscapePath = true + }) { + this.headerFormatter = new HeaderFormatter(); + this.service = service; + this.sha256 = sha256; + this.uriEscapePath = uriEscapePath; + this.applyChecksum = typeof applyChecksum === "boolean" ? applyChecksum : true; + this.regionProvider = (0, import_util_middleware.normalizeProvider)(region); + this.credentialProvider = (0, import_util_middleware.normalizeProvider)(credentials); + } + async presign(originalRequest, options = {}) { + const { + signingDate = /* @__PURE__ */ new Date(), + expiresIn = 3600, + unsignableHeaders, + unhoistableHeaders, + signableHeaders, + signingRegion, + signingService + } = options; + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { longDate, shortDate } = formatDate(signingDate); + if (expiresIn > MAX_PRESIGNED_TTL) { + return Promise.reject( + "Signature version 4 presigned URLs must have an expiration date less than one week in the future" + ); + } + const scope = createScope(shortDate, region, signingService ?? this.service); + const request = moveHeadersToQuery(prepareRequest(originalRequest), { unhoistableHeaders }); + if (credentials.sessionToken) { + request.query[TOKEN_QUERY_PARAM] = credentials.sessionToken; + } + request.query[ALGORITHM_QUERY_PARAM] = ALGORITHM_IDENTIFIER; + request.query[CREDENTIAL_QUERY_PARAM] = `${credentials.accessKeyId}/${scope}`; + request.query[AMZ_DATE_QUERY_PARAM] = longDate; + request.query[EXPIRES_QUERY_PARAM] = expiresIn.toString(10); + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + request.query[SIGNED_HEADERS_QUERY_PARAM] = getCanonicalHeaderList(canonicalHeaders); + request.query[SIGNATURE_QUERY_PARAM] = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request, canonicalHeaders, await getPayloadHash(originalRequest, this.sha256)) + ); + return request; + } + async sign(toSign, options) { + if (typeof toSign === "string") { + return this.signString(toSign, options); + } else if (toSign.headers && toSign.payload) { + return this.signEvent(toSign, options); + } else if (toSign.message) { + return this.signMessage(toSign, options); + } else { + return this.signRequest(toSign, options); + } + } + async signEvent({ headers, payload }, { signingDate = /* @__PURE__ */ new Date(), priorSignature, signingRegion, signingService }) { + const region = signingRegion ?? await this.regionProvider(); + const { shortDate, longDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + const hashedPayload = await getPayloadHash({ headers: {}, body: payload }, this.sha256); + const hash = new this.sha256(); + hash.update(headers); + const hashedHeaders = (0, import_util_hex_encoding.toHex)(await hash.digest()); + const stringToSign = [ + EVENT_ALGORITHM_IDENTIFIER, + longDate, + scope, + priorSignature, + hashedHeaders, + hashedPayload + ].join("\n"); + return this.signString(stringToSign, { signingDate, signingRegion: region, signingService }); + } + async signMessage(signableMessage, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService }) { + const promise = this.signEvent( + { + headers: this.headerFormatter.format(signableMessage.message.headers), + payload: signableMessage.message.body + }, + { + signingDate, + signingRegion, + signingService, + priorSignature: signableMessage.priorSignature + } + ); + return promise.then((signature) => { + return { message: signableMessage.message, signature }; + }); + } + async signString(stringToSign, { signingDate = /* @__PURE__ */ new Date(), signingRegion, signingService } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const { shortDate } = formatDate(signingDate); + const hash = new this.sha256(await this.getSigningKey(credentials, region, shortDate, signingService)); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); + } + async signRequest(requestToSign, { + signingDate = /* @__PURE__ */ new Date(), + signableHeaders, + unsignableHeaders, + signingRegion, + signingService + } = {}) { + const credentials = await this.credentialProvider(); + this.validateResolvedCredentials(credentials); + const region = signingRegion ?? await this.regionProvider(); + const request = prepareRequest(requestToSign); + const { longDate, shortDate } = formatDate(signingDate); + const scope = createScope(shortDate, region, signingService ?? this.service); + request.headers[AMZ_DATE_HEADER] = longDate; + if (credentials.sessionToken) { + request.headers[TOKEN_HEADER] = credentials.sessionToken; + } + const payloadHash = await getPayloadHash(request, this.sha256); + if (!hasHeader(SHA256_HEADER, request.headers) && this.applyChecksum) { + request.headers[SHA256_HEADER] = payloadHash; + } + const canonicalHeaders = getCanonicalHeaders(request, unsignableHeaders, signableHeaders); + const signature = await this.getSignature( + longDate, + scope, + this.getSigningKey(credentials, region, shortDate, signingService), + this.createCanonicalRequest(request, canonicalHeaders, payloadHash) + ); + request.headers[AUTH_HEADER] = `${ALGORITHM_IDENTIFIER} Credential=${credentials.accessKeyId}/${scope}, SignedHeaders=${getCanonicalHeaderList(canonicalHeaders)}, Signature=${signature}`; + return request; + } + createCanonicalRequest(request, canonicalHeaders, payloadHash) { + const sortedHeaders = Object.keys(canonicalHeaders).sort(); + return `${request.method} +${this.getCanonicalPath(request)} +${getCanonicalQuery(request)} +${sortedHeaders.map((name) => `${name}:${canonicalHeaders[name]}`).join("\n")} + +${sortedHeaders.join(";")} +${payloadHash}`; + } + async createStringToSign(longDate, credentialScope, canonicalRequest) { + const hash = new this.sha256(); + hash.update((0, import_util_utf84.toUint8Array)(canonicalRequest)); + const hashedRequest = await hash.digest(); + return `${ALGORITHM_IDENTIFIER} +${longDate} +${credentialScope} +${(0, import_util_hex_encoding.toHex)(hashedRequest)}`; + } + getCanonicalPath({ path }) { + if (this.uriEscapePath) { + const normalizedPathSegments = []; + for (const pathSegment of path.split("/")) { + if ((pathSegment == null ? void 0 : pathSegment.length) === 0) + continue; + if (pathSegment === ".") + continue; + if (pathSegment === "..") { + normalizedPathSegments.pop(); + } else { + normalizedPathSegments.push(pathSegment); + } + } + const normalizedPath = `${(path == null ? void 0 : path.startsWith("/")) ? "/" : ""}${normalizedPathSegments.join("/")}${normalizedPathSegments.length > 0 && (path == null ? void 0 : path.endsWith("/")) ? "/" : ""}`; + const doubleEncoded = (0, import_util_uri_escape.escapeUri)(normalizedPath); + return doubleEncoded.replace(/%2F/g, "/"); + } + return path; + } + async getSignature(longDate, credentialScope, keyPromise, canonicalRequest) { + const stringToSign = await this.createStringToSign(longDate, credentialScope, canonicalRequest); + const hash = new this.sha256(await keyPromise); + hash.update((0, import_util_utf84.toUint8Array)(stringToSign)); + return (0, import_util_hex_encoding.toHex)(await hash.digest()); + } + getSigningKey(credentials, region, shortDate, service) { + return getSigningKey(this.sha256, credentials, shortDate, region, service || this.service); + } + validateResolvedCredentials(credentials) { + if (typeof credentials !== "object" || // @ts-expect-error: Property 'accessKeyId' does not exist on type 'object'.ts(2339) + typeof credentials.accessKeyId !== "string" || // @ts-expect-error: Property 'secretAccessKey' does not exist on type 'object'.ts(2339) + typeof credentials.secretAccessKey !== "string") { + throw new Error("Resolved credential object is not valid"); + } + } +}; +__name(_SignatureV4, "SignatureV4"); +var SignatureV4 = _SignatureV4; +var formatDate = /* @__PURE__ */ __name((now) => { + const longDate = iso8601(now).replace(/[\-:]/g, ""); + return { + longDate, + shortDate: longDate.slice(0, 8) + }; +}, "formatDate"); +var getCanonicalHeaderList = /* @__PURE__ */ __name((headers) => Object.keys(headers).sort().join(";"), "getCanonicalHeaderList"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 63570: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Client: () => Client, + Command: () => Command, + LazyJsonString: () => LazyJsonString, + NoOpLogger: () => NoOpLogger, + SENSITIVE_STRING: () => SENSITIVE_STRING, + ServiceException: () => ServiceException, + StringWrapper: () => StringWrapper, + _json: () => _json, + collectBody: () => collectBody, + convertMap: () => convertMap, + createAggregatedClient: () => createAggregatedClient, + dateToUtcString: () => dateToUtcString, + decorateServiceException: () => decorateServiceException, + emitWarningIfUnsupportedVersion: () => emitWarningIfUnsupportedVersion, + expectBoolean: () => expectBoolean, + expectByte: () => expectByte, + expectFloat32: () => expectFloat32, + expectInt: () => expectInt, + expectInt32: () => expectInt32, + expectLong: () => expectLong, + expectNonNull: () => expectNonNull, + expectNumber: () => expectNumber, + expectObject: () => expectObject, + expectShort: () => expectShort, + expectString: () => expectString, + expectUnion: () => expectUnion, + extendedEncodeURIComponent: () => extendedEncodeURIComponent, + getArrayIfSingleItem: () => getArrayIfSingleItem, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + getDefaultExtensionConfiguration: () => getDefaultExtensionConfiguration, + getValueFromTextNode: () => getValueFromTextNode, + handleFloat: () => handleFloat, + limitedParseDouble: () => limitedParseDouble, + limitedParseFloat: () => limitedParseFloat, + limitedParseFloat32: () => limitedParseFloat32, + loadConfigsForDefaultMode: () => loadConfigsForDefaultMode, + logger: () => logger, + map: () => map, + parseBoolean: () => parseBoolean, + parseEpochTimestamp: () => parseEpochTimestamp, + parseRfc3339DateTime: () => parseRfc3339DateTime, + parseRfc3339DateTimeWithOffset: () => parseRfc3339DateTimeWithOffset, + parseRfc7231DateTime: () => parseRfc7231DateTime, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig, + resolvedPath: () => resolvedPath, + serializeDateTime: () => serializeDateTime, + serializeFloat: () => serializeFloat, + splitEvery: () => splitEvery, + strictParseByte: () => strictParseByte, + strictParseDouble: () => strictParseDouble, + strictParseFloat: () => strictParseFloat, + strictParseFloat32: () => strictParseFloat32, + strictParseInt: () => strictParseInt, + strictParseInt32: () => strictParseInt32, + strictParseLong: () => strictParseLong, + strictParseShort: () => strictParseShort, + take: () => take, + throwDefaultError: () => throwDefaultError, + withBaseException: () => withBaseException +}); +module.exports = __toCommonJS(src_exports); + +// src/NoOpLogger.ts +var _NoOpLogger = class _NoOpLogger { + trace() { + } + debug() { + } + info() { + } + warn() { + } + error() { + } +}; +__name(_NoOpLogger, "NoOpLogger"); +var NoOpLogger = _NoOpLogger; + +// src/client.ts +var import_middleware_stack = __nccwpck_require__(97911); +var _Client = class _Client { + constructor(config) { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + this.config = config; + } + send(command, optionsOrCb, cb) { + const options = typeof optionsOrCb !== "function" ? optionsOrCb : void 0; + const callback = typeof optionsOrCb === "function" ? optionsOrCb : cb; + const handler = command.resolveMiddleware(this.middlewareStack, this.config, options); + if (callback) { + handler(command).then( + (result) => callback(null, result.output), + (err) => callback(err) + ).catch( + // prevent any errors thrown in the callback from triggering an + // unhandled promise rejection + () => { + } + ); + } else { + return handler(command).then((result) => result.output); + } + } + destroy() { + if (this.config.requestHandler.destroy) + this.config.requestHandler.destroy(); + } +}; +__name(_Client, "Client"); +var Client = _Client; + +// src/collect-stream-body.ts +var import_util_stream = __nccwpck_require__(96607); +var collectBody = /* @__PURE__ */ __name(async (streamBody = new Uint8Array(), context) => { + if (streamBody instanceof Uint8Array) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(streamBody); + } + if (!streamBody) { + return import_util_stream.Uint8ArrayBlobAdapter.mutate(new Uint8Array()); + } + const fromContext = context.streamCollector(streamBody); + return import_util_stream.Uint8ArrayBlobAdapter.mutate(await fromContext); +}, "collectBody"); + +// src/command.ts + +var import_types = __nccwpck_require__(55756); +var _Command = class _Command { + constructor() { + this.middlewareStack = (0, import_middleware_stack.constructStack)(); + } + /** + * Factory for Command ClassBuilder. + * @internal + */ + static classBuilder() { + return new ClassBuilder(); + } + /** + * @internal + */ + resolveMiddlewareWithContext(clientStack, configuration, options, { + middlewareFn, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + smithyContext, + additionalContext, + CommandCtor + }) { + for (const mw of middlewareFn.bind(this)(CommandCtor, clientStack, configuration, options)) { + this.middlewareStack.use(mw); + } + const stack = clientStack.concat(this.middlewareStack); + const { logger: logger2 } = configuration; + const handlerExecutionContext = { + logger: logger2, + clientName, + commandName, + inputFilterSensitiveLog, + outputFilterSensitiveLog, + [import_types.SMITHY_CONTEXT_KEY]: { + ...smithyContext + }, + ...additionalContext + }; + const { requestHandler } = configuration; + return stack.resolve( + (request) => requestHandler.handle(request.request, options || {}), + handlerExecutionContext + ); + } +}; +__name(_Command, "Command"); +var Command = _Command; +var _ClassBuilder = class _ClassBuilder { + constructor() { + this._init = () => { + }; + this._ep = {}; + this._middlewareFn = () => []; + this._commandName = ""; + this._clientName = ""; + this._additionalContext = {}; + this._smithyContext = {}; + this._inputFilterSensitiveLog = (_) => _; + this._outputFilterSensitiveLog = (_) => _; + this._serializer = null; + this._deserializer = null; + } + /** + * Optional init callback. + */ + init(cb) { + this._init = cb; + } + /** + * Set the endpoint parameter instructions. + */ + ep(endpointParameterInstructions) { + this._ep = endpointParameterInstructions; + return this; + } + /** + * Add any number of middleware. + */ + m(middlewareSupplier) { + this._middlewareFn = middlewareSupplier; + return this; + } + /** + * Set the initial handler execution context Smithy field. + */ + s(service, operation, smithyContext = {}) { + this._smithyContext = { + service, + operation, + ...smithyContext + }; + return this; + } + /** + * Set the initial handler execution context. + */ + c(additionalContext = {}) { + this._additionalContext = additionalContext; + return this; + } + /** + * Set constant string identifiers for the operation. + */ + n(clientName, commandName) { + this._clientName = clientName; + this._commandName = commandName; + return this; + } + /** + * Set the input and output sensistive log filters. + */ + f(inputFilter = (_) => _, outputFilter = (_) => _) { + this._inputFilterSensitiveLog = inputFilter; + this._outputFilterSensitiveLog = outputFilter; + return this; + } + /** + * Sets the serializer. + */ + ser(serializer) { + this._serializer = serializer; + return this; + } + /** + * Sets the deserializer. + */ + de(deserializer) { + this._deserializer = deserializer; + return this; + } + /** + * @returns a Command class with the classBuilder properties. + */ + build() { + var _a; + const closure = this; + let CommandRef; + return CommandRef = (_a = class extends Command { + /** + * @public + */ + constructor(...[input]) { + super(); + /** + * @internal + */ + // @ts-ignore used in middlewareFn closure. + this.serialize = closure._serializer; + /** + * @internal + */ + // @ts-ignore used in middlewareFn closure. + this.deserialize = closure._deserializer; + this.input = input ?? {}; + closure._init(this); + } + /** + * @public + */ + static getEndpointParameterInstructions() { + return closure._ep; + } + /** + * @internal + */ + resolveMiddleware(stack, configuration, options) { + return this.resolveMiddlewareWithContext(stack, configuration, options, { + CommandCtor: CommandRef, + middlewareFn: closure._middlewareFn, + clientName: closure._clientName, + commandName: closure._commandName, + inputFilterSensitiveLog: closure._inputFilterSensitiveLog, + outputFilterSensitiveLog: closure._outputFilterSensitiveLog, + smithyContext: closure._smithyContext, + additionalContext: closure._additionalContext + }); + } + }, __name(_a, "CommandRef"), _a); + } +}; +__name(_ClassBuilder, "ClassBuilder"); +var ClassBuilder = _ClassBuilder; + +// src/constants.ts +var SENSITIVE_STRING = "***SensitiveInformation***"; + +// src/create-aggregated-client.ts +var createAggregatedClient = /* @__PURE__ */ __name((commands, Client2) => { + for (const command of Object.keys(commands)) { + const CommandCtor = commands[command]; + const methodImpl = /* @__PURE__ */ __name(async function(args, optionsOrCb, cb) { + const command2 = new CommandCtor(args); + if (typeof optionsOrCb === "function") { + this.send(command2, optionsOrCb); + } else if (typeof cb === "function") { + if (typeof optionsOrCb !== "object") + throw new Error(`Expected http options but got ${typeof optionsOrCb}`); + this.send(command2, optionsOrCb || {}, cb); + } else { + return this.send(command2, optionsOrCb); + } + }, "methodImpl"); + const methodName = (command[0].toLowerCase() + command.slice(1)).replace(/Command$/, ""); + Client2.prototype[methodName] = methodImpl; + } +}, "createAggregatedClient"); + +// src/parse-utils.ts +var parseBoolean = /* @__PURE__ */ __name((value) => { + switch (value) { + case "true": + return true; + case "false": + return false; + default: + throw new Error(`Unable to parse boolean value "${value}"`); + } +}, "parseBoolean"); +var expectBoolean = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "number") { + if (value === 0 || value === 1) { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (value === 0) { + return false; + } + if (value === 1) { + return true; + } + } + if (typeof value === "string") { + const lower = value.toLowerCase(); + if (lower === "false" || lower === "true") { + logger.warn(stackTraceWarning(`Expected boolean, got ${typeof value}: ${value}`)); + } + if (lower === "false") { + return false; + } + if (lower === "true") { + return true; + } + } + if (typeof value === "boolean") { + return value; + } + throw new TypeError(`Expected boolean, got ${typeof value}: ${value}`); +}, "expectBoolean"); +var expectNumber = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + const parsed = parseFloat(value); + if (!Number.isNaN(parsed)) { + if (String(parsed) !== String(value)) { + logger.warn(stackTraceWarning(`Expected number but observed string: ${value}`)); + } + return parsed; + } + } + if (typeof value === "number") { + return value; + } + throw new TypeError(`Expected number, got ${typeof value}: ${value}`); +}, "expectNumber"); +var MAX_FLOAT = Math.ceil(2 ** 127 * (2 - 2 ** -23)); +var expectFloat32 = /* @__PURE__ */ __name((value) => { + const expected = expectNumber(value); + if (expected !== void 0 && !Number.isNaN(expected) && expected !== Infinity && expected !== -Infinity) { + if (Math.abs(expected) > MAX_FLOAT) { + throw new TypeError(`Expected 32-bit float, got ${value}`); + } + } + return expected; +}, "expectFloat32"); +var expectLong = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (Number.isInteger(value) && !Number.isNaN(value)) { + return value; + } + throw new TypeError(`Expected integer, got ${typeof value}: ${value}`); +}, "expectLong"); +var expectInt = expectLong; +var expectInt32 = /* @__PURE__ */ __name((value) => expectSizedInt(value, 32), "expectInt32"); +var expectShort = /* @__PURE__ */ __name((value) => expectSizedInt(value, 16), "expectShort"); +var expectByte = /* @__PURE__ */ __name((value) => expectSizedInt(value, 8), "expectByte"); +var expectSizedInt = /* @__PURE__ */ __name((value, size) => { + const expected = expectLong(value); + if (expected !== void 0 && castInt(expected, size) !== expected) { + throw new TypeError(`Expected ${size}-bit integer, got ${value}`); + } + return expected; +}, "expectSizedInt"); +var castInt = /* @__PURE__ */ __name((value, size) => { + switch (size) { + case 32: + return Int32Array.of(value)[0]; + case 16: + return Int16Array.of(value)[0]; + case 8: + return Int8Array.of(value)[0]; + } +}, "castInt"); +var expectNonNull = /* @__PURE__ */ __name((value, location) => { + if (value === null || value === void 0) { + if (location) { + throw new TypeError(`Expected a non-null value for ${location}`); + } + throw new TypeError("Expected a non-null value"); + } + return value; +}, "expectNonNull"); +var expectObject = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "object" && !Array.isArray(value)) { + return value; + } + const receivedType = Array.isArray(value) ? "array" : typeof value; + throw new TypeError(`Expected object, got ${receivedType}: ${value}`); +}, "expectObject"); +var expectString = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value === "string") { + return value; + } + if (["boolean", "number", "bigint"].includes(typeof value)) { + logger.warn(stackTraceWarning(`Expected string, got ${typeof value}: ${value}`)); + return String(value); + } + throw new TypeError(`Expected string, got ${typeof value}: ${value}`); +}, "expectString"); +var expectUnion = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + const asObject = expectObject(value); + const setKeys = Object.entries(asObject).filter(([, v]) => v != null).map(([k]) => k); + if (setKeys.length === 0) { + throw new TypeError(`Unions must have exactly one non-null member. None were found.`); + } + if (setKeys.length > 1) { + throw new TypeError(`Unions must have exactly one non-null member. Keys ${setKeys} were not null.`); + } + return asObject; +}, "expectUnion"); +var strictParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectNumber(parseNumber(value)); + } + return expectNumber(value); +}, "strictParseDouble"); +var strictParseFloat = strictParseDouble; +var strictParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return expectFloat32(parseNumber(value)); + } + return expectFloat32(value); +}, "strictParseFloat32"); +var NUMBER_REGEX = /(-?(?:0|[1-9]\d*)(?:\.\d+)?(?:[eE][+-]?\d+)?)|(-?Infinity)|(NaN)/g; +var parseNumber = /* @__PURE__ */ __name((value) => { + const matches = value.match(NUMBER_REGEX); + if (matches === null || matches[0].length !== value.length) { + throw new TypeError(`Expected real number, got implicit NaN`); + } + return parseFloat(value); +}, "parseNumber"); +var limitedParseDouble = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectNumber(value); +}, "limitedParseDouble"); +var handleFloat = limitedParseDouble; +var limitedParseFloat = limitedParseDouble; +var limitedParseFloat32 = /* @__PURE__ */ __name((value) => { + if (typeof value == "string") { + return parseFloatString(value); + } + return expectFloat32(value); +}, "limitedParseFloat32"); +var parseFloatString = /* @__PURE__ */ __name((value) => { + switch (value) { + case "NaN": + return NaN; + case "Infinity": + return Infinity; + case "-Infinity": + return -Infinity; + default: + throw new Error(`Unable to parse float value: ${value}`); + } +}, "parseFloatString"); +var strictParseLong = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectLong(parseNumber(value)); + } + return expectLong(value); +}, "strictParseLong"); +var strictParseInt = strictParseLong; +var strictParseInt32 = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectInt32(parseNumber(value)); + } + return expectInt32(value); +}, "strictParseInt32"); +var strictParseShort = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectShort(parseNumber(value)); + } + return expectShort(value); +}, "strictParseShort"); +var strictParseByte = /* @__PURE__ */ __name((value) => { + if (typeof value === "string") { + return expectByte(parseNumber(value)); + } + return expectByte(value); +}, "strictParseByte"); +var stackTraceWarning = /* @__PURE__ */ __name((message) => { + return String(new TypeError(message).stack || message).split("\n").slice(0, 5).filter((s) => !s.includes("stackTraceWarning")).join("\n"); +}, "stackTraceWarning"); +var logger = { + warn: console.warn +}; + +// src/date-utils.ts +var DAYS = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"]; +var MONTHS = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"]; +function dateToUtcString(date) { + const year = date.getUTCFullYear(); + const month = date.getUTCMonth(); + const dayOfWeek = date.getUTCDay(); + const dayOfMonthInt = date.getUTCDate(); + const hoursInt = date.getUTCHours(); + const minutesInt = date.getUTCMinutes(); + const secondsInt = date.getUTCSeconds(); + const dayOfMonthString = dayOfMonthInt < 10 ? `0${dayOfMonthInt}` : `${dayOfMonthInt}`; + const hoursString = hoursInt < 10 ? `0${hoursInt}` : `${hoursInt}`; + const minutesString = minutesInt < 10 ? `0${minutesInt}` : `${minutesInt}`; + const secondsString = secondsInt < 10 ? `0${secondsInt}` : `${secondsInt}`; + return `${DAYS[dayOfWeek]}, ${dayOfMonthString} ${MONTHS[month]} ${year} ${hoursString}:${minutesString}:${secondsString} GMT`; +} +__name(dateToUtcString, "dateToUtcString"); +var RFC3339 = new RegExp(/^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?[zZ]$/); +var parseRfc3339DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + return buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); +}, "parseRfc3339DateTime"); +var RFC3339_WITH_OFFSET = new RegExp( + /^(\d{4})-(\d{2})-(\d{2})[tT](\d{2}):(\d{2}):(\d{2})(?:\.(\d+))?(([-+]\d{2}\:\d{2})|[zZ])$/ +); +var parseRfc3339DateTimeWithOffset = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-3339 date-times must be expressed as strings"); + } + const match = RFC3339_WITH_OFFSET.exec(value); + if (!match) { + throw new TypeError("Invalid RFC-3339 date-time value"); + } + const [_, yearStr, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, offsetStr] = match; + const year = strictParseShort(stripLeadingZeroes(yearStr)); + const month = parseDateValue(monthStr, "month", 1, 12); + const day = parseDateValue(dayStr, "day", 1, 31); + const date = buildDate(year, month, day, { hours, minutes, seconds, fractionalMilliseconds }); + if (offsetStr.toUpperCase() != "Z") { + date.setTime(date.getTime() - parseOffsetToMilliseconds(offsetStr)); + } + return date; +}, "parseRfc3339DateTimeWithOffset"); +var IMF_FIXDATE = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun), (\d{2}) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) (\d{4}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var RFC_850_DATE = new RegExp( + /^(?:Monday|Tuesday|Wednesday|Thursday|Friday|Saturday|Sunday), (\d{2})-(Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec)-(\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? GMT$/ +); +var ASC_TIME = new RegExp( + /^(?:Mon|Tue|Wed|Thu|Fri|Sat|Sun) (Jan|Feb|Mar|Apr|May|Jun|Jul|Aug|Sep|Oct|Nov|Dec) ( [1-9]|\d{2}) (\d{1,2}):(\d{2}):(\d{2})(?:\.(\d+))? (\d{4})$/ +); +var parseRfc7231DateTime = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + if (typeof value !== "string") { + throw new TypeError("RFC-7231 date-times must be expressed as strings"); + } + let match = IMF_FIXDATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr, "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + match = RFC_850_DATE.exec(value); + if (match) { + const [_, dayStr, monthStr, yearStr, hours, minutes, seconds, fractionalMilliseconds] = match; + return adjustRfc850Year( + buildDate(parseTwoDigitYear(yearStr), parseMonthByShortName(monthStr), parseDateValue(dayStr, "day", 1, 31), { + hours, + minutes, + seconds, + fractionalMilliseconds + }) + ); + } + match = ASC_TIME.exec(value); + if (match) { + const [_, monthStr, dayStr, hours, minutes, seconds, fractionalMilliseconds, yearStr] = match; + return buildDate( + strictParseShort(stripLeadingZeroes(yearStr)), + parseMonthByShortName(monthStr), + parseDateValue(dayStr.trimLeft(), "day", 1, 31), + { hours, minutes, seconds, fractionalMilliseconds } + ); + } + throw new TypeError("Invalid RFC-7231 date-time value"); +}, "parseRfc7231DateTime"); +var parseEpochTimestamp = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return void 0; + } + let valueAsDouble; + if (typeof value === "number") { + valueAsDouble = value; + } else if (typeof value === "string") { + valueAsDouble = strictParseDouble(value); + } else { + throw new TypeError("Epoch timestamps must be expressed as floating point numbers or their string representation"); + } + if (Number.isNaN(valueAsDouble) || valueAsDouble === Infinity || valueAsDouble === -Infinity) { + throw new TypeError("Epoch timestamps must be valid, non-Infinite, non-NaN numerics"); + } + return new Date(Math.round(valueAsDouble * 1e3)); +}, "parseEpochTimestamp"); +var buildDate = /* @__PURE__ */ __name((year, month, day, time) => { + const adjustedMonth = month - 1; + validateDayOfMonth(year, adjustedMonth, day); + return new Date( + Date.UTC( + year, + adjustedMonth, + day, + parseDateValue(time.hours, "hour", 0, 23), + parseDateValue(time.minutes, "minute", 0, 59), + // seconds can go up to 60 for leap seconds + parseDateValue(time.seconds, "seconds", 0, 60), + parseMilliseconds(time.fractionalMilliseconds) + ) + ); +}, "buildDate"); +var parseTwoDigitYear = /* @__PURE__ */ __name((value) => { + const thisYear = (/* @__PURE__ */ new Date()).getUTCFullYear(); + const valueInThisCentury = Math.floor(thisYear / 100) * 100 + strictParseShort(stripLeadingZeroes(value)); + if (valueInThisCentury < thisYear) { + return valueInThisCentury + 100; + } + return valueInThisCentury; +}, "parseTwoDigitYear"); +var FIFTY_YEARS_IN_MILLIS = 50 * 365 * 24 * 60 * 60 * 1e3; +var adjustRfc850Year = /* @__PURE__ */ __name((input) => { + if (input.getTime() - (/* @__PURE__ */ new Date()).getTime() > FIFTY_YEARS_IN_MILLIS) { + return new Date( + Date.UTC( + input.getUTCFullYear() - 100, + input.getUTCMonth(), + input.getUTCDate(), + input.getUTCHours(), + input.getUTCMinutes(), + input.getUTCSeconds(), + input.getUTCMilliseconds() + ) + ); + } + return input; +}, "adjustRfc850Year"); +var parseMonthByShortName = /* @__PURE__ */ __name((value) => { + const monthIdx = MONTHS.indexOf(value); + if (monthIdx < 0) { + throw new TypeError(`Invalid month: ${value}`); + } + return monthIdx + 1; +}, "parseMonthByShortName"); +var DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31]; +var validateDayOfMonth = /* @__PURE__ */ __name((year, month, day) => { + let maxDays = DAYS_IN_MONTH[month]; + if (month === 1 && isLeapYear(year)) { + maxDays = 29; + } + if (day > maxDays) { + throw new TypeError(`Invalid day for ${MONTHS[month]} in ${year}: ${day}`); + } +}, "validateDayOfMonth"); +var isLeapYear = /* @__PURE__ */ __name((year) => { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +}, "isLeapYear"); +var parseDateValue = /* @__PURE__ */ __name((value, type, lower, upper) => { + const dateVal = strictParseByte(stripLeadingZeroes(value)); + if (dateVal < lower || dateVal > upper) { + throw new TypeError(`${type} must be between ${lower} and ${upper}, inclusive`); + } + return dateVal; +}, "parseDateValue"); +var parseMilliseconds = /* @__PURE__ */ __name((value) => { + if (value === null || value === void 0) { + return 0; + } + return strictParseFloat32("0." + value) * 1e3; +}, "parseMilliseconds"); +var parseOffsetToMilliseconds = /* @__PURE__ */ __name((value) => { + const directionStr = value[0]; + let direction = 1; + if (directionStr == "+") { + direction = 1; + } else if (directionStr == "-") { + direction = -1; + } else { + throw new TypeError(`Offset direction, ${directionStr}, must be "+" or "-"`); + } + const hour = Number(value.substring(1, 3)); + const minute = Number(value.substring(4, 6)); + return direction * (hour * 60 + minute) * 60 * 1e3; +}, "parseOffsetToMilliseconds"); +var stripLeadingZeroes = /* @__PURE__ */ __name((value) => { + let idx = 0; + while (idx < value.length - 1 && value.charAt(idx) === "0") { + idx++; + } + if (idx === 0) { + return value; + } + return value.slice(idx); +}, "stripLeadingZeroes"); + +// src/exceptions.ts +var _ServiceException = class _ServiceException extends Error { + constructor(options) { + super(options.message); + Object.setPrototypeOf(this, _ServiceException.prototype); + this.name = options.name; + this.$fault = options.$fault; + this.$metadata = options.$metadata; + } +}; +__name(_ServiceException, "ServiceException"); +var ServiceException = _ServiceException; +var decorateServiceException = /* @__PURE__ */ __name((exception, additions = {}) => { + Object.entries(additions).filter(([, v]) => v !== void 0).forEach(([k, v]) => { + if (exception[k] == void 0 || exception[k] === "") { + exception[k] = v; + } + }); + const message = exception.message || exception.Message || "UnknownError"; + exception.message = message; + delete exception.Message; + return exception; +}, "decorateServiceException"); + +// src/default-error-handler.ts +var throwDefaultError = /* @__PURE__ */ __name(({ output, parsedBody, exceptionCtor, errorCode }) => { + const $metadata = deserializeMetadata(output); + const statusCode = $metadata.httpStatusCode ? $metadata.httpStatusCode + "" : void 0; + const response = new exceptionCtor({ + name: (parsedBody == null ? void 0 : parsedBody.code) || (parsedBody == null ? void 0 : parsedBody.Code) || errorCode || statusCode || "UnknownError", + $fault: "client", + $metadata + }); + throw decorateServiceException(response, parsedBody); +}, "throwDefaultError"); +var withBaseException = /* @__PURE__ */ __name((ExceptionCtor) => { + return ({ output, parsedBody, errorCode }) => { + throwDefaultError({ output, parsedBody, exceptionCtor: ExceptionCtor, errorCode }); + }; +}, "withBaseException"); +var deserializeMetadata = /* @__PURE__ */ __name((output) => ({ + httpStatusCode: output.statusCode, + requestId: output.headers["x-amzn-requestid"] ?? output.headers["x-amzn-request-id"] ?? output.headers["x-amz-request-id"], + extendedRequestId: output.headers["x-amz-id-2"], + cfId: output.headers["x-amz-cf-id"] +}), "deserializeMetadata"); + +// src/defaults-mode.ts +var loadConfigsForDefaultMode = /* @__PURE__ */ __name((mode) => { + switch (mode) { + case "standard": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "in-region": + return { + retryMode: "standard", + connectionTimeout: 1100 + }; + case "cross-region": + return { + retryMode: "standard", + connectionTimeout: 3100 + }; + case "mobile": + return { + retryMode: "standard", + connectionTimeout: 3e4 + }; + default: + return {}; + } +}, "loadConfigsForDefaultMode"); + +// src/emitWarningIfUnsupportedVersion.ts +var warningEmitted = false; +var emitWarningIfUnsupportedVersion = /* @__PURE__ */ __name((version) => { + if (version && !warningEmitted && parseInt(version.substring(1, version.indexOf("."))) < 16) { + warningEmitted = true; + } +}, "emitWarningIfUnsupportedVersion"); + +// src/extensions/checksum.ts + +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + for (const id in import_types.AlgorithmId) { + const algorithmId = import_types.AlgorithmId[id]; + if (runtimeConfig[algorithmId] === void 0) { + continue; + } + checksumAlgorithms.push({ + algorithmId: () => algorithmId, + checksumConstructor: () => runtimeConfig[algorithmId] + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); + +// src/extensions/retry.ts +var getRetryConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + let _retryStrategy = runtimeConfig.retryStrategy; + return { + setRetryStrategy(retryStrategy) { + _retryStrategy = retryStrategy; + }, + retryStrategy() { + return _retryStrategy; + } + }; +}, "getRetryConfiguration"); +var resolveRetryRuntimeConfig = /* @__PURE__ */ __name((retryStrategyConfiguration) => { + const runtimeConfig = {}; + runtimeConfig.retryStrategy = retryStrategyConfiguration.retryStrategy(); + return runtimeConfig; +}, "resolveRetryRuntimeConfig"); + +// src/extensions/defaultExtensionConfiguration.ts +var getDefaultExtensionConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + ...getChecksumConfiguration(runtimeConfig), + ...getRetryConfiguration(runtimeConfig) + }; +}, "getDefaultExtensionConfiguration"); +var getDefaultClientConfiguration = getDefaultExtensionConfiguration; +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + ...resolveChecksumRuntimeConfig(config), + ...resolveRetryRuntimeConfig(config) + }; +}, "resolveDefaultRuntimeConfig"); + +// src/extended-encode-uri-component.ts +function extendedEncodeURIComponent(str) { + return encodeURIComponent(str).replace(/[!'()*]/g, function(c) { + return "%" + c.charCodeAt(0).toString(16).toUpperCase(); + }); +} +__name(extendedEncodeURIComponent, "extendedEncodeURIComponent"); + +// src/get-array-if-single-item.ts +var getArrayIfSingleItem = /* @__PURE__ */ __name((mayBeArray) => Array.isArray(mayBeArray) ? mayBeArray : [mayBeArray], "getArrayIfSingleItem"); + +// src/get-value-from-text-node.ts +var getValueFromTextNode = /* @__PURE__ */ __name((obj) => { + const textNodeName = "#text"; + for (const key in obj) { + if (obj.hasOwnProperty(key) && obj[key][textNodeName] !== void 0) { + obj[key] = obj[key][textNodeName]; + } else if (typeof obj[key] === "object" && obj[key] !== null) { + obj[key] = getValueFromTextNode(obj[key]); + } + } + return obj; +}, "getValueFromTextNode"); + +// src/lazy-json.ts +var StringWrapper = /* @__PURE__ */ __name(function() { + const Class = Object.getPrototypeOf(this).constructor; + const Constructor = Function.bind.apply(String, [null, ...arguments]); + const instance = new Constructor(); + Object.setPrototypeOf(instance, Class.prototype); + return instance; +}, "StringWrapper"); +StringWrapper.prototype = Object.create(String.prototype, { + constructor: { + value: StringWrapper, + enumerable: false, + writable: true, + configurable: true + } +}); +Object.setPrototypeOf(StringWrapper, String); +var _LazyJsonString = class _LazyJsonString extends StringWrapper { + deserializeJSON() { + return JSON.parse(super.toString()); + } + toJSON() { + return super.toString(); + } + static fromObject(object) { + if (object instanceof _LazyJsonString) { + return object; + } else if (object instanceof String || typeof object === "string") { + return new _LazyJsonString(object); + } + return new _LazyJsonString(JSON.stringify(object)); + } +}; +__name(_LazyJsonString, "LazyJsonString"); +var LazyJsonString = _LazyJsonString; + +// src/object-mapping.ts +function map(arg0, arg1, arg2) { + let target; + let filter; + let instructions; + if (typeof arg1 === "undefined" && typeof arg2 === "undefined") { + target = {}; + instructions = arg0; + } else { + target = arg0; + if (typeof arg1 === "function") { + filter = arg1; + instructions = arg2; + return mapWithFilter(target, filter, instructions); + } else { + instructions = arg1; + } + } + for (const key of Object.keys(instructions)) { + if (!Array.isArray(instructions[key])) { + target[key] = instructions[key]; + continue; + } + applyInstruction(target, null, instructions, key); + } + return target; +} +__name(map, "map"); +var convertMap = /* @__PURE__ */ __name((target) => { + const output = {}; + for (const [k, v] of Object.entries(target || {})) { + output[k] = [, v]; + } + return output; +}, "convertMap"); +var take = /* @__PURE__ */ __name((source, instructions) => { + const out = {}; + for (const key in instructions) { + applyInstruction(out, source, instructions, key); + } + return out; +}, "take"); +var mapWithFilter = /* @__PURE__ */ __name((target, filter, instructions) => { + return map( + target, + Object.entries(instructions).reduce( + (_instructions, [key, value]) => { + if (Array.isArray(value)) { + _instructions[key] = value; + } else { + if (typeof value === "function") { + _instructions[key] = [filter, value()]; + } else { + _instructions[key] = [filter, value]; + } + } + return _instructions; + }, + {} + ) + ); +}, "mapWithFilter"); +var applyInstruction = /* @__PURE__ */ __name((target, source, instructions, targetKey) => { + if (source !== null) { + let instruction = instructions[targetKey]; + if (typeof instruction === "function") { + instruction = [, instruction]; + } + const [filter2 = nonNullish, valueFn = pass, sourceKey = targetKey] = instruction; + if (typeof filter2 === "function" && filter2(source[sourceKey]) || typeof filter2 !== "function" && !!filter2) { + target[targetKey] = valueFn(source[sourceKey]); + } + return; + } + let [filter, value] = instructions[targetKey]; + if (typeof value === "function") { + let _value; + const defaultFilterPassed = filter === void 0 && (_value = value()) != null; + const customFilterPassed = typeof filter === "function" && !!filter(void 0) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed) { + target[targetKey] = _value; + } else if (customFilterPassed) { + target[targetKey] = value(); + } + } else { + const defaultFilterPassed = filter === void 0 && value != null; + const customFilterPassed = typeof filter === "function" && !!filter(value) || typeof filter !== "function" && !!filter; + if (defaultFilterPassed || customFilterPassed) { + target[targetKey] = value; + } + } +}, "applyInstruction"); +var nonNullish = /* @__PURE__ */ __name((_) => _ != null, "nonNullish"); +var pass = /* @__PURE__ */ __name((_) => _, "pass"); + +// src/resolve-path.ts +var resolvedPath = /* @__PURE__ */ __name((resolvedPath2, input, memberName, labelValueProvider, uriLabel, isGreedyLabel) => { + if (input != null && input[memberName] !== void 0) { + const labelValue = labelValueProvider(); + if (labelValue.length <= 0) { + throw new Error("Empty value provided for input HTTP label: " + memberName + "."); + } + resolvedPath2 = resolvedPath2.replace( + uriLabel, + isGreedyLabel ? labelValue.split("/").map((segment) => extendedEncodeURIComponent(segment)).join("/") : extendedEncodeURIComponent(labelValue) + ); + } else { + throw new Error("No value provided for input HTTP label: " + memberName + "."); + } + return resolvedPath2; +}, "resolvedPath"); + +// src/ser-utils.ts +var serializeFloat = /* @__PURE__ */ __name((value) => { + if (value !== value) { + return "NaN"; + } + switch (value) { + case Infinity: + return "Infinity"; + case -Infinity: + return "-Infinity"; + default: + return value; + } +}, "serializeFloat"); +var serializeDateTime = /* @__PURE__ */ __name((date) => date.toISOString().replace(".000Z", "Z"), "serializeDateTime"); + +// src/serde-json.ts +var _json = /* @__PURE__ */ __name((obj) => { + if (obj == null) { + return {}; + } + if (Array.isArray(obj)) { + return obj.filter((_) => _ != null).map(_json); + } + if (typeof obj === "object") { + const target = {}; + for (const key of Object.keys(obj)) { + if (obj[key] == null) { + continue; + } + target[key] = _json(obj[key]); + } + return target; + } + return obj; +}, "_json"); + +// src/split-every.ts +function splitEvery(value, delimiter, numDelimiters) { + if (numDelimiters <= 0 || !Number.isInteger(numDelimiters)) { + throw new Error("Invalid number of delimiters (" + numDelimiters + ") for splitEvery."); + } + const segments = value.split(delimiter); + if (numDelimiters === 1) { + return segments; + } + const compoundSegments = []; + let currentSegment = ""; + for (let i = 0; i < segments.length; i++) { + if (currentSegment === "") { + currentSegment = segments[i]; + } else { + currentSegment += delimiter + segments[i]; + } + if ((i + 1) % numDelimiters === 0) { + compoundSegments.push(currentSegment); + currentSegment = ""; + } + } + if (currentSegment !== "") { + compoundSegments.push(currentSegment); + } + return compoundSegments; +} +__name(splitEvery, "splitEvery"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 55756: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AlgorithmId: () => AlgorithmId, + EndpointURLScheme: () => EndpointURLScheme, + FieldPosition: () => FieldPosition, + HttpApiKeyAuthLocation: () => HttpApiKeyAuthLocation, + HttpAuthLocation: () => HttpAuthLocation, + IniSectionType: () => IniSectionType, + RequestHandlerProtocol: () => RequestHandlerProtocol, + SMITHY_CONTEXT_KEY: () => SMITHY_CONTEXT_KEY, + getDefaultClientConfiguration: () => getDefaultClientConfiguration, + resolveDefaultRuntimeConfig: () => resolveDefaultRuntimeConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/auth/auth.ts +var HttpAuthLocation = /* @__PURE__ */ ((HttpAuthLocation2) => { + HttpAuthLocation2["HEADER"] = "header"; + HttpAuthLocation2["QUERY"] = "query"; + return HttpAuthLocation2; +})(HttpAuthLocation || {}); + +// src/auth/HttpApiKeyAuth.ts +var HttpApiKeyAuthLocation = /* @__PURE__ */ ((HttpApiKeyAuthLocation2) => { + HttpApiKeyAuthLocation2["HEADER"] = "header"; + HttpApiKeyAuthLocation2["QUERY"] = "query"; + return HttpApiKeyAuthLocation2; +})(HttpApiKeyAuthLocation || {}); + +// src/endpoint.ts +var EndpointURLScheme = /* @__PURE__ */ ((EndpointURLScheme2) => { + EndpointURLScheme2["HTTP"] = "http"; + EndpointURLScheme2["HTTPS"] = "https"; + return EndpointURLScheme2; +})(EndpointURLScheme || {}); + +// src/extensions/checksum.ts +var AlgorithmId = /* @__PURE__ */ ((AlgorithmId2) => { + AlgorithmId2["MD5"] = "md5"; + AlgorithmId2["CRC32"] = "crc32"; + AlgorithmId2["CRC32C"] = "crc32c"; + AlgorithmId2["SHA1"] = "sha1"; + AlgorithmId2["SHA256"] = "sha256"; + return AlgorithmId2; +})(AlgorithmId || {}); +var getChecksumConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + const checksumAlgorithms = []; + if (runtimeConfig.sha256 !== void 0) { + checksumAlgorithms.push({ + algorithmId: () => "sha256" /* SHA256 */, + checksumConstructor: () => runtimeConfig.sha256 + }); + } + if (runtimeConfig.md5 != void 0) { + checksumAlgorithms.push({ + algorithmId: () => "md5" /* MD5 */, + checksumConstructor: () => runtimeConfig.md5 + }); + } + return { + _checksumAlgorithms: checksumAlgorithms, + addChecksumAlgorithm(algo) { + this._checksumAlgorithms.push(algo); + }, + checksumAlgorithms() { + return this._checksumAlgorithms; + } + }; +}, "getChecksumConfiguration"); +var resolveChecksumRuntimeConfig = /* @__PURE__ */ __name((clientConfig) => { + const runtimeConfig = {}; + clientConfig.checksumAlgorithms().forEach((checksumAlgorithm) => { + runtimeConfig[checksumAlgorithm.algorithmId()] = checksumAlgorithm.checksumConstructor(); + }); + return runtimeConfig; +}, "resolveChecksumRuntimeConfig"); + +// src/extensions/defaultClientConfiguration.ts +var getDefaultClientConfiguration = /* @__PURE__ */ __name((runtimeConfig) => { + return { + ...getChecksumConfiguration(runtimeConfig) + }; +}, "getDefaultClientConfiguration"); +var resolveDefaultRuntimeConfig = /* @__PURE__ */ __name((config) => { + return { + ...resolveChecksumRuntimeConfig(config) + }; +}, "resolveDefaultRuntimeConfig"); + +// src/http.ts +var FieldPosition = /* @__PURE__ */ ((FieldPosition2) => { + FieldPosition2[FieldPosition2["HEADER"] = 0] = "HEADER"; + FieldPosition2[FieldPosition2["TRAILER"] = 1] = "TRAILER"; + return FieldPosition2; +})(FieldPosition || {}); + +// src/middleware.ts +var SMITHY_CONTEXT_KEY = "__smithy_context"; + +// src/profile.ts +var IniSectionType = /* @__PURE__ */ ((IniSectionType2) => { + IniSectionType2["PROFILE"] = "profile"; + IniSectionType2["SSO_SESSION"] = "sso-session"; + IniSectionType2["SERVICES"] = "services"; + return IniSectionType2; +})(IniSectionType || {}); + +// src/transfer.ts +var RequestHandlerProtocol = /* @__PURE__ */ ((RequestHandlerProtocol2) => { + RequestHandlerProtocol2["HTTP_0_9"] = "http/0.9"; + RequestHandlerProtocol2["HTTP_1_0"] = "http/1.0"; + RequestHandlerProtocol2["TDS_8_0"] = "tds/8.0"; + return RequestHandlerProtocol2; +})(RequestHandlerProtocol || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 14681: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + parseUrl: () => parseUrl +}); +module.exports = __toCommonJS(src_exports); +var import_querystring_parser = __nccwpck_require__(4769); +var parseUrl = /* @__PURE__ */ __name((url) => { + if (typeof url === "string") { + return parseUrl(new URL(url)); + } + const { hostname, pathname, port, protocol, search } = url; + let query; + if (search) { + query = (0, import_querystring_parser.parseQueryString)(search); + } + return { + hostname, + port: port ? parseInt(port) : void 0, + protocol, + path: pathname, + query + }; +}, "parseUrl"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 30305: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.fromBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(31381); +const BASE64_REGEX = /^[A-Za-z0-9+/]*={0,2}$/; +const fromBase64 = (input) => { + if ((input.length * 3) % 4 !== 0) { + throw new TypeError(`Incorrect padding on base64 string.`); + } + if (!BASE64_REGEX.exec(input)) { + throw new TypeError(`Invalid base64 string.`); + } + const buffer = (0, util_buffer_from_1.fromString)(input, "base64"); + return new Uint8Array(buffer.buffer, buffer.byteOffset, buffer.byteLength); +}; +exports.fromBase64 = fromBase64; + + +/***/ }), + +/***/ 75600: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +module.exports = __toCommonJS(src_exports); +__reExport(src_exports, __nccwpck_require__(30305), module.exports); +__reExport(src_exports, __nccwpck_require__(74730), module.exports); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 74730: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.toBase64 = void 0; +const util_buffer_from_1 = __nccwpck_require__(31381); +const util_utf8_1 = __nccwpck_require__(41895); +const toBase64 = (_input) => { + let input; + if (typeof _input === "string") { + input = (0, util_utf8_1.fromUtf8)(_input); + } + else { + input = _input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-base64: toBase64 encoder function only accepts string | Uint8Array."); + } + return (0, util_buffer_from_1.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("base64"); +}; +exports.toBase64 = toBase64; + + +/***/ }), + +/***/ 68075: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + calculateBodyLength: () => calculateBodyLength +}); +module.exports = __toCommonJS(src_exports); + +// src/calculateBodyLength.ts +var import_fs = __nccwpck_require__(57147); +var calculateBodyLength = /* @__PURE__ */ __name((body) => { + if (!body) { + return 0; + } + if (typeof body === "string") { + return Buffer.byteLength(body); + } else if (typeof body.byteLength === "number") { + return body.byteLength; + } else if (typeof body.size === "number") { + return body.size; + } else if (typeof body.start === "number" && typeof body.end === "number") { + return body.end + 1 - body.start; + } else if (typeof body.path === "string" || Buffer.isBuffer(body.path)) { + return (0, import_fs.lstatSync)(body.path).size; + } else if (typeof body.fd === "number") { + return (0, import_fs.fstatSync)(body.fd).size; + } + throw new Error(`Body Length computation failed for ${body}`); +}, "calculateBodyLength"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 31381: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromArrayBuffer: () => fromArrayBuffer, + fromString: () => fromString +}); +module.exports = __toCommonJS(src_exports); +var import_is_array_buffer = __nccwpck_require__(10780); +var import_buffer = __nccwpck_require__(14300); +var fromArrayBuffer = /* @__PURE__ */ __name((input, offset = 0, length = input.byteLength - offset) => { + if (!(0, import_is_array_buffer.isArrayBuffer)(input)) { + throw new TypeError(`The "input" argument must be ArrayBuffer. Received type ${typeof input} (${input})`); + } + return import_buffer.Buffer.from(input, offset, length); +}, "fromArrayBuffer"); +var fromString = /* @__PURE__ */ __name((input, encoding) => { + if (typeof input !== "string") { + throw new TypeError(`The "input" argument must be of type string. Received type ${typeof input} (${input})`); + } + return encoding ? import_buffer.Buffer.from(input, encoding) : import_buffer.Buffer.from(input); +}, "fromString"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 83375: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + SelectorType: () => SelectorType, + booleanSelector: () => booleanSelector, + numberSelector: () => numberSelector +}); +module.exports = __toCommonJS(src_exports); + +// src/booleanSelector.ts +var booleanSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + if (obj[key] === "true") + return true; + if (obj[key] === "false") + return false; + throw new Error(`Cannot load ${type} "${key}". Expected "true" or "false", got ${obj[key]}.`); +}, "booleanSelector"); + +// src/numberSelector.ts +var numberSelector = /* @__PURE__ */ __name((obj, key, type) => { + if (!(key in obj)) + return void 0; + const numberValue = parseInt(obj[key], 10); + if (Number.isNaN(numberValue)) { + throw new TypeError(`Cannot load ${type} '${key}'. Expected number, got '${obj[key]}'.`); + } + return numberValue; +}, "numberSelector"); + +// src/types.ts +var SelectorType = /* @__PURE__ */ ((SelectorType2) => { + SelectorType2["ENV"] = "env"; + SelectorType2["CONFIG"] = "shared config entry"; + return SelectorType2; +})(SelectorType || {}); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 72429: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __create = Object.create; +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __getProtoOf = Object.getPrototypeOf; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps( + // If the importer is in node compatibility mode or this is not an ESM + // file that has been converted to a CommonJS file using a Babel- + // compatible transform (i.e. "__esModule" has not been set), then set + // "default" to the CommonJS "module.exports" for node compatibility. + isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target, + mod +)); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + resolveDefaultsModeConfig: () => resolveDefaultsModeConfig +}); +module.exports = __toCommonJS(src_exports); + +// src/resolveDefaultsModeConfig.ts +var import_config_resolver = __nccwpck_require__(53098); +var import_node_config_provider = __nccwpck_require__(33461); +var import_property_provider = __nccwpck_require__(79721); + +// src/constants.ts +var AWS_EXECUTION_ENV = "AWS_EXECUTION_ENV"; +var AWS_REGION_ENV = "AWS_REGION"; +var AWS_DEFAULT_REGION_ENV = "AWS_DEFAULT_REGION"; +var ENV_IMDS_DISABLED = "AWS_EC2_METADATA_DISABLED"; +var DEFAULTS_MODE_OPTIONS = ["in-region", "cross-region", "mobile", "standard", "legacy"]; +var IMDS_REGION_PATH = "/latest/meta-data/placement/region"; + +// src/defaultsModeConfig.ts +var AWS_DEFAULTS_MODE_ENV = "AWS_DEFAULTS_MODE"; +var AWS_DEFAULTS_MODE_CONFIG = "defaults_mode"; +var NODE_DEFAULTS_MODE_CONFIG_OPTIONS = { + environmentVariableSelector: (env) => { + return env[AWS_DEFAULTS_MODE_ENV]; + }, + configFileSelector: (profile) => { + return profile[AWS_DEFAULTS_MODE_CONFIG]; + }, + default: "legacy" +}; + +// src/resolveDefaultsModeConfig.ts +var resolveDefaultsModeConfig = /* @__PURE__ */ __name(({ + region = (0, import_node_config_provider.loadConfig)(import_config_resolver.NODE_REGION_CONFIG_OPTIONS), + defaultsMode = (0, import_node_config_provider.loadConfig)(NODE_DEFAULTS_MODE_CONFIG_OPTIONS) +} = {}) => (0, import_property_provider.memoize)(async () => { + const mode = typeof defaultsMode === "function" ? await defaultsMode() : defaultsMode; + switch (mode == null ? void 0 : mode.toLowerCase()) { + case "auto": + return resolveNodeDefaultsModeAuto(region); + case "in-region": + case "cross-region": + case "mobile": + case "standard": + case "legacy": + return Promise.resolve(mode == null ? void 0 : mode.toLocaleLowerCase()); + case void 0: + return Promise.resolve("legacy"); + default: + throw new Error( + `Invalid parameter for "defaultsMode", expect ${DEFAULTS_MODE_OPTIONS.join(", ")}, got ${mode}` + ); + } +}), "resolveDefaultsModeConfig"); +var resolveNodeDefaultsModeAuto = /* @__PURE__ */ __name(async (clientRegion) => { + if (clientRegion) { + const resolvedRegion = typeof clientRegion === "function" ? await clientRegion() : clientRegion; + const inferredRegion = await inferPhysicalRegion(); + if (!inferredRegion) { + return "standard"; + } + if (resolvedRegion === inferredRegion) { + return "in-region"; + } else { + return "cross-region"; + } + } + return "standard"; +}, "resolveNodeDefaultsModeAuto"); +var inferPhysicalRegion = /* @__PURE__ */ __name(async () => { + if (process.env[AWS_EXECUTION_ENV] && (process.env[AWS_REGION_ENV] || process.env[AWS_DEFAULT_REGION_ENV])) { + return process.env[AWS_REGION_ENV] ?? process.env[AWS_DEFAULT_REGION_ENV]; + } + if (!process.env[ENV_IMDS_DISABLED]) { + try { + const { getInstanceMetadataEndpoint, httpRequest } = await Promise.resolve().then(() => __toESM(__nccwpck_require__(7477))); + const endpoint = await getInstanceMetadataEndpoint(); + return (await httpRequest({ ...endpoint, path: IMDS_REGION_PATH })).toString(); + } catch (e) { + } + } +}, "inferPhysicalRegion"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 45473: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + EndpointError: () => EndpointError, + customEndpointFunctions: () => customEndpointFunctions, + isIpAddress: () => isIpAddress, + isValidHostLabel: () => isValidHostLabel, + resolveEndpoint: () => resolveEndpoint +}); +module.exports = __toCommonJS(src_exports); + +// src/lib/isIpAddress.ts +var IP_V4_REGEX = new RegExp( + `^(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)(?:\\.(?:25[0-5]|2[0-4]\\d|1\\d\\d|[1-9]\\d|\\d)){3}$` +); +var isIpAddress = /* @__PURE__ */ __name((value) => IP_V4_REGEX.test(value) || value.startsWith("[") && value.endsWith("]"), "isIpAddress"); + +// src/lib/isValidHostLabel.ts +var VALID_HOST_LABEL_REGEX = new RegExp(`^(?!.*-$)(?!-)[a-zA-Z0-9-]{1,63}$`); +var isValidHostLabel = /* @__PURE__ */ __name((value, allowSubDomains = false) => { + if (!allowSubDomains) { + return VALID_HOST_LABEL_REGEX.test(value); + } + const labels = value.split("."); + for (const label of labels) { + if (!isValidHostLabel(label)) { + return false; + } + } + return true; +}, "isValidHostLabel"); + +// src/utils/customEndpointFunctions.ts +var customEndpointFunctions = {}; + +// src/debug/debugId.ts +var debugId = "endpoints"; + +// src/debug/toDebugString.ts +function toDebugString(input) { + if (typeof input !== "object" || input == null) { + return input; + } + if ("ref" in input) { + return `$${toDebugString(input.ref)}`; + } + if ("fn" in input) { + return `${input.fn}(${(input.argv || []).map(toDebugString).join(", ")})`; + } + return JSON.stringify(input, null, 2); +} +__name(toDebugString, "toDebugString"); + +// src/types/EndpointError.ts +var _EndpointError = class _EndpointError extends Error { + constructor(message) { + super(message); + this.name = "EndpointError"; + } +}; +__name(_EndpointError, "EndpointError"); +var EndpointError = _EndpointError; + +// src/lib/booleanEquals.ts +var booleanEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "booleanEquals"); + +// src/lib/getAttrPathList.ts +var getAttrPathList = /* @__PURE__ */ __name((path) => { + const parts = path.split("."); + const pathList = []; + for (const part of parts) { + const squareBracketIndex = part.indexOf("["); + if (squareBracketIndex !== -1) { + if (part.indexOf("]") !== part.length - 1) { + throw new EndpointError(`Path: '${path}' does not end with ']'`); + } + const arrayIndex = part.slice(squareBracketIndex + 1, -1); + if (Number.isNaN(parseInt(arrayIndex))) { + throw new EndpointError(`Invalid array index: '${arrayIndex}' in path: '${path}'`); + } + if (squareBracketIndex !== 0) { + pathList.push(part.slice(0, squareBracketIndex)); + } + pathList.push(arrayIndex); + } else { + pathList.push(part); + } + } + return pathList; +}, "getAttrPathList"); + +// src/lib/getAttr.ts +var getAttr = /* @__PURE__ */ __name((value, path) => getAttrPathList(path).reduce((acc, index) => { + if (typeof acc !== "object") { + throw new EndpointError(`Index '${index}' in '${path}' not found in '${JSON.stringify(value)}'`); + } else if (Array.isArray(acc)) { + return acc[parseInt(index)]; + } + return acc[index]; +}, value), "getAttr"); + +// src/lib/isSet.ts +var isSet = /* @__PURE__ */ __name((value) => value != null, "isSet"); + +// src/lib/not.ts +var not = /* @__PURE__ */ __name((value) => !value, "not"); + +// src/lib/parseURL.ts +var import_types3 = __nccwpck_require__(55756); +var DEFAULT_PORTS = { + [import_types3.EndpointURLScheme.HTTP]: 80, + [import_types3.EndpointURLScheme.HTTPS]: 443 +}; +var parseURL = /* @__PURE__ */ __name((value) => { + const whatwgURL = (() => { + try { + if (value instanceof URL) { + return value; + } + if (typeof value === "object" && "hostname" in value) { + const { hostname: hostname2, port, protocol: protocol2 = "", path = "", query = {} } = value; + const url = new URL(`${protocol2}//${hostname2}${port ? `:${port}` : ""}${path}`); + url.search = Object.entries(query).map(([k, v]) => `${k}=${v}`).join("&"); + return url; + } + return new URL(value); + } catch (error) { + return null; + } + })(); + if (!whatwgURL) { + console.error(`Unable to parse ${JSON.stringify(value)} as a whatwg URL.`); + return null; + } + const urlString = whatwgURL.href; + const { host, hostname, pathname, protocol, search } = whatwgURL; + if (search) { + return null; + } + const scheme = protocol.slice(0, -1); + if (!Object.values(import_types3.EndpointURLScheme).includes(scheme)) { + return null; + } + const isIp = isIpAddress(hostname); + const inputContainsDefaultPort = urlString.includes(`${host}:${DEFAULT_PORTS[scheme]}`) || typeof value === "string" && value.includes(`${host}:${DEFAULT_PORTS[scheme]}`); + const authority = `${host}${inputContainsDefaultPort ? `:${DEFAULT_PORTS[scheme]}` : ``}`; + return { + scheme, + authority, + path: pathname, + normalizedPath: pathname.endsWith("/") ? pathname : `${pathname}/`, + isIp + }; +}, "parseURL"); + +// src/lib/stringEquals.ts +var stringEquals = /* @__PURE__ */ __name((value1, value2) => value1 === value2, "stringEquals"); + +// src/lib/substring.ts +var substring = /* @__PURE__ */ __name((input, start, stop, reverse) => { + if (start >= stop || input.length < stop) { + return null; + } + if (!reverse) { + return input.substring(start, stop); + } + return input.substring(input.length - stop, input.length - start); +}, "substring"); + +// src/lib/uriEncode.ts +var uriEncode = /* @__PURE__ */ __name((value) => encodeURIComponent(value).replace(/[!*'()]/g, (c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`), "uriEncode"); + +// src/utils/endpointFunctions.ts +var endpointFunctions = { + booleanEquals, + getAttr, + isSet, + isValidHostLabel, + not, + parseURL, + stringEquals, + substring, + uriEncode +}; + +// src/utils/evaluateTemplate.ts +var evaluateTemplate = /* @__PURE__ */ __name((template, options) => { + const evaluatedTemplateArr = []; + const templateContext = { + ...options.endpointParams, + ...options.referenceRecord + }; + let currentIndex = 0; + while (currentIndex < template.length) { + const openingBraceIndex = template.indexOf("{", currentIndex); + if (openingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(currentIndex)); + break; + } + evaluatedTemplateArr.push(template.slice(currentIndex, openingBraceIndex)); + const closingBraceIndex = template.indexOf("}", openingBraceIndex); + if (closingBraceIndex === -1) { + evaluatedTemplateArr.push(template.slice(openingBraceIndex)); + break; + } + if (template[openingBraceIndex + 1] === "{" && template[closingBraceIndex + 1] === "}") { + evaluatedTemplateArr.push(template.slice(openingBraceIndex + 1, closingBraceIndex)); + currentIndex = closingBraceIndex + 2; + } + const parameterName = template.substring(openingBraceIndex + 1, closingBraceIndex); + if (parameterName.includes("#")) { + const [refName, attrName] = parameterName.split("#"); + evaluatedTemplateArr.push(getAttr(templateContext[refName], attrName)); + } else { + evaluatedTemplateArr.push(templateContext[parameterName]); + } + currentIndex = closingBraceIndex + 1; + } + return evaluatedTemplateArr.join(""); +}, "evaluateTemplate"); + +// src/utils/getReferenceValue.ts +var getReferenceValue = /* @__PURE__ */ __name(({ ref }, options) => { + const referenceRecord = { + ...options.endpointParams, + ...options.referenceRecord + }; + return referenceRecord[ref]; +}, "getReferenceValue"); + +// src/utils/evaluateExpression.ts +var evaluateExpression = /* @__PURE__ */ __name((obj, keyName, options) => { + if (typeof obj === "string") { + return evaluateTemplate(obj, options); + } else if (obj["fn"]) { + return callFunction(obj, options); + } else if (obj["ref"]) { + return getReferenceValue(obj, options); + } + throw new EndpointError(`'${keyName}': ${String(obj)} is not a string, function or reference.`); +}, "evaluateExpression"); + +// src/utils/callFunction.ts +var callFunction = /* @__PURE__ */ __name(({ fn, argv }, options) => { + const evaluatedArgs = argv.map( + (arg) => ["boolean", "number"].includes(typeof arg) ? arg : evaluateExpression(arg, "arg", options) + ); + const fnSegments = fn.split("."); + if (fnSegments[0] in customEndpointFunctions && fnSegments[1] != null) { + return customEndpointFunctions[fnSegments[0]][fnSegments[1]](...evaluatedArgs); + } + return endpointFunctions[fn](...evaluatedArgs); +}, "callFunction"); + +// src/utils/evaluateCondition.ts +var evaluateCondition = /* @__PURE__ */ __name(({ assign, ...fnArgs }, options) => { + var _a, _b; + if (assign && assign in options.referenceRecord) { + throw new EndpointError(`'${assign}' is already defined in Reference Record.`); + } + const value = callFunction(fnArgs, options); + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} evaluateCondition: ${toDebugString(fnArgs)} = ${toDebugString(value)}`); + return { + result: value === "" ? true : !!value, + ...assign != null && { toAssign: { name: assign, value } } + }; +}, "evaluateCondition"); + +// src/utils/evaluateConditions.ts +var evaluateConditions = /* @__PURE__ */ __name((conditions = [], options) => { + var _a, _b; + const conditionsReferenceRecord = {}; + for (const condition of conditions) { + const { result, toAssign } = evaluateCondition(condition, { + ...options, + referenceRecord: { + ...options.referenceRecord, + ...conditionsReferenceRecord + } + }); + if (!result) { + return { result }; + } + if (toAssign) { + conditionsReferenceRecord[toAssign.name] = toAssign.value; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} assign: ${toAssign.name} := ${toDebugString(toAssign.value)}`); + } + } + return { result: true, referenceRecord: conditionsReferenceRecord }; +}, "evaluateConditions"); + +// src/utils/getEndpointHeaders.ts +var getEndpointHeaders = /* @__PURE__ */ __name((headers, options) => Object.entries(headers).reduce( + (acc, [headerKey, headerVal]) => ({ + ...acc, + [headerKey]: headerVal.map((headerValEntry) => { + const processedExpr = evaluateExpression(headerValEntry, "Header value entry", options); + if (typeof processedExpr !== "string") { + throw new EndpointError(`Header '${headerKey}' value '${processedExpr}' is not a string`); + } + return processedExpr; + }) + }), + {} +), "getEndpointHeaders"); + +// src/utils/getEndpointProperty.ts +var getEndpointProperty = /* @__PURE__ */ __name((property, options) => { + if (Array.isArray(property)) { + return property.map((propertyEntry) => getEndpointProperty(propertyEntry, options)); + } + switch (typeof property) { + case "string": + return evaluateTemplate(property, options); + case "object": + if (property === null) { + throw new EndpointError(`Unexpected endpoint property: ${property}`); + } + return getEndpointProperties(property, options); + case "boolean": + return property; + default: + throw new EndpointError(`Unexpected endpoint property type: ${typeof property}`); + } +}, "getEndpointProperty"); + +// src/utils/getEndpointProperties.ts +var getEndpointProperties = /* @__PURE__ */ __name((properties, options) => Object.entries(properties).reduce( + (acc, [propertyKey, propertyVal]) => ({ + ...acc, + [propertyKey]: getEndpointProperty(propertyVal, options) + }), + {} +), "getEndpointProperties"); + +// src/utils/getEndpointUrl.ts +var getEndpointUrl = /* @__PURE__ */ __name((endpointUrl, options) => { + const expression = evaluateExpression(endpointUrl, "Endpoint URL", options); + if (typeof expression === "string") { + try { + return new URL(expression); + } catch (error) { + console.error(`Failed to construct URL with ${expression}`, error); + throw error; + } + } + throw new EndpointError(`Endpoint URL must be a string, got ${typeof expression}`); +}, "getEndpointUrl"); + +// src/utils/evaluateEndpointRule.ts +var evaluateEndpointRule = /* @__PURE__ */ __name((endpointRule, options) => { + var _a, _b; + const { conditions, endpoint } = endpointRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + const endpointRuleOptions = { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }; + const { url, properties, headers } = endpoint; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} Resolving endpoint from template: ${toDebugString(endpoint)}`); + return { + ...headers != void 0 && { + headers: getEndpointHeaders(headers, endpointRuleOptions) + }, + ...properties != void 0 && { + properties: getEndpointProperties(properties, endpointRuleOptions) + }, + url: getEndpointUrl(url, endpointRuleOptions) + }; +}, "evaluateEndpointRule"); + +// src/utils/evaluateErrorRule.ts +var evaluateErrorRule = /* @__PURE__ */ __name((errorRule, options) => { + const { conditions, error } = errorRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + throw new EndpointError( + evaluateExpression(error, "Error", { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }) + ); +}, "evaluateErrorRule"); + +// src/utils/evaluateTreeRule.ts +var evaluateTreeRule = /* @__PURE__ */ __name((treeRule, options) => { + const { conditions, rules } = treeRule; + const { result, referenceRecord } = evaluateConditions(conditions, options); + if (!result) { + return; + } + return evaluateRules(rules, { + ...options, + referenceRecord: { ...options.referenceRecord, ...referenceRecord } + }); +}, "evaluateTreeRule"); + +// src/utils/evaluateRules.ts +var evaluateRules = /* @__PURE__ */ __name((rules, options) => { + for (const rule of rules) { + if (rule.type === "endpoint") { + const endpointOrUndefined = evaluateEndpointRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else if (rule.type === "error") { + evaluateErrorRule(rule, options); + } else if (rule.type === "tree") { + const endpointOrUndefined = evaluateTreeRule(rule, options); + if (endpointOrUndefined) { + return endpointOrUndefined; + } + } else { + throw new EndpointError(`Unknown endpoint rule: ${rule}`); + } + } + throw new EndpointError(`Rules evaluation failed`); +}, "evaluateRules"); + +// src/resolveEndpoint.ts +var resolveEndpoint = /* @__PURE__ */ __name((ruleSetObject, options) => { + var _a, _b, _c, _d, _e; + const { endpointParams, logger } = options; + const { parameters, rules } = ruleSetObject; + (_b = (_a = options.logger) == null ? void 0 : _a.debug) == null ? void 0 : _b.call(_a, `${debugId} Initial EndpointParams: ${toDebugString(endpointParams)}`); + const paramsWithDefault = Object.entries(parameters).filter(([, v]) => v.default != null).map(([k, v]) => [k, v.default]); + if (paramsWithDefault.length > 0) { + for (const [paramKey, paramDefaultValue] of paramsWithDefault) { + endpointParams[paramKey] = endpointParams[paramKey] ?? paramDefaultValue; + } + } + const requiredParams = Object.entries(parameters).filter(([, v]) => v.required).map(([k]) => k); + for (const requiredParam of requiredParams) { + if (endpointParams[requiredParam] == null) { + throw new EndpointError(`Missing required parameter: '${requiredParam}'`); + } + } + const endpoint = evaluateRules(rules, { endpointParams, logger, referenceRecord: {} }); + if ((_c = options.endpointParams) == null ? void 0 : _c.Endpoint) { + try { + const givenEndpoint = new URL(options.endpointParams.Endpoint); + const { protocol, port } = givenEndpoint; + endpoint.url.protocol = protocol; + endpoint.url.port = port; + } catch (e) { + } + } + (_e = (_d = options.logger) == null ? void 0 : _d.debug) == null ? void 0 : _e.call(_d, `${debugId} Resolved endpoint: ${toDebugString(endpoint)}`); + return endpoint; +}, "resolveEndpoint"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 45364: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromHex: () => fromHex, + toHex: () => toHex +}); +module.exports = __toCommonJS(src_exports); +var SHORT_TO_HEX = {}; +var HEX_TO_SHORT = {}; +for (let i = 0; i < 256; i++) { + let encodedByte = i.toString(16).toLowerCase(); + if (encodedByte.length === 1) { + encodedByte = `0${encodedByte}`; + } + SHORT_TO_HEX[i] = encodedByte; + HEX_TO_SHORT[encodedByte] = i; +} +function fromHex(encoded) { + if (encoded.length % 2 !== 0) { + throw new Error("Hex encoded strings must have an even number length"); + } + const out = new Uint8Array(encoded.length / 2); + for (let i = 0; i < encoded.length; i += 2) { + const encodedByte = encoded.slice(i, i + 2).toLowerCase(); + if (encodedByte in HEX_TO_SHORT) { + out[i / 2] = HEX_TO_SHORT[encodedByte]; + } else { + throw new Error(`Cannot decode unrecognized sequence ${encodedByte} as hexadecimal`); + } + } + return out; +} +__name(fromHex, "fromHex"); +function toHex(bytes) { + let out = ""; + for (let i = 0; i < bytes.byteLength; i++) { + out += SHORT_TO_HEX[bytes[i]]; + } + return out; +} +__name(toHex, "toHex"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 2390: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + getSmithyContext: () => getSmithyContext, + normalizeProvider: () => normalizeProvider +}); +module.exports = __toCommonJS(src_exports); + +// src/getSmithyContext.ts +var import_types = __nccwpck_require__(55756); +var getSmithyContext = /* @__PURE__ */ __name((context) => context[import_types.SMITHY_CONTEXT_KEY] || (context[import_types.SMITHY_CONTEXT_KEY] = {}), "getSmithyContext"); + +// src/normalizeProvider.ts +var normalizeProvider = /* @__PURE__ */ __name((input) => { + if (typeof input === "function") + return input; + const promisified = Promise.resolve(input); + return () => promisified; +}, "normalizeProvider"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 84902: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + AdaptiveRetryStrategy: () => AdaptiveRetryStrategy, + ConfiguredRetryStrategy: () => ConfiguredRetryStrategy, + DEFAULT_MAX_ATTEMPTS: () => DEFAULT_MAX_ATTEMPTS, + DEFAULT_RETRY_DELAY_BASE: () => DEFAULT_RETRY_DELAY_BASE, + DEFAULT_RETRY_MODE: () => DEFAULT_RETRY_MODE, + DefaultRateLimiter: () => DefaultRateLimiter, + INITIAL_RETRY_TOKENS: () => INITIAL_RETRY_TOKENS, + INVOCATION_ID_HEADER: () => INVOCATION_ID_HEADER, + MAXIMUM_RETRY_DELAY: () => MAXIMUM_RETRY_DELAY, + NO_RETRY_INCREMENT: () => NO_RETRY_INCREMENT, + REQUEST_HEADER: () => REQUEST_HEADER, + RETRY_COST: () => RETRY_COST, + RETRY_MODES: () => RETRY_MODES, + StandardRetryStrategy: () => StandardRetryStrategy, + THROTTLING_RETRY_DELAY_BASE: () => THROTTLING_RETRY_DELAY_BASE, + TIMEOUT_RETRY_COST: () => TIMEOUT_RETRY_COST +}); +module.exports = __toCommonJS(src_exports); + +// src/config.ts +var RETRY_MODES = /* @__PURE__ */ ((RETRY_MODES2) => { + RETRY_MODES2["STANDARD"] = "standard"; + RETRY_MODES2["ADAPTIVE"] = "adaptive"; + return RETRY_MODES2; +})(RETRY_MODES || {}); +var DEFAULT_MAX_ATTEMPTS = 3; +var DEFAULT_RETRY_MODE = "standard" /* STANDARD */; + +// src/DefaultRateLimiter.ts +var import_service_error_classification = __nccwpck_require__(6375); +var _DefaultRateLimiter = class _DefaultRateLimiter { + constructor(options) { + // Pre-set state variables + this.currentCapacity = 0; + this.enabled = false; + this.lastMaxRate = 0; + this.measuredTxRate = 0; + this.requestCount = 0; + this.lastTimestamp = 0; + this.timeWindow = 0; + this.beta = (options == null ? void 0 : options.beta) ?? 0.7; + this.minCapacity = (options == null ? void 0 : options.minCapacity) ?? 1; + this.minFillRate = (options == null ? void 0 : options.minFillRate) ?? 0.5; + this.scaleConstant = (options == null ? void 0 : options.scaleConstant) ?? 0.4; + this.smooth = (options == null ? void 0 : options.smooth) ?? 0.8; + const currentTimeInSeconds = this.getCurrentTimeInSeconds(); + this.lastThrottleTime = currentTimeInSeconds; + this.lastTxRateBucket = Math.floor(this.getCurrentTimeInSeconds()); + this.fillRate = this.minFillRate; + this.maxCapacity = this.minCapacity; + } + getCurrentTimeInSeconds() { + return Date.now() / 1e3; + } + async getSendToken() { + return this.acquireTokenBucket(1); + } + async acquireTokenBucket(amount) { + if (!this.enabled) { + return; + } + this.refillTokenBucket(); + if (amount > this.currentCapacity) { + const delay = (amount - this.currentCapacity) / this.fillRate * 1e3; + await new Promise((resolve) => setTimeout(resolve, delay)); + } + this.currentCapacity = this.currentCapacity - amount; + } + refillTokenBucket() { + const timestamp = this.getCurrentTimeInSeconds(); + if (!this.lastTimestamp) { + this.lastTimestamp = timestamp; + return; + } + const fillAmount = (timestamp - this.lastTimestamp) * this.fillRate; + this.currentCapacity = Math.min(this.maxCapacity, this.currentCapacity + fillAmount); + this.lastTimestamp = timestamp; + } + updateClientSendingRate(response) { + let calculatedRate; + this.updateMeasuredRate(); + if ((0, import_service_error_classification.isThrottlingError)(response)) { + const rateToUse = !this.enabled ? this.measuredTxRate : Math.min(this.measuredTxRate, this.fillRate); + this.lastMaxRate = rateToUse; + this.calculateTimeWindow(); + this.lastThrottleTime = this.getCurrentTimeInSeconds(); + calculatedRate = this.cubicThrottle(rateToUse); + this.enableTokenBucket(); + } else { + this.calculateTimeWindow(); + calculatedRate = this.cubicSuccess(this.getCurrentTimeInSeconds()); + } + const newRate = Math.min(calculatedRate, 2 * this.measuredTxRate); + this.updateTokenBucketRate(newRate); + } + calculateTimeWindow() { + this.timeWindow = this.getPrecise(Math.pow(this.lastMaxRate * (1 - this.beta) / this.scaleConstant, 1 / 3)); + } + cubicThrottle(rateToUse) { + return this.getPrecise(rateToUse * this.beta); + } + cubicSuccess(timestamp) { + return this.getPrecise( + this.scaleConstant * Math.pow(timestamp - this.lastThrottleTime - this.timeWindow, 3) + this.lastMaxRate + ); + } + enableTokenBucket() { + this.enabled = true; + } + updateTokenBucketRate(newRate) { + this.refillTokenBucket(); + this.fillRate = Math.max(newRate, this.minFillRate); + this.maxCapacity = Math.max(newRate, this.minCapacity); + this.currentCapacity = Math.min(this.currentCapacity, this.maxCapacity); + } + updateMeasuredRate() { + const t = this.getCurrentTimeInSeconds(); + const timeBucket = Math.floor(t * 2) / 2; + this.requestCount++; + if (timeBucket > this.lastTxRateBucket) { + const currentRate = this.requestCount / (timeBucket - this.lastTxRateBucket); + this.measuredTxRate = this.getPrecise(currentRate * this.smooth + this.measuredTxRate * (1 - this.smooth)); + this.requestCount = 0; + this.lastTxRateBucket = timeBucket; + } + } + getPrecise(num) { + return parseFloat(num.toFixed(8)); + } +}; +__name(_DefaultRateLimiter, "DefaultRateLimiter"); +var DefaultRateLimiter = _DefaultRateLimiter; + +// src/constants.ts +var DEFAULT_RETRY_DELAY_BASE = 100; +var MAXIMUM_RETRY_DELAY = 20 * 1e3; +var THROTTLING_RETRY_DELAY_BASE = 500; +var INITIAL_RETRY_TOKENS = 500; +var RETRY_COST = 5; +var TIMEOUT_RETRY_COST = 10; +var NO_RETRY_INCREMENT = 1; +var INVOCATION_ID_HEADER = "amz-sdk-invocation-id"; +var REQUEST_HEADER = "amz-sdk-request"; + +// src/defaultRetryBackoffStrategy.ts +var getDefaultRetryBackoffStrategy = /* @__PURE__ */ __name(() => { + let delayBase = DEFAULT_RETRY_DELAY_BASE; + const computeNextBackoffDelay = /* @__PURE__ */ __name((attempts) => { + return Math.floor(Math.min(MAXIMUM_RETRY_DELAY, Math.random() * 2 ** attempts * delayBase)); + }, "computeNextBackoffDelay"); + const setDelayBase = /* @__PURE__ */ __name((delay) => { + delayBase = delay; + }, "setDelayBase"); + return { + computeNextBackoffDelay, + setDelayBase + }; +}, "getDefaultRetryBackoffStrategy"); + +// src/defaultRetryToken.ts +var createDefaultRetryToken = /* @__PURE__ */ __name(({ + retryDelay, + retryCount, + retryCost +}) => { + const getRetryCount = /* @__PURE__ */ __name(() => retryCount, "getRetryCount"); + const getRetryDelay = /* @__PURE__ */ __name(() => Math.min(MAXIMUM_RETRY_DELAY, retryDelay), "getRetryDelay"); + const getRetryCost = /* @__PURE__ */ __name(() => retryCost, "getRetryCost"); + return { + getRetryCount, + getRetryDelay, + getRetryCost + }; +}, "createDefaultRetryToken"); + +// src/StandardRetryStrategy.ts +var _StandardRetryStrategy = class _StandardRetryStrategy { + constructor(maxAttempts) { + this.maxAttempts = maxAttempts; + this.mode = "standard" /* STANDARD */; + this.capacity = INITIAL_RETRY_TOKENS; + this.retryBackoffStrategy = getDefaultRetryBackoffStrategy(); + this.maxAttemptsProvider = typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts; + } + // eslint-disable-next-line @typescript-eslint/no-unused-vars + async acquireInitialRetryToken(retryTokenScope) { + return createDefaultRetryToken({ + retryDelay: DEFAULT_RETRY_DELAY_BASE, + retryCount: 0 + }); + } + async refreshRetryTokenForRetry(token, errorInfo) { + const maxAttempts = await this.getMaxAttempts(); + if (this.shouldRetry(token, errorInfo, maxAttempts)) { + const errorType = errorInfo.errorType; + this.retryBackoffStrategy.setDelayBase( + errorType === "THROTTLING" ? THROTTLING_RETRY_DELAY_BASE : DEFAULT_RETRY_DELAY_BASE + ); + const delayFromErrorType = this.retryBackoffStrategy.computeNextBackoffDelay(token.getRetryCount()); + const retryDelay = errorInfo.retryAfterHint ? Math.max(errorInfo.retryAfterHint.getTime() - Date.now() || 0, delayFromErrorType) : delayFromErrorType; + const capacityCost = this.getCapacityCost(errorType); + this.capacity -= capacityCost; + return createDefaultRetryToken({ + retryDelay, + retryCount: token.getRetryCount() + 1, + retryCost: capacityCost + }); + } + throw new Error("No retry token available"); + } + recordSuccess(token) { + this.capacity = Math.max(INITIAL_RETRY_TOKENS, this.capacity + (token.getRetryCost() ?? NO_RETRY_INCREMENT)); + } + /** + * @returns the current available retry capacity. + * + * This number decreases when retries are executed and refills when requests or retries succeed. + */ + getCapacity() { + return this.capacity; + } + async getMaxAttempts() { + try { + return await this.maxAttemptsProvider(); + } catch (error) { + console.warn(`Max attempts provider could not resolve. Using default of ${DEFAULT_MAX_ATTEMPTS}`); + return DEFAULT_MAX_ATTEMPTS; + } + } + shouldRetry(tokenToRenew, errorInfo, maxAttempts) { + const attempts = tokenToRenew.getRetryCount() + 1; + return attempts < maxAttempts && this.capacity >= this.getCapacityCost(errorInfo.errorType) && this.isRetryableError(errorInfo.errorType); + } + getCapacityCost(errorType) { + return errorType === "TRANSIENT" ? TIMEOUT_RETRY_COST : RETRY_COST; + } + isRetryableError(errorType) { + return errorType === "THROTTLING" || errorType === "TRANSIENT"; + } +}; +__name(_StandardRetryStrategy, "StandardRetryStrategy"); +var StandardRetryStrategy = _StandardRetryStrategy; + +// src/AdaptiveRetryStrategy.ts +var _AdaptiveRetryStrategy = class _AdaptiveRetryStrategy { + constructor(maxAttemptsProvider, options) { + this.maxAttemptsProvider = maxAttemptsProvider; + this.mode = "adaptive" /* ADAPTIVE */; + const { rateLimiter } = options ?? {}; + this.rateLimiter = rateLimiter ?? new DefaultRateLimiter(); + this.standardRetryStrategy = new StandardRetryStrategy(maxAttemptsProvider); + } + async acquireInitialRetryToken(retryTokenScope) { + await this.rateLimiter.getSendToken(); + return this.standardRetryStrategy.acquireInitialRetryToken(retryTokenScope); + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + this.rateLimiter.updateClientSendingRate(errorInfo); + return this.standardRetryStrategy.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + } + recordSuccess(token) { + this.rateLimiter.updateClientSendingRate({}); + this.standardRetryStrategy.recordSuccess(token); + } +}; +__name(_AdaptiveRetryStrategy, "AdaptiveRetryStrategy"); +var AdaptiveRetryStrategy = _AdaptiveRetryStrategy; + +// src/ConfiguredRetryStrategy.ts +var _ConfiguredRetryStrategy = class _ConfiguredRetryStrategy extends StandardRetryStrategy { + /** + * @param maxAttempts - the maximum number of retry attempts allowed. + * e.g., if set to 3, then 4 total requests are possible. + * @param computeNextBackoffDelay - a millisecond delay for each retry or a function that takes the retry attempt + * and returns the delay. + * + * @example exponential backoff. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, (attempt) => attempt ** 2) + * }); + * ``` + * @example constant delay. + * ```js + * new Client({ + * retryStrategy: new ConfiguredRetryStrategy(3, 2000) + * }); + * ``` + */ + constructor(maxAttempts, computeNextBackoffDelay = DEFAULT_RETRY_DELAY_BASE) { + super(typeof maxAttempts === "function" ? maxAttempts : async () => maxAttempts); + if (typeof computeNextBackoffDelay === "number") { + this.computeNextBackoffDelay = () => computeNextBackoffDelay; + } else { + this.computeNextBackoffDelay = computeNextBackoffDelay; + } + } + async refreshRetryTokenForRetry(tokenToRenew, errorInfo) { + const token = await super.refreshRetryTokenForRetry(tokenToRenew, errorInfo); + token.getRetryDelay = () => this.computeNextBackoffDelay(token.getRetryCount()); + return token; + } +}; +__name(_ConfiguredRetryStrategy, "ConfiguredRetryStrategy"); +var ConfiguredRetryStrategy = _ConfiguredRetryStrategy; +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 23636: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.getAwsChunkedEncodingStream = void 0; +const stream_1 = __nccwpck_require__(12781); +const getAwsChunkedEncodingStream = (readableStream, options) => { + const { base64Encoder, bodyLengthChecker, checksumAlgorithmFn, checksumLocationName, streamHasher } = options; + const checksumRequired = base64Encoder !== undefined && + checksumAlgorithmFn !== undefined && + checksumLocationName !== undefined && + streamHasher !== undefined; + const digest = checksumRequired ? streamHasher(checksumAlgorithmFn, readableStream) : undefined; + const awsChunkedEncodingStream = new stream_1.Readable({ read: () => { } }); + readableStream.on("data", (data) => { + const length = bodyLengthChecker(data) || 0; + awsChunkedEncodingStream.push(`${length.toString(16)}\r\n`); + awsChunkedEncodingStream.push(data); + awsChunkedEncodingStream.push("\r\n"); + }); + readableStream.on("end", async () => { + awsChunkedEncodingStream.push(`0\r\n`); + if (checksumRequired) { + const checksum = base64Encoder(await digest); + awsChunkedEncodingStream.push(`${checksumLocationName}:${checksum}\r\n`); + awsChunkedEncodingStream.push(`\r\n`); + } + awsChunkedEncodingStream.push(null); + }); + return awsChunkedEncodingStream; +}; +exports.getAwsChunkedEncodingStream = getAwsChunkedEncodingStream; + + +/***/ }), + +/***/ 96607: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __reExport = (target, mod, secondTarget) => (__copyProps(target, mod, "default"), secondTarget && __copyProps(secondTarget, mod, "default")); +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + Uint8ArrayBlobAdapter: () => Uint8ArrayBlobAdapter +}); +module.exports = __toCommonJS(src_exports); + +// src/blob/transforms.ts +var import_util_base64 = __nccwpck_require__(75600); +var import_util_utf8 = __nccwpck_require__(41895); +function transformToString(payload, encoding = "utf-8") { + if (encoding === "base64") { + return (0, import_util_base64.toBase64)(payload); + } + return (0, import_util_utf8.toUtf8)(payload); +} +__name(transformToString, "transformToString"); +function transformFromString(str, encoding) { + if (encoding === "base64") { + return Uint8ArrayBlobAdapter.mutate((0, import_util_base64.fromBase64)(str)); + } + return Uint8ArrayBlobAdapter.mutate((0, import_util_utf8.fromUtf8)(str)); +} +__name(transformFromString, "transformFromString"); + +// src/blob/Uint8ArrayBlobAdapter.ts +var _Uint8ArrayBlobAdapter = class _Uint8ArrayBlobAdapter extends Uint8Array { + /** + * @param source - such as a string or Stream. + * @returns a new Uint8ArrayBlobAdapter extending Uint8Array. + */ + static fromString(source, encoding = "utf-8") { + switch (typeof source) { + case "string": + return transformFromString(source, encoding); + default: + throw new Error(`Unsupported conversion from ${typeof source} to Uint8ArrayBlobAdapter.`); + } + } + /** + * @param source - Uint8Array to be mutated. + * @returns the same Uint8Array but with prototype switched to Uint8ArrayBlobAdapter. + */ + static mutate(source) { + Object.setPrototypeOf(source, _Uint8ArrayBlobAdapter.prototype); + return source; + } + /** + * @param encoding - default 'utf-8'. + * @returns the blob as string. + */ + transformToString(encoding = "utf-8") { + return transformToString(this, encoding); + } +}; +__name(_Uint8ArrayBlobAdapter, "Uint8ArrayBlobAdapter"); +var Uint8ArrayBlobAdapter = _Uint8ArrayBlobAdapter; + +// src/index.ts +__reExport(src_exports, __nccwpck_require__(23636), module.exports); +__reExport(src_exports, __nccwpck_require__(4515), module.exports); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 50942: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.sdkStreamMixin = void 0; +const fetch_http_handler_1 = __nccwpck_require__(82687); +const util_base64_1 = __nccwpck_require__(75600); +const util_hex_encoding_1 = __nccwpck_require__(45364); +const util_utf8_1 = __nccwpck_require__(41895); +const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; +const sdkStreamMixin = (stream) => { + var _a, _b; + if (!isBlobInstance(stream) && !isReadableStreamInstance(stream)) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Blob or ReadableStream, got ${name}`); + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, fetch_http_handler_1.streamCollector)(stream); + }; + const blobToWebStream = (blob) => { + if (typeof blob.stream !== "function") { + throw new Error("Cannot transform payload Blob to web stream. Please make sure the Blob.stream() is polyfilled.\n" + + "If you are using React Native, this API is not yet supported, see: https://react-native.canny.io/feature-requests/p/fetch-streaming-body"); + } + return blob.stream(); + }; + return Object.assign(stream, { + transformToByteArray: transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === "base64") { + return (0, util_base64_1.toBase64)(buf); + } + else if (encoding === "hex") { + return (0, util_hex_encoding_1.toHex)(buf); + } + else if (encoding === undefined || encoding === "utf8" || encoding === "utf-8") { + return (0, util_utf8_1.toUtf8)(buf); + } + else if (typeof TextDecoder === "function") { + return new TextDecoder(encoding).decode(buf); + } + else { + throw new Error("TextDecoder is not available, please make sure polyfill is provided."); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + if (isBlobInstance(stream)) { + return blobToWebStream(stream); + } + else if (isReadableStreamInstance(stream)) { + return stream; + } + else { + throw new Error(`Cannot transform payload to web stream, got ${stream}`); + } + }, + }); +}; +exports.sdkStreamMixin = sdkStreamMixin; +const isBlobInstance = (stream) => typeof Blob === "function" && stream instanceof Blob; +const isReadableStreamInstance = (stream) => typeof ReadableStream === "function" && stream instanceof ReadableStream; + + +/***/ }), + +/***/ 4515: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + +Object.defineProperty(exports, "__esModule", ({ value: true })); +exports.sdkStreamMixin = void 0; +const node_http_handler_1 = __nccwpck_require__(20258); +const util_buffer_from_1 = __nccwpck_require__(31381); +const stream_1 = __nccwpck_require__(12781); +const util_1 = __nccwpck_require__(73837); +const sdk_stream_mixin_browser_1 = __nccwpck_require__(50942); +const ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED = "The stream has already been transformed."; +const sdkStreamMixin = (stream) => { + var _a, _b; + if (!(stream instanceof stream_1.Readable)) { + try { + return (0, sdk_stream_mixin_browser_1.sdkStreamMixin)(stream); + } + catch (e) { + const name = ((_b = (_a = stream === null || stream === void 0 ? void 0 : stream.__proto__) === null || _a === void 0 ? void 0 : _a.constructor) === null || _b === void 0 ? void 0 : _b.name) || stream; + throw new Error(`Unexpected stream implementation, expect Stream.Readable instance, got ${name}`); + } + } + let transformed = false; + const transformToByteArray = async () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + transformed = true; + return await (0, node_http_handler_1.streamCollector)(stream); + }; + return Object.assign(stream, { + transformToByteArray, + transformToString: async (encoding) => { + const buf = await transformToByteArray(); + if (encoding === undefined || Buffer.isEncoding(encoding)) { + return (0, util_buffer_from_1.fromArrayBuffer)(buf.buffer, buf.byteOffset, buf.byteLength).toString(encoding); + } + else { + const decoder = new util_1.TextDecoder(encoding); + return decoder.decode(buf); + } + }, + transformToWebStream: () => { + if (transformed) { + throw new Error(ERR_MSG_STREAM_HAS_BEEN_TRANSFORMED); + } + if (stream.readableFlowing !== null) { + throw new Error("The stream has been consumed by other callbacks."); + } + if (typeof stream_1.Readable.toWeb !== "function") { + throw new Error("Readable.toWeb() is not supported. Please make sure you are using Node.js >= 17.0.0, or polyfill is available."); + } + transformed = true; + return stream_1.Readable.toWeb(stream); + }, + }); +}; +exports.sdkStreamMixin = sdkStreamMixin; + + +/***/ }), + +/***/ 54197: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + escapeUri: () => escapeUri, + escapeUriPath: () => escapeUriPath +}); +module.exports = __toCommonJS(src_exports); + +// src/escape-uri.ts +var escapeUri = /* @__PURE__ */ __name((uri) => ( + // AWS percent-encodes some extra non-standard characters in a URI + encodeURIComponent(uri).replace(/[!'()*]/g, hexEncode) +), "escapeUri"); +var hexEncode = /* @__PURE__ */ __name((c) => `%${c.charCodeAt(0).toString(16).toUpperCase()}`, "hexEncode"); + +// src/escape-uri-path.ts +var escapeUriPath = /* @__PURE__ */ __name((uri) => uri.split("/").map(escapeUri).join("/"), "escapeUriPath"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 41895: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + fromUtf8: () => fromUtf8, + toUint8Array: () => toUint8Array, + toUtf8: () => toUtf8 +}); +module.exports = __toCommonJS(src_exports); + +// src/fromUtf8.ts +var import_util_buffer_from = __nccwpck_require__(31381); +var fromUtf8 = /* @__PURE__ */ __name((input) => { + const buf = (0, import_util_buffer_from.fromString)(input, "utf8"); + return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength / Uint8Array.BYTES_PER_ELEMENT); +}, "fromUtf8"); + +// src/toUint8Array.ts +var toUint8Array = /* @__PURE__ */ __name((data) => { + if (typeof data === "string") { + return fromUtf8(data); + } + if (ArrayBuffer.isView(data)) { + return new Uint8Array(data.buffer, data.byteOffset, data.byteLength / Uint8Array.BYTES_PER_ELEMENT); + } + return new Uint8Array(data); +}, "toUint8Array"); + +// src/toUtf8.ts + +var toUtf8 = /* @__PURE__ */ __name((input) => { + if (typeof input === "string") { + return input; + } + if (typeof input !== "object" || typeof input.byteOffset !== "number" || typeof input.byteLength !== "number") { + throw new Error("@smithy/util-utf8: toUtf8 encoder function only accepts string | Uint8Array."); + } + return (0, import_util_buffer_from.fromArrayBuffer)(input.buffer, input.byteOffset, input.byteLength).toString("utf8"); +}, "toUtf8"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + +/***/ }), + +/***/ 78011: +/***/ ((module) => { + +var __defProp = Object.defineProperty; +var __getOwnPropDesc = Object.getOwnPropertyDescriptor; +var __getOwnPropNames = Object.getOwnPropertyNames; +var __hasOwnProp = Object.prototype.hasOwnProperty; +var __name = (target, value) => __defProp(target, "name", { value, configurable: true }); +var __export = (target, all) => { + for (var name in all) + __defProp(target, name, { get: all[name], enumerable: true }); +}; +var __copyProps = (to, from, except, desc) => { + if (from && typeof from === "object" || typeof from === "function") { + for (let key of __getOwnPropNames(from)) + if (!__hasOwnProp.call(to, key) && key !== except) + __defProp(to, key, { get: () => from[key], enumerable: !(desc = __getOwnPropDesc(from, key)) || desc.enumerable }); + } + return to; +}; +var __toCommonJS = (mod) => __copyProps(__defProp({}, "__esModule", { value: true }), mod); + +// src/index.ts +var src_exports = {}; +__export(src_exports, { + WaiterState: () => WaiterState, + checkExceptions: () => checkExceptions, + createWaiter: () => createWaiter, + waiterServiceDefaults: () => waiterServiceDefaults +}); +module.exports = __toCommonJS(src_exports); + +// src/utils/sleep.ts +var sleep = /* @__PURE__ */ __name((seconds) => { + return new Promise((resolve) => setTimeout(resolve, seconds * 1e3)); +}, "sleep"); + +// src/waiter.ts +var waiterServiceDefaults = { + minDelay: 2, + maxDelay: 120 +}; +var WaiterState = /* @__PURE__ */ ((WaiterState2) => { + WaiterState2["ABORTED"] = "ABORTED"; + WaiterState2["FAILURE"] = "FAILURE"; + WaiterState2["SUCCESS"] = "SUCCESS"; + WaiterState2["RETRY"] = "RETRY"; + WaiterState2["TIMEOUT"] = "TIMEOUT"; + return WaiterState2; +})(WaiterState || {}); +var checkExceptions = /* @__PURE__ */ __name((result) => { + if (result.state === "ABORTED" /* ABORTED */) { + const abortError = new Error( + `${JSON.stringify({ + ...result, + reason: "Request was aborted" + })}` + ); + abortError.name = "AbortError"; + throw abortError; + } else if (result.state === "TIMEOUT" /* TIMEOUT */) { + const timeoutError = new Error( + `${JSON.stringify({ + ...result, + reason: "Waiter has timed out" + })}` + ); + timeoutError.name = "TimeoutError"; + throw timeoutError; + } else if (result.state !== "SUCCESS" /* SUCCESS */) { + throw new Error(`${JSON.stringify(result)}`); + } + return result; +}, "checkExceptions"); + +// src/poller.ts +var exponentialBackoffWithJitter = /* @__PURE__ */ __name((minDelay, maxDelay, attemptCeiling, attempt) => { + if (attempt > attemptCeiling) + return maxDelay; + const delay = minDelay * 2 ** (attempt - 1); + return randomInRange(minDelay, delay); +}, "exponentialBackoffWithJitter"); +var randomInRange = /* @__PURE__ */ __name((min, max) => min + Math.random() * (max - min), "randomInRange"); +var runPolling = /* @__PURE__ */ __name(async ({ minDelay, maxDelay, maxWaitTime, abortController, client, abortSignal }, input, acceptorChecks) => { + var _a; + const { state, reason } = await acceptorChecks(client, input); + if (state !== "RETRY" /* RETRY */) { + return { state, reason }; + } + let currentAttempt = 1; + const waitUntil = Date.now() + maxWaitTime * 1e3; + const attemptCeiling = Math.log(maxDelay / minDelay) / Math.log(2) + 1; + while (true) { + if (((_a = abortController == null ? void 0 : abortController.signal) == null ? void 0 : _a.aborted) || (abortSignal == null ? void 0 : abortSignal.aborted)) { + return { state: "ABORTED" /* ABORTED */ }; + } + const delay = exponentialBackoffWithJitter(minDelay, maxDelay, attemptCeiling, currentAttempt); + if (Date.now() + delay * 1e3 > waitUntil) { + return { state: "TIMEOUT" /* TIMEOUT */ }; + } + await sleep(delay); + const { state: state2, reason: reason2 } = await acceptorChecks(client, input); + if (state2 !== "RETRY" /* RETRY */) { + return { state: state2, reason: reason2 }; + } + currentAttempt += 1; + } +}, "runPolling"); + +// src/utils/validate.ts +var validateWaiterOptions = /* @__PURE__ */ __name((options) => { + if (options.maxWaitTime < 1) { + throw new Error(`WaiterConfiguration.maxWaitTime must be greater than 0`); + } else if (options.minDelay < 1) { + throw new Error(`WaiterConfiguration.minDelay must be greater than 0`); + } else if (options.maxDelay < 1) { + throw new Error(`WaiterConfiguration.maxDelay must be greater than 0`); + } else if (options.maxWaitTime <= options.minDelay) { + throw new Error( + `WaiterConfiguration.maxWaitTime [${options.maxWaitTime}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` + ); + } else if (options.maxDelay < options.minDelay) { + throw new Error( + `WaiterConfiguration.maxDelay [${options.maxDelay}] must be greater than WaiterConfiguration.minDelay [${options.minDelay}] for this waiter` + ); + } +}, "validateWaiterOptions"); + +// src/createWaiter.ts +var abortTimeout = /* @__PURE__ */ __name(async (abortSignal) => { + return new Promise((resolve) => { + const onAbort = /* @__PURE__ */ __name(() => resolve({ state: "ABORTED" /* ABORTED */ }), "onAbort"); + if (typeof abortSignal.addEventListener === "function") { + abortSignal.addEventListener("abort", onAbort); + } else { + abortSignal.onabort = onAbort; + } + }); +}, "abortTimeout"); +var createWaiter = /* @__PURE__ */ __name(async (options, input, acceptorChecks) => { + const params = { + ...waiterServiceDefaults, + ...options + }; + validateWaiterOptions(params); + const exitConditions = [runPolling(params, input, acceptorChecks)]; + if (options.abortController) { + exitConditions.push(abortTimeout(options.abortController.signal)); + } + if (options.abortSignal) { + exitConditions.push(abortTimeout(options.abortSignal)); + } + return Promise.race(exitConditions); +}, "createWaiter"); +// Annotate the CommonJS export names for ESM import in node: + +0 && (0); + + + /***/ }), /***/ 20940: @@ -25082,181 +46107,630 @@ AWS.util.update(AWS.Service, { AWS.Service._clientSideMonitoring = true; } } - AWS.SequentialExecutor.call(svc.prototype); - AWS.Service.addDefaultMonitoringListeners(svc.prototype); - return svc; - }, + AWS.SequentialExecutor.call(svc.prototype); + AWS.Service.addDefaultMonitoringListeners(svc.prototype); + return svc; + }, + + /** + * @api private + */ + addVersions: function addVersions(svc, versions) { + if (!Array.isArray(versions)) versions = [versions]; + + svc.services = svc.services || {}; + for (var i = 0; i < versions.length; i++) { + if (svc.services[versions[i]] === undefined) { + svc.services[versions[i]] = null; + } + } + + svc.apiVersions = Object.keys(svc.services).sort(); + }, + + /** + * @api private + */ + defineServiceApi: function defineServiceApi(superclass, version, apiConfig) { + var svc = inherit(superclass, { + serviceIdentifier: superclass.serviceIdentifier + }); + + function setApi(api) { + if (api.isApi) { + svc.prototype.api = api; + } else { + svc.prototype.api = new Api(api, { + serviceIdentifier: superclass.serviceIdentifier + }); + } + } + + if (typeof version === 'string') { + if (apiConfig) { + setApi(apiConfig); + } else { + try { + setApi(AWS.apiLoader(superclass.serviceIdentifier, version)); + } catch (err) { + throw AWS.util.error(err, { + message: 'Could not find API configuration ' + + superclass.serviceIdentifier + '-' + version + }); + } + } + if (!Object.prototype.hasOwnProperty.call(superclass.services, version)) { + superclass.apiVersions = superclass.apiVersions.concat(version).sort(); + } + superclass.services[version] = svc; + } else { + setApi(version); + } + + AWS.Service.defineMethods(svc); + return svc; + }, + + /** + * @api private + */ + hasService: function(identifier) { + return Object.prototype.hasOwnProperty.call(AWS.Service._serviceMap, identifier); + }, + + /** + * @param attachOn attach default monitoring listeners to object + * + * Each monitoring event should be emitted from service client to service constructor prototype and then + * to global service prototype like bubbling up. These default monitoring events listener will transfer + * the monitoring events to the upper layer. + * @api private + */ + addDefaultMonitoringListeners: function addDefaultMonitoringListeners(attachOn) { + attachOn.addNamedListener('MONITOR_EVENTS_BUBBLE', 'apiCallAttempt', function EVENTS_BUBBLE(event) { + var baseClass = Object.getPrototypeOf(attachOn); + if (baseClass._events) baseClass.emit('apiCallAttempt', [event]); + }); + attachOn.addNamedListener('CALL_EVENTS_BUBBLE', 'apiCall', function CALL_EVENTS_BUBBLE(event) { + var baseClass = Object.getPrototypeOf(attachOn); + if (baseClass._events) baseClass.emit('apiCall', [event]); + }); + }, + + /** + * @api private + */ + _serviceMap: {} +}); + +AWS.util.mixin(AWS.Service, AWS.SequentialExecutor); + +/** + * @api private + */ +module.exports = AWS.Service; + + +/***/ }), + +/***/ 4338: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.APIGateway.prototype, { +/** + * Sets the Accept header to application/json. + * + * @api private + */ + setAcceptHeader: function setAcceptHeader(req) { + var httpRequest = req.httpRequest; + if (!httpRequest.headers.Accept) { + httpRequest.headers['Accept'] = 'application/json'; + } + }, + + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + request.addListener('build', this.setAcceptHeader); + if (request.operation === 'getExport') { + var params = request.params || {}; + if (params.exportType === 'swagger') { + request.addListener('extractData', AWS.util.convertPayloadToString); + } + } + } +}); + + + +/***/ }), + +/***/ 95483: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +// pull in CloudFront signer +__nccwpck_require__(93260); + +AWS.util.update(AWS.CloudFront.prototype, { + + setupRequestListeners: function setupRequestListeners(request) { + request.addListener('extractData', AWS.util.hoistPayloadMember); + } + +}); + + +/***/ }), + +/***/ 48571: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +/** + * Constructs a service interface object. Each API operation is exposed as a + * function on service. + * + * ### Sending a Request Using CloudSearchDomain + * + * ```javascript + * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); + * csd.search(params, function (err, data) { + * if (err) console.log(err, err.stack); // an error occurred + * else console.log(data); // successful response + * }); + * ``` + * + * ### Locking the API Version + * + * In order to ensure that the CloudSearchDomain object uses this specific API, + * you can construct the object by passing the `apiVersion` option to the + * constructor: + * + * ```javascript + * var csd = new AWS.CloudSearchDomain({ + * endpoint: 'my.host.tld', + * apiVersion: '2013-01-01' + * }); + * ``` + * + * You can also set the API version globally in `AWS.config.apiVersions` using + * the **cloudsearchdomain** service identifier: + * + * ```javascript + * AWS.config.apiVersions = { + * cloudsearchdomain: '2013-01-01', + * // other service API versions + * }; + * + * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); + * ``` + * + * @note You *must* provide an `endpoint` configuration parameter when + * constructing this service. See {constructor} for more information. + * + * @!method constructor(options = {}) + * Constructs a service object. This object has one method for each + * API operation. + * + * @example Constructing a CloudSearchDomain object + * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); + * @note You *must* provide an `endpoint` when constructing this service. + * @option (see AWS.Config.constructor) + * + * @service cloudsearchdomain + * @version 2013-01-01 + */ +AWS.util.update(AWS.CloudSearchDomain.prototype, { + /** + * @api private + */ + validateService: function validateService() { + if (!this.config.endpoint || this.config.endpoint.indexOf('{') >= 0) { + var msg = 'AWS.CloudSearchDomain requires an explicit ' + + '`endpoint\' configuration option.'; + throw AWS.util.error(new Error(), + {name: 'InvalidEndpoint', message: msg}); + } + }, + + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + request.removeListener('validate', + AWS.EventListeners.Core.VALIDATE_CREDENTIALS + ); + request.onAsync('validate', this.validateCredentials); + request.addListener('validate', this.updateRegion); + if (request.operation === 'search') { + request.addListener('build', this.convertGetToPost); + } + }, + + /** + * @api private + */ + validateCredentials: function(req, done) { + if (!req.service.api.signatureVersion) return done(); // none + req.service.config.getCredentials(function(err) { + if (err) { + req.removeListener('sign', AWS.EventListeners.Core.SIGN); + } + done(); + }); + }, + + /** + * @api private + */ + convertGetToPost: function(request) { + var httpRequest = request.httpRequest; + // convert queries to POST to avoid length restrictions + var path = httpRequest.path.split('?'); + httpRequest.method = 'POST'; + httpRequest.path = path[0]; + httpRequest.body = path[1]; + httpRequest.headers['Content-Length'] = httpRequest.body.length; + httpRequest.headers['Content-Type'] = 'application/x-www-form-urlencoded'; + }, + + /** + * @api private + */ + updateRegion: function updateRegion(request) { + var endpoint = request.httpRequest.endpoint.hostname; + var zones = endpoint.split('.'); + request.httpRequest.region = zones[1] || request.httpRequest.region; + } + +}); + + +/***/ }), + +/***/ 59050: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var rdsutil = __nccwpck_require__(30650); + +/** +* @api private +*/ +var crossRegionOperations = ['createDBCluster', 'copyDBClusterSnapshot']; + +AWS.util.update(AWS.DocDB.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + if ( + crossRegionOperations.indexOf(request.operation) !== -1 && + this.config.params && + this.config.params.SourceRegion && + request.params && + !request.params.SourceRegion + ) { + request.params.SourceRegion = this.config.params.SourceRegion; + } + rdsutil.setupRequestListeners(this, request, crossRegionOperations); + }, +}); + + +/***/ }), + +/***/ 17101: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +__nccwpck_require__(90030); + +AWS.util.update(AWS.DynamoDB.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + if (request.service.config.dynamoDbCrc32) { + request.removeListener('extractData', AWS.EventListeners.Json.EXTRACT_DATA); + request.addListener('extractData', this.checkCrc32); + request.addListener('extractData', AWS.EventListeners.Json.EXTRACT_DATA); + } + }, + + /** + * @api private + */ + checkCrc32: function checkCrc32(resp) { + if (!resp.httpResponse.streaming && !resp.request.service.crc32IsValid(resp)) { + resp.data = null; + resp.error = AWS.util.error(new Error(), { + code: 'CRC32CheckFailed', + message: 'CRC32 integrity check failed', + retryable: true + }); + resp.request.haltHandlersOnError(); + throw (resp.error); + } + }, + + /** + * @api private + */ + crc32IsValid: function crc32IsValid(resp) { + var crc = resp.httpResponse.headers['x-amz-crc32']; + if (!crc) return true; // no (valid) CRC32 header + return parseInt(crc, 10) === AWS.util.crypto.crc32(resp.httpResponse.body); + }, + + /** + * @api private + */ + defaultRetryCount: 10, + + /** + * @api private + */ + retryDelays: function retryDelays(retryCount, err) { + var retryDelayOptions = AWS.util.copy(this.config.retryDelayOptions); + + if (typeof retryDelayOptions.base !== 'number') { + retryDelayOptions.base = 50; // default for dynamodb + } + var delay = AWS.util.calculateRetryDelay(retryCount, retryDelayOptions, err); + return delay; + } +}); + + +/***/ }), + +/***/ 92501: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.EC2.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + request.removeListener('extractError', AWS.EventListeners.Query.EXTRACT_ERROR); + request.addListener('extractError', this.extractError); + + if (request.operation === 'copySnapshot') { + request.onAsync('validate', this.buildCopySnapshotPresignedUrl); + } + }, + + /** + * @api private + */ + buildCopySnapshotPresignedUrl: function buildCopySnapshotPresignedUrl(req, done) { + if (req.params.PresignedUrl || req._subRequest) { + return done(); + } + + req.params = AWS.util.copy(req.params); + req.params.DestinationRegion = req.service.config.region; + + var config = AWS.util.copy(req.service.config); + delete config.endpoint; + config.region = req.params.SourceRegion; + var svc = new req.service.constructor(config); + var newReq = svc[req.operation](req.params); + newReq._subRequest = true; + newReq.presign(function(err, url) { + if (err) done(err); + else { + req.params.PresignedUrl = url; + done(); + } + }); + }, + + /** + * @api private + */ + extractError: function extractError(resp) { + // EC2 nests the error code and message deeper than other AWS Query services. + var httpResponse = resp.httpResponse; + var data = new AWS.XML.Parser().parse(httpResponse.body.toString() || ''); + if (data.Errors) { + resp.error = AWS.util.error(new Error(), { + code: data.Errors.Error.Code, + message: data.Errors.Error.Message + }); + } else { + resp.error = AWS.util.error(new Error(), { + code: httpResponse.statusCode, + message: null + }); + } + resp.error.requestId = data.RequestID || null; + } +}); - /** - * @api private - */ - addVersions: function addVersions(svc, versions) { - if (!Array.isArray(versions)) versions = [versions]; - svc.services = svc.services || {}; - for (var i = 0; i < versions.length; i++) { - if (svc.services[versions[i]] === undefined) { - svc.services[versions[i]] = null; - } - } +/***/ }), - svc.apiVersions = Object.keys(svc.services).sort(); - }, +/***/ 3034: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +AWS.util.update(AWS.EventBridge.prototype, { /** * @api private */ - defineServiceApi: function defineServiceApi(superclass, version, apiConfig) { - var svc = inherit(superclass, { - serviceIdentifier: superclass.serviceIdentifier - }); - - function setApi(api) { - if (api.isApi) { - svc.prototype.api = api; - } else { - svc.prototype.api = new Api(api, { - serviceIdentifier: superclass.serviceIdentifier + setupRequestListeners: function setupRequestListeners(request) { + if (request.operation === 'putEvents') { + var params = request.params || {}; + if (params.EndpointId !== undefined) { + throw new AWS.util.error(new Error(), { + code: 'InvalidParameter', + message: 'EndpointId is not supported in current SDK.\n' + + 'You should consider switching to V3(https://github.com/aws/aws-sdk-js-v3).' }); } } + }, +}); - if (typeof version === 'string') { - if (apiConfig) { - setApi(apiConfig); - } else { - try { - setApi(AWS.apiLoader(superclass.serviceIdentifier, version)); - } catch (err) { - throw AWS.util.error(err, { - message: 'Could not find API configuration ' + - superclass.serviceIdentifier + '-' + version - }); - } - } - if (!Object.prototype.hasOwnProperty.call(superclass.services, version)) { - superclass.apiVersions = superclass.apiVersions.concat(version).sort(); - } - superclass.services[version] = svc; + +/***/ }), + +/***/ 14472: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.Glacier.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + if (Array.isArray(request._events.validate)) { + request._events.validate.unshift(this.validateAccountId); } else { - setApi(version); + request.on('validate', this.validateAccountId); } - - AWS.Service.defineMethods(svc); - return svc; + request.removeListener('afterBuild', + AWS.EventListeners.Core.COMPUTE_SHA256); + request.on('build', this.addGlacierApiVersion); + request.on('build', this.addTreeHashHeaders); }, /** * @api private */ - hasService: function(identifier) { - return Object.prototype.hasOwnProperty.call(AWS.Service._serviceMap, identifier); + validateAccountId: function validateAccountId(request) { + if (request.params.accountId !== undefined) return; + request.params = AWS.util.copy(request.params); + request.params.accountId = '-'; }, /** - * @param attachOn attach default monitoring listeners to object - * - * Each monitoring event should be emitted from service client to service constructor prototype and then - * to global service prototype like bubbling up. These default monitoring events listener will transfer - * the monitoring events to the upper layer. * @api private */ - addDefaultMonitoringListeners: function addDefaultMonitoringListeners(attachOn) { - attachOn.addNamedListener('MONITOR_EVENTS_BUBBLE', 'apiCallAttempt', function EVENTS_BUBBLE(event) { - var baseClass = Object.getPrototypeOf(attachOn); - if (baseClass._events) baseClass.emit('apiCallAttempt', [event]); - }); - attachOn.addNamedListener('CALL_EVENTS_BUBBLE', 'apiCall', function CALL_EVENTS_BUBBLE(event) { - var baseClass = Object.getPrototypeOf(attachOn); - if (baseClass._events) baseClass.emit('apiCall', [event]); - }); + addGlacierApiVersion: function addGlacierApiVersion(request) { + var version = request.service.api.apiVersion; + request.httpRequest.headers['x-amz-glacier-version'] = version; }, /** * @api private */ - _serviceMap: {} -}); - -AWS.util.mixin(AWS.Service, AWS.SequentialExecutor); + addTreeHashHeaders: function addTreeHashHeaders(request) { + if (request.params.body === undefined) return; -/** - * @api private - */ -module.exports = AWS.Service; + var hashes = request.service.computeChecksums(request.params.body); + request.httpRequest.headers['X-Amz-Content-Sha256'] = hashes.linearHash; + if (!request.httpRequest.headers['x-amz-sha256-tree-hash']) { + request.httpRequest.headers['x-amz-sha256-tree-hash'] = hashes.treeHash; + } + }, -/***/ }), + /** + * @!group Computing Checksums + */ -/***/ 4338: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + /** + * Computes the SHA-256 linear and tree hash checksums for a given + * block of Buffer data. Pass the tree hash of the computed checksums + * as the checksum input to the {completeMultipartUpload} when performing + * a multi-part upload. + * + * @example Calculate checksum of 5.5MB data chunk + * var glacier = new AWS.Glacier(); + * var data = Buffer.alloc(5.5 * 1024 * 1024); + * data.fill('0'); // fill with zeros + * var results = glacier.computeChecksums(data); + * // Result: { linearHash: '68aff0c5a9...', treeHash: '154e26c78f...' } + * @param data [Buffer, String] data to calculate the checksum for + * @return [map] a map containing + * the linearHash and treeHash properties representing hex based digests + * of the respective checksums. + * @see completeMultipartUpload + */ + computeChecksums: function computeChecksums(data) { + if (!AWS.util.Buffer.isBuffer(data)) data = AWS.util.buffer.toBuffer(data); -var AWS = __nccwpck_require__(28437); + var mb = 1024 * 1024; + var hashes = []; + var hash = AWS.util.crypto.createHash('sha256'); -AWS.util.update(AWS.APIGateway.prototype, { -/** - * Sets the Accept header to application/json. - * - * @api private - */ - setAcceptHeader: function setAcceptHeader(req) { - var httpRequest = req.httpRequest; - if (!httpRequest.headers.Accept) { - httpRequest.headers['Accept'] = 'application/json'; + // build leaf nodes in 1mb chunks + for (var i = 0; i < data.length; i += mb) { + var chunk = data.slice(i, Math.min(i + mb, data.length)); + hash.update(chunk); + hashes.push(AWS.util.crypto.sha256(chunk)); } + + return { + linearHash: hash.digest('hex'), + treeHash: this.buildHashTree(hashes) + }; }, /** * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('build', this.setAcceptHeader); - if (request.operation === 'getExport') { - var params = request.params || {}; - if (params.exportType === 'swagger') { - request.addListener('extractData', AWS.util.convertPayloadToString); + buildHashTree: function buildHashTree(hashes) { + // merge leaf nodes + while (hashes.length > 1) { + var tmpHashes = []; + for (var i = 0; i < hashes.length; i += 2) { + if (hashes[i + 1]) { + var tmpHash = AWS.util.buffer.alloc(64); + tmpHash.write(hashes[i], 0, 32, 'binary'); + tmpHash.write(hashes[i + 1], 32, 32, 'binary'); + tmpHashes.push(AWS.util.crypto.sha256(tmpHash)); + } else { + tmpHashes.push(hashes[i]); + } } + hashes = tmpHashes; } - } -}); - - - -/***/ }), - -/***/ 95483: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); -// pull in CloudFront signer -__nccwpck_require__(93260); - -AWS.util.update(AWS.CloudFront.prototype, { - - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('extractData', AWS.util.hoistPayloadMember); + return AWS.util.crypto.toHex(hashes[0]); } - }); /***/ }), -/***/ 48571: +/***/ 27062: /***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); +/** + * @api private + */ +var blobPayloadOutputOps = [ + 'deleteThingShadow', + 'getThingShadow', + 'updateThingShadow' +]; + /** * Constructs a service interface object. Each API operation is exposed as a * function on service. * - * ### Sending a Request Using CloudSearchDomain + * ### Sending a Request Using IotData * * ```javascript - * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); - * csd.search(params, function (err, data) { + * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); + * iotdata.getThingShadow(params, function (err, data) { * if (err) console.log(err, err.stack); // an error occurred * else console.log(data); // successful response * }); @@ -25264,27 +46738,27 @@ var AWS = __nccwpck_require__(28437); * * ### Locking the API Version * - * In order to ensure that the CloudSearchDomain object uses this specific API, + * In order to ensure that the IotData object uses this specific API, * you can construct the object by passing the `apiVersion` option to the * constructor: * * ```javascript - * var csd = new AWS.CloudSearchDomain({ + * var iotdata = new AWS.IotData({ * endpoint: 'my.host.tld', - * apiVersion: '2013-01-01' + * apiVersion: '2015-05-28' * }); * ``` * * You can also set the API version globally in `AWS.config.apiVersions` using - * the **cloudsearchdomain** service identifier: + * the **iotdata** service identifier: * * ```javascript * AWS.config.apiVersions = { - * cloudsearchdomain: '2013-01-01', + * iotdata: '2015-05-28', * // other service API versions * }; * - * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); + * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); * ``` * * @note You *must* provide an `endpoint` configuration parameter when @@ -25294,6692 +46768,8203 @@ var AWS = __nccwpck_require__(28437); * Constructs a service object. This object has one method for each * API operation. * - * @example Constructing a CloudSearchDomain object - * var csd = new AWS.CloudSearchDomain({endpoint: 'my.host.tld'}); + * @example Constructing a IotData object + * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); * @note You *must* provide an `endpoint` when constructing this service. * @option (see AWS.Config.constructor) * - * @service cloudsearchdomain - * @version 2013-01-01 + * @service iotdata + * @version 2015-05-28 */ -AWS.util.update(AWS.CloudSearchDomain.prototype, { +AWS.util.update(AWS.IotData.prototype, { + /** + * @api private + */ + validateService: function validateService() { + if (!this.config.endpoint || this.config.endpoint.indexOf('{') >= 0) { + var msg = 'AWS.IotData requires an explicit ' + + '`endpoint\' configuration option.'; + throw AWS.util.error(new Error(), + {name: 'InvalidEndpoint', message: msg}); + } + }, + + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + request.addListener('validateResponse', this.validateResponseBody); + if (blobPayloadOutputOps.indexOf(request.operation) > -1) { + request.addListener('extractData', AWS.util.convertPayloadToString); + } + }, + + /** + * @api private + */ + validateResponseBody: function validateResponseBody(resp) { + var body = resp.httpResponse.body.toString() || '{}'; + var bodyCheck = body.trim(); + if (!bodyCheck || bodyCheck.charAt(0) !== '{') { + resp.httpResponse.body = ''; + } + } + +}); + + +/***/ }), + +/***/ 8452: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.Lambda.prototype, { /** * @api private */ - validateService: function validateService() { - if (!this.config.endpoint || this.config.endpoint.indexOf('{') >= 0) { - var msg = 'AWS.CloudSearchDomain requires an explicit ' + - '`endpoint\' configuration option.'; - throw AWS.util.error(new Error(), - {name: 'InvalidEndpoint', message: msg}); + setupRequestListeners: function setupRequestListeners(request) { + if (request.operation === 'invoke') { + request.addListener('extractData', AWS.util.convertPayloadToString); + } + } +}); + + + +/***/ }), + +/***/ 19174: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.MachineLearning.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + if (request.operation === 'predict') { + request.addListener('build', this.buildEndpoint); } }, /** + * Updates request endpoint from PredictEndpoint * @api private */ + buildEndpoint: function buildEndpoint(request) { + var url = request.params.PredictEndpoint; + if (url) { + request.httpRequest.endpoint = new AWS.Endpoint(url); + } + } + +}); + + +/***/ }), + +/***/ 73090: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var rdsutil = __nccwpck_require__(30650); + +/** +* @api private +*/ +var crossRegionOperations = ['createDBCluster', 'copyDBClusterSnapshot']; + +AWS.util.update(AWS.Neptune.prototype, { + /** + * @api private + */ setupRequestListeners: function setupRequestListeners(request) { - request.removeListener('validate', - AWS.EventListeners.Core.VALIDATE_CREDENTIALS - ); - request.onAsync('validate', this.validateCredentials); - request.addListener('validate', this.updateRegion); - if (request.operation === 'search') { - request.addListener('build', this.convertGetToPost); + if ( + crossRegionOperations.indexOf(request.operation) !== -1 && + this.config.params && + this.config.params.SourceRegion && + request.params && + !request.params.SourceRegion + ) { + request.params.SourceRegion = this.config.params.SourceRegion; + } + rdsutil.setupRequestListeners(this, request, crossRegionOperations); + }, +}); + + +/***/ }), + +/***/ 53199: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +__nccwpck_require__(44086); + + +/***/ }), + +/***/ 71928: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var rdsutil = __nccwpck_require__(30650); +__nccwpck_require__(16612); + /** + * @api private + */ + var crossRegionOperations = ['copyDBSnapshot', 'createDBInstanceReadReplica', 'createDBCluster', 'copyDBClusterSnapshot', 'startDBInstanceAutomatedBackupsReplication']; + + AWS.util.update(AWS.RDS.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + rdsutil.setupRequestListeners(this, request, crossRegionOperations); + }, + }); + + +/***/ }), + +/***/ 64070: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.RDSDataService.prototype, { + /** + * @return [Boolean] whether the error can be retried + * @api private + */ + retryableError: function retryableError(error) { + if (error.code === 'BadRequestException' && + error.message && + error.message.match(/^Communications link failure/) && + error.statusCode === 400) { + return true; + } else { + var _super = AWS.Service.prototype.retryableError; + return _super.call(this, error); + } + } +}); + + +/***/ }), + +/***/ 30650: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +var rdsutil = { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(service, request, crossRegionOperations) { + if (crossRegionOperations.indexOf(request.operation) !== -1 && + request.params.SourceRegion) { + request.params = AWS.util.copy(request.params); + if (request.params.PreSignedUrl || + request.params.SourceRegion === service.config.region) { + delete request.params.SourceRegion; + } else { + var doesParamValidation = !!service.config.paramValidation; + // remove the validate parameters listener so we can re-add it after we build the URL + if (doesParamValidation) { + request.removeListener('validate', AWS.EventListeners.Core.VALIDATE_PARAMETERS); + } + request.onAsync('validate', rdsutil.buildCrossRegionPresignedUrl); + if (doesParamValidation) { + request.addListener('validate', AWS.EventListeners.Core.VALIDATE_PARAMETERS); + } + } } }, /** * @api private */ - validateCredentials: function(req, done) { - if (!req.service.api.signatureVersion) return done(); // none - req.service.config.getCredentials(function(err) { - if (err) { - req.removeListener('sign', AWS.EventListeners.Core.SIGN); + buildCrossRegionPresignedUrl: function buildCrossRegionPresignedUrl(req, done) { + var config = AWS.util.copy(req.service.config); + config.region = req.params.SourceRegion; + delete req.params.SourceRegion; + delete config.endpoint; + // relevant params for the operation will already be in req.params + delete config.params; + config.signatureVersion = 'v4'; + var destinationRegion = req.service.config.region; + + var svc = new req.service.constructor(config); + var newReq = svc[req.operation](AWS.util.copy(req.params)); + newReq.on('build', function addDestinationRegionParam(request) { + var httpRequest = request.httpRequest; + httpRequest.params.DestinationRegion = destinationRegion; + httpRequest.body = AWS.util.queryParamsToString(httpRequest.params); + }); + newReq.presign(function(err, url) { + if (err) done(err); + else { + req.params.PreSignedUrl = url; + done(); } - done(); }); + } +}; + +/** + * @api private + */ +module.exports = rdsutil; + + +/***/ }), + +/***/ 69627: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +AWS.util.update(AWS.Route53.prototype, { + /** + * @api private + */ + setupRequestListeners: function setupRequestListeners(request) { + request.on('build', this.sanitizeUrl); }, /** * @api private */ - convertGetToPost: function(request) { - var httpRequest = request.httpRequest; - // convert queries to POST to avoid length restrictions - var path = httpRequest.path.split('?'); - httpRequest.method = 'POST'; - httpRequest.path = path[0]; - httpRequest.body = path[1]; - httpRequest.headers['Content-Length'] = httpRequest.body.length; - httpRequest.headers['Content-Type'] = 'application/x-www-form-urlencoded'; + sanitizeUrl: function sanitizeUrl(request) { + var path = request.httpRequest.path; + request.httpRequest.path = path.replace(/\/%2F\w+%2F/, '/'); }, /** + * @return [Boolean] whether the error can be retried * @api private */ - updateRegion: function updateRegion(request) { - var endpoint = request.httpRequest.endpoint.hostname; - var zones = endpoint.split('.'); - request.httpRequest.region = zones[1] || request.httpRequest.region; + retryableError: function retryableError(error) { + if (error.code === 'PriorRequestNotComplete' && + error.statusCode === 400) { + return true; + } else { + var _super = AWS.Service.prototype.retryableError; + return _super.call(this, error); + } } - }); /***/ }), -/***/ 59050: +/***/ 26543: /***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var rdsutil = __nccwpck_require__(30650); +var v4Credentials = __nccwpck_require__(62660); +var resolveRegionalEndpointsFlag = __nccwpck_require__(85566); +var s3util = __nccwpck_require__(35895); +var regionUtil = __nccwpck_require__(18262); + +// Pull in managed upload extension +__nccwpck_require__(81600); /** -* @api private -*/ -var crossRegionOperations = ['createDBCluster', 'copyDBClusterSnapshot']; + * @api private + */ +var operationsWith200StatusCodeError = { + 'completeMultipartUpload': true, + 'copyObject': true, + 'uploadPartCopy': true +}; -AWS.util.update(AWS.DocDB.prototype, { +/** + * @api private + */ + var regionRedirectErrorCodes = [ + 'AuthorizationHeaderMalformed', // non-head operations on virtual-hosted global bucket endpoints + 'BadRequest', // head operations on virtual-hosted global bucket endpoints + 'PermanentRedirect', // non-head operations on path-style or regional endpoints + 301 // head operations on path-style or regional endpoints + ]; + +var OBJECT_LAMBDA_SERVICE = 's3-object-lambda'; + +AWS.util.update(AWS.S3.prototype, { /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - if ( - crossRegionOperations.indexOf(request.operation) !== -1 && - this.config.params && - this.config.params.SourceRegion && - request.params && - !request.params.SourceRegion - ) { - request.params.SourceRegion = this.config.params.SourceRegion; + * @api private + */ + getSignatureVersion: function getSignatureVersion(request) { + var defaultApiVersion = this.api.signatureVersion; + var userDefinedVersion = this._originalConfig ? this._originalConfig.signatureVersion : null; + var regionDefinedVersion = this.config.signatureVersion; + var isPresigned = request ? request.isPresigned() : false; + /* + 1) User defined version specified: + a) always return user defined version + 2) No user defined version specified: + a) If not using presigned urls, default to V4 + b) If using presigned urls, default to lowest version the region supports + */ + if (userDefinedVersion) { + userDefinedVersion = userDefinedVersion === 'v2' ? 's3' : userDefinedVersion; + return userDefinedVersion; } - rdsutil.setupRequestListeners(this, request, crossRegionOperations); + if (isPresigned !== true) { + defaultApiVersion = 'v4'; + } else if (regionDefinedVersion) { + defaultApiVersion = regionDefinedVersion; + } + return defaultApiVersion; }, -}); + /** + * @api private + */ + getSigningName: function getSigningName(req) { + if (req && req.operation === 'writeGetObjectResponse') { + return OBJECT_LAMBDA_SERVICE; + } -/***/ }), - -/***/ 17101: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + var _super = AWS.Service.prototype.getSigningName; + return (req && req._parsedArn && req._parsedArn.service) + ? req._parsedArn.service + : _super.call(this); + }, -var AWS = __nccwpck_require__(28437); -__nccwpck_require__(90030); + /** + * @api private + */ + getSignerClass: function getSignerClass(request) { + var signatureVersion = this.getSignatureVersion(request); + return AWS.Signers.RequestSigner.getVersion(signatureVersion); + }, -AWS.util.update(AWS.DynamoDB.prototype, { /** * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - if (request.service.config.dynamoDbCrc32) { - request.removeListener('extractData', AWS.EventListeners.Json.EXTRACT_DATA); - request.addListener('extractData', this.checkCrc32); - request.addListener('extractData', AWS.EventListeners.Json.EXTRACT_DATA); + validateService: function validateService() { + var msg; + var messages = []; + + // default to us-east-1 when no region is provided + if (!this.config.region) this.config.region = 'us-east-1'; + + if (!this.config.endpoint && this.config.s3BucketEndpoint) { + messages.push('An endpoint must be provided when configuring ' + + '`s3BucketEndpoint` to true.'); + } + if (messages.length === 1) { + msg = messages[0]; + } else if (messages.length > 1) { + msg = 'Multiple configuration errors:\n' + messages.join('\n'); + } + if (msg) { + throw AWS.util.error(new Error(), + {name: 'InvalidEndpoint', message: msg}); } }, /** * @api private */ - checkCrc32: function checkCrc32(resp) { - if (!resp.httpResponse.streaming && !resp.request.service.crc32IsValid(resp)) { - resp.data = null; - resp.error = AWS.util.error(new Error(), { - code: 'CRC32CheckFailed', - message: 'CRC32 integrity check failed', - retryable: true - }); - resp.request.haltHandlersOnError(); - throw (resp.error); + shouldDisableBodySigning: function shouldDisableBodySigning(request) { + var signerClass = this.getSignerClass(); + if (this.config.s3DisableBodySigning === true && signerClass === AWS.Signers.V4 + && request.httpRequest.endpoint.protocol === 'https:') { + return true; } + return false; }, /** * @api private */ - crc32IsValid: function crc32IsValid(resp) { - var crc = resp.httpResponse.headers['x-amz-crc32']; - if (!crc) return true; // no (valid) CRC32 header - return parseInt(crc, 10) === AWS.util.crypto.crc32(resp.httpResponse.body); + setupRequestListeners: function setupRequestListeners(request) { + var prependListener = true; + request.addListener('validate', this.validateScheme); + request.addListener('validate', this.validateBucketName, prependListener); + request.addListener('validate', this.optInUsEast1RegionalEndpoint, prependListener); + + request.removeListener('validate', + AWS.EventListeners.Core.VALIDATE_REGION); + request.addListener('build', this.addContentType); + request.addListener('build', this.computeContentMd5); + request.addListener('build', this.computeSseCustomerKeyMd5); + request.addListener('build', this.populateURI); + request.addListener('afterBuild', this.addExpect100Continue); + request.addListener('extractError', this.extractError); + request.addListener('extractData', AWS.util.hoistPayloadMember); + request.addListener('extractData', this.extractData); + request.addListener('extractData', this.extractErrorFrom200Response); + request.addListener('beforePresign', this.prepareSignedUrl); + if (this.shouldDisableBodySigning(request)) { + request.removeListener('afterBuild', AWS.EventListeners.Core.COMPUTE_SHA256); + request.addListener('afterBuild', this.disableBodySigning); + } + //deal with ARNs supplied to Bucket + if (request.operation !== 'createBucket' && s3util.isArnInParam(request, 'Bucket')) { + // avoid duplicate parsing in the future + request._parsedArn = AWS.util.ARN.parse(request.params.Bucket); + + request.removeListener('validate', this.validateBucketName); + request.removeListener('build', this.populateURI); + if (request._parsedArn.service === 's3') { + request.addListener('validate', s3util.validateS3AccessPointArn); + request.addListener('validate', this.validateArnResourceType); + request.addListener('validate', this.validateArnRegion); + } else if (request._parsedArn.service === 's3-outposts') { + request.addListener('validate', s3util.validateOutpostsAccessPointArn); + request.addListener('validate', s3util.validateOutpostsArn); + request.addListener('validate', s3util.validateArnRegion); + } + request.addListener('validate', s3util.validateArnAccount); + request.addListener('validate', s3util.validateArnService); + request.addListener('build', this.populateUriFromAccessPointArn); + request.addListener('build', s3util.validatePopulateUriFromArn); + return; + } + //listeners regarding region inference + request.addListener('validate', this.validateBucketEndpoint); + request.addListener('validate', this.correctBucketRegionFromCache); + request.onAsync('extractError', this.requestBucketRegion); + if (AWS.util.isBrowser()) { + request.onAsync('retry', this.reqRegionForNetworkingError); + } }, /** * @api private */ - defaultRetryCount: 10, + validateScheme: function(req) { + var params = req.params, + scheme = req.httpRequest.endpoint.protocol, + sensitive = params.SSECustomerKey || params.CopySourceSSECustomerKey; + if (sensitive && scheme !== 'https:') { + var msg = 'Cannot send SSE keys over HTTP. Set \'sslEnabled\'' + + 'to \'true\' in your configuration'; + throw AWS.util.error(new Error(), + { code: 'ConfigError', message: msg }); + } + }, /** * @api private */ - retryDelays: function retryDelays(retryCount, err) { - var retryDelayOptions = AWS.util.copy(this.config.retryDelayOptions); - - if (typeof retryDelayOptions.base !== 'number') { - retryDelayOptions.base = 50; // default for dynamodb + validateBucketEndpoint: function(req) { + if (!req.params.Bucket && req.service.config.s3BucketEndpoint) { + var msg = 'Cannot send requests to root API with `s3BucketEndpoint` set.'; + throw AWS.util.error(new Error(), + { code: 'ConfigError', message: msg }); } - var delay = AWS.util.calculateRetryDelay(retryCount, retryDelayOptions, err); - return delay; - } -}); + }, + /** + * @api private + */ + validateArnRegion: function validateArnRegion(req) { + s3util.validateArnRegion(req, { allowFipsEndpoint: true }); + }, -/***/ }), + /** + * Validate resource-type supplied in S3 ARN + */ + validateArnResourceType: function validateArnResourceType(req) { + var resource = req._parsedArn.resource; -/***/ 92501: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + if ( + resource.indexOf('accesspoint:') !== 0 && + resource.indexOf('accesspoint/') !== 0 + ) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'ARN resource should begin with \'accesspoint/\'' + }); + } + }, -var AWS = __nccwpck_require__(28437); + /** + * @api private + */ + validateBucketName: function validateBucketName(req) { + var service = req.service; + var signatureVersion = service.getSignatureVersion(req); + var bucket = req.params && req.params.Bucket; + var key = req.params && req.params.Key; + var slashIndex = bucket && bucket.indexOf('/'); + if (bucket && slashIndex >= 0) { + if (typeof key === 'string' && slashIndex > 0) { + req.params = AWS.util.copy(req.params); + // Need to include trailing slash to match sigv2 behavior + var prefix = bucket.substr(slashIndex + 1) || ''; + req.params.Key = prefix + '/' + key; + req.params.Bucket = bucket.substr(0, slashIndex); + } else if (signatureVersion === 'v4') { + var msg = 'Bucket names cannot contain forward slashes. Bucket: ' + bucket; + throw AWS.util.error(new Error(), + { code: 'InvalidBucket', message: msg }); + } + } + }, -AWS.util.update(AWS.EC2.prototype, { /** * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - request.removeListener('extractError', AWS.EventListeners.Query.EXTRACT_ERROR); - request.addListener('extractError', this.extractError); + isValidAccelerateOperation: function isValidAccelerateOperation(operation) { + var invalidOperations = [ + 'createBucket', + 'deleteBucket', + 'listBuckets' + ]; + return invalidOperations.indexOf(operation) === -1; + }, - if (request.operation === 'copySnapshot') { - request.onAsync('validate', this.buildCopySnapshotPresignedUrl); + /** + * When us-east-1 region endpoint configuration is set, in stead of sending request to + * global endpoint(e.g. 's3.amazonaws.com'), we will send request to + * 's3.us-east-1.amazonaws.com'. + * @api private + */ + optInUsEast1RegionalEndpoint: function optInUsEast1RegionalEndpoint(req) { + var service = req.service; + var config = service.config; + config.s3UsEast1RegionalEndpoint = resolveRegionalEndpointsFlag(service._originalConfig, { + env: 'AWS_S3_US_EAST_1_REGIONAL_ENDPOINT', + sharedConfig: 's3_us_east_1_regional_endpoint', + clientConfig: 's3UsEast1RegionalEndpoint' + }); + if ( + !(service._originalConfig || {}).endpoint && + req.httpRequest.region === 'us-east-1' && + config.s3UsEast1RegionalEndpoint === 'regional' && + req.httpRequest.endpoint.hostname.indexOf('s3.amazonaws.com') >= 0 + ) { + var insertPoint = config.endpoint.indexOf('.amazonaws.com'); + regionalEndpoint = config.endpoint.substring(0, insertPoint) + + '.us-east-1' + config.endpoint.substring(insertPoint); + req.httpRequest.updateEndpoint(regionalEndpoint); } }, /** + * S3 prefers dns-compatible bucket names to be moved from the uri path + * to the hostname as a sub-domain. This is not possible, even for dns-compat + * buckets when using SSL and the bucket name contains a dot ('.'). The + * ssl wildcard certificate is only 1-level deep. + * * @api private */ - buildCopySnapshotPresignedUrl: function buildCopySnapshotPresignedUrl(req, done) { - if (req.params.PresignedUrl || req._subRequest) { - return done(); - } + populateURI: function populateURI(req) { + var httpRequest = req.httpRequest; + var b = req.params.Bucket; + var service = req.service; + var endpoint = httpRequest.endpoint; + if (b) { + if (!service.pathStyleBucketName(b)) { + if (service.config.useAccelerateEndpoint && service.isValidAccelerateOperation(req.operation)) { + if (service.config.useDualstackEndpoint) { + endpoint.hostname = b + '.s3-accelerate.dualstack.amazonaws.com'; + } else { + endpoint.hostname = b + '.s3-accelerate.amazonaws.com'; + } + } else if (!service.config.s3BucketEndpoint) { + endpoint.hostname = + b + '.' + endpoint.hostname; + } - req.params = AWS.util.copy(req.params); - req.params.DestinationRegion = req.service.config.region; + var port = endpoint.port; + if (port !== 80 && port !== 443) { + endpoint.host = endpoint.hostname + ':' + + endpoint.port; + } else { + endpoint.host = endpoint.hostname; + } - var config = AWS.util.copy(req.service.config); - delete config.endpoint; - config.region = req.params.SourceRegion; - var svc = new req.service.constructor(config); - var newReq = svc[req.operation](req.params); - newReq._subRequest = true; - newReq.presign(function(err, url) { - if (err) done(err); - else { - req.params.PresignedUrl = url; - done(); + httpRequest.virtualHostedBucket = b; // needed for signing the request + service.removeVirtualHostedBucketFromPath(req); } - }); + } }, /** + * Takes the bucket name out of the path if bucket is virtual-hosted + * * @api private */ - extractError: function extractError(resp) { - // EC2 nests the error code and message deeper than other AWS Query services. - var httpResponse = resp.httpResponse; - var data = new AWS.XML.Parser().parse(httpResponse.body.toString() || ''); - if (data.Errors) { - resp.error = AWS.util.error(new Error(), { - code: data.Errors.Error.Code, - message: data.Errors.Error.Message - }); - } else { - resp.error = AWS.util.error(new Error(), { - code: httpResponse.statusCode, - message: null - }); + removeVirtualHostedBucketFromPath: function removeVirtualHostedBucketFromPath(req) { + var httpRequest = req.httpRequest; + var bucket = httpRequest.virtualHostedBucket; + if (bucket && httpRequest.path) { + if (req.params && req.params.Key) { + var encodedS3Key = '/' + AWS.util.uriEscapePath(req.params.Key); + if (httpRequest.path.indexOf(encodedS3Key) === 0 && (httpRequest.path.length === encodedS3Key.length || httpRequest.path[encodedS3Key.length] === '?')) { + //path only contains key or path contains only key and querystring + return; + } + } + httpRequest.path = httpRequest.path.replace(new RegExp('/' + bucket), ''); + if (httpRequest.path[0] !== '/') { + httpRequest.path = '/' + httpRequest.path; + } } - resp.error.requestId = data.RequestID || null; - } -}); + }, + /** + * When user supply an access point ARN in the Bucket parameter, we need to + * populate the URI according to the ARN. + */ + populateUriFromAccessPointArn: function populateUriFromAccessPointArn(req) { + var accessPointArn = req._parsedArn; -/***/ }), + var isOutpostArn = accessPointArn.service === 's3-outposts'; + var isObjectLambdaArn = accessPointArn.service === 's3-object-lambda'; -/***/ 3034: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + var outpostsSuffix = isOutpostArn ? '.' + accessPointArn.outpostId: ''; + var serviceName = isOutpostArn ? 's3-outposts': 's3-accesspoint'; + var fipsSuffix = !isOutpostArn && req.service.config.useFipsEndpoint ? '-fips': ''; + var dualStackSuffix = !isOutpostArn && + req.service.config.useDualstackEndpoint ? '.dualstack' : ''; -var AWS = __nccwpck_require__(28437); + var endpoint = req.httpRequest.endpoint; + var dnsSuffix = regionUtil.getEndpointSuffix(accessPointArn.region); + var useArnRegion = req.service.config.s3UseArnRegion; + + endpoint.hostname = [ + accessPointArn.accessPoint + '-' + accessPointArn.accountId + outpostsSuffix, + serviceName + fipsSuffix + dualStackSuffix, + useArnRegion ? accessPointArn.region : req.service.config.region, + dnsSuffix + ].join('.'); + + if (isObjectLambdaArn) { + // should be in the format: "accesspoint/${accesspointName}" + var serviceName = 's3-object-lambda'; + var accesspointName = accessPointArn.resource.split('/')[1]; + var fipsSuffix = req.service.config.useFipsEndpoint ? '-fips': ''; + endpoint.hostname = [ + accesspointName + '-' + accessPointArn.accountId, + serviceName + fipsSuffix, + useArnRegion ? accessPointArn.region : req.service.config.region, + dnsSuffix + ].join('.'); + } + endpoint.host = endpoint.hostname; + var encodedArn = AWS.util.uriEscape(req.params.Bucket); + var path = req.httpRequest.path; + //remove the Bucket value from path + req.httpRequest.path = path.replace(new RegExp('/' + encodedArn), ''); + if (req.httpRequest.path[0] !== '/') { + req.httpRequest.path = '/' + req.httpRequest.path; + } + req.httpRequest.region = accessPointArn.region; //region used to sign + }, -AWS.util.update(AWS.EventBridge.prototype, { /** + * Adds Expect: 100-continue header if payload is greater-or-equal 1MB * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - if (request.operation === 'putEvents') { - var params = request.params || {}; - if (params.EndpointId !== undefined) { - throw new AWS.util.error(new Error(), { - code: 'InvalidParameter', - message: 'EndpointId is not supported in current SDK.\n' + - 'You should consider switching to V3(https://github.com/aws/aws-sdk-js-v3).' - }); + addExpect100Continue: function addExpect100Continue(req) { + var len = req.httpRequest.headers['Content-Length']; + if (AWS.util.isNode() && (len >= 1024 * 1024 || req.params.Body instanceof AWS.util.stream.Stream)) { + req.httpRequest.headers['Expect'] = '100-continue'; + } + }, + + /** + * Adds a default content type if none is supplied. + * + * @api private + */ + addContentType: function addContentType(req) { + var httpRequest = req.httpRequest; + if (httpRequest.method === 'GET' || httpRequest.method === 'HEAD') { + // Content-Type is not set in GET/HEAD requests + delete httpRequest.headers['Content-Type']; + return; + } + + if (!httpRequest.headers['Content-Type']) { // always have a Content-Type + httpRequest.headers['Content-Type'] = 'application/octet-stream'; + } + + var contentType = httpRequest.headers['Content-Type']; + if (AWS.util.isBrowser()) { + if (typeof httpRequest.body === 'string' && !contentType.match(/;\s*charset=/)) { + var charset = '; charset=UTF-8'; + httpRequest.headers['Content-Type'] += charset; + } else { + var replaceFn = function(_, prefix, charsetName) { + return prefix + charsetName.toUpperCase(); + }; + + httpRequest.headers['Content-Type'] = + contentType.replace(/(;\s*charset=)(.+)$/, replaceFn); } } }, -}); + /** + * Checks whether checksums should be computed for the request if it's not + * already set by {AWS.EventListeners.Core.COMPUTE_CHECKSUM}. It depends on + * whether {AWS.Config.computeChecksums} is set. + * + * @param req [AWS.Request] the request to check against + * @return [Boolean] whether to compute checksums for a request. + * @api private + */ + willComputeChecksums: function willComputeChecksums(req) { + var rules = req.service.api.operations[req.operation].input.members; + var body = req.httpRequest.body; + var needsContentMD5 = req.service.config.computeChecksums && + rules.ContentMD5 && + !req.params.ContentMD5 && + body && + (AWS.util.Buffer.isBuffer(req.httpRequest.body) || typeof req.httpRequest.body === 'string'); -/***/ }), + // Sha256 signing disabled, and not a presigned url + if (needsContentMD5 && req.service.shouldDisableBodySigning(req) && !req.isPresigned()) { + return true; + } -/***/ 14472: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + // SigV2 and presign, for backwards compatibility purpose. + if (needsContentMD5 && this.getSignatureVersion(req) === 's3' && req.isPresigned()) { + return true; + } -var AWS = __nccwpck_require__(28437); + return false; + }, -AWS.util.update(AWS.Glacier.prototype, { /** + * A listener that computes the Content-MD5 and sets it in the header. + * This listener is to support S3-specific features like + * s3DisableBodySigning and SigV2 presign. Content MD5 logic for SigV4 is + * handled in AWS.EventListeners.Core.COMPUTE_CHECKSUM + * * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - if (Array.isArray(request._events.validate)) { - request._events.validate.unshift(this.validateAccountId); - } else { - request.on('validate', this.validateAccountId); + computeContentMd5: function computeContentMd5(req) { + if (req.service.willComputeChecksums(req)) { + var md5 = AWS.util.crypto.md5(req.httpRequest.body, 'base64'); + req.httpRequest.headers['Content-MD5'] = md5; } - request.removeListener('afterBuild', - AWS.EventListeners.Core.COMPUTE_SHA256); - request.on('build', this.addGlacierApiVersion); - request.on('build', this.addTreeHashHeaders); }, /** * @api private */ - validateAccountId: function validateAccountId(request) { - if (request.params.accountId !== undefined) return; - request.params = AWS.util.copy(request.params); - request.params.accountId = '-'; + computeSseCustomerKeyMd5: function computeSseCustomerKeyMd5(req) { + var keys = { + SSECustomerKey: 'x-amz-server-side-encryption-customer-key-MD5', + CopySourceSSECustomerKey: 'x-amz-copy-source-server-side-encryption-customer-key-MD5' + }; + AWS.util.each(keys, function(key, header) { + if (req.params[key]) { + var value = AWS.util.crypto.md5(req.params[key], 'base64'); + req.httpRequest.headers[header] = value; + } + }); }, /** + * Returns true if the bucket name should be left in the URI path for + * a request to S3. This function takes into account the current + * endpoint protocol (e.g. http or https). + * * @api private */ - addGlacierApiVersion: function addGlacierApiVersion(request) { - var version = request.service.api.apiVersion; - request.httpRequest.headers['x-amz-glacier-version'] = version; + pathStyleBucketName: function pathStyleBucketName(bucketName) { + // user can force path style requests via the configuration + if (this.config.s3ForcePathStyle) return true; + if (this.config.s3BucketEndpoint) return false; + + if (s3util.dnsCompatibleBucketName(bucketName)) { + return (this.config.sslEnabled && bucketName.match(/\./)) ? true : false; + } else { + return true; // not dns compatible names must always use path style + } }, /** + * For COPY operations, some can be error even with status code 200. + * SDK treats the response as exception when response body indicates + * an exception or body is empty. + * * @api private */ - addTreeHashHeaders: function addTreeHashHeaders(request) { - if (request.params.body === undefined) return; - - var hashes = request.service.computeChecksums(request.params.body); - request.httpRequest.headers['X-Amz-Content-Sha256'] = hashes.linearHash; - - if (!request.httpRequest.headers['x-amz-sha256-tree-hash']) { - request.httpRequest.headers['x-amz-sha256-tree-hash'] = hashes.treeHash; + extractErrorFrom200Response: function extractErrorFrom200Response(resp) { + if (!operationsWith200StatusCodeError[resp.request.operation]) return; + var httpResponse = resp.httpResponse; + if (httpResponse.body && httpResponse.body.toString().match('')) { + // Response body with '...' indicates an exception. + // Get S3 client object. In ManagedUpload, this.service refers to + // S3 client object. + resp.data = null; + var service = this.service ? this.service : this; + service.extractError(resp); + throw resp.error; + } else if (!httpResponse.body || !httpResponse.body.toString().match(/<[\w_]/)) { + // When body is empty or incomplete, S3 might stop the request on detecting client + // side aborting the request. + resp.data = null; + throw AWS.util.error(new Error(), { + code: 'InternalError', + message: 'S3 aborted request' + }); } }, /** - * @!group Computing Checksums + * @return [Boolean] whether the error can be retried + * @api private */ + retryableError: function retryableError(error, request) { + if (operationsWith200StatusCodeError[request.operation] && + error.statusCode === 200) { + return true; + } else if (request._requestRegionForBucket && + request.service.bucketRegionCache[request._requestRegionForBucket]) { + return false; + } else if (error && error.code === 'RequestTimeout') { + return true; + } else if (error && + regionRedirectErrorCodes.indexOf(error.code) != -1 && + error.region && error.region != request.httpRequest.region) { + request.httpRequest.region = error.region; + if (error.statusCode === 301) { + request.service.updateReqBucketRegion(request); + } + return true; + } else { + var _super = AWS.Service.prototype.retryableError; + return _super.call(this, error, request); + } + }, /** - * Computes the SHA-256 linear and tree hash checksums for a given - * block of Buffer data. Pass the tree hash of the computed checksums - * as the checksum input to the {completeMultipartUpload} when performing - * a multi-part upload. + * Updates httpRequest with region. If region is not provided, then + * the httpRequest will be updated based on httpRequest.region * - * @example Calculate checksum of 5.5MB data chunk - * var glacier = new AWS.Glacier(); - * var data = Buffer.alloc(5.5 * 1024 * 1024); - * data.fill('0'); // fill with zeros - * var results = glacier.computeChecksums(data); - * // Result: { linearHash: '68aff0c5a9...', treeHash: '154e26c78f...' } - * @param data [Buffer, String] data to calculate the checksum for - * @return [map] a map containing - * the linearHash and treeHash properties representing hex based digests - * of the respective checksums. - * @see completeMultipartUpload + * @api private */ - computeChecksums: function computeChecksums(data) { - if (!AWS.util.Buffer.isBuffer(data)) data = AWS.util.buffer.toBuffer(data); + updateReqBucketRegion: function updateReqBucketRegion(request, region) { + var httpRequest = request.httpRequest; + if (typeof region === 'string' && region.length) { + httpRequest.region = region; + } + if (!httpRequest.endpoint.host.match(/s3(?!-accelerate).*\.amazonaws\.com$/)) { + return; + } + var service = request.service; + var s3Config = service.config; + var s3BucketEndpoint = s3Config.s3BucketEndpoint; + if (s3BucketEndpoint) { + delete s3Config.s3BucketEndpoint; + } + var newConfig = AWS.util.copy(s3Config); + delete newConfig.endpoint; + newConfig.region = httpRequest.region; - var mb = 1024 * 1024; - var hashes = []; - var hash = AWS.util.crypto.createHash('sha256'); + httpRequest.endpoint = (new AWS.S3(newConfig)).endpoint; + service.populateURI(request); + s3Config.s3BucketEndpoint = s3BucketEndpoint; + httpRequest.headers.Host = httpRequest.endpoint.host; - // build leaf nodes in 1mb chunks - for (var i = 0; i < data.length; i += mb) { - var chunk = data.slice(i, Math.min(i + mb, data.length)); - hash.update(chunk); - hashes.push(AWS.util.crypto.sha256(chunk)); + if (request._asm.currentState === 'validate') { + request.removeListener('build', service.populateURI); + request.addListener('build', service.removeVirtualHostedBucketFromPath); } - - return { - linearHash: hash.digest('hex'), - treeHash: this.buildHashTree(hashes) - }; }, /** + * Provides a specialized parser for getBucketLocation -- all other + * operations are parsed by the super class. + * * @api private */ - buildHashTree: function buildHashTree(hashes) { - // merge leaf nodes - while (hashes.length > 1) { - var tmpHashes = []; - for (var i = 0; i < hashes.length; i += 2) { - if (hashes[i + 1]) { - var tmpHash = AWS.util.buffer.alloc(64); - tmpHash.write(hashes[i], 0, 32, 'binary'); - tmpHash.write(hashes[i + 1], 32, 32, 'binary'); - tmpHashes.push(AWS.util.crypto.sha256(tmpHash)); - } else { - tmpHashes.push(hashes[i]); - } + extractData: function extractData(resp) { + var req = resp.request; + if (req.operation === 'getBucketLocation') { + var match = resp.httpResponse.body.toString().match(/>(.+)<\/Location/); + delete resp.data['_']; + if (match) { + resp.data.LocationConstraint = match[1]; + } else { + resp.data.LocationConstraint = ''; } - hashes = tmpHashes; } - - return AWS.util.crypto.toHex(hashes[0]); - } -}); - - -/***/ }), - -/***/ 27062: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); - -/** - * @api private - */ -var blobPayloadOutputOps = [ - 'deleteThingShadow', - 'getThingShadow', - 'updateThingShadow' -]; - -/** - * Constructs a service interface object. Each API operation is exposed as a - * function on service. - * - * ### Sending a Request Using IotData - * - * ```javascript - * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); - * iotdata.getThingShadow(params, function (err, data) { - * if (err) console.log(err, err.stack); // an error occurred - * else console.log(data); // successful response - * }); - * ``` - * - * ### Locking the API Version - * - * In order to ensure that the IotData object uses this specific API, - * you can construct the object by passing the `apiVersion` option to the - * constructor: - * - * ```javascript - * var iotdata = new AWS.IotData({ - * endpoint: 'my.host.tld', - * apiVersion: '2015-05-28' - * }); - * ``` - * - * You can also set the API version globally in `AWS.config.apiVersions` using - * the **iotdata** service identifier: - * - * ```javascript - * AWS.config.apiVersions = { - * iotdata: '2015-05-28', - * // other service API versions - * }; - * - * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); - * ``` - * - * @note You *must* provide an `endpoint` configuration parameter when - * constructing this service. See {constructor} for more information. - * - * @!method constructor(options = {}) - * Constructs a service object. This object has one method for each - * API operation. - * - * @example Constructing a IotData object - * var iotdata = new AWS.IotData({endpoint: 'my.host.tld'}); - * @note You *must* provide an `endpoint` when constructing this service. - * @option (see AWS.Config.constructor) - * - * @service iotdata - * @version 2015-05-28 - */ -AWS.util.update(AWS.IotData.prototype, { - /** - * @api private - */ - validateService: function validateService() { - if (!this.config.endpoint || this.config.endpoint.indexOf('{') >= 0) { - var msg = 'AWS.IotData requires an explicit ' + - '`endpoint\' configuration option.'; - throw AWS.util.error(new Error(), - {name: 'InvalidEndpoint', message: msg}); - } - }, - - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('validateResponse', this.validateResponseBody); - if (blobPayloadOutputOps.indexOf(request.operation) > -1) { - request.addListener('extractData', AWS.util.convertPayloadToString); - } - }, - - /** - * @api private - */ - validateResponseBody: function validateResponseBody(resp) { - var body = resp.httpResponse.body.toString() || '{}'; - var bodyCheck = body.trim(); - if (!bodyCheck || bodyCheck.charAt(0) !== '{') { - resp.httpResponse.body = ''; + var bucket = req.params.Bucket || null; + if (req.operation === 'deleteBucket' && typeof bucket === 'string' && !resp.error) { + req.service.clearBucketRegionCache(bucket); + } else { + var headers = resp.httpResponse.headers || {}; + var region = headers['x-amz-bucket-region'] || null; + if (!region && req.operation === 'createBucket' && !resp.error) { + var createBucketConfiguration = req.params.CreateBucketConfiguration; + if (!createBucketConfiguration) { + region = 'us-east-1'; + } else if (createBucketConfiguration.LocationConstraint === 'EU') { + region = 'eu-west-1'; + } else { + region = createBucketConfiguration.LocationConstraint; } + } + if (region) { + if (bucket && region !== req.service.bucketRegionCache[bucket]) { + req.service.bucketRegionCache[bucket] = region; + } + } } + req.service.extractRequestIds(resp); + }, -}); - - -/***/ }), - -/***/ 8452: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); - -AWS.util.update(AWS.Lambda.prototype, { /** + * Extracts an error object from the http response. + * * @api private */ - setupRequestListeners: function setupRequestListeners(request) { - if (request.operation === 'invoke') { - request.addListener('extractData', AWS.util.convertPayloadToString); - } - } -}); - + extractError: function extractError(resp) { + var codes = { + 304: 'NotModified', + 403: 'Forbidden', + 400: 'BadRequest', + 404: 'NotFound' + }; + var req = resp.request; + var code = resp.httpResponse.statusCode; + var body = resp.httpResponse.body || ''; -/***/ }), + var headers = resp.httpResponse.headers || {}; + var region = headers['x-amz-bucket-region'] || null; + var bucket = req.params.Bucket || null; + var bucketRegionCache = req.service.bucketRegionCache; + if (region && bucket && region !== bucketRegionCache[bucket]) { + bucketRegionCache[bucket] = region; + } -/***/ 19174: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + var cachedRegion; + if (codes[code] && body.length === 0) { + if (bucket && !region) { + cachedRegion = bucketRegionCache[bucket] || null; + if (cachedRegion !== req.httpRequest.region) { + region = cachedRegion; + } + } + resp.error = AWS.util.error(new Error(), { + code: codes[code], + message: null, + region: region + }); + } else { + var data = new AWS.XML.Parser().parse(body.toString()); -var AWS = __nccwpck_require__(28437); + if (data.Region && !region) { + region = data.Region; + if (bucket && region !== bucketRegionCache[bucket]) { + bucketRegionCache[bucket] = region; + } + } else if (bucket && !region && !data.Region) { + cachedRegion = bucketRegionCache[bucket] || null; + if (cachedRegion !== req.httpRequest.region) { + region = cachedRegion; + } + } -AWS.util.update(AWS.MachineLearning.prototype, { - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - if (request.operation === 'predict') { - request.addListener('build', this.buildEndpoint); + resp.error = AWS.util.error(new Error(), { + code: data.Code || code, + message: data.Message || null, + region: region + }); } + req.service.extractRequestIds(resp); }, /** - * Updates request endpoint from PredictEndpoint + * If region was not obtained synchronously, then send async request + * to get bucket region for errors resulting from wrong region. + * * @api private */ - buildEndpoint: function buildEndpoint(request) { - var url = request.params.PredictEndpoint; - if (url) { - request.httpRequest.endpoint = new AWS.Endpoint(url); - } - } - -}); - - -/***/ }), - -/***/ 73090: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); -var rdsutil = __nccwpck_require__(30650); - -/** -* @api private -*/ -var crossRegionOperations = ['createDBCluster', 'copyDBClusterSnapshot']; + requestBucketRegion: function requestBucketRegion(resp, done) { + var error = resp.error; + var req = resp.request; + var bucket = req.params.Bucket || null; -AWS.util.update(AWS.Neptune.prototype, { - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - if ( - crossRegionOperations.indexOf(request.operation) !== -1 && - this.config.params && - this.config.params.SourceRegion && - request.params && - !request.params.SourceRegion - ) { - request.params.SourceRegion = this.config.params.SourceRegion; + if (!error || !bucket || error.region || req.operation === 'listObjects' || + (AWS.util.isNode() && req.operation === 'headBucket') || + (error.statusCode === 400 && req.operation !== 'headObject') || + regionRedirectErrorCodes.indexOf(error.code) === -1) { + return done(); } - rdsutil.setupRequestListeners(this, request, crossRegionOperations); - }, -}); - - -/***/ }), - -/***/ 53199: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -__nccwpck_require__(44086); - - -/***/ }), - -/***/ 71928: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); -var rdsutil = __nccwpck_require__(30650); -__nccwpck_require__(16612); - /** - * @api private - */ - var crossRegionOperations = ['copyDBSnapshot', 'createDBInstanceReadReplica', 'createDBCluster', 'copyDBClusterSnapshot', 'startDBInstanceAutomatedBackupsReplication']; + var reqOperation = AWS.util.isNode() ? 'headBucket' : 'listObjects'; + var reqParams = {Bucket: bucket}; + if (reqOperation === 'listObjects') reqParams.MaxKeys = 0; + var regionReq = req.service[reqOperation](reqParams); + regionReq._requestRegionForBucket = bucket; + regionReq.send(function() { + var region = req.service.bucketRegionCache[bucket] || null; + error.region = region; + done(); + }); + }, - AWS.util.update(AWS.RDS.prototype, { /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - rdsutil.setupRequestListeners(this, request, crossRegionOperations); - }, - }); - + * For browser only. If NetworkingError received, will attempt to obtain + * the bucket region. + * + * @api private + */ + reqRegionForNetworkingError: function reqRegionForNetworkingError(resp, done) { + if (!AWS.util.isBrowser()) { + return done(); + } + var error = resp.error; + var request = resp.request; + var bucket = request.params.Bucket; + if (!error || error.code !== 'NetworkingError' || !bucket || + request.httpRequest.region === 'us-east-1') { + return done(); + } + var service = request.service; + var bucketRegionCache = service.bucketRegionCache; + var cachedRegion = bucketRegionCache[bucket] || null; -/***/ }), + if (cachedRegion && cachedRegion !== request.httpRequest.region) { + service.updateReqBucketRegion(request, cachedRegion); + done(); + } else if (!s3util.dnsCompatibleBucketName(bucket)) { + service.updateReqBucketRegion(request, 'us-east-1'); + if (bucketRegionCache[bucket] !== 'us-east-1') { + bucketRegionCache[bucket] = 'us-east-1'; + } + done(); + } else if (request.httpRequest.virtualHostedBucket) { + var getRegionReq = service.listObjects({Bucket: bucket, MaxKeys: 0}); + service.updateReqBucketRegion(getRegionReq, 'us-east-1'); + getRegionReq._requestRegionForBucket = bucket; -/***/ 64070: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + getRegionReq.send(function() { + var region = service.bucketRegionCache[bucket] || null; + if (region && region !== request.httpRequest.region) { + service.updateReqBucketRegion(request, region); + } + done(); + }); + } else { + // DNS-compatible path-style + // (s3ForcePathStyle or bucket name with dot over https) + // Cannot obtain region information for this case + done(); + } + }, -var AWS = __nccwpck_require__(28437); + /** + * Cache for bucket region. + * + * @api private + */ + bucketRegionCache: {}, -AWS.util.update(AWS.RDSDataService.prototype, { /** - * @return [Boolean] whether the error can be retried + * Clears bucket region cache. + * * @api private */ - retryableError: function retryableError(error) { - if (error.code === 'BadRequestException' && - error.message && - error.message.match(/^Communications link failure/) && - error.statusCode === 400) { - return true; - } else { - var _super = AWS.Service.prototype.retryableError; - return _super.call(this, error); + clearBucketRegionCache: function(buckets) { + var bucketRegionCache = this.bucketRegionCache; + if (!buckets) { + buckets = Object.keys(bucketRegionCache); + } else if (typeof buckets === 'string') { + buckets = [buckets]; } - } -}); - - -/***/ }), - -/***/ 30650: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); + for (var i = 0; i < buckets.length; i++) { + delete bucketRegionCache[buckets[i]]; + } + return bucketRegionCache; + }, -var rdsutil = { - /** + /** + * Corrects request region if bucket's cached region is different + * * @api private */ - setupRequestListeners: function setupRequestListeners(service, request, crossRegionOperations) { - if (crossRegionOperations.indexOf(request.operation) !== -1 && - request.params.SourceRegion) { - request.params = AWS.util.copy(request.params); - if (request.params.PreSignedUrl || - request.params.SourceRegion === service.config.region) { - delete request.params.SourceRegion; - } else { - var doesParamValidation = !!service.config.paramValidation; - // remove the validate parameters listener so we can re-add it after we build the URL - if (doesParamValidation) { - request.removeListener('validate', AWS.EventListeners.Core.VALIDATE_PARAMETERS); - } - request.onAsync('validate', rdsutil.buildCrossRegionPresignedUrl); - if (doesParamValidation) { - request.addListener('validate', AWS.EventListeners.Core.VALIDATE_PARAMETERS); - } + correctBucketRegionFromCache: function correctBucketRegionFromCache(req) { + var bucket = req.params.Bucket || null; + if (bucket) { + var service = req.service; + var requestRegion = req.httpRequest.region; + var cachedRegion = service.bucketRegionCache[bucket]; + if (cachedRegion && cachedRegion !== requestRegion) { + service.updateReqBucketRegion(req, cachedRegion); } } }, /** + * Extracts S3 specific request ids from the http response. + * * @api private */ - buildCrossRegionPresignedUrl: function buildCrossRegionPresignedUrl(req, done) { - var config = AWS.util.copy(req.service.config); - config.region = req.params.SourceRegion; - delete req.params.SourceRegion; - delete config.endpoint; - // relevant params for the operation will already be in req.params - delete config.params; - config.signatureVersion = 'v4'; - var destinationRegion = req.service.config.region; - - var svc = new req.service.constructor(config); - var newReq = svc[req.operation](AWS.util.copy(req.params)); - newReq.on('build', function addDestinationRegionParam(request) { - var httpRequest = request.httpRequest; - httpRequest.params.DestinationRegion = destinationRegion; - httpRequest.body = AWS.util.queryParamsToString(httpRequest.params); - }); - newReq.presign(function(err, url) { - if (err) done(err); - else { - req.params.PreSignedUrl = url; - done(); - } - }); - } -}; - -/** - * @api private - */ -module.exports = rdsutil; + extractRequestIds: function extractRequestIds(resp) { + var extendedRequestId = resp.httpResponse.headers ? resp.httpResponse.headers['x-amz-id-2'] : null; + var cfId = resp.httpResponse.headers ? resp.httpResponse.headers['x-amz-cf-id'] : null; + resp.extendedRequestId = extendedRequestId; + resp.cfId = cfId; + if (resp.error) { + resp.error.requestId = resp.requestId || null; + resp.error.extendedRequestId = extendedRequestId; + resp.error.cfId = cfId; + } + }, -/***/ }), + /** + * Get a pre-signed URL for a given operation name. + * + * @note You must ensure that you have static or previously resolved + * credentials if you call this method synchronously (with no callback), + * otherwise it may not properly sign the request. If you cannot guarantee + * this (you are using an asynchronous credential provider, i.e., EC2 + * IAM roles), you should always call this method with an asynchronous + * callback. + * @note Not all operation parameters are supported when using pre-signed + * URLs. Certain parameters, such as `SSECustomerKey`, `ACL`, `Expires`, + * `ContentLength`, or `Tagging` must be provided as headers when sending a + * request. If you are using pre-signed URLs to upload from a browser and + * need to use these fields, see {createPresignedPost}. + * @note The default signer allows altering the request by adding corresponding + * headers to set some parameters (e.g. Range) and these added parameters + * won't be signed. You must use signatureVersion v4 to to include these + * parameters in the signed portion of the URL and enforce exact matching + * between headers and signed params in the URL. + * @note This operation cannot be used with a promise. See note above regarding + * asynchronous credentials and use with a callback. + * @param operation [String] the name of the operation to call + * @param params [map] parameters to pass to the operation. See the given + * operation for the expected operation parameters. In addition, you can + * also pass the "Expires" parameter to inform S3 how long the URL should + * work for. + * @option params Expires [Integer] (900) the number of seconds to expire + * the pre-signed URL operation in. Defaults to 15 minutes. + * @param callback [Function] if a callback is provided, this function will + * pass the URL as the second parameter (after the error parameter) to + * the callback function. + * @return [String] if called synchronously (with no callback), returns the + * signed URL. + * @return [null] nothing is returned if a callback is provided. + * @example Pre-signing a getObject operation (synchronously) + * var params = {Bucket: 'bucket', Key: 'key'}; + * var url = s3.getSignedUrl('getObject', params); + * console.log('The URL is', url); + * @example Pre-signing a putObject (asynchronously) + * var params = {Bucket: 'bucket', Key: 'key'}; + * s3.getSignedUrl('putObject', params, function (err, url) { + * console.log('The URL is', url); + * }); + * @example Pre-signing a putObject operation with a specific payload + * var params = {Bucket: 'bucket', Key: 'key', Body: 'body'}; + * var url = s3.getSignedUrl('putObject', params); + * console.log('The URL is', url); + * @example Passing in a 1-minute expiry time for a pre-signed URL + * var params = {Bucket: 'bucket', Key: 'key', Expires: 60}; + * var url = s3.getSignedUrl('getObject', params); + * console.log('The URL is', url); // expires in 60 seconds + */ + getSignedUrl: function getSignedUrl(operation, params, callback) { + params = AWS.util.copy(params || {}); + var expires = params.Expires || 900; -/***/ 69627: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + if (typeof expires !== 'number') { + throw AWS.util.error(new Error(), + { code: 'InvalidParameterException', message: 'The expiration must be a number, received ' + typeof expires }); + } -var AWS = __nccwpck_require__(28437); + delete params.Expires; // we can't validate this + var request = this.makeRequest(operation, params); -AWS.util.update(AWS.Route53.prototype, { - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - request.on('build', this.sanitizeUrl); + if (callback) { + AWS.util.defer(function() { + request.presign(expires, callback); + }); + } else { + return request.presign(expires, callback); + } }, /** - * @api private + * @!method getSignedUrlPromise() + * Returns a 'thenable' promise that will be resolved with a pre-signed URL + * for a given operation name. + * + * Two callbacks can be provided to the `then` method on the returned promise. + * The first callback will be called if the promise is fulfilled, and the second + * callback will be called if the promise is rejected. + * @note Not all operation parameters are supported when using pre-signed + * URLs. Certain parameters, such as `SSECustomerKey`, `ACL`, `Expires`, + * `ContentLength`, or `Tagging` must be provided as headers when sending a + * request. If you are using pre-signed URLs to upload from a browser and + * need to use these fields, see {createPresignedPost}. + * @param operation [String] the name of the operation to call + * @param params [map] parameters to pass to the operation. See the given + * operation for the expected operation parameters. In addition, you can + * also pass the "Expires" parameter to inform S3 how long the URL should + * work for. + * @option params Expires [Integer] (900) the number of seconds to expire + * the pre-signed URL operation in. Defaults to 15 minutes. + * @callback fulfilledCallback function(url) + * Called if the promise is fulfilled. + * @param url [String] the signed url + * @callback rejectedCallback function(err) + * Called if the promise is rejected. + * @param err [Error] if an error occurred, this value will be filled + * @return [Promise] A promise that represents the state of the `refresh` call. + * @example Pre-signing a getObject operation + * var params = {Bucket: 'bucket', Key: 'key'}; + * var promise = s3.getSignedUrlPromise('getObject', params); + * promise.then(function(url) { + * console.log('The URL is', url); + * }, function(err) { ... }); + * @example Pre-signing a putObject operation with a specific payload + * var params = {Bucket: 'bucket', Key: 'key', Body: 'body'}; + * var promise = s3.getSignedUrlPromise('putObject', params); + * promise.then(function(url) { + * console.log('The URL is', url); + * }, function(err) { ... }); + * @example Passing in a 1-minute expiry time for a pre-signed URL + * var params = {Bucket: 'bucket', Key: 'key', Expires: 60}; + * var promise = s3.getSignedUrlPromise('getObject', params); + * promise.then(function(url) { + * console.log('The URL is', url); + * }, function(err) { ... }); */ - sanitizeUrl: function sanitizeUrl(request) { - var path = request.httpRequest.path; - request.httpRequest.path = path.replace(/\/%2F\w+%2F/, '/'); - }, /** - * @return [Boolean] whether the error can be retried - * @api private + * Get a pre-signed POST policy to support uploading to S3 directly from an + * HTML form. + * + * @param params [map] + * @option params Bucket [String] The bucket to which the post should be + * uploaded + * @option params Expires [Integer] (3600) The number of seconds for which + * the presigned policy should be valid. + * @option params Conditions [Array] An array of conditions that must be met + * for the presigned policy to allow the + * upload. This can include required tags, + * the accepted range for content lengths, + * etc. + * @see http://docs.aws.amazon.com/AmazonS3/latest/API/sigv4-HTTPPOSTConstructPolicy.html + * @option params Fields [map] Fields to include in the form. All + * values passed in as fields will be + * signed as exact match conditions. + * @param callback [Function] + * + * @note All fields passed in when creating presigned post data will be signed + * as exact match conditions. Any fields that will be interpolated by S3 + * must be added to the fields hash after signing, and an appropriate + * condition for such fields must be explicitly added to the Conditions + * array passed to this function before signing. + * + * @example Presiging post data with a known key + * var params = { + * Bucket: 'bucket', + * Fields: { + * key: 'key' + * } + * }; + * s3.createPresignedPost(params, function(err, data) { + * if (err) { + * console.error('Presigning post data encountered an error', err); + * } else { + * console.log('The post data is', data); + * } + * }); + * + * @example Presigning post data with an interpolated key + * var params = { + * Bucket: 'bucket', + * Conditions: [ + * ['starts-with', '$key', 'path/to/uploads/'] + * ] + * }; + * s3.createPresignedPost(params, function(err, data) { + * if (err) { + * console.error('Presigning post data encountered an error', err); + * } else { + * data.Fields.key = 'path/to/uploads/${filename}'; + * console.log('The post data is', data); + * } + * }); + * + * @note You must ensure that you have static or previously resolved + * credentials if you call this method synchronously (with no callback), + * otherwise it may not properly sign the request. If you cannot guarantee + * this (you are using an asynchronous credential provider, i.e., EC2 + * IAM roles), you should always call this method with an asynchronous + * callback. + * + * @return [map] If called synchronously (with no callback), returns a hash + * with the url to set as the form action and a hash of fields + * to include in the form. + * @return [null] Nothing is returned if a callback is provided. + * + * @callback callback function (err, data) + * @param err [Error] the error object returned from the policy signer + * @param data [map] The data necessary to construct an HTML form + * @param data.url [String] The URL to use as the action of the form + * @param data.fields [map] A hash of fields that must be included in the + * form for the upload to succeed. This hash will + * include the signed POST policy, your access key + * ID and security token (if present), etc. These + * may be safely included as input elements of type + * 'hidden.' */ - retryableError: function retryableError(error) { - if (error.code === 'PriorRequestNotComplete' && - error.statusCode === 400) { - return true; - } else { - var _super = AWS.Service.prototype.retryableError; - return _super.call(this, error); + createPresignedPost: function createPresignedPost(params, callback) { + if (typeof params === 'function' && callback === undefined) { + callback = params; + params = null; } - } -}); + params = AWS.util.copy(params || {}); + var boundParams = this.config.params || {}; + var bucket = params.Bucket || boundParams.Bucket, + self = this, + config = this.config, + endpoint = AWS.util.copy(this.endpoint); + if (!config.s3BucketEndpoint) { + endpoint.pathname = '/' + bucket; + } -/***/ }), + function finalizePost() { + return { + url: AWS.util.urlFormat(endpoint), + fields: self.preparePostFields( + config.credentials, + config.region, + bucket, + params.Fields, + params.Conditions, + params.Expires + ) + }; + } -/***/ 26543: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + if (callback) { + config.getCredentials(function (err) { + if (err) { + callback(err); + } else { + try { + callback(null, finalizePost()); + } catch (err) { + callback(err); + } + } + }); + } else { + return finalizePost(); + } + }, -var AWS = __nccwpck_require__(28437); -var v4Credentials = __nccwpck_require__(62660); -var resolveRegionalEndpointsFlag = __nccwpck_require__(85566); -var s3util = __nccwpck_require__(35895); -var regionUtil = __nccwpck_require__(18262); + /** + * @api private + */ + preparePostFields: function preparePostFields( + credentials, + region, + bucket, + fields, + conditions, + expiresInSeconds + ) { + var now = this.getSkewCorrectedDate(); + if (!credentials || !region || !bucket) { + throw new Error('Unable to create a POST object policy without a bucket,' + + ' region, and credentials'); + } + fields = AWS.util.copy(fields || {}); + conditions = (conditions || []).slice(0); + expiresInSeconds = expiresInSeconds || 3600; -// Pull in managed upload extension -__nccwpck_require__(81600); + var signingDate = AWS.util.date.iso8601(now).replace(/[:\-]|\.\d{3}/g, ''); + var shortDate = signingDate.substr(0, 8); + var scope = v4Credentials.createScope(shortDate, region, 's3'); + var credential = credentials.accessKeyId + '/' + scope; -/** - * @api private - */ -var operationsWith200StatusCodeError = { - 'completeMultipartUpload': true, - 'copyObject': true, - 'uploadPartCopy': true -}; + fields['bucket'] = bucket; + fields['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256'; + fields['X-Amz-Credential'] = credential; + fields['X-Amz-Date'] = signingDate; + if (credentials.sessionToken) { + fields['X-Amz-Security-Token'] = credentials.sessionToken; + } + for (var field in fields) { + if (fields.hasOwnProperty(field)) { + var condition = {}; + condition[field] = fields[field]; + conditions.push(condition); + } + } -/** - * @api private - */ - var regionRedirectErrorCodes = [ - 'AuthorizationHeaderMalformed', // non-head operations on virtual-hosted global bucket endpoints - 'BadRequest', // head operations on virtual-hosted global bucket endpoints - 'PermanentRedirect', // non-head operations on path-style or regional endpoints - 301 // head operations on path-style or regional endpoints - ]; + fields.Policy = this.preparePostPolicy( + new Date(now.valueOf() + expiresInSeconds * 1000), + conditions + ); + fields['X-Amz-Signature'] = AWS.util.crypto.hmac( + v4Credentials.getSigningKey(credentials, shortDate, region, 's3', true), + fields.Policy, + 'hex' + ); -var OBJECT_LAMBDA_SERVICE = 's3-object-lambda'; + return fields; + }, -AWS.util.update(AWS.S3.prototype, { /** * @api private */ - getSignatureVersion: function getSignatureVersion(request) { - var defaultApiVersion = this.api.signatureVersion; - var userDefinedVersion = this._originalConfig ? this._originalConfig.signatureVersion : null; - var regionDefinedVersion = this.config.signatureVersion; - var isPresigned = request ? request.isPresigned() : false; - /* - 1) User defined version specified: - a) always return user defined version - 2) No user defined version specified: - a) If not using presigned urls, default to V4 - b) If using presigned urls, default to lowest version the region supports - */ - if (userDefinedVersion) { - userDefinedVersion = userDefinedVersion === 'v2' ? 's3' : userDefinedVersion; - return userDefinedVersion; - } - if (isPresigned !== true) { - defaultApiVersion = 'v4'; - } else if (regionDefinedVersion) { - defaultApiVersion = regionDefinedVersion; - } - return defaultApiVersion; + preparePostPolicy: function preparePostPolicy(expiration, conditions) { + return AWS.util.base64.encode(JSON.stringify({ + expiration: AWS.util.date.iso8601(expiration), + conditions: conditions + })); }, /** * @api private */ - getSigningName: function getSigningName(req) { - if (req && req.operation === 'writeGetObjectResponse') { - return OBJECT_LAMBDA_SERVICE; + prepareSignedUrl: function prepareSignedUrl(request) { + request.addListener('validate', request.service.noPresignedContentLength); + request.removeListener('build', request.service.addContentType); + if (!request.params.Body) { + // no Content-MD5/SHA-256 if body is not provided + request.removeListener('build', request.service.computeContentMd5); + } else { + request.addListener('afterBuild', AWS.EventListeners.Core.COMPUTE_SHA256); } - - var _super = AWS.Service.prototype.getSigningName; - return (req && req._parsedArn && req._parsedArn.service) - ? req._parsedArn.service - : _super.call(this); }, /** * @api private + * @param request */ - getSignerClass: function getSignerClass(request) { - var signatureVersion = this.getSignatureVersion(request); - return AWS.Signers.RequestSigner.getVersion(signatureVersion); + disableBodySigning: function disableBodySigning(request) { + var headers = request.httpRequest.headers; + // Add the header to anything that isn't a presigned url, unless that presigned url had a body defined + if (!Object.prototype.hasOwnProperty.call(headers, 'presigned-expires')) { + headers['X-Amz-Content-Sha256'] = 'UNSIGNED-PAYLOAD'; + } }, /** * @api private */ - validateService: function validateService() { - var msg; - var messages = []; - - // default to us-east-1 when no region is provided - if (!this.config.region) this.config.region = 'us-east-1'; + noPresignedContentLength: function noPresignedContentLength(request) { + if (request.params.ContentLength !== undefined) { + throw AWS.util.error(new Error(), {code: 'UnexpectedParameter', + message: 'ContentLength is not supported in pre-signed URLs.'}); + } + }, - if (!this.config.endpoint && this.config.s3BucketEndpoint) { - messages.push('An endpoint must be provided when configuring ' + - '`s3BucketEndpoint` to true.'); + createBucket: function createBucket(params, callback) { + // When creating a bucket *outside* the classic region, the location + // constraint must be set for the bucket and it must match the endpoint. + // This chunk of code will set the location constraint param based + // on the region (when possible), but it will not override a passed-in + // location constraint. + if (typeof params === 'function' || !params) { + callback = callback || params; + params = {}; } - if (messages.length === 1) { - msg = messages[0]; - } else if (messages.length > 1) { - msg = 'Multiple configuration errors:\n' + messages.join('\n'); + var hostname = this.endpoint.hostname; + // copy params so that appending keys does not unintentioinallly + // mutate params object argument passed in by user + var copiedParams = AWS.util.copy(params); + + if (hostname !== this.api.globalEndpoint && !params.CreateBucketConfiguration) { + copiedParams.CreateBucketConfiguration = { LocationConstraint: this.config.region }; } - if (msg) { - throw AWS.util.error(new Error(), - {name: 'InvalidEndpoint', message: msg}); + return this.makeRequest('createBucket', copiedParams, callback); + }, + + writeGetObjectResponse: function writeGetObjectResponse(params, callback) { + + var request = this.makeRequest('writeGetObjectResponse', AWS.util.copy(params), callback); + var hostname = this.endpoint.hostname; + if (hostname.indexOf(this.config.region) !== -1) { + // hostname specifies a region already + hostname = hostname.replace('s3.', OBJECT_LAMBDA_SERVICE + '.'); + } else { + // Hostname doesn't have a region. + // Object Lambda requires an explicit region. + hostname = hostname.replace('s3.', OBJECT_LAMBDA_SERVICE + '.' + this.config.region + '.'); } + + request.httpRequest.endpoint = new AWS.Endpoint(hostname, this.config); + return request; }, /** - * @api private + * @see AWS.S3.ManagedUpload + * @overload upload(params = {}, [options], [callback]) + * Uploads an arbitrarily sized buffer, blob, or stream, using intelligent + * concurrent handling of parts if the payload is large enough. You can + * configure the concurrent queue size by setting `options`. Note that this + * is the only operation for which the SDK can retry requests with stream + * bodies. + * + * @param (see AWS.S3.putObject) + * @option (see AWS.S3.ManagedUpload.constructor) + * @return [AWS.S3.ManagedUpload] the managed upload object that can call + * `send()` or track progress. + * @example Uploading a stream object + * var params = {Bucket: 'bucket', Key: 'key', Body: stream}; + * s3.upload(params, function(err, data) { + * console.log(err, data); + * }); + * @example Uploading a stream with concurrency of 1 and partSize of 10mb + * var params = {Bucket: 'bucket', Key: 'key', Body: stream}; + * var options = {partSize: 10 * 1024 * 1024, queueSize: 1}; + * s3.upload(params, options, function(err, data) { + * console.log(err, data); + * }); + * @callback callback function(err, data) + * @param err [Error] an error or null if no error occurred. + * @param data [map] The response data from the successful upload: + * @param data.Location [String] the URL of the uploaded object + * @param data.ETag [String] the ETag of the uploaded object + * @param data.Bucket [String] the bucket to which the object was uploaded + * @param data.Key [String] the key to which the object was uploaded */ - shouldDisableBodySigning: function shouldDisableBodySigning(request) { - var signerClass = this.getSignerClass(); - if (this.config.s3DisableBodySigning === true && signerClass === AWS.Signers.V4 - && request.httpRequest.endpoint.protocol === 'https:') { - return true; + upload: function upload(params, options, callback) { + if (typeof options === 'function' && callback === undefined) { + callback = options; + options = null; } - return false; - }, + options = options || {}; + options = AWS.util.merge(options || {}, {service: this, params: params}); + + var uploader = new AWS.S3.ManagedUpload(options); + if (typeof callback === 'function') uploader.send(callback); + return uploader; + } +}); + +/** + * @api private + */ +AWS.S3.addPromisesToClass = function addPromisesToClass(PromiseDependency) { + this.prototype.getSignedUrlPromise = AWS.util.promisifyMethod('getSignedUrl', PromiseDependency); +}; + +/** + * @api private + */ +AWS.S3.deletePromisesFromClass = function deletePromisesFromClass() { + delete this.prototype.getSignedUrlPromise; +}; + +AWS.util.addPromises(AWS.S3); + + +/***/ }), + +/***/ 71207: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var s3util = __nccwpck_require__(35895); +var regionUtil = __nccwpck_require__(18262); + +AWS.util.update(AWS.S3Control.prototype, { /** * @api private */ setupRequestListeners: function setupRequestListeners(request) { - var prependListener = true; - request.addListener('validate', this.validateScheme); - request.addListener('validate', this.validateBucketName, prependListener); - request.addListener('validate', this.optInUsEast1RegionalEndpoint, prependListener); + request.addListener('extractError', this.extractHostId); + request.addListener('extractData', this.extractHostId); + request.addListener('validate', this.validateAccountId); - request.removeListener('validate', - AWS.EventListeners.Core.VALIDATE_REGION); - request.addListener('build', this.addContentType); - request.addListener('build', this.computeContentMd5); - request.addListener('build', this.computeSseCustomerKeyMd5); - request.addListener('build', this.populateURI); - request.addListener('afterBuild', this.addExpect100Continue); - request.addListener('extractError', this.extractError); - request.addListener('extractData', AWS.util.hoistPayloadMember); - request.addListener('extractData', this.extractData); - request.addListener('extractData', this.extractErrorFrom200Response); - request.addListener('beforePresign', this.prepareSignedUrl); - if (this.shouldDisableBodySigning(request)) { - request.removeListener('afterBuild', AWS.EventListeners.Core.COMPUTE_SHA256); - request.addListener('afterBuild', this.disableBodySigning); + var isArnInBucket = s3util.isArnInParam(request, 'Bucket'); + var isArnInName = s3util.isArnInParam(request, 'Name'); + + if (isArnInBucket) { + request._parsedArn = AWS.util.ARN.parse(request.params['Bucket']); + request.addListener('validate', this.validateOutpostsBucketArn); + request.addListener('validate', s3util.validateOutpostsArn); + request.addListener('afterBuild', this.addOutpostIdHeader); + } else if (isArnInName) { + request._parsedArn = AWS.util.ARN.parse(request.params['Name']); + request.addListener('validate', s3util.validateOutpostsAccessPointArn); + request.addListener('validate', s3util.validateOutpostsArn); + request.addListener('afterBuild', this.addOutpostIdHeader); } - //deal with ARNs supplied to Bucket - if (request.operation !== 'createBucket' && s3util.isArnInParam(request, 'Bucket')) { - // avoid duplicate parsing in the future - request._parsedArn = AWS.util.ARN.parse(request.params.Bucket); - request.removeListener('validate', this.validateBucketName); - request.removeListener('build', this.populateURI); - if (request._parsedArn.service === 's3') { - request.addListener('validate', s3util.validateS3AccessPointArn); - request.addListener('validate', this.validateArnResourceType); - request.addListener('validate', this.validateArnRegion); - } else if (request._parsedArn.service === 's3-outposts') { - request.addListener('validate', s3util.validateOutpostsAccessPointArn); - request.addListener('validate', s3util.validateOutpostsArn); - request.addListener('validate', s3util.validateArnRegion); - } + if (isArnInBucket || isArnInName) { + request.addListener('validate', this.validateArnRegion); + request.addListener('validate', this.validateArnAccountWithParams, true); request.addListener('validate', s3util.validateArnAccount); request.addListener('validate', s3util.validateArnService); - request.addListener('build', this.populateUriFromAccessPointArn); + request.addListener('build', this.populateParamFromArn, true); + request.addListener('build', this.populateUriFromArn); request.addListener('build', s3util.validatePopulateUriFromArn); - return; - } - //listeners regarding region inference - request.addListener('validate', this.validateBucketEndpoint); - request.addListener('validate', this.correctBucketRegionFromCache); - request.onAsync('extractError', this.requestBucketRegion); - if (AWS.util.isBrowser()) { - request.onAsync('retry', this.reqRegionForNetworkingError); } - }, - /** - * @api private - */ - validateScheme: function(req) { - var params = req.params, - scheme = req.httpRequest.endpoint.protocol, - sensitive = params.SSECustomerKey || params.CopySourceSSECustomerKey; - if (sensitive && scheme !== 'https:') { - var msg = 'Cannot send SSE keys over HTTP. Set \'sslEnabled\'' + - 'to \'true\' in your configuration'; - throw AWS.util.error(new Error(), - { code: 'ConfigError', message: msg }); + if (request.params.OutpostId && + (request.operation === 'createBucket' || + request.operation === 'listRegionalBuckets')) { + request.addListener('build', this.populateEndpointForOutpostId); } }, /** - * @api private + * Adds outpostId header */ - validateBucketEndpoint: function(req) { - if (!req.params.Bucket && req.service.config.s3BucketEndpoint) { - var msg = 'Cannot send requests to root API with `s3BucketEndpoint` set.'; - throw AWS.util.error(new Error(), - { code: 'ConfigError', message: msg }); - } + addOutpostIdHeader: function addOutpostIdHeader(req) { + req.httpRequest.headers['x-amz-outpost-id'] = req._parsedArn.outpostId; }, /** - * @api private + * Validate Outposts ARN supplied in Bucket parameter is a valid bucket name */ - validateArnRegion: function validateArnRegion(req) { - s3util.validateArnRegion(req, { allowFipsEndpoint: true }); - }, + validateOutpostsBucketArn: function validateOutpostsBucketArn(req) { + var parsedArn = req._parsedArn; - /** - * Validate resource-type supplied in S3 ARN - */ - validateArnResourceType: function validateArnResourceType(req) { - var resource = req._parsedArn.resource; + //can be ':' or '/' + var delimiter = parsedArn.resource['outpost'.length]; - if ( - resource.indexOf('accesspoint:') !== 0 && - resource.indexOf('accesspoint/') !== 0 - ) { + if (parsedArn.resource.split(delimiter).length !== 4) { throw AWS.util.error(new Error(), { code: 'InvalidARN', - message: 'ARN resource should begin with \'accesspoint/\'' + message: 'Bucket ARN should have two resources outpost/{outpostId}/bucket/{accesspointName}' }); } - }, - /** - * @api private - */ - validateBucketName: function validateBucketName(req) { - var service = req.service; - var signatureVersion = service.getSignatureVersion(req); - var bucket = req.params && req.params.Bucket; - var key = req.params && req.params.Key; - var slashIndex = bucket && bucket.indexOf('/'); - if (bucket && slashIndex >= 0) { - if (typeof key === 'string' && slashIndex > 0) { - req.params = AWS.util.copy(req.params); - // Need to include trailing slash to match sigv2 behavior - var prefix = bucket.substr(slashIndex + 1) || ''; - req.params.Key = prefix + '/' + key; - req.params.Bucket = bucket.substr(0, slashIndex); - } else if (signatureVersion === 'v4') { - var msg = 'Bucket names cannot contain forward slashes. Bucket: ' + bucket; - throw AWS.util.error(new Error(), - { code: 'InvalidBucket', message: msg }); - } + var bucket = parsedArn.resource.split(delimiter)[3]; + if (!s3util.dnsCompatibleBucketName(bucket) || bucket.match(/\./)) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Bucket ARN is not DNS compatible. Got ' + bucket + }); } + + //set parsed valid bucket + req._parsedArn.bucket = bucket; }, /** * @api private */ - isValidAccelerateOperation: function isValidAccelerateOperation(operation) { - var invalidOperations = [ - 'createBucket', - 'deleteBucket', - 'listBuckets' - ]; - return invalidOperations.indexOf(operation) === -1; + populateParamFromArn: function populateParamFromArn(req) { + var parsedArn = req._parsedArn; + if (s3util.isArnInParam(req, 'Bucket')) { + req.params.Bucket = parsedArn.bucket; + } else if (s3util.isArnInParam(req, 'Name')) { + req.params.Name = parsedArn.accessPoint; + } }, /** - * When us-east-1 region endpoint configuration is set, in stead of sending request to - * global endpoint(e.g. 's3.amazonaws.com'), we will send request to - * 's3.us-east-1.amazonaws.com'. - * @api private + * Populate URI according to the ARN */ - optInUsEast1RegionalEndpoint: function optInUsEast1RegionalEndpoint(req) { - var service = req.service; - var config = service.config; - config.s3UsEast1RegionalEndpoint = resolveRegionalEndpointsFlag(service._originalConfig, { - env: 'AWS_S3_US_EAST_1_REGIONAL_ENDPOINT', - sharedConfig: 's3_us_east_1_regional_endpoint', - clientConfig: 's3UsEast1RegionalEndpoint' - }); - if ( - !(service._originalConfig || {}).endpoint && - req.httpRequest.region === 'us-east-1' && - config.s3UsEast1RegionalEndpoint === 'regional' && - req.httpRequest.endpoint.hostname.indexOf('s3.amazonaws.com') >= 0 - ) { - var insertPoint = config.endpoint.indexOf('.amazonaws.com'); - regionalEndpoint = config.endpoint.substring(0, insertPoint) + - '.us-east-1' + config.endpoint.substring(insertPoint); - req.httpRequest.updateEndpoint(regionalEndpoint); - } + populateUriFromArn: function populateUriFromArn(req) { + var parsedArn = req._parsedArn; + + var endpoint = req.httpRequest.endpoint; + var useArnRegion = req.service.config.s3UseArnRegion; + var useFipsEndpoint = req.service.config.useFipsEndpoint; + + endpoint.hostname = [ + 's3-outposts' + (useFipsEndpoint ? '-fips': ''), + useArnRegion ? parsedArn.region : req.service.config.region, + 'amazonaws.com' + ].join('.'); + endpoint.host = endpoint.hostname; }, /** - * S3 prefers dns-compatible bucket names to be moved from the uri path - * to the hostname as a sub-domain. This is not possible, even for dns-compat - * buckets when using SSL and the bucket name contains a dot ('.'). The - * ssl wildcard certificate is only 1-level deep. - * * @api private */ - populateURI: function populateURI(req) { - var httpRequest = req.httpRequest; - var b = req.params.Bucket; - var service = req.service; - var endpoint = httpRequest.endpoint; - if (b) { - if (!service.pathStyleBucketName(b)) { - if (service.config.useAccelerateEndpoint && service.isValidAccelerateOperation(req.operation)) { - if (service.config.useDualstackEndpoint) { - endpoint.hostname = b + '.s3-accelerate.dualstack.amazonaws.com'; - } else { - endpoint.hostname = b + '.s3-accelerate.amazonaws.com'; - } - } else if (!service.config.s3BucketEndpoint) { - endpoint.hostname = - b + '.' + endpoint.hostname; - } - - var port = endpoint.port; - if (port !== 80 && port !== 443) { - endpoint.host = endpoint.hostname + ':' + - endpoint.port; - } else { - endpoint.host = endpoint.hostname; - } - - httpRequest.virtualHostedBucket = b; // needed for signing the request - service.removeVirtualHostedBucketFromPath(req); - } - } + populateEndpointForOutpostId: function populateEndpointForOutpostId(req) { + var endpoint = req.httpRequest.endpoint; + var useFipsEndpoint = req.service.config.useFipsEndpoint; + endpoint.hostname = [ + 's3-outposts' + (useFipsEndpoint ? '-fips': ''), + req.service.config.region, + 'amazonaws.com' + ].join('.'); + endpoint.host = endpoint.hostname; }, /** - * Takes the bucket name out of the path if bucket is virtual-hosted - * * @api private */ - removeVirtualHostedBucketFromPath: function removeVirtualHostedBucketFromPath(req) { - var httpRequest = req.httpRequest; - var bucket = httpRequest.virtualHostedBucket; - if (bucket && httpRequest.path) { - if (req.params && req.params.Key) { - var encodedS3Key = '/' + AWS.util.uriEscapePath(req.params.Key); - if (httpRequest.path.indexOf(encodedS3Key) === 0 && (httpRequest.path.length === encodedS3Key.length || httpRequest.path[encodedS3Key.length] === '?')) { - //path only contains key or path contains only key and querystring - return; - } - } - httpRequest.path = httpRequest.path.replace(new RegExp('/' + bucket), ''); - if (httpRequest.path[0] !== '/') { - httpRequest.path = '/' + httpRequest.path; - } + extractHostId: function(response) { + var hostId = response.httpResponse.headers ? response.httpResponse.headers['x-amz-id-2'] : null; + response.extendedRequestId = hostId; + if (response.error) { + response.error.extendedRequestId = hostId; } }, /** - * When user supply an access point ARN in the Bucket parameter, we need to - * populate the URI according to the ARN. + * @api private */ - populateUriFromAccessPointArn: function populateUriFromAccessPointArn(req) { - var accessPointArn = req._parsedArn; - - var isOutpostArn = accessPointArn.service === 's3-outposts'; - var isObjectLambdaArn = accessPointArn.service === 's3-object-lambda'; - - var outpostsSuffix = isOutpostArn ? '.' + accessPointArn.outpostId: ''; - var serviceName = isOutpostArn ? 's3-outposts': 's3-accesspoint'; - var fipsSuffix = !isOutpostArn && req.service.config.useFipsEndpoint ? '-fips': ''; - var dualStackSuffix = !isOutpostArn && - req.service.config.useDualstackEndpoint ? '.dualstack' : ''; - - var endpoint = req.httpRequest.endpoint; - var dnsSuffix = regionUtil.getEndpointSuffix(accessPointArn.region); - var useArnRegion = req.service.config.s3UseArnRegion; - - endpoint.hostname = [ - accessPointArn.accessPoint + '-' + accessPointArn.accountId + outpostsSuffix, - serviceName + fipsSuffix + dualStackSuffix, - useArnRegion ? accessPointArn.region : req.service.config.region, - dnsSuffix - ].join('.'); - - if (isObjectLambdaArn) { - // should be in the format: "accesspoint/${accesspointName}" - var serviceName = 's3-object-lambda'; - var accesspointName = accessPointArn.resource.split('/')[1]; - var fipsSuffix = req.service.config.useFipsEndpoint ? '-fips': ''; - endpoint.hostname = [ - accesspointName + '-' + accessPointArn.accountId, - serviceName + fipsSuffix, - useArnRegion ? accessPointArn.region : req.service.config.region, - dnsSuffix - ].join('.'); - } - endpoint.host = endpoint.hostname; - var encodedArn = AWS.util.uriEscape(req.params.Bucket); - var path = req.httpRequest.path; - //remove the Bucket value from path - req.httpRequest.path = path.replace(new RegExp('/' + encodedArn), ''); - if (req.httpRequest.path[0] !== '/') { - req.httpRequest.path = '/' + req.httpRequest.path; - } - req.httpRequest.region = accessPointArn.region; //region used to sign + validateArnRegion: function validateArnRegion(req) { + s3util.validateArnRegion(req, { allowFipsEndpoint: true }); }, /** - * Adds Expect: 100-continue header if payload is greater-or-equal 1MB * @api private */ - addExpect100Continue: function addExpect100Continue(req) { - var len = req.httpRequest.headers['Content-Length']; - if (AWS.util.isNode() && (len >= 1024 * 1024 || req.params.Body instanceof AWS.util.stream.Stream)) { - req.httpRequest.headers['Expect'] = '100-continue'; + validateArnAccountWithParams: function validateArnAccountWithParams(req) { + var params = req.params; + var inputModel = req.service.api.operations[req.operation].input; + if (inputModel.members.AccountId) { + var parsedArn = req._parsedArn; + if (parsedArn.accountId) { + if (params.AccountId) { + if (params.AccountId !== parsedArn.accountId) { + throw AWS.util.error( + new Error(), + {code: 'ValidationError', message: 'AccountId in ARN and request params should be same.'} + ); + } + } else { + // Store accountId from ARN in params + params.AccountId = parsedArn.accountId; + } + } } }, /** - * Adds a default content type if none is supplied. - * * @api private */ - addContentType: function addContentType(req) { - var httpRequest = req.httpRequest; - if (httpRequest.method === 'GET' || httpRequest.method === 'HEAD') { - // Content-Type is not set in GET/HEAD requests - delete httpRequest.headers['Content-Type']; - return; + validateAccountId: function(request) { + var params = request.params; + if (!Object.prototype.hasOwnProperty.call(params, 'AccountId')) return; + var accountId = params.AccountId; + //validate type + if (typeof accountId !== 'string') { + throw AWS.util.error( + new Error(), + {code: 'ValidationError', message: 'AccountId must be a string.'} + ); } - - if (!httpRequest.headers['Content-Type']) { // always have a Content-Type - httpRequest.headers['Content-Type'] = 'application/octet-stream'; + //validate length + if (accountId.length < 1 || accountId.length > 63) { + throw AWS.util.error( + new Error(), + {code: 'ValidationError', message: 'AccountId length should be between 1 to 63 characters, inclusive.'} + ); } - - var contentType = httpRequest.headers['Content-Type']; - if (AWS.util.isBrowser()) { - if (typeof httpRequest.body === 'string' && !contentType.match(/;\s*charset=/)) { - var charset = '; charset=UTF-8'; - httpRequest.headers['Content-Type'] += charset; - } else { - var replaceFn = function(_, prefix, charsetName) { - return prefix + charsetName.toUpperCase(); - }; - - httpRequest.headers['Content-Type'] = - contentType.replace(/(;\s*charset=)(.+)$/, replaceFn); - } + //validate pattern + var hostPattern = /^[a-zA-Z0-9]{1}$|^[a-zA-Z0-9][a-zA-Z0-9\-]*[a-zA-Z0-9]$/; + if (!hostPattern.test(accountId)) { + throw AWS.util.error(new Error(), + {code: 'ValidationError', message: 'AccountId should be hostname compatible. AccountId: ' + accountId}); } }, /** - * Checks whether checksums should be computed for the request if it's not - * already set by {AWS.EventListeners.Core.COMPUTE_CHECKSUM}. It depends on - * whether {AWS.Config.computeChecksums} is set. - * - * @param req [AWS.Request] the request to check against - * @return [Boolean] whether to compute checksums for a request. * @api private */ - willComputeChecksums: function willComputeChecksums(req) { - var rules = req.service.api.operations[req.operation].input.members; - var body = req.httpRequest.body; - var needsContentMD5 = req.service.config.computeChecksums && - rules.ContentMD5 && - !req.params.ContentMD5 && - body && - (AWS.util.Buffer.isBuffer(req.httpRequest.body) || typeof req.httpRequest.body === 'string'); - - // Sha256 signing disabled, and not a presigned url - if (needsContentMD5 && req.service.shouldDisableBodySigning(req) && !req.isPresigned()) { - return true; + getSigningName: function getSigningName(req) { + var _super = AWS.Service.prototype.getSigningName; + if (req && req._parsedArn && req._parsedArn.service) { + return req._parsedArn.service; + } else if (req.params.OutpostId && + (req.operation === 'createBucket' || + req.operation === 'listRegionalBuckets')) { + return 's3-outposts'; + } else { + return _super.call(this, req); } + }, +}); - // SigV2 and presign, for backwards compatibility purpose. - if (needsContentMD5 && this.getSignatureVersion(req) === 's3' && req.isPresigned()) { - return true; - } - return false; - }, +/***/ }), - /** - * A listener that computes the Content-MD5 and sets it in the header. - * This listener is to support S3-specific features like - * s3DisableBodySigning and SigV2 presign. Content MD5 logic for SigV4 is - * handled in AWS.EventListeners.Core.COMPUTE_CHECKSUM - * - * @api private - */ - computeContentMd5: function computeContentMd5(req) { - if (req.service.willComputeChecksums(req)) { - var md5 = AWS.util.crypto.md5(req.httpRequest.body, 'base64'); - req.httpRequest.headers['Content-MD5'] = md5; - } - }, +/***/ 35895: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var regionUtil = __nccwpck_require__(18262); +var s3util = { /** * @api private */ - computeSseCustomerKeyMd5: function computeSseCustomerKeyMd5(req) { - var keys = { - SSECustomerKey: 'x-amz-server-side-encryption-customer-key-MD5', - CopySourceSSECustomerKey: 'x-amz-copy-source-server-side-encryption-customer-key-MD5' - }; - AWS.util.each(keys, function(key, header) { - if (req.params[key]) { - var value = AWS.util.crypto.md5(req.params[key], 'base64'); - req.httpRequest.headers[header] = value; - } - }); + isArnInParam: function isArnInParam(req, paramName) { + var inputShape = (req.service.api.operations[req.operation] || {}).input || {}; + var inputMembers = inputShape.members || {}; + if (!req.params[paramName] || !inputMembers[paramName]) return false; + return AWS.util.ARN.validate(req.params[paramName]); }, /** - * Returns true if the bucket name should be left in the URI path for - * a request to S3. This function takes into account the current - * endpoint protocol (e.g. http or https). - * - * @api private + * Validate service component from ARN supplied in Bucket parameter */ - pathStyleBucketName: function pathStyleBucketName(bucketName) { - // user can force path style requests via the configuration - if (this.config.s3ForcePathStyle) return true; - if (this.config.s3BucketEndpoint) return false; + validateArnService: function validateArnService(req) { + var parsedArn = req._parsedArn; - if (s3util.dnsCompatibleBucketName(bucketName)) { - return (this.config.sslEnabled && bucketName.match(/\./)) ? true : false; - } else { - return true; // not dns compatible names must always use path style + if (parsedArn.service !== 's3' + && parsedArn.service !== 's3-outposts' + && parsedArn.service !== 's3-object-lambda') { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'expect \'s3\' or \'s3-outposts\' or \'s3-object-lambda\' in ARN service component' + }); } }, /** - * For COPY operations, some can be error even with status code 200. - * SDK treats the response as exception when response body indicates - * an exception or body is empty. - * - * @api private + * Validate account ID from ARN supplied in Bucket parameter is a valid account */ - extractErrorFrom200Response: function extractErrorFrom200Response(resp) { - if (!operationsWith200StatusCodeError[resp.request.operation]) return; - var httpResponse = resp.httpResponse; - if (httpResponse.body && httpResponse.body.toString().match('')) { - // Response body with '...' indicates an exception. - // Get S3 client object. In ManagedUpload, this.service refers to - // S3 client object. - resp.data = null; - var service = this.service ? this.service : this; - service.extractError(resp); - throw resp.error; - } else if (!httpResponse.body || !httpResponse.body.toString().match(/<[\w_]/)) { - // When body is empty or incomplete, S3 might stop the request on detecting client - // side aborting the request. - resp.data = null; + validateArnAccount: function validateArnAccount(req) { + var parsedArn = req._parsedArn; + + if (!/[0-9]{12}/.exec(parsedArn.accountId)) { throw AWS.util.error(new Error(), { - code: 'InternalError', - message: 'S3 aborted request' + code: 'InvalidARN', + message: 'ARN accountID does not match regex "[0-9]{12}"' }); } }, /** - * @return [Boolean] whether the error can be retried - * @api private + * Validate ARN supplied in Bucket parameter is a valid access point ARN */ - retryableError: function retryableError(error, request) { - if (operationsWith200StatusCodeError[request.operation] && - error.statusCode === 200) { - return true; - } else if (request._requestRegionForBucket && - request.service.bucketRegionCache[request._requestRegionForBucket]) { - return false; - } else if (error && error.code === 'RequestTimeout') { - return true; - } else if (error && - regionRedirectErrorCodes.indexOf(error.code) != -1 && - error.region && error.region != request.httpRequest.region) { - request.httpRequest.region = error.region; - if (error.statusCode === 301) { - request.service.updateReqBucketRegion(request); - } - return true; - } else { - var _super = AWS.Service.prototype.retryableError; - return _super.call(this, error, request); + validateS3AccessPointArn: function validateS3AccessPointArn(req) { + var parsedArn = req._parsedArn; + + //can be ':' or '/' + var delimiter = parsedArn.resource['accesspoint'.length]; + + if (parsedArn.resource.split(delimiter).length !== 2) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Access Point ARN should have one resource accesspoint/{accesspointName}' + }); + } + + var accessPoint = parsedArn.resource.split(delimiter)[1]; + var accessPointPrefix = accessPoint + '-' + parsedArn.accountId; + if (!s3util.dnsCompatibleBucketName(accessPointPrefix) || accessPointPrefix.match(/\./)) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Access point resource in ARN is not DNS compatible. Got ' + accessPoint + }); } + + //set parsed valid access point + req._parsedArn.accessPoint = accessPoint; }, /** - * Updates httpRequest with region. If region is not provided, then - * the httpRequest will be updated based on httpRequest.region - * - * @api private + * Validate Outposts ARN supplied in Bucket parameter is a valid outposts ARN */ - updateReqBucketRegion: function updateReqBucketRegion(request, region) { - var httpRequest = request.httpRequest; - if (typeof region === 'string' && region.length) { - httpRequest.region = region; - } - if (!httpRequest.endpoint.host.match(/s3(?!-accelerate).*\.amazonaws\.com$/)) { - return; - } - var service = request.service; - var s3Config = service.config; - var s3BucketEndpoint = s3Config.s3BucketEndpoint; - if (s3BucketEndpoint) { - delete s3Config.s3BucketEndpoint; - } - var newConfig = AWS.util.copy(s3Config); - delete newConfig.endpoint; - newConfig.region = httpRequest.region; + validateOutpostsArn: function validateOutpostsArn(req) { + var parsedArn = req._parsedArn; - httpRequest.endpoint = (new AWS.S3(newConfig)).endpoint; - service.populateURI(request); - s3Config.s3BucketEndpoint = s3BucketEndpoint; - httpRequest.headers.Host = httpRequest.endpoint.host; + if ( + parsedArn.resource.indexOf('outpost:') !== 0 && + parsedArn.resource.indexOf('outpost/') !== 0 + ) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'ARN resource should begin with \'outpost/\'' + }); + } - if (request._asm.currentState === 'validate') { - request.removeListener('build', service.populateURI); - request.addListener('build', service.removeVirtualHostedBucketFromPath); + //can be ':' or '/' + var delimiter = parsedArn.resource['outpost'.length]; + var outpostId = parsedArn.resource.split(delimiter)[1]; + var dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); + if (!dnsHostRegex.test(outpostId)) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Outpost resource in ARN is not DNS compatible. Got ' + outpostId + }); } + req._parsedArn.outpostId = outpostId; }, /** - * Provides a specialized parser for getBucketLocation -- all other - * operations are parsed by the super class. - * - * @api private + * Validate Outposts ARN supplied in Bucket parameter is a valid outposts ARN */ - extractData: function extractData(resp) { - var req = resp.request; - if (req.operation === 'getBucketLocation') { - var match = resp.httpResponse.body.toString().match(/>(.+)<\/Location/); - delete resp.data['_']; - if (match) { - resp.data.LocationConstraint = match[1]; - } else { - resp.data.LocationConstraint = ''; - } + validateOutpostsAccessPointArn: function validateOutpostsAccessPointArn(req) { + var parsedArn = req._parsedArn; + + //can be ':' or '/' + var delimiter = parsedArn.resource['outpost'.length]; + + if (parsedArn.resource.split(delimiter).length !== 4) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Outposts ARN should have two resources outpost/{outpostId}/accesspoint/{accesspointName}' + }); } - var bucket = req.params.Bucket || null; - if (req.operation === 'deleteBucket' && typeof bucket === 'string' && !resp.error) { - req.service.clearBucketRegionCache(bucket); - } else { - var headers = resp.httpResponse.headers || {}; - var region = headers['x-amz-bucket-region'] || null; - if (!region && req.operation === 'createBucket' && !resp.error) { - var createBucketConfiguration = req.params.CreateBucketConfiguration; - if (!createBucketConfiguration) { - region = 'us-east-1'; - } else if (createBucketConfiguration.LocationConstraint === 'EU') { - region = 'eu-west-1'; - } else { - region = createBucketConfiguration.LocationConstraint; - } - } - if (region) { - if (bucket && region !== req.service.bucketRegionCache[bucket]) { - req.service.bucketRegionCache[bucket] = region; - } - } + + var accessPoint = parsedArn.resource.split(delimiter)[3]; + var accessPointPrefix = accessPoint + '-' + parsedArn.accountId; + if (!s3util.dnsCompatibleBucketName(accessPointPrefix) || accessPointPrefix.match(/\./)) { + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: 'Access point resource in ARN is not DNS compatible. Got ' + accessPoint + }); } - req.service.extractRequestIds(resp); + + //set parsed valid access point + req._parsedArn.accessPoint = accessPoint; }, /** - * Extracts an error object from the http response. - * - * @api private + * Validate region field in ARN supplied in Bucket parameter is a valid region */ - extractError: function extractError(resp) { - var codes = { - 304: 'NotModified', - 403: 'Forbidden', - 400: 'BadRequest', - 404: 'NotFound' - }; + validateArnRegion: function validateArnRegion(req, options) { + if (options === undefined) { + options = {}; + } - var req = resp.request; - var code = resp.httpResponse.statusCode; - var body = resp.httpResponse.body || ''; + var useArnRegion = s3util.loadUseArnRegionConfig(req); + var regionFromArn = req._parsedArn.region; + var clientRegion = req.service.config.region; + var useFipsEndpoint = req.service.config.useFipsEndpoint; + var allowFipsEndpoint = options.allowFipsEndpoint || false; - var headers = resp.httpResponse.headers || {}; - var region = headers['x-amz-bucket-region'] || null; - var bucket = req.params.Bucket || null; - var bucketRegionCache = req.service.bucketRegionCache; - if (region && bucket && region !== bucketRegionCache[bucket]) { - bucketRegionCache[bucket] = region; + if (!regionFromArn) { + var message = 'ARN region is empty'; + if (req._parsedArn.service === 's3') { + message = message + '\nYou may want to use multi-regional ARN. The feature is not supported in current SDK. ' + + 'You should consider switching to V3(https://github.com/aws/aws-sdk-js-v3).'; + } + throw AWS.util.error(new Error(), { + code: 'InvalidARN', + message: message + }); } - var cachedRegion; - if (codes[code] && body.length === 0) { - if (bucket && !region) { - cachedRegion = bucketRegionCache[bucket] || null; - if (cachedRegion !== req.httpRequest.region) { - region = cachedRegion; - } - } - resp.error = AWS.util.error(new Error(), { - code: codes[code], - message: null, - region: region + if (useFipsEndpoint && !allowFipsEndpoint) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'ARN endpoint is not compatible with FIPS region' }); - } else { - var data = new AWS.XML.Parser().parse(body.toString()); + } - if (data.Region && !region) { - region = data.Region; - if (bucket && region !== bucketRegionCache[bucket]) { - bucketRegionCache[bucket] = region; - } - } else if (bucket && !region && !data.Region) { - cachedRegion = bucketRegionCache[bucket] || null; - if (cachedRegion !== req.httpRequest.region) { - region = cachedRegion; - } - } + if (regionFromArn.indexOf('fips') >= 0) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'FIPS region not allowed in ARN' + }); + } - resp.error = AWS.util.error(new Error(), { - code: data.Code || code, - message: data.Message || null, - region: region + if (!useArnRegion && regionFromArn !== clientRegion) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'Configured region conflicts with access point region' + }); + } else if ( + useArnRegion && + regionUtil.getEndpointSuffix(regionFromArn) !== regionUtil.getEndpointSuffix(clientRegion) + ) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'Configured region and access point region not in same partition' }); } - req.service.extractRequestIds(resp); - }, - /** - * If region was not obtained synchronously, then send async request - * to get bucket region for errors resulting from wrong region. - * - * @api private - */ - requestBucketRegion: function requestBucketRegion(resp, done) { - var error = resp.error; - var req = resp.request; - var bucket = req.params.Bucket || null; + if (req.service.config.useAccelerateEndpoint) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'useAccelerateEndpoint config is not supported with access point ARN' + }); + } - if (!error || !bucket || error.region || req.operation === 'listObjects' || - (AWS.util.isNode() && req.operation === 'headBucket') || - (error.statusCode === 400 && req.operation !== 'headObject') || - regionRedirectErrorCodes.indexOf(error.code) === -1) { - return done(); + if (req._parsedArn.service === 's3-outposts' && req.service.config.useDualstackEndpoint) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'Dualstack is not supported with outposts access point ARN' + }); } - var reqOperation = AWS.util.isNode() ? 'headBucket' : 'listObjects'; - var reqParams = {Bucket: bucket}; - if (reqOperation === 'listObjects') reqParams.MaxKeys = 0; - var regionReq = req.service[reqOperation](reqParams); - regionReq._requestRegionForBucket = bucket; - regionReq.send(function() { - var region = req.service.bucketRegionCache[bucket] || null; - error.region = region; - done(); - }); }, - /** - * For browser only. If NetworkingError received, will attempt to obtain - * the bucket region. - * - * @api private - */ - reqRegionForNetworkingError: function reqRegionForNetworkingError(resp, done) { - if (!AWS.util.isBrowser()) { - return done(); - } - var error = resp.error; - var request = resp.request; - var bucket = request.params.Bucket; - if (!error || error.code !== 'NetworkingError' || !bucket || - request.httpRequest.region === 'us-east-1') { - return done(); + loadUseArnRegionConfig: function loadUseArnRegionConfig(req) { + var envName = 'AWS_S3_USE_ARN_REGION'; + var configName = 's3_use_arn_region'; + var useArnRegion = true; + var originalConfig = req.service._originalConfig || {}; + if (req.service.config.s3UseArnRegion !== undefined) { + return req.service.config.s3UseArnRegion; + } else if (originalConfig.s3UseArnRegion !== undefined) { + useArnRegion = originalConfig.s3UseArnRegion === true; + } else if (AWS.util.isNode()) { + //load from environmental variable AWS_USE_ARN_REGION + if (process.env[envName]) { + var value = process.env[envName].trim().toLowerCase(); + if (['false', 'true'].indexOf(value) < 0) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: envName + ' only accepts true or false. Got ' + process.env[envName], + retryable: false + }); + } + useArnRegion = value === 'true'; + } else { //load from shared config property use_arn_region + var profiles = {}; + var profile = {}; + try { + profiles = AWS.util.getProfilesFromSharedConfig(AWS.util.iniLoader); + profile = profiles[process.env.AWS_PROFILE || AWS.util.defaultProfile]; + } catch (e) {} + if (profile[configName]) { + if (['false', 'true'].indexOf(profile[configName].trim().toLowerCase()) < 0) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: configName + ' only accepts true or false. Got ' + profile[configName], + retryable: false + }); + } + useArnRegion = profile[configName].trim().toLowerCase() === 'true'; + } + } } - var service = request.service; - var bucketRegionCache = service.bucketRegionCache; - var cachedRegion = bucketRegionCache[bucket] || null; + req.service.config.s3UseArnRegion = useArnRegion; + return useArnRegion; + }, - if (cachedRegion && cachedRegion !== request.httpRequest.region) { - service.updateReqBucketRegion(request, cachedRegion); - done(); - } else if (!s3util.dnsCompatibleBucketName(bucket)) { - service.updateReqBucketRegion(request, 'us-east-1'); - if (bucketRegionCache[bucket] !== 'us-east-1') { - bucketRegionCache[bucket] = 'us-east-1'; - } - done(); - } else if (request.httpRequest.virtualHostedBucket) { - var getRegionReq = service.listObjects({Bucket: bucket, MaxKeys: 0}); - service.updateReqBucketRegion(getRegionReq, 'us-east-1'); - getRegionReq._requestRegionForBucket = bucket; + /** + * Validations before URI can be populated + */ + validatePopulateUriFromArn: function validatePopulateUriFromArn(req) { + if (req.service._originalConfig && req.service._originalConfig.endpoint) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'Custom endpoint is not compatible with access point ARN' + }); + } - getRegionReq.send(function() { - var region = service.bucketRegionCache[bucket] || null; - if (region && region !== request.httpRequest.region) { - service.updateReqBucketRegion(request, region); - } - done(); + if (req.service.config.s3ForcePathStyle) { + throw AWS.util.error(new Error(), { + code: 'InvalidConfiguration', + message: 'Cannot construct path-style endpoint with access point' }); - } else { - // DNS-compatible path-style - // (s3ForcePathStyle or bucket name with dot over https) - // Cannot obtain region information for this case - done(); } - }, + }, /** - * Cache for bucket region. + * Returns true if the bucket name is DNS compatible. Buckets created + * outside of the classic region MUST be DNS compatible. * * @api private */ - bucketRegionCache: {}, + dnsCompatibleBucketName: function dnsCompatibleBucketName(bucketName) { + var b = bucketName; + var domain = new RegExp(/^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/); + var ipAddress = new RegExp(/(\d+\.){3}\d+/); + var dots = new RegExp(/\.\./); + return (b.match(domain) && !b.match(ipAddress) && !b.match(dots)) ? true : false; + }, +}; + +/** + * @api private + */ +module.exports = s3util; + + +/***/ }), + +/***/ 94571: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +AWS.util.update(AWS.SQS.prototype, { /** - * Clears bucket region cache. - * * @api private */ - clearBucketRegionCache: function(buckets) { - var bucketRegionCache = this.bucketRegionCache; - if (!buckets) { - buckets = Object.keys(bucketRegionCache); - } else if (typeof buckets === 'string') { - buckets = [buckets]; - } - for (var i = 0; i < buckets.length; i++) { - delete bucketRegionCache[buckets[i]]; - } - return bucketRegionCache; - }, + setupRequestListeners: function setupRequestListeners(request) { + request.addListener('build', this.buildEndpoint); - /** - * Corrects request region if bucket's cached region is different - * - * @api private - */ - correctBucketRegionFromCache: function correctBucketRegionFromCache(req) { - var bucket = req.params.Bucket || null; - if (bucket) { - var service = req.service; - var requestRegion = req.httpRequest.region; - var cachedRegion = service.bucketRegionCache[bucket]; - if (cachedRegion && cachedRegion !== requestRegion) { - service.updateReqBucketRegion(req, cachedRegion); + if (request.service.config.computeChecksums) { + if (request.operation === 'sendMessage') { + request.addListener('extractData', this.verifySendMessageChecksum); + } else if (request.operation === 'sendMessageBatch') { + request.addListener('extractData', this.verifySendMessageBatchChecksum); + } else if (request.operation === 'receiveMessage') { + request.addListener('extractData', this.verifyReceiveMessageChecksum); } } }, /** - * Extracts S3 specific request ids from the http response. - * * @api private */ - extractRequestIds: function extractRequestIds(resp) { - var extendedRequestId = resp.httpResponse.headers ? resp.httpResponse.headers['x-amz-id-2'] : null; - var cfId = resp.httpResponse.headers ? resp.httpResponse.headers['x-amz-cf-id'] : null; - resp.extendedRequestId = extendedRequestId; - resp.cfId = cfId; + verifySendMessageChecksum: function verifySendMessageChecksum(response) { + if (!response.data) return; - if (resp.error) { - resp.error.requestId = resp.requestId || null; - resp.error.extendedRequestId = extendedRequestId; - resp.error.cfId = cfId; + var md5 = response.data.MD5OfMessageBody; + var body = this.params.MessageBody; + var calculatedMd5 = this.service.calculateChecksum(body); + if (calculatedMd5 !== md5) { + var msg = 'Got "' + response.data.MD5OfMessageBody + + '", expecting "' + calculatedMd5 + '".'; + this.service.throwInvalidChecksumError(response, + [response.data.MessageId], msg); } }, /** - * Get a pre-signed URL for a given operation name. - * - * @note You must ensure that you have static or previously resolved - * credentials if you call this method synchronously (with no callback), - * otherwise it may not properly sign the request. If you cannot guarantee - * this (you are using an asynchronous credential provider, i.e., EC2 - * IAM roles), you should always call this method with an asynchronous - * callback. - * @note Not all operation parameters are supported when using pre-signed - * URLs. Certain parameters, such as `SSECustomerKey`, `ACL`, `Expires`, - * `ContentLength`, or `Tagging` must be provided as headers when sending a - * request. If you are using pre-signed URLs to upload from a browser and - * need to use these fields, see {createPresignedPost}. - * @note The default signer allows altering the request by adding corresponding - * headers to set some parameters (e.g. Range) and these added parameters - * won't be signed. You must use signatureVersion v4 to to include these - * parameters in the signed portion of the URL and enforce exact matching - * between headers and signed params in the URL. - * @note This operation cannot be used with a promise. See note above regarding - * asynchronous credentials and use with a callback. - * @param operation [String] the name of the operation to call - * @param params [map] parameters to pass to the operation. See the given - * operation for the expected operation parameters. In addition, you can - * also pass the "Expires" parameter to inform S3 how long the URL should - * work for. - * @option params Expires [Integer] (900) the number of seconds to expire - * the pre-signed URL operation in. Defaults to 15 minutes. - * @param callback [Function] if a callback is provided, this function will - * pass the URL as the second parameter (after the error parameter) to - * the callback function. - * @return [String] if called synchronously (with no callback), returns the - * signed URL. - * @return [null] nothing is returned if a callback is provided. - * @example Pre-signing a getObject operation (synchronously) - * var params = {Bucket: 'bucket', Key: 'key'}; - * var url = s3.getSignedUrl('getObject', params); - * console.log('The URL is', url); - * @example Pre-signing a putObject (asynchronously) - * var params = {Bucket: 'bucket', Key: 'key'}; - * s3.getSignedUrl('putObject', params, function (err, url) { - * console.log('The URL is', url); - * }); - * @example Pre-signing a putObject operation with a specific payload - * var params = {Bucket: 'bucket', Key: 'key', Body: 'body'}; - * var url = s3.getSignedUrl('putObject', params); - * console.log('The URL is', url); - * @example Passing in a 1-minute expiry time for a pre-signed URL - * var params = {Bucket: 'bucket', Key: 'key', Expires: 60}; - * var url = s3.getSignedUrl('getObject', params); - * console.log('The URL is', url); // expires in 60 seconds + * @api private */ - getSignedUrl: function getSignedUrl(operation, params, callback) { - params = AWS.util.copy(params || {}); - var expires = params.Expires || 900; + verifySendMessageBatchChecksum: function verifySendMessageBatchChecksum(response) { + if (!response.data) return; - if (typeof expires !== 'number') { - throw AWS.util.error(new Error(), - { code: 'InvalidParameterException', message: 'The expiration must be a number, received ' + typeof expires }); + var service = this.service; + var entries = {}; + var errors = []; + var messageIds = []; + AWS.util.arrayEach(response.data.Successful, function (entry) { + entries[entry.Id] = entry; + }); + AWS.util.arrayEach(this.params.Entries, function (entry) { + if (entries[entry.Id]) { + var md5 = entries[entry.Id].MD5OfMessageBody; + var body = entry.MessageBody; + if (!service.isChecksumValid(md5, body)) { + errors.push(entry.Id); + messageIds.push(entries[entry.Id].MessageId); + } + } + }); + + if (errors.length > 0) { + service.throwInvalidChecksumError(response, messageIds, + 'Invalid messages: ' + errors.join(', ')); } + }, - delete params.Expires; // we can't validate this - var request = this.makeRequest(operation, params); + /** + * @api private + */ + verifyReceiveMessageChecksum: function verifyReceiveMessageChecksum(response) { + if (!response.data) return; - if (callback) { - AWS.util.defer(function() { - request.presign(expires, callback); - }); - } else { - return request.presign(expires, callback); + var service = this.service; + var messageIds = []; + AWS.util.arrayEach(response.data.Messages, function(message) { + var md5 = message.MD5OfBody; + var body = message.Body; + if (!service.isChecksumValid(md5, body)) { + messageIds.push(message.MessageId); + } + }); + + if (messageIds.length > 0) { + service.throwInvalidChecksumError(response, messageIds, + 'Invalid messages: ' + messageIds.join(', ')); } }, /** - * @!method getSignedUrlPromise() - * Returns a 'thenable' promise that will be resolved with a pre-signed URL - * for a given operation name. - * - * Two callbacks can be provided to the `then` method on the returned promise. - * The first callback will be called if the promise is fulfilled, and the second - * callback will be called if the promise is rejected. - * @note Not all operation parameters are supported when using pre-signed - * URLs. Certain parameters, such as `SSECustomerKey`, `ACL`, `Expires`, - * `ContentLength`, or `Tagging` must be provided as headers when sending a - * request. If you are using pre-signed URLs to upload from a browser and - * need to use these fields, see {createPresignedPost}. - * @param operation [String] the name of the operation to call - * @param params [map] parameters to pass to the operation. See the given - * operation for the expected operation parameters. In addition, you can - * also pass the "Expires" parameter to inform S3 how long the URL should - * work for. - * @option params Expires [Integer] (900) the number of seconds to expire - * the pre-signed URL operation in. Defaults to 15 minutes. - * @callback fulfilledCallback function(url) - * Called if the promise is fulfilled. - * @param url [String] the signed url - * @callback rejectedCallback function(err) - * Called if the promise is rejected. - * @param err [Error] if an error occurred, this value will be filled - * @return [Promise] A promise that represents the state of the `refresh` call. - * @example Pre-signing a getObject operation - * var params = {Bucket: 'bucket', Key: 'key'}; - * var promise = s3.getSignedUrlPromise('getObject', params); - * promise.then(function(url) { - * console.log('The URL is', url); - * }, function(err) { ... }); - * @example Pre-signing a putObject operation with a specific payload - * var params = {Bucket: 'bucket', Key: 'key', Body: 'body'}; - * var promise = s3.getSignedUrlPromise('putObject', params); - * promise.then(function(url) { - * console.log('The URL is', url); - * }, function(err) { ... }); - * @example Passing in a 1-minute expiry time for a pre-signed URL - * var params = {Bucket: 'bucket', Key: 'key', Expires: 60}; - * var promise = s3.getSignedUrlPromise('getObject', params); - * promise.then(function(url) { - * console.log('The URL is', url); - * }, function(err) { ... }); + * @api private */ + throwInvalidChecksumError: function throwInvalidChecksumError(response, ids, message) { + response.error = AWS.util.error(new Error(), { + retryable: true, + code: 'InvalidChecksum', + messageIds: ids, + message: response.request.operation + + ' returned an invalid MD5 response. ' + message + }); + }, /** - * Get a pre-signed POST policy to support uploading to S3 directly from an - * HTML form. - * - * @param params [map] - * @option params Bucket [String] The bucket to which the post should be - * uploaded - * @option params Expires [Integer] (3600) The number of seconds for which - * the presigned policy should be valid. - * @option params Conditions [Array] An array of conditions that must be met - * for the presigned policy to allow the - * upload. This can include required tags, - * the accepted range for content lengths, - * etc. - * @see http://docs.aws.amazon.com/AmazonS3/latest/API/sigv4-HTTPPOSTConstructPolicy.html - * @option params Fields [map] Fields to include in the form. All - * values passed in as fields will be - * signed as exact match conditions. - * @param callback [Function] - * - * @note All fields passed in when creating presigned post data will be signed - * as exact match conditions. Any fields that will be interpolated by S3 - * must be added to the fields hash after signing, and an appropriate - * condition for such fields must be explicitly added to the Conditions - * array passed to this function before signing. - * - * @example Presiging post data with a known key - * var params = { - * Bucket: 'bucket', - * Fields: { - * key: 'key' - * } - * }; - * s3.createPresignedPost(params, function(err, data) { - * if (err) { - * console.error('Presigning post data encountered an error', err); - * } else { - * console.log('The post data is', data); - * } - * }); - * - * @example Presigning post data with an interpolated key - * var params = { - * Bucket: 'bucket', - * Conditions: [ - * ['starts-with', '$key', 'path/to/uploads/'] - * ] - * }; - * s3.createPresignedPost(params, function(err, data) { - * if (err) { - * console.error('Presigning post data encountered an error', err); - * } else { - * data.Fields.key = 'path/to/uploads/${filename}'; - * console.log('The post data is', data); - * } - * }); - * - * @note You must ensure that you have static or previously resolved - * credentials if you call this method synchronously (with no callback), - * otherwise it may not properly sign the request. If you cannot guarantee - * this (you are using an asynchronous credential provider, i.e., EC2 - * IAM roles), you should always call this method with an asynchronous - * callback. - * - * @return [map] If called synchronously (with no callback), returns a hash - * with the url to set as the form action and a hash of fields - * to include in the form. - * @return [null] Nothing is returned if a callback is provided. - * - * @callback callback function (err, data) - * @param err [Error] the error object returned from the policy signer - * @param data [map] The data necessary to construct an HTML form - * @param data.url [String] The URL to use as the action of the form - * @param data.fields [map] A hash of fields that must be included in the - * form for the upload to succeed. This hash will - * include the signed POST policy, your access key - * ID and security token (if present), etc. These - * may be safely included as input elements of type - * 'hidden.' + * @api private */ - createPresignedPost: function createPresignedPost(params, callback) { - if (typeof params === 'function' && callback === undefined) { - callback = params; - params = null; - } - - params = AWS.util.copy(params || {}); - var boundParams = this.config.params || {}; - var bucket = params.Bucket || boundParams.Bucket, - self = this, - config = this.config, - endpoint = AWS.util.copy(this.endpoint); - if (!config.s3BucketEndpoint) { - endpoint.pathname = '/' + bucket; - } - - function finalizePost() { - return { - url: AWS.util.urlFormat(endpoint), - fields: self.preparePostFields( - config.credentials, - config.region, - bucket, - params.Fields, - params.Conditions, - params.Expires - ) - }; - } + isChecksumValid: function isChecksumValid(checksum, data) { + return this.calculateChecksum(data) === checksum; + }, - if (callback) { - config.getCredentials(function (err) { - if (err) { - callback(err); - } else { - try { - callback(null, finalizePost()); - } catch (err) { - callback(err); - } - } - }); - } else { - return finalizePost(); - } + /** + * @api private + */ + calculateChecksum: function calculateChecksum(data) { + return AWS.util.crypto.md5(data, 'hex'); }, /** * @api private */ - preparePostFields: function preparePostFields( - credentials, - region, - bucket, - fields, - conditions, - expiresInSeconds - ) { - var now = this.getSkewCorrectedDate(); - if (!credentials || !region || !bucket) { - throw new Error('Unable to create a POST object policy without a bucket,' - + ' region, and credentials'); + buildEndpoint: function buildEndpoint(request) { + var url = request.httpRequest.params.QueueUrl; + if (url) { + request.httpRequest.endpoint = new AWS.Endpoint(url); + + // signature version 4 requires the region name to be set, + // sqs queue urls contain the region name + var matches = request.httpRequest.endpoint.host.match(/^sqs\.(.+?)\./); + if (matches) request.httpRequest.region = matches[1]; } - fields = AWS.util.copy(fields || {}); - conditions = (conditions || []).slice(0); - expiresInSeconds = expiresInSeconds || 3600; + } +}); - var signingDate = AWS.util.date.iso8601(now).replace(/[:\-]|\.\d{3}/g, ''); - var shortDate = signingDate.substr(0, 8); - var scope = v4Credentials.createScope(shortDate, region, 's3'); - var credential = credentials.accessKeyId + '/' + scope; - fields['bucket'] = bucket; - fields['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256'; - fields['X-Amz-Credential'] = credential; - fields['X-Amz-Date'] = signingDate; - if (credentials.sessionToken) { - fields['X-Amz-Security-Token'] = credentials.sessionToken; - } - for (var field in fields) { - if (fields.hasOwnProperty(field)) { - var condition = {}; - condition[field] = fields[field]; - conditions.push(condition); - } - } +/***/ }), - fields.Policy = this.preparePostPolicy( - new Date(now.valueOf() + expiresInSeconds * 1000), - conditions - ); - fields['X-Amz-Signature'] = AWS.util.crypto.hmac( - v4Credentials.getSigningKey(credentials, shortDate, region, 's3', true), - fields.Policy, - 'hex' - ); +/***/ 91055: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - return fields; +var AWS = __nccwpck_require__(28437); +var resolveRegionalEndpointsFlag = __nccwpck_require__(85566); +var ENV_REGIONAL_ENDPOINT_ENABLED = 'AWS_STS_REGIONAL_ENDPOINTS'; +var CONFIG_REGIONAL_ENDPOINT_ENABLED = 'sts_regional_endpoints'; + +AWS.util.update(AWS.STS.prototype, { + /** + * @overload credentialsFrom(data, credentials = null) + * Creates a credentials object from STS response data containing + * credentials information. Useful for quickly setting AWS credentials. + * + * @note This is a low-level utility function. If you want to load temporary + * credentials into your process for subsequent requests to AWS resources, + * you should use {AWS.TemporaryCredentials} instead. + * @param data [map] data retrieved from a call to {getFederatedToken}, + * {getSessionToken}, {assumeRole}, or {assumeRoleWithWebIdentity}. + * @param credentials [AWS.Credentials] an optional credentials object to + * fill instead of creating a new object. Useful when modifying an + * existing credentials object from a refresh call. + * @return [AWS.TemporaryCredentials] the set of temporary credentials + * loaded from a raw STS operation response. + * @example Using credentialsFrom to load global AWS credentials + * var sts = new AWS.STS(); + * sts.getSessionToken(function (err, data) { + * if (err) console.log("Error getting credentials"); + * else { + * AWS.config.credentials = sts.credentialsFrom(data); + * } + * }); + * @see AWS.TemporaryCredentials + */ + credentialsFrom: function credentialsFrom(data, credentials) { + if (!data) return null; + if (!credentials) credentials = new AWS.TemporaryCredentials(); + credentials.expired = false; + credentials.accessKeyId = data.Credentials.AccessKeyId; + credentials.secretAccessKey = data.Credentials.SecretAccessKey; + credentials.sessionToken = data.Credentials.SessionToken; + credentials.expireTime = data.Credentials.Expiration; + return credentials; }, - /** - * @api private - */ - preparePostPolicy: function preparePostPolicy(expiration, conditions) { - return AWS.util.base64.encode(JSON.stringify({ - expiration: AWS.util.date.iso8601(expiration), - conditions: conditions - })); + assumeRoleWithWebIdentity: function assumeRoleWithWebIdentity(params, callback) { + return this.makeUnauthenticatedRequest('assumeRoleWithWebIdentity', params, callback); }, - /** - * @api private - */ - prepareSignedUrl: function prepareSignedUrl(request) { - request.addListener('validate', request.service.noPresignedContentLength); - request.removeListener('build', request.service.addContentType); - if (!request.params.Body) { - // no Content-MD5/SHA-256 if body is not provided - request.removeListener('build', request.service.computeContentMd5); - } else { - request.addListener('afterBuild', AWS.EventListeners.Core.COMPUTE_SHA256); - } + assumeRoleWithSAML: function assumeRoleWithSAML(params, callback) { + return this.makeUnauthenticatedRequest('assumeRoleWithSAML', params, callback); }, /** * @api private - * @param request */ - disableBodySigning: function disableBodySigning(request) { - var headers = request.httpRequest.headers; - // Add the header to anything that isn't a presigned url, unless that presigned url had a body defined - if (!Object.prototype.hasOwnProperty.call(headers, 'presigned-expires')) { - headers['X-Amz-Content-Sha256'] = 'UNSIGNED-PAYLOAD'; - } + setupRequestListeners: function setupRequestListeners(request) { + request.addListener('validate', this.optInRegionalEndpoint, true); }, /** * @api private */ - noPresignedContentLength: function noPresignedContentLength(request) { - if (request.params.ContentLength !== undefined) { - throw AWS.util.error(new Error(), {code: 'UnexpectedParameter', - message: 'ContentLength is not supported in pre-signed URLs.'}); - } - }, - - createBucket: function createBucket(params, callback) { - // When creating a bucket *outside* the classic region, the location - // constraint must be set for the bucket and it must match the endpoint. - // This chunk of code will set the location constraint param based - // on the region (when possible), but it will not override a passed-in - // location constraint. - if (typeof params === 'function' || !params) { - callback = callback || params; - params = {}; - } - var hostname = this.endpoint.hostname; - // copy params so that appending keys does not unintentioinallly - // mutate params object argument passed in by user - var copiedParams = AWS.util.copy(params); - - if (hostname !== this.api.globalEndpoint && !params.CreateBucketConfiguration) { - copiedParams.CreateBucketConfiguration = { LocationConstraint: this.config.region }; + optInRegionalEndpoint: function optInRegionalEndpoint(req) { + var service = req.service; + var config = service.config; + config.stsRegionalEndpoints = resolveRegionalEndpointsFlag(service._originalConfig, { + env: ENV_REGIONAL_ENDPOINT_ENABLED, + sharedConfig: CONFIG_REGIONAL_ENDPOINT_ENABLED, + clientConfig: 'stsRegionalEndpoints' + }); + if ( + config.stsRegionalEndpoints === 'regional' && + service.isGlobalEndpoint + ) { + //client will throw if region is not supplied; request will be signed with specified region + if (!config.region) { + throw AWS.util.error(new Error(), + {code: 'ConfigError', message: 'Missing region in config'}); + } + var insertPoint = config.endpoint.indexOf('.amazonaws.com'); + var regionalEndpoint = config.endpoint.substring(0, insertPoint) + + '.' + config.region + config.endpoint.substring(insertPoint); + req.httpRequest.updateEndpoint(regionalEndpoint); + req.httpRequest.region = config.region; } - return this.makeRequest('createBucket', copiedParams, callback); - }, + } - writeGetObjectResponse: function writeGetObjectResponse(params, callback) { +}); - var request = this.makeRequest('writeGetObjectResponse', AWS.util.copy(params), callback); - var hostname = this.endpoint.hostname; - if (hostname.indexOf(this.config.region) !== -1) { - // hostname specifies a region already - hostname = hostname.replace('s3.', OBJECT_LAMBDA_SERVICE + '.'); - } else { - // Hostname doesn't have a region. - // Object Lambda requires an explicit region. - hostname = hostname.replace('s3.', OBJECT_LAMBDA_SERVICE + '.' + this.config.region + '.'); - } - request.httpRequest.endpoint = new AWS.Endpoint(hostname, this.config); - return request; - }, +/***/ }), - /** - * @see AWS.S3.ManagedUpload - * @overload upload(params = {}, [options], [callback]) - * Uploads an arbitrarily sized buffer, blob, or stream, using intelligent - * concurrent handling of parts if the payload is large enough. You can - * configure the concurrent queue size by setting `options`. Note that this - * is the only operation for which the SDK can retry requests with stream - * bodies. - * - * @param (see AWS.S3.putObject) - * @option (see AWS.S3.ManagedUpload.constructor) - * @return [AWS.S3.ManagedUpload] the managed upload object that can call - * `send()` or track progress. - * @example Uploading a stream object - * var params = {Bucket: 'bucket', Key: 'key', Body: stream}; - * s3.upload(params, function(err, data) { - * console.log(err, data); - * }); - * @example Uploading a stream with concurrency of 1 and partSize of 10mb - * var params = {Bucket: 'bucket', Key: 'key', Body: stream}; - * var options = {partSize: 10 * 1024 * 1024, queueSize: 1}; - * s3.upload(params, options, function(err, data) { - * console.log(err, data); - * }); - * @callback callback function(err, data) - * @param err [Error] an error or null if no error occurred. - * @param data [map] The response data from the successful upload: - * @param data.Location [String] the URL of the uploaded object - * @param data.ETag [String] the ETag of the uploaded object - * @param data.Bucket [String] the bucket to which the object was uploaded - * @param data.Key [String] the key to which the object was uploaded - */ - upload: function upload(params, options, callback) { - if (typeof options === 'function' && callback === undefined) { - callback = options; - options = null; - } +/***/ 31987: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - options = options || {}; - options = AWS.util.merge(options || {}, {service: this, params: params}); +var AWS = __nccwpck_require__(28437); - var uploader = new AWS.S3.ManagedUpload(options); - if (typeof callback === 'function') uploader.send(callback); - return uploader; - } -}); +AWS.util.hideProperties(AWS, ['SimpleWorkflow']); /** - * @api private + * @constant + * @readonly + * Backwards compatibility for access to the {AWS.SWF} service class. */ -AWS.S3.addPromisesToClass = function addPromisesToClass(PromiseDependency) { - this.prototype.getSignedUrlPromise = AWS.util.promisifyMethod('getSignedUrl', PromiseDependency); -}; +AWS.SimpleWorkflow = AWS.SWF; + + +/***/ }), + +/***/ 29697: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +var IniLoader = (__nccwpck_require__(95417).IniLoader); /** - * @api private + * Singleton object to load specified config/credentials files. + * It will cache all the files ever loaded; */ -AWS.S3.deletePromisesFromClass = function deletePromisesFromClass() { - delete this.prototype.getSignedUrlPromise; -}; - -AWS.util.addPromises(AWS.S3); +module.exports.b = new IniLoader(); /***/ }), -/***/ 71207: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 95417: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var s3util = __nccwpck_require__(35895); -var regionUtil = __nccwpck_require__(18262); +var os = __nccwpck_require__(22037); +var path = __nccwpck_require__(71017); -AWS.util.update(AWS.S3Control.prototype, { - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('extractError', this.extractHostId); - request.addListener('extractData', this.extractHostId); - request.addListener('validate', this.validateAccountId); +function parseFile(filename) { + return AWS.util.ini.parse(AWS.util.readFileSync(filename)); +} - var isArnInBucket = s3util.isArnInParam(request, 'Bucket'); - var isArnInName = s3util.isArnInParam(request, 'Name'); +function getProfiles(fileContent) { + var tmpContent = {}; + Object.keys(fileContent).forEach(function(sectionName) { + if (/^sso-session\s/.test(sectionName)) return; + Object.defineProperty(tmpContent, sectionName.replace(/^profile\s/, ''), { + value: fileContent[sectionName], + enumerable: true + }); + }); + return tmpContent; +} - if (isArnInBucket) { - request._parsedArn = AWS.util.ARN.parse(request.params['Bucket']); - request.addListener('validate', this.validateOutpostsBucketArn); - request.addListener('validate', s3util.validateOutpostsArn); - request.addListener('afterBuild', this.addOutpostIdHeader); - } else if (isArnInName) { - request._parsedArn = AWS.util.ARN.parse(request.params['Name']); - request.addListener('validate', s3util.validateOutpostsAccessPointArn); - request.addListener('validate', s3util.validateOutpostsArn); - request.addListener('afterBuild', this.addOutpostIdHeader); - } +function getSsoSessions(fileContent) { + var tmpContent = {}; + Object.keys(fileContent).forEach(function(sectionName) { + if (!/^sso-session\s/.test(sectionName)) return; + Object.defineProperty(tmpContent, sectionName.replace(/^sso-session\s/, ''), { + value: fileContent[sectionName], + enumerable: true + }); + }); + return tmpContent; +} - if (isArnInBucket || isArnInName) { - request.addListener('validate', this.validateArnRegion); - request.addListener('validate', this.validateArnAccountWithParams, true); - request.addListener('validate', s3util.validateArnAccount); - request.addListener('validate', s3util.validateArnService); - request.addListener('build', this.populateParamFromArn, true); - request.addListener('build', this.populateUriFromArn); - request.addListener('build', s3util.validatePopulateUriFromArn); - } +/** + * Ini file loader class the same as that used in the SDK. It loads and + * parses config and credentials files in .ini format and cache the content + * to assure files are only read once. + * Note that calling operations on the instance instantiated from this class + * won't affect the behavior of SDK since SDK uses an internal singleton of + * this class. + * @!macro nobrowser + */ +AWS.IniLoader = AWS.util.inherit({ + constructor: function IniLoader() { + this.resolvedProfiles = {}; + this.resolvedSsoSessions = {}; + }, - if (request.params.OutpostId && - (request.operation === 'createBucket' || - request.operation === 'listRegionalBuckets')) { - request.addListener('build', this.populateEndpointForOutpostId); - } + /** Remove all cached files. Used after config files are updated. */ + clearCachedFiles: function clearCachedFiles() { + this.resolvedProfiles = {}; + this.resolvedSsoSessions = {}; }, /** - * Adds outpostId header + * Load configurations from config/credentials files and cache them + * for later use. If no file is specified it will try to load default files. + * + * @param options [map] information describing the file + * @option options filename [String] ('~/.aws/credentials' or defined by + * AWS_SHARED_CREDENTIALS_FILE process env var or '~/.aws/config' if + * isConfig is set to true) + * path to the file to be read. + * @option options isConfig [Boolean] (false) True to read config file. + * @return [map] object containing contents from file in key-value + * pairs. */ - addOutpostIdHeader: function addOutpostIdHeader(req) { - req.httpRequest.headers['x-amz-outpost-id'] = req._parsedArn.outpostId; + loadFrom: function loadFrom(options) { + options = options || {}; + var isConfig = options.isConfig === true; + var filename = options.filename || this.getDefaultFilePath(isConfig); + if (!this.resolvedProfiles[filename]) { + var fileContent = parseFile(filename); + if (isConfig) { + Object.defineProperty(this.resolvedProfiles, filename, { + value: getProfiles(fileContent) + }); + } else { + Object.defineProperty(this.resolvedProfiles, filename, { value: fileContent }); + } + } + return this.resolvedProfiles[filename]; }, /** - * Validate Outposts ARN supplied in Bucket parameter is a valid bucket name + * Load sso sessions from config/credentials files and cache them + * for later use. If no file is specified it will try to load default file. + * + * @param options [map] information describing the file + * @option options filename [String] ('~/.aws/config' or defined by + * AWS_CONFIG_FILE process env var) + * @return [map] object containing contents from file in key-value + * pairs. */ - validateOutpostsBucketArn: function validateOutpostsBucketArn(req) { - var parsedArn = req._parsedArn; - - //can be ':' or '/' - var delimiter = parsedArn.resource['outpost'.length]; - - if (parsedArn.resource.split(delimiter).length !== 4) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Bucket ARN should have two resources outpost/{outpostId}/bucket/{accesspointName}' - }); - } - - var bucket = parsedArn.resource.split(delimiter)[3]; - if (!s3util.dnsCompatibleBucketName(bucket) || bucket.match(/\./)) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Bucket ARN is not DNS compatible. Got ' + bucket + loadSsoSessionsFrom: function loadSsoSessionsFrom(options) { + options = options || {}; + var filename = options.filename || this.getDefaultFilePath(true); + if (!this.resolvedSsoSessions[filename]) { + var fileContent = parseFile(filename); + Object.defineProperty(this.resolvedSsoSessions, filename, { + value: getSsoSessions(fileContent) }); } - - //set parsed valid bucket - req._parsedArn.bucket = bucket; + return this.resolvedSsoSessions[filename]; }, /** * @api private */ - populateParamFromArn: function populateParamFromArn(req) { - var parsedArn = req._parsedArn; - if (s3util.isArnInParam(req, 'Bucket')) { - req.params.Bucket = parsedArn.bucket; - } else if (s3util.isArnInParam(req, 'Name')) { - req.params.Name = parsedArn.accessPoint; - } + getDefaultFilePath: function getDefaultFilePath(isConfig) { + return path.join( + this.getHomeDir(), + '.aws', + isConfig ? 'config' : 'credentials' + ); }, /** - * Populate URI according to the ARN + * @api private */ - populateUriFromArn: function populateUriFromArn(req) { - var parsedArn = req._parsedArn; + getHomeDir: function getHomeDir() { + var env = process.env; + var home = env.HOME || + env.USERPROFILE || + (env.HOMEPATH ? ((env.HOMEDRIVE || 'C:/') + env.HOMEPATH) : null); - var endpoint = req.httpRequest.endpoint; - var useArnRegion = req.service.config.s3UseArnRegion; - var useFipsEndpoint = req.service.config.useFipsEndpoint; + if (home) { + return home; + } - endpoint.hostname = [ - 's3-outposts' + (useFipsEndpoint ? '-fips': ''), - useArnRegion ? parsedArn.region : req.service.config.region, - 'amazonaws.com' - ].join('.'); - endpoint.host = endpoint.hostname; - }, + if (typeof os.homedir === 'function') { + return os.homedir(); + } - /** - * @api private - */ - populateEndpointForOutpostId: function populateEndpointForOutpostId(req) { - var endpoint = req.httpRequest.endpoint; - var useFipsEndpoint = req.service.config.useFipsEndpoint; - endpoint.hostname = [ - 's3-outposts' + (useFipsEndpoint ? '-fips': ''), - req.service.config.region, - 'amazonaws.com' - ].join('.'); - endpoint.host = endpoint.hostname; + throw AWS.util.error( + new Error('Cannot load credentials, HOME path not set') + ); + } +}); + +var IniLoader = AWS.IniLoader; + +module.exports = { + IniLoader: IniLoader +}; + + +/***/ }), + +/***/ 98382: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +/** + * @api private + */ +AWS.Signers.Bearer = AWS.util.inherit(AWS.Signers.RequestSigner, { + constructor: function Bearer(request) { + AWS.Signers.RequestSigner.call(this, request); }, - /** - * @api private - */ - extractHostId: function(response) { - var hostId = response.httpResponse.headers ? response.httpResponse.headers['x-amz-id-2'] : null; - response.extendedRequestId = hostId; - if (response.error) { - response.error.extendedRequestId = hostId; + addAuthorization: function addAuthorization(token) { + this.request.headers['Authorization'] = 'Bearer ' + token.token; + } +}); + + +/***/ }), + +/***/ 60328: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var inherit = AWS.util.inherit; + +/** + * @api private + */ +var expiresHeader = 'presigned-expires'; + +/** + * @api private + */ +function signedUrlBuilder(request) { + var expires = request.httpRequest.headers[expiresHeader]; + var signerClass = request.service.getSignerClass(request); + + delete request.httpRequest.headers['User-Agent']; + delete request.httpRequest.headers['X-Amz-User-Agent']; + + if (signerClass === AWS.Signers.V4) { + if (expires > 604800) { // one week expiry is invalid + var message = 'Presigning does not support expiry time greater ' + + 'than a week with SigV4 signing.'; + throw AWS.util.error(new Error(), { + code: 'InvalidExpiryTime', message: message, retryable: false + }); } - }, + request.httpRequest.headers[expiresHeader] = expires; + } else if (signerClass === AWS.Signers.S3) { + var now = request.service ? request.service.getSkewCorrectedDate() : AWS.util.date.getDate(); + request.httpRequest.headers[expiresHeader] = parseInt( + AWS.util.date.unixTimestamp(now) + expires, 10).toString(); + } else { + throw AWS.util.error(new Error(), { + message: 'Presigning only supports S3 or SigV4 signing.', + code: 'UnsupportedSigner', retryable: false + }); + } +} - /** - * @api private - */ - validateArnRegion: function validateArnRegion(req) { - s3util.validateArnRegion(req, { allowFipsEndpoint: true }); - }, +/** + * @api private + */ +function signedUrlSigner(request) { + var endpoint = request.httpRequest.endpoint; + var parsedUrl = AWS.util.urlParse(request.httpRequest.path); + var queryParams = {}; + + if (parsedUrl.search) { + queryParams = AWS.util.queryStringParse(parsedUrl.search.substr(1)); + } + + var auth = request.httpRequest.headers['Authorization'].split(' '); + if (auth[0] === 'AWS') { + auth = auth[1].split(':'); + queryParams['Signature'] = auth.pop(); + queryParams['AWSAccessKeyId'] = auth.join(':'); + + AWS.util.each(request.httpRequest.headers, function (key, value) { + if (key === expiresHeader) key = 'Expires'; + if (key.indexOf('x-amz-meta-') === 0) { + // Delete existing, potentially not normalized key + delete queryParams[key]; + key = key.toLowerCase(); + } + queryParams[key] = value; + }); + delete request.httpRequest.headers[expiresHeader]; + delete queryParams['Authorization']; + delete queryParams['Host']; + } else if (auth[0] === 'AWS4-HMAC-SHA256') { // SigV4 signing + auth.shift(); + var rest = auth.join(' '); + var signature = rest.match(/Signature=(.*?)(?:,|\s|\r?\n|$)/)[1]; + queryParams['X-Amz-Signature'] = signature; + delete queryParams['Expires']; + } + + // build URL + endpoint.pathname = parsedUrl.pathname; + endpoint.search = AWS.util.queryParamsToString(queryParams); +} +/** + * @api private + */ +AWS.Signers.Presign = inherit({ /** * @api private */ - validateArnAccountWithParams: function validateArnAccountWithParams(req) { - var params = req.params; - var inputModel = req.service.api.operations[req.operation].input; - if (inputModel.members.AccountId) { - var parsedArn = req._parsedArn; - if (parsedArn.accountId) { - if (params.AccountId) { - if (params.AccountId !== parsedArn.accountId) { - throw AWS.util.error( - new Error(), - {code: 'ValidationError', message: 'AccountId in ARN and request params should be same.'} - ); - } - } else { - // Store accountId from ARN in params - params.AccountId = parsedArn.accountId; + sign: function sign(request, expireTime, callback) { + request.httpRequest.headers[expiresHeader] = expireTime || 3600; + request.on('build', signedUrlBuilder); + request.on('sign', signedUrlSigner); + request.removeListener('afterBuild', + AWS.EventListeners.Core.SET_CONTENT_LENGTH); + request.removeListener('afterBuild', + AWS.EventListeners.Core.COMPUTE_SHA256); + + request.emit('beforePresign', [request]); + + if (callback) { + request.build(function() { + if (this.response.error) callback(this.response.error); + else { + callback(null, AWS.util.urlFormat(request.httpRequest.endpoint)); } - } + }); + } else { + request.build(); + if (request.response.error) throw request.response.error; + return AWS.util.urlFormat(request.httpRequest.endpoint); } - }, + } +}); - /** - * @api private - */ - validateAccountId: function(request) { - var params = request.params; - if (!Object.prototype.hasOwnProperty.call(params, 'AccountId')) return; - var accountId = params.AccountId; - //validate type - if (typeof accountId !== 'string') { - throw AWS.util.error( - new Error(), - {code: 'ValidationError', message: 'AccountId must be a string.'} - ); - } - //validate length - if (accountId.length < 1 || accountId.length > 63) { - throw AWS.util.error( - new Error(), - {code: 'ValidationError', message: 'AccountId length should be between 1 to 63 characters, inclusive.'} - ); - } - //validate pattern - var hostPattern = /^[a-zA-Z0-9]{1}$|^[a-zA-Z0-9][a-zA-Z0-9\-]*[a-zA-Z0-9]$/; - if (!hostPattern.test(accountId)) { - throw AWS.util.error(new Error(), - {code: 'ValidationError', message: 'AccountId should be hostname compatible. AccountId: ' + accountId}); - } +/** + * @api private + */ +module.exports = AWS.Signers.Presign; + + +/***/ }), + +/***/ 9897: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); + +var inherit = AWS.util.inherit; + +/** + * @api private + */ +AWS.Signers.RequestSigner = inherit({ + constructor: function RequestSigner(request) { + this.request = request; }, - /** - * @api private - */ - getSigningName: function getSigningName(req) { - var _super = AWS.Service.prototype.getSigningName; - if (req && req._parsedArn && req._parsedArn.service) { - return req._parsedArn.service; - } else if (req.params.OutpostId && - (req.operation === 'createBucket' || - req.operation === 'listRegionalBuckets')) { - return 's3-outposts'; - } else { - return _super.call(this, req); - } + setServiceClientId: function setServiceClientId(id) { + this.serviceClientId = id; }, + + getServiceClientId: function getServiceClientId() { + return this.serviceClientId; + } }); +AWS.Signers.RequestSigner.getVersion = function getVersion(version) { + switch (version) { + case 'v2': return AWS.Signers.V2; + case 'v3': return AWS.Signers.V3; + case 's3v4': return AWS.Signers.V4; + case 'v4': return AWS.Signers.V4; + case 's3': return AWS.Signers.S3; + case 'v3https': return AWS.Signers.V3Https; + case 'bearer': return AWS.Signers.Bearer; + } + throw new Error('Unknown signing version ' + version); +}; + +__nccwpck_require__(28489); +__nccwpck_require__(66458); +__nccwpck_require__(24473); +__nccwpck_require__(26529); +__nccwpck_require__(58616); +__nccwpck_require__(60328); +__nccwpck_require__(98382); + /***/ }), -/***/ 35895: +/***/ 58616: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var regionUtil = __nccwpck_require__(18262); +var inherit = AWS.util.inherit; -var s3util = { +/** + * @api private + */ +AWS.Signers.S3 = inherit(AWS.Signers.RequestSigner, { /** - * @api private + * When building the stringToSign, these sub resource params should be + * part of the canonical resource string with their NON-decoded values */ - isArnInParam: function isArnInParam(req, paramName) { - var inputShape = (req.service.api.operations[req.operation] || {}).input || {}; - var inputMembers = inputShape.members || {}; - if (!req.params[paramName] || !inputMembers[paramName]) return false; - return AWS.util.ARN.validate(req.params[paramName]); + subResources: { + 'acl': 1, + 'accelerate': 1, + 'analytics': 1, + 'cors': 1, + 'lifecycle': 1, + 'delete': 1, + 'inventory': 1, + 'location': 1, + 'logging': 1, + 'metrics': 1, + 'notification': 1, + 'partNumber': 1, + 'policy': 1, + 'requestPayment': 1, + 'replication': 1, + 'restore': 1, + 'tagging': 1, + 'torrent': 1, + 'uploadId': 1, + 'uploads': 1, + 'versionId': 1, + 'versioning': 1, + 'versions': 1, + 'website': 1 }, - /** - * Validate service component from ARN supplied in Bucket parameter - */ - validateArnService: function validateArnService(req) { - var parsedArn = req._parsedArn; - - if (parsedArn.service !== 's3' - && parsedArn.service !== 's3-outposts' - && parsedArn.service !== 's3-object-lambda') { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'expect \'s3\' or \'s3-outposts\' or \'s3-object-lambda\' in ARN service component' - }); - } + // when building the stringToSign, these querystring params should be + // part of the canonical resource string with their NON-encoded values + responseHeaders: { + 'response-content-type': 1, + 'response-content-language': 1, + 'response-expires': 1, + 'response-cache-control': 1, + 'response-content-disposition': 1, + 'response-content-encoding': 1 }, - /** - * Validate account ID from ARN supplied in Bucket parameter is a valid account - */ - validateArnAccount: function validateArnAccount(req) { - var parsedArn = req._parsedArn; + addAuthorization: function addAuthorization(credentials, date) { + if (!this.request.headers['presigned-expires']) { + this.request.headers['X-Amz-Date'] = AWS.util.date.rfc822(date); + } - if (!/[0-9]{12}/.exec(parsedArn.accountId)) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'ARN accountID does not match regex "[0-9]{12}"' - }); + if (credentials.sessionToken) { + // presigned URLs require this header to be lowercased + this.request.headers['x-amz-security-token'] = credentials.sessionToken; } - }, - /** - * Validate ARN supplied in Bucket parameter is a valid access point ARN - */ - validateS3AccessPointArn: function validateS3AccessPointArn(req) { - var parsedArn = req._parsedArn; + var signature = this.sign(credentials.secretAccessKey, this.stringToSign()); + var auth = 'AWS ' + credentials.accessKeyId + ':' + signature; - //can be ':' or '/' - var delimiter = parsedArn.resource['accesspoint'.length]; + this.request.headers['Authorization'] = auth; + }, - if (parsedArn.resource.split(delimiter).length !== 2) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Access Point ARN should have one resource accesspoint/{accesspointName}' - }); - } + stringToSign: function stringToSign() { + var r = this.request; - var accessPoint = parsedArn.resource.split(delimiter)[1]; - var accessPointPrefix = accessPoint + '-' + parsedArn.accountId; - if (!s3util.dnsCompatibleBucketName(accessPointPrefix) || accessPointPrefix.match(/\./)) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Access point resource in ARN is not DNS compatible. Got ' + accessPoint - }); - } + var parts = []; + parts.push(r.method); + parts.push(r.headers['Content-MD5'] || ''); + parts.push(r.headers['Content-Type'] || ''); - //set parsed valid access point - req._parsedArn.accessPoint = accessPoint; - }, + // This is the "Date" header, but we use X-Amz-Date. + // The S3 signing mechanism requires us to pass an empty + // string for this Date header regardless. + parts.push(r.headers['presigned-expires'] || ''); - /** - * Validate Outposts ARN supplied in Bucket parameter is a valid outposts ARN - */ - validateOutpostsArn: function validateOutpostsArn(req) { - var parsedArn = req._parsedArn; + var headers = this.canonicalizedAmzHeaders(); + if (headers) parts.push(headers); + parts.push(this.canonicalizedResource()); - if ( - parsedArn.resource.indexOf('outpost:') !== 0 && - parsedArn.resource.indexOf('outpost/') !== 0 - ) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'ARN resource should begin with \'outpost/\'' - }); - } + return parts.join('\n'); - //can be ':' or '/' - var delimiter = parsedArn.resource['outpost'.length]; - var outpostId = parsedArn.resource.split(delimiter)[1]; - var dnsHostRegex = new RegExp(/^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9-]{0,61}[a-zA-Z0-9])$/); - if (!dnsHostRegex.test(outpostId)) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Outpost resource in ARN is not DNS compatible. Got ' + outpostId - }); - } - req._parsedArn.outpostId = outpostId; }, - /** - * Validate Outposts ARN supplied in Bucket parameter is a valid outposts ARN - */ - validateOutpostsAccessPointArn: function validateOutpostsAccessPointArn(req) { - var parsedArn = req._parsedArn; + canonicalizedAmzHeaders: function canonicalizedAmzHeaders() { - //can be ':' or '/' - var delimiter = parsedArn.resource['outpost'.length]; + var amzHeaders = []; - if (parsedArn.resource.split(delimiter).length !== 4) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Outposts ARN should have two resources outpost/{outpostId}/accesspoint/{accesspointName}' - }); - } + AWS.util.each(this.request.headers, function (name) { + if (name.match(/^x-amz-/i)) + amzHeaders.push(name); + }); - var accessPoint = parsedArn.resource.split(delimiter)[3]; - var accessPointPrefix = accessPoint + '-' + parsedArn.accountId; - if (!s3util.dnsCompatibleBucketName(accessPointPrefix) || accessPointPrefix.match(/\./)) { - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: 'Access point resource in ARN is not DNS compatible. Got ' + accessPoint - }); - } + amzHeaders.sort(function (a, b) { + return a.toLowerCase() < b.toLowerCase() ? -1 : 1; + }); + + var parts = []; + AWS.util.arrayEach.call(this, amzHeaders, function (name) { + parts.push(name.toLowerCase() + ':' + String(this.request.headers[name])); + }); + + return parts.join('\n'); - //set parsed valid access point - req._parsedArn.accessPoint = accessPoint; }, - /** - * Validate region field in ARN supplied in Bucket parameter is a valid region - */ - validateArnRegion: function validateArnRegion(req, options) { - if (options === undefined) { - options = {}; - } + canonicalizedResource: function canonicalizedResource() { - var useArnRegion = s3util.loadUseArnRegionConfig(req); - var regionFromArn = req._parsedArn.region; - var clientRegion = req.service.config.region; - var useFipsEndpoint = req.service.config.useFipsEndpoint; - var allowFipsEndpoint = options.allowFipsEndpoint || false; + var r = this.request; - if (!regionFromArn) { - var message = 'ARN region is empty'; - if (req._parsedArn.service === 's3') { - message = message + '\nYou may want to use multi-regional ARN. The feature is not supported in current SDK. ' + - 'You should consider switching to V3(https://github.com/aws/aws-sdk-js-v3).'; - } - throw AWS.util.error(new Error(), { - code: 'InvalidARN', - message: message - }); - } + var parts = r.path.split('?'); + var path = parts[0]; + var querystring = parts[1]; - if (useFipsEndpoint && !allowFipsEndpoint) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'ARN endpoint is not compatible with FIPS region' - }); - } + var resource = ''; - if (regionFromArn.indexOf('fips') >= 0) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'FIPS region not allowed in ARN' - }); - } + if (r.virtualHostedBucket) + resource += '/' + r.virtualHostedBucket; - if (!useArnRegion && regionFromArn !== clientRegion) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'Configured region conflicts with access point region' - }); - } else if ( - useArnRegion && - regionUtil.getEndpointSuffix(regionFromArn) !== regionUtil.getEndpointSuffix(clientRegion) - ) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'Configured region and access point region not in same partition' - }); - } + resource += path; - if (req.service.config.useAccelerateEndpoint) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'useAccelerateEndpoint config is not supported with access point ARN' - }); - } + if (querystring) { - if (req._parsedArn.service === 's3-outposts' && req.service.config.useDualstackEndpoint) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'Dualstack is not supported with outposts access point ARN' - }); - } - }, + // collect a list of sub resources and query params that need to be signed + var resources = []; - loadUseArnRegionConfig: function loadUseArnRegionConfig(req) { - var envName = 'AWS_S3_USE_ARN_REGION'; - var configName = 's3_use_arn_region'; - var useArnRegion = true; - var originalConfig = req.service._originalConfig || {}; - if (req.service.config.s3UseArnRegion !== undefined) { - return req.service.config.s3UseArnRegion; - } else if (originalConfig.s3UseArnRegion !== undefined) { - useArnRegion = originalConfig.s3UseArnRegion === true; - } else if (AWS.util.isNode()) { - //load from environmental variable AWS_USE_ARN_REGION - if (process.env[envName]) { - var value = process.env[envName].trim().toLowerCase(); - if (['false', 'true'].indexOf(value) < 0) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: envName + ' only accepts true or false. Got ' + process.env[envName], - retryable: false - }); - } - useArnRegion = value === 'true'; - } else { //load from shared config property use_arn_region - var profiles = {}; - var profile = {}; - try { - profiles = AWS.util.getProfilesFromSharedConfig(AWS.util.iniLoader); - profile = profiles[process.env.AWS_PROFILE || AWS.util.defaultProfile]; - } catch (e) {} - if (profile[configName]) { - if (['false', 'true'].indexOf(profile[configName].trim().toLowerCase()) < 0) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: configName + ' only accepts true or false. Got ' + profile[configName], - retryable: false - }); + AWS.util.arrayEach.call(this, querystring.split('&'), function (param) { + var name = param.split('=')[0]; + var value = param.split('=')[1]; + if (this.subResources[name] || this.responseHeaders[name]) { + var subresource = { name: name }; + if (value !== undefined) { + if (this.subResources[name]) { + subresource.value = value; + } else { + subresource.value = decodeURIComponent(value); + } } - useArnRegion = profile[configName].trim().toLowerCase() === 'true'; + resources.push(subresource); } + }); + + resources.sort(function (a, b) { return a.name < b.name ? -1 : 1; }); + + if (resources.length) { + + querystring = []; + AWS.util.arrayEach(resources, function (res) { + if (res.value === undefined) { + querystring.push(res.name); + } else { + querystring.push(res.name + '=' + res.value); + } + }); + + resource += '?' + querystring.join('&'); } + } - req.service.config.s3UseArnRegion = useArnRegion; - return useArnRegion; + + return resource; + }, - /** - * Validations before URI can be populated - */ - validatePopulateUriFromArn: function validatePopulateUriFromArn(req) { - if (req.service._originalConfig && req.service._originalConfig.endpoint) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'Custom endpoint is not compatible with access point ARN' - }); - } + sign: function sign(secret, string) { + return AWS.util.crypto.hmac(secret, string, 'base64', 'sha1'); + } +}); + +/** + * @api private + */ +module.exports = AWS.Signers.S3; + + +/***/ }), + +/***/ 28489: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var inherit = AWS.util.inherit; + +/** + * @api private + */ +AWS.Signers.V2 = inherit(AWS.Signers.RequestSigner, { + addAuthorization: function addAuthorization(credentials, date) { + + if (!date) date = AWS.util.date.getDate(); + + var r = this.request; + + r.params.Timestamp = AWS.util.date.iso8601(date); + r.params.SignatureVersion = '2'; + r.params.SignatureMethod = 'HmacSHA256'; + r.params.AWSAccessKeyId = credentials.accessKeyId; - if (req.service.config.s3ForcePathStyle) { - throw AWS.util.error(new Error(), { - code: 'InvalidConfiguration', - message: 'Cannot construct path-style endpoint with access point' - }); + if (credentials.sessionToken) { + r.params.SecurityToken = credentials.sessionToken; } + + delete r.params.Signature; // delete old Signature for re-signing + r.params.Signature = this.signature(credentials); + + r.body = AWS.util.queryParamsToString(r.params); + r.headers['Content-Length'] = r.body.length; }, - /** - * Returns true if the bucket name is DNS compatible. Buckets created - * outside of the classic region MUST be DNS compatible. - * - * @api private - */ - dnsCompatibleBucketName: function dnsCompatibleBucketName(bucketName) { - var b = bucketName; - var domain = new RegExp(/^[a-z0-9][a-z0-9\.\-]{1,61}[a-z0-9]$/); - var ipAddress = new RegExp(/(\d+\.){3}\d+/); - var dots = new RegExp(/\.\./); - return (b.match(domain) && !b.match(ipAddress) && !b.match(dots)) ? true : false; + signature: function signature(credentials) { + return AWS.util.crypto.hmac(credentials.secretAccessKey, this.stringToSign(), 'base64'); }, -}; + + stringToSign: function stringToSign() { + var parts = []; + parts.push(this.request.method); + parts.push(this.request.endpoint.host.toLowerCase()); + parts.push(this.request.pathname()); + parts.push(AWS.util.queryParamsToString(this.request.params)); + return parts.join('\n'); + } + +}); /** * @api private */ -module.exports = s3util; +module.exports = AWS.Signers.V2; /***/ }), -/***/ 94571: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 66458: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); +var inherit = AWS.util.inherit; -AWS.util.update(AWS.SQS.prototype, { - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('build', this.buildEndpoint); +/** + * @api private + */ +AWS.Signers.V3 = inherit(AWS.Signers.RequestSigner, { + addAuthorization: function addAuthorization(credentials, date) { - if (request.service.config.computeChecksums) { - if (request.operation === 'sendMessage') { - request.addListener('extractData', this.verifySendMessageChecksum); - } else if (request.operation === 'sendMessageBatch') { - request.addListener('extractData', this.verifySendMessageBatchChecksum); - } else if (request.operation === 'receiveMessage') { - request.addListener('extractData', this.verifyReceiveMessageChecksum); - } - } - }, + var datetime = AWS.util.date.rfc822(date); - /** - * @api private - */ - verifySendMessageChecksum: function verifySendMessageChecksum(response) { - if (!response.data) return; + this.request.headers['X-Amz-Date'] = datetime; - var md5 = response.data.MD5OfMessageBody; - var body = this.params.MessageBody; - var calculatedMd5 = this.service.calculateChecksum(body); - if (calculatedMd5 !== md5) { - var msg = 'Got "' + response.data.MD5OfMessageBody + - '", expecting "' + calculatedMd5 + '".'; - this.service.throwInvalidChecksumError(response, - [response.data.MessageId], msg); + if (credentials.sessionToken) { + this.request.headers['x-amz-security-token'] = credentials.sessionToken; } - }, - - /** - * @api private - */ - verifySendMessageBatchChecksum: function verifySendMessageBatchChecksum(response) { - if (!response.data) return; - var service = this.service; - var entries = {}; - var errors = []; - var messageIds = []; - AWS.util.arrayEach(response.data.Successful, function (entry) { - entries[entry.Id] = entry; - }); - AWS.util.arrayEach(this.params.Entries, function (entry) { - if (entries[entry.Id]) { - var md5 = entries[entry.Id].MD5OfMessageBody; - var body = entry.MessageBody; - if (!service.isChecksumValid(md5, body)) { - errors.push(entry.Id); - messageIds.push(entries[entry.Id].MessageId); - } - } - }); + this.request.headers['X-Amzn-Authorization'] = + this.authorization(credentials, datetime); - if (errors.length > 0) { - service.throwInvalidChecksumError(response, messageIds, - 'Invalid messages: ' + errors.join(', ')); - } }, - /** - * @api private - */ - verifyReceiveMessageChecksum: function verifyReceiveMessageChecksum(response) { - if (!response.data) return; + authorization: function authorization(credentials) { + return 'AWS3 ' + + 'AWSAccessKeyId=' + credentials.accessKeyId + ',' + + 'Algorithm=HmacSHA256,' + + 'SignedHeaders=' + this.signedHeaders() + ',' + + 'Signature=' + this.signature(credentials); + }, - var service = this.service; - var messageIds = []; - AWS.util.arrayEach(response.data.Messages, function(message) { - var md5 = message.MD5OfBody; - var body = message.Body; - if (!service.isChecksumValid(md5, body)) { - messageIds.push(message.MessageId); - } + signedHeaders: function signedHeaders() { + var headers = []; + AWS.util.arrayEach(this.headersToSign(), function iterator(h) { + headers.push(h.toLowerCase()); }); - - if (messageIds.length > 0) { - service.throwInvalidChecksumError(response, messageIds, - 'Invalid messages: ' + messageIds.join(', ')); - } + return headers.sort().join(';'); }, - /** - * @api private - */ - throwInvalidChecksumError: function throwInvalidChecksumError(response, ids, message) { - response.error = AWS.util.error(new Error(), { - retryable: true, - code: 'InvalidChecksum', - messageIds: ids, - message: response.request.operation + - ' returned an invalid MD5 response. ' + message + canonicalHeaders: function canonicalHeaders() { + var headers = this.request.headers; + var parts = []; + AWS.util.arrayEach(this.headersToSign(), function iterator(h) { + parts.push(h.toLowerCase().trim() + ':' + String(headers[h]).trim()); }); + return parts.sort().join('\n') + '\n'; }, - /** - * @api private - */ - isChecksumValid: function isChecksumValid(checksum, data) { - return this.calculateChecksum(data) === checksum; + headersToSign: function headersToSign() { + var headers = []; + AWS.util.each(this.request.headers, function iterator(k) { + if (k === 'Host' || k === 'Content-Encoding' || k.match(/^X-Amz/i)) { + headers.push(k); + } + }); + return headers; }, - /** - * @api private - */ - calculateChecksum: function calculateChecksum(data) { - return AWS.util.crypto.md5(data, 'hex'); + signature: function signature(credentials) { + return AWS.util.crypto.hmac(credentials.secretAccessKey, this.stringToSign(), 'base64'); }, - /** - * @api private - */ - buildEndpoint: function buildEndpoint(request) { - var url = request.httpRequest.params.QueueUrl; - if (url) { - request.httpRequest.endpoint = new AWS.Endpoint(url); + stringToSign: function stringToSign() { + var parts = []; + parts.push(this.request.method); + parts.push('/'); + parts.push(''); + parts.push(this.canonicalHeaders()); + parts.push(this.request.body); + return AWS.util.crypto.sha256(parts.join('\n')); + } - // signature version 4 requires the region name to be set, - // sqs queue urls contain the region name - var matches = request.httpRequest.endpoint.host.match(/^sqs\.(.+?)\./); - if (matches) request.httpRequest.region = matches[1]; - } +}); + +/** + * @api private + */ +module.exports = AWS.Signers.V3; + + +/***/ }), + +/***/ 24473: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + +var AWS = __nccwpck_require__(28437); +var inherit = AWS.util.inherit; + +__nccwpck_require__(66458); + +/** + * @api private + */ +AWS.Signers.V3Https = inherit(AWS.Signers.V3, { + authorization: function authorization(credentials) { + return 'AWS3-HTTPS ' + + 'AWSAccessKeyId=' + credentials.accessKeyId + ',' + + 'Algorithm=HmacSHA256,' + + 'Signature=' + this.signature(credentials); + }, + + stringToSign: function stringToSign() { + return this.request.headers['X-Amz-Date']; } }); +/** + * @api private + */ +module.exports = AWS.Signers.V3Https; + /***/ }), -/***/ 91055: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 26529: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var resolveRegionalEndpointsFlag = __nccwpck_require__(85566); -var ENV_REGIONAL_ENDPOINT_ENABLED = 'AWS_STS_REGIONAL_ENDPOINTS'; -var CONFIG_REGIONAL_ENDPOINT_ENABLED = 'sts_regional_endpoints'; +var v4Credentials = __nccwpck_require__(62660); +var inherit = AWS.util.inherit; -AWS.util.update(AWS.STS.prototype, { - /** - * @overload credentialsFrom(data, credentials = null) - * Creates a credentials object from STS response data containing - * credentials information. Useful for quickly setting AWS credentials. - * - * @note This is a low-level utility function. If you want to load temporary - * credentials into your process for subsequent requests to AWS resources, - * you should use {AWS.TemporaryCredentials} instead. - * @param data [map] data retrieved from a call to {getFederatedToken}, - * {getSessionToken}, {assumeRole}, or {assumeRoleWithWebIdentity}. - * @param credentials [AWS.Credentials] an optional credentials object to - * fill instead of creating a new object. Useful when modifying an - * existing credentials object from a refresh call. - * @return [AWS.TemporaryCredentials] the set of temporary credentials - * loaded from a raw STS operation response. - * @example Using credentialsFrom to load global AWS credentials - * var sts = new AWS.STS(); - * sts.getSessionToken(function (err, data) { - * if (err) console.log("Error getting credentials"); - * else { - * AWS.config.credentials = sts.credentialsFrom(data); - * } - * }); - * @see AWS.TemporaryCredentials - */ - credentialsFrom: function credentialsFrom(data, credentials) { - if (!data) return null; - if (!credentials) credentials = new AWS.TemporaryCredentials(); - credentials.expired = false; - credentials.accessKeyId = data.Credentials.AccessKeyId; - credentials.secretAccessKey = data.Credentials.SecretAccessKey; - credentials.sessionToken = data.Credentials.SessionToken; - credentials.expireTime = data.Credentials.Expiration; - return credentials; +/** + * @api private + */ +var expiresHeader = 'presigned-expires'; + +/** + * @api private + */ +AWS.Signers.V4 = inherit(AWS.Signers.RequestSigner, { + constructor: function V4(request, serviceName, options) { + AWS.Signers.RequestSigner.call(this, request); + this.serviceName = serviceName; + options = options || {}; + this.signatureCache = typeof options.signatureCache === 'boolean' ? options.signatureCache : true; + this.operation = options.operation; + this.signatureVersion = options.signatureVersion; }, - assumeRoleWithWebIdentity: function assumeRoleWithWebIdentity(params, callback) { - return this.makeUnauthenticatedRequest('assumeRoleWithWebIdentity', params, callback); + algorithm: 'AWS4-HMAC-SHA256', + + addAuthorization: function addAuthorization(credentials, date) { + var datetime = AWS.util.date.iso8601(date).replace(/[:\-]|\.\d{3}/g, ''); + + if (this.isPresigned()) { + this.updateForPresigned(credentials, datetime); + } else { + this.addHeaders(credentials, datetime); + } + + this.request.headers['Authorization'] = + this.authorization(credentials, datetime); }, - assumeRoleWithSAML: function assumeRoleWithSAML(params, callback) { - return this.makeUnauthenticatedRequest('assumeRoleWithSAML', params, callback); + addHeaders: function addHeaders(credentials, datetime) { + this.request.headers['X-Amz-Date'] = datetime; + if (credentials.sessionToken) { + this.request.headers['x-amz-security-token'] = credentials.sessionToken; + } }, - /** - * @api private - */ - setupRequestListeners: function setupRequestListeners(request) { - request.addListener('validate', this.optInRegionalEndpoint, true); + updateForPresigned: function updateForPresigned(credentials, datetime) { + var credString = this.credentialString(datetime); + var qs = { + 'X-Amz-Date': datetime, + 'X-Amz-Algorithm': this.algorithm, + 'X-Amz-Credential': credentials.accessKeyId + '/' + credString, + 'X-Amz-Expires': this.request.headers[expiresHeader], + 'X-Amz-SignedHeaders': this.signedHeaders() + }; + + if (credentials.sessionToken) { + qs['X-Amz-Security-Token'] = credentials.sessionToken; + } + + if (this.request.headers['Content-Type']) { + qs['Content-Type'] = this.request.headers['Content-Type']; + } + if (this.request.headers['Content-MD5']) { + qs['Content-MD5'] = this.request.headers['Content-MD5']; + } + if (this.request.headers['Cache-Control']) { + qs['Cache-Control'] = this.request.headers['Cache-Control']; + } + + // need to pull in any other X-Amz-* headers + AWS.util.each.call(this, this.request.headers, function(key, value) { + if (key === expiresHeader) return; + if (this.isSignableHeader(key)) { + var lowerKey = key.toLowerCase(); + // Metadata should be normalized + if (lowerKey.indexOf('x-amz-meta-') === 0) { + qs[lowerKey] = value; + } else if (lowerKey.indexOf('x-amz-') === 0) { + qs[key] = value; + } + } + }); + + var sep = this.request.path.indexOf('?') >= 0 ? '&' : '?'; + this.request.path += sep + AWS.util.queryParamsToString(qs); }, - /** - * @api private - */ - optInRegionalEndpoint: function optInRegionalEndpoint(req) { - var service = req.service; - var config = service.config; - config.stsRegionalEndpoints = resolveRegionalEndpointsFlag(service._originalConfig, { - env: ENV_REGIONAL_ENDPOINT_ENABLED, - sharedConfig: CONFIG_REGIONAL_ENDPOINT_ENABLED, - clientConfig: 'stsRegionalEndpoints' + authorization: function authorization(credentials, datetime) { + var parts = []; + var credString = this.credentialString(datetime); + parts.push(this.algorithm + ' Credential=' + + credentials.accessKeyId + '/' + credString); + parts.push('SignedHeaders=' + this.signedHeaders()); + parts.push('Signature=' + this.signature(credentials, datetime)); + return parts.join(', '); + }, + + signature: function signature(credentials, datetime) { + var signingKey = v4Credentials.getSigningKey( + credentials, + datetime.substr(0, 8), + this.request.region, + this.serviceName, + this.signatureCache + ); + return AWS.util.crypto.hmac(signingKey, this.stringToSign(datetime), 'hex'); + }, + + stringToSign: function stringToSign(datetime) { + var parts = []; + parts.push('AWS4-HMAC-SHA256'); + parts.push(datetime); + parts.push(this.credentialString(datetime)); + parts.push(this.hexEncodedHash(this.canonicalString())); + return parts.join('\n'); + }, + + canonicalString: function canonicalString() { + var parts = [], pathname = this.request.pathname(); + if (this.serviceName !== 's3' && this.signatureVersion !== 's3v4') pathname = AWS.util.uriEscapePath(pathname); + + parts.push(this.request.method); + parts.push(pathname); + parts.push(this.request.search()); + parts.push(this.canonicalHeaders() + '\n'); + parts.push(this.signedHeaders()); + parts.push(this.hexEncodedBodyHash()); + return parts.join('\n'); + }, + + canonicalHeaders: function canonicalHeaders() { + var headers = []; + AWS.util.each.call(this, this.request.headers, function (key, item) { + headers.push([key, item]); }); - if ( - config.stsRegionalEndpoints === 'regional' && - service.isGlobalEndpoint - ) { - //client will throw if region is not supplied; request will be signed with specified region - if (!config.region) { - throw AWS.util.error(new Error(), - {code: 'ConfigError', message: 'Missing region in config'}); + headers.sort(function (a, b) { + return a[0].toLowerCase() < b[0].toLowerCase() ? -1 : 1; + }); + var parts = []; + AWS.util.arrayEach.call(this, headers, function (item) { + var key = item[0].toLowerCase(); + if (this.isSignableHeader(key)) { + var value = item[1]; + if (typeof value === 'undefined' || value === null || typeof value.toString !== 'function') { + throw AWS.util.error(new Error('Header ' + key + ' contains invalid value'), { + code: 'InvalidHeader' + }); + } + parts.push(key + ':' + + this.canonicalHeaderValues(value.toString())); } - var insertPoint = config.endpoint.indexOf('.amazonaws.com'); - var regionalEndpoint = config.endpoint.substring(0, insertPoint) + - '.' + config.region + config.endpoint.substring(insertPoint); - req.httpRequest.updateEndpoint(regionalEndpoint); - req.httpRequest.region = config.region; - } - } - -}); + }); + return parts.join('\n'); + }, + canonicalHeaderValues: function canonicalHeaderValues(values) { + return values.replace(/\s+/g, ' ').replace(/^\s+|\s+$/g, ''); + }, -/***/ }), + signedHeaders: function signedHeaders() { + var keys = []; + AWS.util.each.call(this, this.request.headers, function (key) { + key = key.toLowerCase(); + if (this.isSignableHeader(key)) keys.push(key); + }); + return keys.sort().join(';'); + }, -/***/ 31987: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + credentialString: function credentialString(datetime) { + return v4Credentials.createScope( + datetime.substr(0, 8), + this.request.region, + this.serviceName + ); + }, -var AWS = __nccwpck_require__(28437); + hexEncodedHash: function hash(string) { + return AWS.util.crypto.sha256(string, 'hex'); + }, -AWS.util.hideProperties(AWS, ['SimpleWorkflow']); + hexEncodedBodyHash: function hexEncodedBodyHash() { + var request = this.request; + if (this.isPresigned() && (['s3', 's3-object-lambda'].indexOf(this.serviceName) > -1) && !request.body) { + return 'UNSIGNED-PAYLOAD'; + } else if (request.headers['X-Amz-Content-Sha256']) { + return request.headers['X-Amz-Content-Sha256']; + } else { + return this.hexEncodedHash(this.request.body || ''); + } + }, -/** - * @constant - * @readonly - * Backwards compatibility for access to the {AWS.SWF} service class. - */ -AWS.SimpleWorkflow = AWS.SWF; + unsignableHeaders: [ + 'authorization', + 'content-type', + 'content-length', + 'user-agent', + expiresHeader, + 'expect', + 'x-amzn-trace-id' + ], + isSignableHeader: function isSignableHeader(key) { + if (key.toLowerCase().indexOf('x-amz-') === 0) return true; + return this.unsignableHeaders.indexOf(key) < 0; + }, -/***/ }), + isPresigned: function isPresigned() { + return this.request.headers[expiresHeader] ? true : false; + } -/***/ 29697: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +}); -var IniLoader = (__nccwpck_require__(95417).IniLoader); /** - * Singleton object to load specified config/credentials files. - * It will cache all the files ever loaded; + * @api private */ -module.exports.b = new IniLoader(); +module.exports = AWS.Signers.V4; /***/ }), -/***/ 95417: +/***/ 62660: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var os = __nccwpck_require__(22037); -var path = __nccwpck_require__(71017); -function parseFile(filename) { - return AWS.util.ini.parse(AWS.util.readFileSync(filename)); -} - -function getProfiles(fileContent) { - var tmpContent = {}; - Object.keys(fileContent).forEach(function(sectionName) { - if (/^sso-session\s/.test(sectionName)) return; - Object.defineProperty(tmpContent, sectionName.replace(/^profile\s/, ''), { - value: fileContent[sectionName], - enumerable: true - }); - }); - return tmpContent; -} +/** + * @api private + */ +var cachedSecret = {}; -function getSsoSessions(fileContent) { - var tmpContent = {}; - Object.keys(fileContent).forEach(function(sectionName) { - if (!/^sso-session\s/.test(sectionName)) return; - Object.defineProperty(tmpContent, sectionName.replace(/^sso-session\s/, ''), { - value: fileContent[sectionName], - enumerable: true - }); - }); - return tmpContent; -} +/** + * @api private + */ +var cacheQueue = []; /** - * Ini file loader class the same as that used in the SDK. It loads and - * parses config and credentials files in .ini format and cache the content - * to assure files are only read once. - * Note that calling operations on the instance instantiated from this class - * won't affect the behavior of SDK since SDK uses an internal singleton of - * this class. - * @!macro nobrowser + * @api private */ -AWS.IniLoader = AWS.util.inherit({ - constructor: function IniLoader() { - this.resolvedProfiles = {}; - this.resolvedSsoSessions = {}; - }, +var maxCacheEntries = 50; - /** Remove all cached files. Used after config files are updated. */ - clearCachedFiles: function clearCachedFiles() { - this.resolvedProfiles = {}; - this.resolvedSsoSessions = {}; - }, +/** + * @api private + */ +var v4Identifier = 'aws4_request'; +/** + * @api private + */ +module.exports = { /** - * Load configurations from config/credentials files and cache them - * for later use. If no file is specified it will try to load default files. + * @api private * - * @param options [map] information describing the file - * @option options filename [String] ('~/.aws/credentials' or defined by - * AWS_SHARED_CREDENTIALS_FILE process env var or '~/.aws/config' if - * isConfig is set to true) - * path to the file to be read. - * @option options isConfig [Boolean] (false) True to read config file. - * @return [map] object containing contents from file in key-value - * pairs. + * @param date [String] + * @param region [String] + * @param serviceName [String] + * @return [String] */ - loadFrom: function loadFrom(options) { - options = options || {}; - var isConfig = options.isConfig === true; - var filename = options.filename || this.getDefaultFilePath(isConfig); - if (!this.resolvedProfiles[filename]) { - var fileContent = parseFile(filename); - if (isConfig) { - Object.defineProperty(this.resolvedProfiles, filename, { - value: getProfiles(fileContent) - }); - } else { - Object.defineProperty(this.resolvedProfiles, filename, { value: fileContent }); - } - } - return this.resolvedProfiles[filename]; + createScope: function createScope(date, region, serviceName) { + return [ + date.substr(0, 8), + region, + serviceName, + v4Identifier + ].join('/'); }, /** - * Load sso sessions from config/credentials files and cache them - * for later use. If no file is specified it will try to load default file. + * @api private * - * @param options [map] information describing the file - * @option options filename [String] ('~/.aws/config' or defined by - * AWS_CONFIG_FILE process env var) - * @return [map] object containing contents from file in key-value - * pairs. + * @param credentials [Credentials] + * @param date [String] + * @param region [String] + * @param service [String] + * @param shouldCache [Boolean] + * @return [String] */ - loadSsoSessionsFrom: function loadSsoSessionsFrom(options) { - options = options || {}; - var filename = options.filename || this.getDefaultFilePath(true); - if (!this.resolvedSsoSessions[filename]) { - var fileContent = parseFile(filename); - Object.defineProperty(this.resolvedSsoSessions, filename, { - value: getSsoSessions(fileContent) - }); + getSigningKey: function getSigningKey( + credentials, + date, + region, + service, + shouldCache + ) { + var credsIdentifier = AWS.util.crypto + .hmac(credentials.secretAccessKey, credentials.accessKeyId, 'base64'); + var cacheKey = [credsIdentifier, date, region, service].join('_'); + shouldCache = shouldCache !== false; + if (shouldCache && (cacheKey in cachedSecret)) { + return cachedSecret[cacheKey]; } - return this.resolvedSsoSessions[filename]; - }, - /** - * @api private - */ - getDefaultFilePath: function getDefaultFilePath(isConfig) { - return path.join( - this.getHomeDir(), - '.aws', - isConfig ? 'config' : 'credentials' + var kDate = AWS.util.crypto.hmac( + 'AWS4' + credentials.secretAccessKey, + date, + 'buffer' ); + var kRegion = AWS.util.crypto.hmac(kDate, region, 'buffer'); + var kService = AWS.util.crypto.hmac(kRegion, service, 'buffer'); + + var signingKey = AWS.util.crypto.hmac(kService, v4Identifier, 'buffer'); + if (shouldCache) { + cachedSecret[cacheKey] = signingKey; + cacheQueue.push(cacheKey); + if (cacheQueue.length > maxCacheEntries) { + // remove the oldest entry (not the least recently used) + delete cachedSecret[cacheQueue.shift()]; + } + } + + return signingKey; }, /** * @api private + * + * Empties the derived signing key cache. Made available for testing purposes + * only. */ - getHomeDir: function getHomeDir() { - var env = process.env; - var home = env.HOME || - env.USERPROFILE || - (env.HOMEPATH ? ((env.HOMEDRIVE || 'C:/') + env.HOMEPATH) : null); + emptyCache: function emptyCache() { + cachedSecret = {}; + cacheQueue = []; + } +}; - if (home) { - return home; - } - if (typeof os.homedir === 'function') { - return os.homedir(); - } +/***/ }), - throw AWS.util.error( - new Error('Cannot load credentials, HOME path not set') - ); - } -}); +/***/ 68118: +/***/ ((module) => { -var IniLoader = AWS.IniLoader; +function AcceptorStateMachine(states, state) { + this.currentState = state || null; + this.states = states || {}; +} -module.exports = { - IniLoader: IniLoader -}; +AcceptorStateMachine.prototype.runTo = function runTo(finalState, done, bindObject, inputError) { + if (typeof finalState === 'function') { + inputError = bindObject; bindObject = done; + done = finalState; finalState = null; + } + var self = this; + var state = self.states[self.currentState]; + state.fn.call(bindObject || self, inputError, function(err) { + if (err) { + if (state.fail) self.currentState = state.fail; + else return done ? done.call(bindObject, err) : null; + } else { + if (state.accept) self.currentState = state.accept; + else return done ? done.call(bindObject) : null; + } + if (self.currentState === finalState) { + return done ? done.call(bindObject, err) : null; + } -/***/ }), + self.runTo(finalState, done, bindObject, err); + }); +}; -/***/ 98382: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { +AcceptorStateMachine.prototype.addState = function addState(name, acceptState, failState, fn) { + if (typeof acceptState === 'function') { + fn = acceptState; acceptState = null; failState = null; + } else if (typeof failState === 'function') { + fn = failState; failState = null; + } -var AWS = __nccwpck_require__(28437); + if (!this.currentState) this.currentState = name; + this.states[name] = { accept: acceptState, fail: failState, fn: fn }; + return this; +}; /** * @api private */ -AWS.Signers.Bearer = AWS.util.inherit(AWS.Signers.RequestSigner, { - constructor: function Bearer(request) { - AWS.Signers.RequestSigner.call(this, request); - }, - - addAuthorization: function addAuthorization(token) { - this.request.headers['Authorization'] = 'Bearer ' + token.token; - } -}); +module.exports = AcceptorStateMachine; /***/ }), -/***/ 60328: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 82647: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); -var inherit = AWS.util.inherit; /** - * @api private + * Represents AWS token object, which contains {token}, and optional + * {expireTime}. + * Creating a `Token` object allows you to pass around your + * token to configuration and service objects. + * + * Note that this class typically does not need to be constructed manually, + * as the {AWS.Config} and {AWS.Service} classes both accept simple + * options hashes with the two keys. The token from this object will be used + * automatically in operations which require them. + * + * ## Expiring and Refreshing Token + * + * Occasionally token can expire in the middle of a long-running + * application. In this case, the SDK will automatically attempt to + * refresh the token from the storage location if the Token + * class implements the {refresh} method. + * + * If you are implementing a token storage location, you + * will want to create a subclass of the `Token` class and + * override the {refresh} method. This method allows token to be + * retrieved from the backing store, be it a file system, database, or + * some network storage. The method should reset the token attributes + * on the object. + * + * @!attribute token + * @return [String] represents the literal token string. This will typically + * be a base64 encoded string. + * @!attribute expireTime + * @return [Date] a time when token should be considered expired. Used + * in conjunction with {expired}. + * @!attribute expired + * @return [Boolean] whether the token is expired and require a refresh. Used + * in conjunction with {expireTime}. */ -var expiresHeader = 'presigned-expires'; +AWS.Token = AWS.util.inherit({ + /** + * Creates a Token object with a given set of information in options hash. + * @option options token [String] represents the literal token string. + * @option options expireTime [Date] field representing the time at which + * the token expires. + * @example Create a token object + * var token = new AWS.Token({ token: 'token' }); + */ + constructor: function Token(options) { + // hide token from being displayed with util.inspect + AWS.util.hideProperties(this, ['token']); -/** - * @api private - */ -function signedUrlBuilder(request) { - var expires = request.httpRequest.headers[expiresHeader]; - var signerClass = request.service.getSignerClass(request); + this.expired = false; + this.expireTime = null; + this.refreshCallbacks = []; + if (arguments.length === 1) { + var options = arguments[0]; + this.token = options.token; + this.expireTime = options.expireTime; + } + }, - delete request.httpRequest.headers['User-Agent']; - delete request.httpRequest.headers['X-Amz-User-Agent']; + /** + * @return [Integer] the number of seconds before {expireTime} during which + * the token will be considered expired. + */ + expiryWindow: 15, - if (signerClass === AWS.Signers.V4) { - if (expires > 604800) { // one week expiry is invalid - var message = 'Presigning does not support expiry time greater ' + - 'than a week with SigV4 signing.'; - throw AWS.util.error(new Error(), { - code: 'InvalidExpiryTime', message: message, retryable: false + /** + * @return [Boolean] whether the Token object should call {refresh} + * @note Subclasses should override this method to provide custom refresh + * logic. + */ + needsRefresh: function needsRefresh() { + var currentTime = AWS.util.date.getDate().getTime(); + var adjustedTime = new Date(currentTime + this.expiryWindow * 1000); + + if (this.expireTime && adjustedTime > this.expireTime) + return true; + + return this.expired || !this.token; + }, + + /** + * Gets the existing token, refreshing them if they are not yet loaded + * or have expired. Users should call this method before using {refresh}, + * as this will not attempt to reload token when they are already + * loaded into the object. + * + * @callback callback function(err) + * When this callback is called with no error, it means either token + * do not need to be refreshed or refreshed token information has + * been loaded into the object (as the `token` property). + * @param err [Error] if an error occurred, this value will be filled + */ + get: function get(callback) { + var self = this; + if (this.needsRefresh()) { + this.refresh(function(err) { + if (!err) self.expired = false; // reset expired flag + if (callback) callback(err); }); + } else if (callback) { + callback(); } - request.httpRequest.headers[expiresHeader] = expires; - } else if (signerClass === AWS.Signers.S3) { - var now = request.service ? request.service.getSkewCorrectedDate() : AWS.util.date.getDate(); - request.httpRequest.headers[expiresHeader] = parseInt( - AWS.util.date.unixTimestamp(now) + expires, 10).toString(); - } else { - throw AWS.util.error(new Error(), { - message: 'Presigning only supports S3 or SigV4 signing.', - code: 'UnsupportedSigner', retryable: false - }); - } -} - -/** - * @api private - */ -function signedUrlSigner(request) { - var endpoint = request.httpRequest.endpoint; - var parsedUrl = AWS.util.urlParse(request.httpRequest.path); - var queryParams = {}; + }, - if (parsedUrl.search) { - queryParams = AWS.util.queryStringParse(parsedUrl.search.substr(1)); - } + /** + * @!method getPromise() + * Returns a 'thenable' promise. + * Gets the existing token, refreshing it if it's not yet loaded + * or have expired. Users should call this method before using {refresh}, + * as this will not attempt to reload token when it's already + * loaded into the object. + * + * Two callbacks can be provided to the `then` method on the returned promise. + * The first callback will be called if the promise is fulfilled, and the second + * callback will be called if the promise is rejected. + * @callback fulfilledCallback function() + * Called if the promise is fulfilled. When this callback is called, it means + * either token does not need to be refreshed or refreshed token information + * has been loaded into the object (as the `token` property). + * @callback rejectedCallback function(err) + * Called if the promise is rejected. + * @param err [Error] if an error occurred, this value will be filled. + * @return [Promise] A promise that represents the state of the `get` call. + * @example Calling the `getPromise` method. + * var promise = tokenProvider.getPromise(); + * promise.then(function() { ... }, function(err) { ... }); + */ - var auth = request.httpRequest.headers['Authorization'].split(' '); - if (auth[0] === 'AWS') { - auth = auth[1].split(':'); - queryParams['Signature'] = auth.pop(); - queryParams['AWSAccessKeyId'] = auth.join(':'); + /** + * @!method refreshPromise() + * Returns a 'thenable' promise. + * Refreshes the token. Users should call {get} before attempting + * to forcibly refresh token. + * + * Two callbacks can be provided to the `then` method on the returned promise. + * The first callback will be called if the promise is fulfilled, and the second + * callback will be called if the promise is rejected. + * @callback fulfilledCallback function() + * Called if the promise is fulfilled. When this callback is called, it + * means refreshed token information has been loaded into the object + * (as the `token` property). + * @callback rejectedCallback function(err) + * Called if the promise is rejected. + * @param err [Error] if an error occurred, this value will be filled. + * @return [Promise] A promise that represents the state of the `refresh` call. + * @example Calling the `refreshPromise` method. + * var promise = tokenProvider.refreshPromise(); + * promise.then(function() { ... }, function(err) { ... }); + */ - AWS.util.each(request.httpRequest.headers, function (key, value) { - if (key === expiresHeader) key = 'Expires'; - if (key.indexOf('x-amz-meta-') === 0) { - // Delete existing, potentially not normalized key - delete queryParams[key]; - key = key.toLowerCase(); - } - queryParams[key] = value; - }); - delete request.httpRequest.headers[expiresHeader]; - delete queryParams['Authorization']; - delete queryParams['Host']; - } else if (auth[0] === 'AWS4-HMAC-SHA256') { // SigV4 signing - auth.shift(); - var rest = auth.join(' '); - var signature = rest.match(/Signature=(.*?)(?:,|\s|\r?\n|$)/)[1]; - queryParams['X-Amz-Signature'] = signature; - delete queryParams['Expires']; - } + /** + * Refreshes the token. Users should call {get} before attempting + * to forcibly refresh token. + * + * @callback callback function(err) + * When this callback is called with no error, it means refreshed + * token information has been loaded into the object (as the + * `token` property). + * @param err [Error] if an error occurred, this value will be filled + * @note Subclasses should override this class to reset the + * {token} on the token object and then call the callback with + * any error information. + * @see get + */ + refresh: function refresh(callback) { + this.expired = false; + callback(); + }, - // build URL - endpoint.pathname = parsedUrl.pathname; - endpoint.search = AWS.util.queryParamsToString(queryParams); -} + /** + * @api private + * @param callback + */ + coalesceRefresh: function coalesceRefresh(callback, sync) { + var self = this; + if (self.refreshCallbacks.push(callback) === 1) { + self.load(function onLoad(err) { + AWS.util.arrayEach(self.refreshCallbacks, function(callback) { + if (sync) { + callback(err); + } else { + // callback could throw, so defer to ensure all callbacks are notified + AWS.util.defer(function () { + callback(err); + }); + } + }); + self.refreshCallbacks.length = 0; + }); + } + }, -/** - * @api private - */ -AWS.Signers.Presign = inherit({ /** * @api private + * @param callback */ - sign: function sign(request, expireTime, callback) { - request.httpRequest.headers[expiresHeader] = expireTime || 3600; - request.on('build', signedUrlBuilder); - request.on('sign', signedUrlSigner); - request.removeListener('afterBuild', - AWS.EventListeners.Core.SET_CONTENT_LENGTH); - request.removeListener('afterBuild', - AWS.EventListeners.Core.COMPUTE_SHA256); - - request.emit('beforePresign', [request]); - - if (callback) { - request.build(function() { - if (this.response.error) callback(this.response.error); - else { - callback(null, AWS.util.urlFormat(request.httpRequest.endpoint)); - } - }); - } else { - request.build(); - if (request.response.error) throw request.response.error; - return AWS.util.urlFormat(request.httpRequest.endpoint); - } + load: function load(callback) { + callback(); } }); /** * @api private */ -module.exports = AWS.Signers.Presign; +AWS.Token.addPromisesToClass = function addPromisesToClass(PromiseDependency) { + this.prototype.getPromise = AWS.util.promisifyMethod('get', PromiseDependency); + this.prototype.refreshPromise = AWS.util.promisifyMethod('refresh', PromiseDependency); +}; + +/** + * @api private + */ +AWS.Token.deletePromisesFromClass = function deletePromisesFromClass() { + delete this.prototype.getPromise; + delete this.prototype.refreshPromise; +}; + +AWS.util.addPromises(AWS.Token); /***/ }), -/***/ 9897: +/***/ 90327: /***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { var AWS = __nccwpck_require__(28437); +var crypto = __nccwpck_require__(6113); +var fs = __nccwpck_require__(57147); +var path = __nccwpck_require__(71017); +var iniLoader = AWS.util.iniLoader; -var inherit = AWS.util.inherit; +// Tracking refresh attempt to ensure refresh is not attempted more than once every 30 seconds. +var lastRefreshAttemptTime = 0; /** - * @api private + * Throws error is key is not present in token object. + * + * @param token [Object] Object to be validated. + * @param key [String] The key to be validated on the object. */ -AWS.Signers.RequestSigner = inherit({ - constructor: function RequestSigner(request) { - this.request = request; - }, - - setServiceClientId: function setServiceClientId(id) { - this.serviceClientId = id; - }, - - getServiceClientId: function getServiceClientId() { - return this.serviceClientId; +var validateTokenKey = function validateTokenKey(token, key) { + if (!token[key]) { + throw AWS.util.error( + new Error('Key "' + key + '" not present in SSO Token'), + { code: 'SSOTokenProviderFailure' } + ); } -}); +}; -AWS.Signers.RequestSigner.getVersion = function getVersion(version) { - switch (version) { - case 'v2': return AWS.Signers.V2; - case 'v3': return AWS.Signers.V3; - case 's3v4': return AWS.Signers.V4; - case 'v4': return AWS.Signers.V4; - case 's3': return AWS.Signers.S3; - case 'v3https': return AWS.Signers.V3Https; - case 'bearer': return AWS.Signers.Bearer; +/** + * Calls callback function with or without error based on provided times in case + * of unsuccessful refresh. + * + * @param currentTime [number] current time in milliseconds since ECMAScript epoch. + * @param tokenExpireTime [number] token expire time in milliseconds since ECMAScript epoch. + * @param callback [Function] Callback to call in case of error. + */ +var refreshUnsuccessful = function refreshUnsuccessful( + currentTime, + tokenExpireTime, + callback +) { + if (tokenExpireTime > currentTime) { + // Cached token is still valid, return. + callback(null); + } else { + // Token invalid, throw error requesting user to sso login. + throw AWS.util.error( + new Error('SSO Token refresh failed. Please log in using "aws sso login"'), + { code: 'SSOTokenProviderFailure' } + ); } - throw new Error('Unknown signing version ' + version); }; -__nccwpck_require__(28489); -__nccwpck_require__(66458); -__nccwpck_require__(24473); -__nccwpck_require__(26529); -__nccwpck_require__(58616); -__nccwpck_require__(60328); -__nccwpck_require__(98382); - - -/***/ }), - -/***/ 58616: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); -var inherit = AWS.util.inherit; - /** - * @api private + * Represents token loaded from disk derived from the AWS SSO device grant authorication flow. + * + * ## Using SSO Token Provider + * + * This provider is checked by default in the Node.js environment in TokenProviderChain. + * To use the SSO Token Provider, simply add your SSO Start URL and Region to the + * ~/.aws/config file in the following format: + * + * [default] + * sso_start_url = https://d-abc123.awsapps.com/start + * sso_region = us-east-1 + * + * ## Using custom profiles + * + * The SDK supports loading token for separate profiles. This can be done in two ways: + * + * 1. Set the `AWS_PROFILE` environment variable in your process prior to loading the SDK. + * 2. Directly load the AWS.SSOTokenProvider: + * + * ```javascript + * var ssoTokenProvider = new AWS.SSOTokenProvider({profile: 'myprofile'}); + * ``` + * + * @!macro nobrowser */ -AWS.Signers.S3 = inherit(AWS.Signers.RequestSigner, { +AWS.SSOTokenProvider = AWS.util.inherit(AWS.Token, { /** - * When building the stringToSign, these sub resource params should be - * part of the canonical resource string with their NON-decoded values + * Expiry window of five minutes. */ - subResources: { - 'acl': 1, - 'accelerate': 1, - 'analytics': 1, - 'cors': 1, - 'lifecycle': 1, - 'delete': 1, - 'inventory': 1, - 'location': 1, - 'logging': 1, - 'metrics': 1, - 'notification': 1, - 'partNumber': 1, - 'policy': 1, - 'requestPayment': 1, - 'replication': 1, - 'restore': 1, - 'tagging': 1, - 'torrent': 1, - 'uploadId': 1, - 'uploads': 1, - 'versionId': 1, - 'versioning': 1, - 'versions': 1, - 'website': 1 - }, + expiryWindow: 5 * 60, - // when building the stringToSign, these querystring params should be - // part of the canonical resource string with their NON-encoded values - responseHeaders: { - 'response-content-type': 1, - 'response-content-language': 1, - 'response-expires': 1, - 'response-cache-control': 1, - 'response-content-disposition': 1, - 'response-content-encoding': 1 + /** + * Creates a new token object from cached access token. + * + * @param options [map] a set of options + * @option options profile [String] (AWS_PROFILE env var or 'default') + * the name of the profile to load. + * @option options callback [Function] (err) Token is eagerly loaded + * by the constructor. When the callback is called with no error, the + * token has been loaded successfully. + */ + constructor: function SSOTokenProvider(options) { + AWS.Token.call(this); + + options = options || {}; + + this.expired = true; + this.profile = options.profile || process.env.AWS_PROFILE || AWS.util.defaultProfile; + this.get(options.callback || AWS.util.fn.noop); }, - addAuthorization: function addAuthorization(credentials, date) { - if (!this.request.headers['presigned-expires']) { - this.request.headers['X-Amz-Date'] = AWS.util.date.rfc822(date); - } + /** + * Reads sso_start_url from provided profile, and reads token from + * ~/.aws/sso/cache/.json + * + * Throws an error if required fields token and expiresAt are missing. + * Throws an error if token has expired and metadata to perform refresh is + * not available. + * Attempts to refresh the token if it's within 5 minutes before expiry time. + * + * @api private + */ + load: function load(callback) { + var self = this; + var profiles = iniLoader.loadFrom({ isConfig: true }); + var profile = profiles[this.profile] || {}; - if (credentials.sessionToken) { - // presigned URLs require this header to be lowercased - this.request.headers['x-amz-security-token'] = credentials.sessionToken; + if (Object.keys(profile).length === 0) { + throw AWS.util.error( + new Error('Profile "' + this.profile + '" not found'), + { code: 'SSOTokenProviderFailure' } + ); + } else if (!profile['sso_session']) { + throw AWS.util.error( + new Error('Profile "' + this.profile + '" is missing required property "sso_session".'), + { code: 'SSOTokenProviderFailure' } + ); } - var signature = this.sign(credentials.secretAccessKey, this.stringToSign()); - var auth = 'AWS ' + credentials.accessKeyId + ':' + signature; + var ssoSessionName = profile['sso_session']; + var ssoSessions = iniLoader.loadSsoSessionsFrom(); + var ssoSession = ssoSessions[ssoSessionName]; - this.request.headers['Authorization'] = auth; - }, + if (!ssoSession) { + throw AWS.util.error( + new Error('Sso session "' + ssoSessionName + '" not found'), + { code: 'SSOTokenProviderFailure' } + ); + } else if (!ssoSession['sso_start_url']) { + throw AWS.util.error( + new Error('Sso session "' + this.profile + '" is missing required property "sso_start_url".'), + { code: 'SSOTokenProviderFailure' } + ); + } else if (!ssoSession['sso_region']) { + throw AWS.util.error( + new Error('Sso session "' + this.profile + '" is missing required property "sso_region".'), + { code: 'SSOTokenProviderFailure' } + ); + } - stringToSign: function stringToSign() { - var r = this.request; + var hasher = crypto.createHash('sha1'); + var fileName = hasher.update(ssoSessionName).digest('hex') + '.json'; + var cachePath = path.join(iniLoader.getHomeDir(), '.aws', 'sso', 'cache', fileName); + var tokenFromCache = JSON.parse(fs.readFileSync(cachePath)); - var parts = []; - parts.push(r.method); - parts.push(r.headers['Content-MD5'] || ''); - parts.push(r.headers['Content-Type'] || ''); + if (!tokenFromCache) { + throw AWS.util.error( + new Error('Cached token not found. Please log in using "aws sso login"' + + ' for profile "' + this.profile + '".'), + { code: 'SSOTokenProviderFailure' } + ); + } - // This is the "Date" header, but we use X-Amz-Date. - // The S3 signing mechanism requires us to pass an empty - // string for this Date header regardless. - parts.push(r.headers['presigned-expires'] || ''); + validateTokenKey(tokenFromCache, 'accessToken'); + validateTokenKey(tokenFromCache, 'expiresAt'); - var headers = this.canonicalizedAmzHeaders(); - if (headers) parts.push(headers); - parts.push(this.canonicalizedResource()); + var currentTime = AWS.util.date.getDate().getTime(); + var adjustedTime = new Date(currentTime + this.expiryWindow * 1000); + var tokenExpireTime = new Date(tokenFromCache['expiresAt']); - return parts.join('\n'); + if (tokenExpireTime > adjustedTime) { + // Token is valid and not expired. + self.token = tokenFromCache.accessToken; + self.expireTime = tokenExpireTime; + self.expired = false; + callback(null); + return; + } - }, + // Skip new refresh, if last refresh was done within 30 seconds. + if (currentTime - lastRefreshAttemptTime < 30 * 1000) { + refreshUnsuccessful(currentTime, tokenExpireTime, callback); + return; + } - canonicalizedAmzHeaders: function canonicalizedAmzHeaders() { + // Token is in expiry window, refresh from SSOOIDC.createToken() call. + validateTokenKey(tokenFromCache, 'clientId'); + validateTokenKey(tokenFromCache, 'clientSecret'); + validateTokenKey(tokenFromCache, 'refreshToken'); - var amzHeaders = []; + if (!self.service || self.service.config.region !== ssoSession.sso_region) { + self.service = new AWS.SSOOIDC({ region: ssoSession.sso_region }); + } - AWS.util.each(this.request.headers, function (name) { - if (name.match(/^x-amz-/i)) - amzHeaders.push(name); - }); + var params = { + clientId: tokenFromCache.clientId, + clientSecret: tokenFromCache.clientSecret, + refreshToken: tokenFromCache.refreshToken, + grantType: 'refresh_token', + }; - amzHeaders.sort(function (a, b) { - return a.toLowerCase() < b.toLowerCase() ? -1 : 1; - }); + lastRefreshAttemptTime = AWS.util.date.getDate().getTime(); + self.service.createToken(params, function(err, data) { + if (err || !data) { + refreshUnsuccessful(currentTime, tokenExpireTime, callback); + } else { + try { + validateTokenKey(data, 'accessToken'); + validateTokenKey(data, 'expiresIn'); + self.expired = false; + self.token = data.accessToken; + self.expireTime = new Date(Date.now() + data.expiresIn * 1000); + callback(null); - var parts = []; - AWS.util.arrayEach.call(this, amzHeaders, function (name) { - parts.push(name.toLowerCase() + ':' + String(this.request.headers[name])); + try { + // Write updated token data to disk. + tokenFromCache.accessToken = data.accessToken; + tokenFromCache.expiresAt = self.expireTime.toISOString(); + tokenFromCache.refreshToken = data.refreshToken; + fs.writeFileSync(cachePath, JSON.stringify(tokenFromCache, null, 2)); + } catch (error) { + // Swallow error if unable to write token to file. + } + } catch (error) { + refreshUnsuccessful(currentTime, tokenExpireTime, callback); + } + } }); - - return parts.join('\n'); - }, - canonicalizedResource: function canonicalizedResource() { - - var r = this.request; + /** + * Loads the cached access token from disk. + * + * @callback callback function(err) + * Called after the AWS SSO process has been executed. When this + * callback is called with no error, it means that the token information + * has been loaded into the object (as the `token` property). + * @param err [Error] if an error occurred, this value will be filled. + * @see get + */ + refresh: function refresh(callback) { + iniLoader.clearCachedFiles(); + this.coalesceRefresh(callback || AWS.util.fn.callback); + }, +}); - var parts = r.path.split('?'); - var path = parts[0]; - var querystring = parts[1]; - var resource = ''; +/***/ }), - if (r.virtualHostedBucket) - resource += '/' + r.virtualHostedBucket; +/***/ 50126: +/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { - resource += path; +var AWS = __nccwpck_require__(28437); - if (querystring) { +/** + * Creates a token provider chain that searches for token in a list of + * token providers specified by the {providers} property. + * + * By default, the chain will use the {defaultProviders} to resolve token. + * + * ## Setting Providers + * + * Each provider in the {providers} list should be a function that returns + * a {AWS.Token} object, or a hardcoded token object. The function + * form allows for delayed execution of the Token construction. + * + * ## Resolving Token from a Chain + * + * Call {resolve} to return the first valid token object that can be + * loaded by the provider chain. + * + * For example, to resolve a chain with a custom provider that checks a file + * on disk after the set of {defaultProviders}: + * + * ```javascript + * var diskProvider = new FileTokenProvider('./token.json'); + * var chain = new AWS.TokenProviderChain(); + * chain.providers.push(diskProvider); + * chain.resolve(); + * ``` + * + * The above code will return the `diskProvider` object if the + * file contains token and the `defaultProviders` do not contain + * any token. + * + * @!attribute providers + * @return [Array] + * a list of token objects or functions that return token + * objects. If the provider is a function, the function will be + * executed lazily when the provider needs to be checked for valid + * token. By default, this object will be set to the {defaultProviders}. + * @see defaultProviders + */ +AWS.TokenProviderChain = AWS.util.inherit(AWS.Token, { - // collect a list of sub resources and query params that need to be signed - var resources = []; + /** + * Creates a new TokenProviderChain with a default set of providers + * specified by {defaultProviders}. + */ + constructor: function TokenProviderChain(providers) { + if (providers) { + this.providers = providers; + } else { + this.providers = AWS.TokenProviderChain.defaultProviders.slice(0); + } + this.resolveCallbacks = []; + }, - AWS.util.arrayEach.call(this, querystring.split('&'), function (param) { - var name = param.split('=')[0]; - var value = param.split('=')[1]; - if (this.subResources[name] || this.responseHeaders[name]) { - var subresource = { name: name }; - if (value !== undefined) { - if (this.subResources[name]) { - subresource.value = value; - } else { - subresource.value = decodeURIComponent(value); - } - } - resources.push(subresource); - } - }); + /** + * @!method resolvePromise() + * Returns a 'thenable' promise. + * Resolves the provider chain by searching for the first token in {providers}. + * + * Two callbacks can be provided to the `then` method on the returned promise. + * The first callback will be called if the promise is fulfilled, and the second + * callback will be called if the promise is rejected. + * @callback fulfilledCallback function(token) + * Called if the promise is fulfilled and the provider resolves the chain + * to a token object + * @param token [AWS.Token] the token object resolved by the provider chain. + * @callback rejectedCallback function(error) + * Called if the promise is rejected. + * @param err [Error] the error object returned if no token is found. + * @return [Promise] A promise that represents the state of the `resolve` method call. + * @example Calling the `resolvePromise` method. + * var promise = chain.resolvePromise(); + * promise.then(function(token) { ... }, function(err) { ... }); + */ - resources.sort(function (a, b) { return a.name < b.name ? -1 : 1; }); + /** + * Resolves the provider chain by searching for the first token in {providers}. + * + * @callback callback function(err, token) + * Called when the provider resolves the chain to a token object + * or null if no token can be found. + * + * @param err [Error] the error object returned if no token is found. + * @param token [AWS.Token] the token object resolved by the provider chain. + * @return [AWS.TokenProviderChain] the provider, for chaining. + */ + resolve: function resolve(callback) { + var self = this; + if (self.providers.length === 0) { + callback(new Error('No providers')); + return self; + } - if (resources.length) { + if (self.resolveCallbacks.push(callback) === 1) { + var index = 0; + var providers = self.providers.slice(0); - querystring = []; - AWS.util.arrayEach(resources, function (res) { - if (res.value === undefined) { - querystring.push(res.name); - } else { - querystring.push(res.name + '=' + res.value); - } - }); + function resolveNext(err, token) { + if ((!err && token) || index === providers.length) { + AWS.util.arrayEach(self.resolveCallbacks, function (callback) { + callback(err, token); + }); + self.resolveCallbacks.length = 0; + return; + } - resource += '?' + querystring.join('&'); + var provider = providers[index++]; + if (typeof provider === 'function') { + token = provider.call(); + } else { + token = provider; + } + + if (token.get) { + token.get(function (getErr) { + resolveNext(getErr, getErr ? null : token); + }); + } else { + resolveNext(null, token); + } } + resolveNext(); } - return resource; - - }, - - sign: function sign(secret, string) { - return AWS.util.crypto.hmac(secret, string, 'base64', 'sha1'); + return self; } }); +/** + * The default set of providers used by a vanilla TokenProviderChain. + * + * In the browser: + * + * ```javascript + * AWS.TokenProviderChain.defaultProviders = [] + * ``` + * + * In Node.js: + * + * ```javascript + * AWS.TokenProviderChain.defaultProviders = [ + * function () { return new AWS.SSOTokenProvider(); }, + * ] + * ``` + */ +AWS.TokenProviderChain.defaultProviders = []; + /** * @api private */ -module.exports = AWS.Signers.S3; +AWS.TokenProviderChain.addPromisesToClass = function addPromisesToClass(PromiseDependency) { + this.prototype.resolvePromise = AWS.util.promisifyMethod('resolve', PromiseDependency); +}; + +/** + * @api private + */ +AWS.TokenProviderChain.deletePromisesFromClass = function deletePromisesFromClass() { + delete this.prototype.resolvePromise; +}; + +AWS.util.addPromises(AWS.TokenProviderChain); /***/ }), -/***/ 28489: +/***/ 77985: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var AWS = __nccwpck_require__(28437); -var inherit = AWS.util.inherit; +/* eslint guard-for-in:0 */ +var AWS; /** + * A set of utility methods for use with the AWS SDK. + * + * @!attribute abort + * Return this value from an iterator function {each} or {arrayEach} + * to break out of the iteration. + * @example Breaking out of an iterator function + * AWS.util.each({a: 1, b: 2, c: 3}, function(key, value) { + * if (key == 'b') return AWS.util.abort; + * }); + * @see each + * @see arrayEach * @api private */ -AWS.Signers.V2 = inherit(AWS.Signers.RequestSigner, { - addAuthorization: function addAuthorization(credentials, date) { +var util = { + environment: 'nodejs', + engine: function engine() { + if (util.isBrowser() && typeof navigator !== 'undefined') { + return navigator.userAgent; + } else { + var engine = process.platform + '/' + process.version; + if (process.env.AWS_EXECUTION_ENV) { + engine += ' exec-env/' + process.env.AWS_EXECUTION_ENV; + } + return engine; + } + }, - if (!date) date = AWS.util.date.getDate(); + userAgent: function userAgent() { + var name = util.environment; + var agent = 'aws-sdk-' + name + '/' + (__nccwpck_require__(28437).VERSION); + if (name === 'nodejs') agent += ' ' + util.engine(); + return agent; + }, - var r = this.request; + uriEscape: function uriEscape(string) { + var output = encodeURIComponent(string); + output = output.replace(/[^A-Za-z0-9_.~\-%]+/g, escape); - r.params.Timestamp = AWS.util.date.iso8601(date); - r.params.SignatureVersion = '2'; - r.params.SignatureMethod = 'HmacSHA256'; - r.params.AWSAccessKeyId = credentials.accessKeyId; + // AWS percent-encodes some extra non-standard characters in a URI + output = output.replace(/[*]/g, function(ch) { + return '%' + ch.charCodeAt(0).toString(16).toUpperCase(); + }); - if (credentials.sessionToken) { - r.params.SecurityToken = credentials.sessionToken; - } + return output; + }, - delete r.params.Signature; // delete old Signature for re-signing - r.params.Signature = this.signature(credentials); + uriEscapePath: function uriEscapePath(string) { + var parts = []; + util.arrayEach(string.split('/'), function (part) { + parts.push(util.uriEscape(part)); + }); + return parts.join('/'); + }, - r.body = AWS.util.queryParamsToString(r.params); - r.headers['Content-Length'] = r.body.length; + urlParse: function urlParse(url) { + return util.url.parse(url); }, - signature: function signature(credentials) { - return AWS.util.crypto.hmac(credentials.secretAccessKey, this.stringToSign(), 'base64'); + urlFormat: function urlFormat(url) { + return util.url.format(url); }, - stringToSign: function stringToSign() { - var parts = []; - parts.push(this.request.method); - parts.push(this.request.endpoint.host.toLowerCase()); - parts.push(this.request.pathname()); - parts.push(AWS.util.queryParamsToString(this.request.params)); - return parts.join('\n'); - } + queryStringParse: function queryStringParse(qs) { + return util.querystring.parse(qs); + }, -}); + queryParamsToString: function queryParamsToString(params) { + var items = []; + var escape = util.uriEscape; + var sortedKeys = Object.keys(params).sort(); -/** - * @api private - */ -module.exports = AWS.Signers.V2; + util.arrayEach(sortedKeys, function(name) { + var value = params[name]; + var ename = escape(name); + var result = ename + '='; + if (Array.isArray(value)) { + var vals = []; + util.arrayEach(value, function(item) { vals.push(escape(item)); }); + result = ename + '=' + vals.sort().join('&' + ename + '='); + } else if (value !== undefined && value !== null) { + result = ename + '=' + escape(value); + } + items.push(result); + }); + return items.join('&'); + }, -/***/ }), + readFileSync: function readFileSync(path) { + if (util.isBrowser()) return null; + return (__nccwpck_require__(57147).readFileSync)(path, 'utf-8'); + }, -/***/ 66458: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + base64: { + encode: function encode64(string) { + if (typeof string === 'number') { + throw util.error(new Error('Cannot base64 encode number ' + string)); + } + if (string === null || typeof string === 'undefined') { + return string; + } + var buf = util.buffer.toBuffer(string); + return buf.toString('base64'); + }, -var AWS = __nccwpck_require__(28437); -var inherit = AWS.util.inherit; + decode: function decode64(string) { + if (typeof string === 'number') { + throw util.error(new Error('Cannot base64 decode number ' + string)); + } + if (string === null || typeof string === 'undefined') { + return string; + } + return util.buffer.toBuffer(string, 'base64'); + } -/** - * @api private - */ -AWS.Signers.V3 = inherit(AWS.Signers.RequestSigner, { - addAuthorization: function addAuthorization(credentials, date) { + }, - var datetime = AWS.util.date.rfc822(date); + buffer: { + /** + * Buffer constructor for Node buffer and buffer pollyfill + */ + toBuffer: function(data, encoding) { + return (typeof util.Buffer.from === 'function' && util.Buffer.from !== Uint8Array.from) ? + util.Buffer.from(data, encoding) : new util.Buffer(data, encoding); + }, - this.request.headers['X-Amz-Date'] = datetime; + alloc: function(size, fill, encoding) { + if (typeof size !== 'number') { + throw new Error('size passed to alloc must be a number.'); + } + if (typeof util.Buffer.alloc === 'function') { + return util.Buffer.alloc(size, fill, encoding); + } else { + var buf = new util.Buffer(size); + if (fill !== undefined && typeof buf.fill === 'function') { + buf.fill(fill, undefined, undefined, encoding); + } + return buf; + } + }, - if (credentials.sessionToken) { - this.request.headers['x-amz-security-token'] = credentials.sessionToken; - } + toStream: function toStream(buffer) { + if (!util.Buffer.isBuffer(buffer)) buffer = util.buffer.toBuffer(buffer); - this.request.headers['X-Amzn-Authorization'] = - this.authorization(credentials, datetime); + var readable = new (util.stream.Readable)(); + var pos = 0; + readable._read = function(size) { + if (pos >= buffer.length) return readable.push(null); - }, + var end = pos + size; + if (end > buffer.length) end = buffer.length; + readable.push(buffer.slice(pos, end)); + pos = end; + }; - authorization: function authorization(credentials) { - return 'AWS3 ' + - 'AWSAccessKeyId=' + credentials.accessKeyId + ',' + - 'Algorithm=HmacSHA256,' + - 'SignedHeaders=' + this.signedHeaders() + ',' + - 'Signature=' + this.signature(credentials); - }, + return readable; + }, - signedHeaders: function signedHeaders() { - var headers = []; - AWS.util.arrayEach(this.headersToSign(), function iterator(h) { - headers.push(h.toLowerCase()); - }); - return headers.sort().join(';'); - }, + /** + * Concatenates a list of Buffer objects. + */ + concat: function(buffers) { + var length = 0, + offset = 0, + buffer = null, i; - canonicalHeaders: function canonicalHeaders() { - var headers = this.request.headers; - var parts = []; - AWS.util.arrayEach(this.headersToSign(), function iterator(h) { - parts.push(h.toLowerCase().trim() + ':' + String(headers[h]).trim()); - }); - return parts.sort().join('\n') + '\n'; - }, + for (i = 0; i < buffers.length; i++) { + length += buffers[i].length; + } - headersToSign: function headersToSign() { - var headers = []; - AWS.util.each(this.request.headers, function iterator(k) { - if (k === 'Host' || k === 'Content-Encoding' || k.match(/^X-Amz/i)) { - headers.push(k); + buffer = util.buffer.alloc(length); + + for (i = 0; i < buffers.length; i++) { + buffers[i].copy(buffer, offset); + offset += buffers[i].length; } - }); - return headers; - }, - signature: function signature(credentials) { - return AWS.util.crypto.hmac(credentials.secretAccessKey, this.stringToSign(), 'base64'); + return buffer; + } }, - stringToSign: function stringToSign() { - var parts = []; - parts.push(this.request.method); - parts.push('/'); - parts.push(''); - parts.push(this.canonicalHeaders()); - parts.push(this.request.body); - return AWS.util.crypto.sha256(parts.join('\n')); - } + string: { + byteLength: function byteLength(string) { + if (string === null || string === undefined) return 0; + if (typeof string === 'string') string = util.buffer.toBuffer(string); -}); + if (typeof string.byteLength === 'number') { + return string.byteLength; + } else if (typeof string.length === 'number') { + return string.length; + } else if (typeof string.size === 'number') { + return string.size; + } else if (typeof string.path === 'string') { + return (__nccwpck_require__(57147).lstatSync)(string.path).size; + } else { + throw util.error(new Error('Cannot determine length of ' + string), + { object: string }); + } + }, -/** - * @api private - */ -module.exports = AWS.Signers.V3; + upperFirst: function upperFirst(string) { + return string[0].toUpperCase() + string.substr(1); + }, + lowerFirst: function lowerFirst(string) { + return string[0].toLowerCase() + string.substr(1); + } + }, -/***/ }), + ini: { + parse: function string(ini) { + var currentSection, map = {}; + util.arrayEach(ini.split(/\r?\n/), function(line) { + line = line.split(/(^|\s)[;#]/)[0].trim(); // remove comments and trim + var isSection = line[0] === '[' && line[line.length - 1] === ']'; + if (isSection) { + currentSection = line.substring(1, line.length - 1); + if (currentSection === '__proto__' || currentSection.split(/\s/)[1] === '__proto__') { + throw util.error( + new Error('Cannot load profile name \'' + currentSection + '\' from shared ini file.') + ); + } + } else if (currentSection) { + var indexOfEqualsSign = line.indexOf('='); + var start = 0; + var end = line.length - 1; + var isAssignment = + indexOfEqualsSign !== -1 && indexOfEqualsSign !== start && indexOfEqualsSign !== end; -/***/ 24473: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + if (isAssignment) { + var name = line.substring(0, indexOfEqualsSign).trim(); + var value = line.substring(indexOfEqualsSign + 1).trim(); -var AWS = __nccwpck_require__(28437); -var inherit = AWS.util.inherit; + map[currentSection] = map[currentSection] || {}; + map[currentSection][name] = value; + } + } + }); -__nccwpck_require__(66458); + return map; + } + }, -/** - * @api private - */ -AWS.Signers.V3Https = inherit(AWS.Signers.V3, { - authorization: function authorization(credentials) { - return 'AWS3-HTTPS ' + - 'AWSAccessKeyId=' + credentials.accessKeyId + ',' + - 'Algorithm=HmacSHA256,' + - 'Signature=' + this.signature(credentials); + fn: { + noop: function() {}, + callback: function (err) { if (err) throw err; }, + + /** + * Turn a synchronous function into as "async" function by making it call + * a callback. The underlying function is called with all but the last argument, + * which is treated as the callback. The callback is passed passed a first argument + * of null on success to mimick standard node callbacks. + */ + makeAsync: function makeAsync(fn, expectedArgs) { + if (expectedArgs && expectedArgs <= fn.length) { + return fn; + } + + return function() { + var args = Array.prototype.slice.call(arguments, 0); + var callback = args.pop(); + var result = fn.apply(null, args); + callback(result); + }; + } }, - stringToSign: function stringToSign() { - return this.request.headers['X-Amz-Date']; - } -}); + /** + * Date and time utility functions. + */ + date: { -/** - * @api private - */ -module.exports = AWS.Signers.V3Https; + /** + * @return [Date] the current JavaScript date object. Since all + * AWS services rely on this date object, you can override + * this function to provide a special time value to AWS service + * requests. + */ + getDate: function getDate() { + if (!AWS) AWS = __nccwpck_require__(28437); + if (AWS.config.systemClockOffset) { // use offset when non-zero + return new Date(new Date().getTime() + AWS.config.systemClockOffset); + } else { + return new Date(); + } + }, + /** + * @return [String] the date in ISO-8601 format + */ + iso8601: function iso8601(date) { + if (date === undefined) { date = util.date.getDate(); } + return date.toISOString().replace(/\.\d{3}Z$/, 'Z'); + }, -/***/ }), + /** + * @return [String] the date in RFC 822 format + */ + rfc822: function rfc822(date) { + if (date === undefined) { date = util.date.getDate(); } + return date.toUTCString(); + }, -/***/ 26529: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + /** + * @return [Integer] the UNIX timestamp value for the current time + */ + unixTimestamp: function unixTimestamp(date) { + if (date === undefined) { date = util.date.getDate(); } + return date.getTime() / 1000; + }, -var AWS = __nccwpck_require__(28437); -var v4Credentials = __nccwpck_require__(62660); -var inherit = AWS.util.inherit; + /** + * @param [String,number,Date] date + * @return [Date] + */ + from: function format(date) { + if (typeof date === 'number') { + return new Date(date * 1000); // unix timestamp + } else { + return new Date(date); + } + }, -/** - * @api private - */ -var expiresHeader = 'presigned-expires'; + /** + * Given a Date or date-like value, this function formats the + * date into a string of the requested value. + * @param [String,number,Date] date + * @param [String] formatter Valid formats are: + # * 'iso8601' + # * 'rfc822' + # * 'unixTimestamp' + * @return [String] + */ + format: function format(date, formatter) { + if (!formatter) formatter = 'iso8601'; + return util.date[formatter](util.date.from(date)); + }, + + parseTimestamp: function parseTimestamp(value) { + if (typeof value === 'number') { // unix timestamp (number) + return new Date(value * 1000); + } else if (value.match(/^\d+$/)) { // unix timestamp + return new Date(value * 1000); + } else if (value.match(/^\d{4}/)) { // iso8601 + return new Date(value); + } else if (value.match(/^\w{3},/)) { // rfc822 + return new Date(value); + } else { + throw util.error( + new Error('unhandled timestamp format: ' + value), + {code: 'TimestampParserError'}); + } + } + + }, + + crypto: { + crc32Table: [ + 0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA, 0x076DC419, + 0x706AF48F, 0xE963A535, 0x9E6495A3, 0x0EDB8832, 0x79DCB8A4, + 0xE0D5E91E, 0x97D2D988, 0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, + 0x90BF1D91, 0x1DB71064, 0x6AB020F2, 0xF3B97148, 0x84BE41DE, + 0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7, 0x136C9856, + 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC, 0x14015C4F, 0x63066CD9, + 0xFA0F3D63, 0x8D080DF5, 0x3B6E20C8, 0x4C69105E, 0xD56041E4, + 0xA2677172, 0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B, + 0x35B5A8FA, 0x42B2986C, 0xDBBBC9D6, 0xACBCF940, 0x32D86CE3, + 0x45DF5C75, 0xDCD60DCF, 0xABD13D59, 0x26D930AC, 0x51DE003A, + 0xC8D75180, 0xBFD06116, 0x21B4F4B5, 0x56B3C423, 0xCFBA9599, + 0xB8BDA50F, 0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924, + 0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D, 0x76DC4190, + 0x01DB7106, 0x98D220BC, 0xEFD5102A, 0x71B18589, 0x06B6B51F, + 0x9FBFE4A5, 0xE8B8D433, 0x7807C9A2, 0x0F00F934, 0x9609A88E, + 0xE10E9818, 0x7F6A0DBB, 0x086D3D2D, 0x91646C97, 0xE6635C01, + 0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E, 0x6C0695ED, + 0x1B01A57B, 0x8208F4C1, 0xF50FC457, 0x65B0D9C6, 0x12B7E950, + 0x8BBEB8EA, 0xFCB9887C, 0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, + 0xFBD44C65, 0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2, + 0x4ADFA541, 0x3DD895D7, 0xA4D1C46D, 0xD3D6F4FB, 0x4369E96A, + 0x346ED9FC, 0xAD678846, 0xDA60B8D0, 0x44042D73, 0x33031DE5, + 0xAA0A4C5F, 0xDD0D7CC9, 0x5005713C, 0x270241AA, 0xBE0B1010, + 0xC90C2086, 0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F, + 0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4, 0x59B33D17, + 0x2EB40D81, 0xB7BD5C3B, 0xC0BA6CAD, 0xEDB88320, 0x9ABFB3B6, + 0x03B6E20C, 0x74B1D29A, 0xEAD54739, 0x9DD277AF, 0x04DB2615, + 0x73DC1683, 0xE3630B12, 0x94643B84, 0x0D6D6A3E, 0x7A6A5AA8, + 0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1, 0xF00F9344, + 0x8708A3D2, 0x1E01F268, 0x6906C2FE, 0xF762575D, 0x806567CB, + 0x196C3671, 0x6E6B06E7, 0xFED41B76, 0x89D32BE0, 0x10DA7A5A, + 0x67DD4ACC, 0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5, + 0xD6D6A3E8, 0xA1D1937E, 0x38D8C2C4, 0x4FDFF252, 0xD1BB67F1, + 0xA6BC5767, 0x3FB506DD, 0x48B2364B, 0xD80D2BDA, 0xAF0A1B4C, + 0x36034AF6, 0x41047A60, 0xDF60EFC3, 0xA867DF55, 0x316E8EEF, + 0x4669BE79, 0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236, + 0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F, 0xC5BA3BBE, + 0xB2BD0B28, 0x2BB45A92, 0x5CB36A04, 0xC2D7FFA7, 0xB5D0CF31, + 0x2CD99E8B, 0x5BDEAE1D, 0x9B64C2B0, 0xEC63F226, 0x756AA39C, + 0x026D930A, 0x9C0906A9, 0xEB0E363F, 0x72076785, 0x05005713, + 0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38, 0x92D28E9B, + 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21, 0x86D3D2D4, 0xF1D4E242, + 0x68DDB3F8, 0x1FDA836E, 0x81BE16CD, 0xF6B9265B, 0x6FB077E1, + 0x18B74777, 0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C, + 0x8F659EFF, 0xF862AE69, 0x616BFFD3, 0x166CCF45, 0xA00AE278, + 0xD70DD2EE, 0x4E048354, 0x3903B3C2, 0xA7672661, 0xD06016F7, + 0x4969474D, 0x3E6E77DB, 0xAED16A4A, 0xD9D65ADC, 0x40DF0B66, + 0x37D83BF0, 0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9, + 0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6, 0xBAD03605, + 0xCDD70693, 0x54DE5729, 0x23D967BF, 0xB3667A2E, 0xC4614AB8, + 0x5D681B02, 0x2A6F2B94, 0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, + 0x2D02EF8D], -/** - * @api private - */ -AWS.Signers.V4 = inherit(AWS.Signers.RequestSigner, { - constructor: function V4(request, serviceName, options) { - AWS.Signers.RequestSigner.call(this, request); - this.serviceName = serviceName; - options = options || {}; - this.signatureCache = typeof options.signatureCache === 'boolean' ? options.signatureCache : true; - this.operation = options.operation; - this.signatureVersion = options.signatureVersion; - }, + crc32: function crc32(data) { + var tbl = util.crypto.crc32Table; + var crc = 0 ^ -1; - algorithm: 'AWS4-HMAC-SHA256', + if (typeof data === 'string') { + data = util.buffer.toBuffer(data); + } - addAuthorization: function addAuthorization(credentials, date) { - var datetime = AWS.util.date.iso8601(date).replace(/[:\-]|\.\d{3}/g, ''); + for (var i = 0; i < data.length; i++) { + var code = data.readUInt8(i); + crc = (crc >>> 8) ^ tbl[(crc ^ code) & 0xFF]; + } + return (crc ^ -1) >>> 0; + }, - if (this.isPresigned()) { - this.updateForPresigned(credentials, datetime); - } else { - this.addHeaders(credentials, datetime); - } + hmac: function hmac(key, string, digest, fn) { + if (!digest) digest = 'binary'; + if (digest === 'buffer') { digest = undefined; } + if (!fn) fn = 'sha256'; + if (typeof string === 'string') string = util.buffer.toBuffer(string); + return util.crypto.lib.createHmac(fn, key).update(string).digest(digest); + }, - this.request.headers['Authorization'] = - this.authorization(credentials, datetime); - }, + md5: function md5(data, digest, callback) { + return util.crypto.hash('md5', data, digest, callback); + }, - addHeaders: function addHeaders(credentials, datetime) { - this.request.headers['X-Amz-Date'] = datetime; - if (credentials.sessionToken) { - this.request.headers['x-amz-security-token'] = credentials.sessionToken; - } - }, + sha256: function sha256(data, digest, callback) { + return util.crypto.hash('sha256', data, digest, callback); + }, - updateForPresigned: function updateForPresigned(credentials, datetime) { - var credString = this.credentialString(datetime); - var qs = { - 'X-Amz-Date': datetime, - 'X-Amz-Algorithm': this.algorithm, - 'X-Amz-Credential': credentials.accessKeyId + '/' + credString, - 'X-Amz-Expires': this.request.headers[expiresHeader], - 'X-Amz-SignedHeaders': this.signedHeaders() - }; + hash: function(algorithm, data, digest, callback) { + var hash = util.crypto.createHash(algorithm); + if (!digest) { digest = 'binary'; } + if (digest === 'buffer') { digest = undefined; } + if (typeof data === 'string') data = util.buffer.toBuffer(data); + var sliceFn = util.arraySliceFn(data); + var isBuffer = util.Buffer.isBuffer(data); + //Identifying objects with an ArrayBuffer as buffers + if (util.isBrowser() && typeof ArrayBuffer !== 'undefined' && data && data.buffer instanceof ArrayBuffer) isBuffer = true; - if (credentials.sessionToken) { - qs['X-Amz-Security-Token'] = credentials.sessionToken; - } + if (callback && typeof data === 'object' && + typeof data.on === 'function' && !isBuffer) { + data.on('data', function(chunk) { hash.update(chunk); }); + data.on('error', function(err) { callback(err); }); + data.on('end', function() { callback(null, hash.digest(digest)); }); + } else if (callback && sliceFn && !isBuffer && + typeof FileReader !== 'undefined') { + // this might be a File/Blob + var index = 0, size = 1024 * 512; + var reader = new FileReader(); + reader.onerror = function() { + callback(new Error('Failed to read data.')); + }; + reader.onload = function() { + var buf = new util.Buffer(new Uint8Array(reader.result)); + hash.update(buf); + index += buf.length; + reader._continueReading(); + }; + reader._continueReading = function() { + if (index >= data.size) { + callback(null, hash.digest(digest)); + return; + } - if (this.request.headers['Content-Type']) { - qs['Content-Type'] = this.request.headers['Content-Type']; - } - if (this.request.headers['Content-MD5']) { - qs['Content-MD5'] = this.request.headers['Content-MD5']; - } - if (this.request.headers['Cache-Control']) { - qs['Cache-Control'] = this.request.headers['Cache-Control']; - } + var back = index + size; + if (back > data.size) back = data.size; + reader.readAsArrayBuffer(sliceFn.call(data, index, back)); + }; - // need to pull in any other X-Amz-* headers - AWS.util.each.call(this, this.request.headers, function(key, value) { - if (key === expiresHeader) return; - if (this.isSignableHeader(key)) { - var lowerKey = key.toLowerCase(); - // Metadata should be normalized - if (lowerKey.indexOf('x-amz-meta-') === 0) { - qs[lowerKey] = value; - } else if (lowerKey.indexOf('x-amz-') === 0) { - qs[key] = value; + reader._continueReading(); + } else { + if (util.isBrowser() && typeof data === 'object' && !isBuffer) { + data = new util.Buffer(new Uint8Array(data)); } + var out = hash.update(data).digest(digest); + if (callback) callback(null, out); + return out; } - }); - - var sep = this.request.path.indexOf('?') >= 0 ? '&' : '?'; - this.request.path += sep + AWS.util.queryParamsToString(qs); - }, + }, - authorization: function authorization(credentials, datetime) { - var parts = []; - var credString = this.credentialString(datetime); - parts.push(this.algorithm + ' Credential=' + - credentials.accessKeyId + '/' + credString); - parts.push('SignedHeaders=' + this.signedHeaders()); - parts.push('Signature=' + this.signature(credentials, datetime)); - return parts.join(', '); - }, + toHex: function toHex(data) { + var out = []; + for (var i = 0; i < data.length; i++) { + out.push(('0' + data.charCodeAt(i).toString(16)).substr(-2, 2)); + } + return out.join(''); + }, - signature: function signature(credentials, datetime) { - var signingKey = v4Credentials.getSigningKey( - credentials, - datetime.substr(0, 8), - this.request.region, - this.serviceName, - this.signatureCache - ); - return AWS.util.crypto.hmac(signingKey, this.stringToSign(datetime), 'hex'); - }, + createHash: function createHash(algorithm) { + return util.crypto.lib.createHash(algorithm); + } - stringToSign: function stringToSign(datetime) { - var parts = []; - parts.push('AWS4-HMAC-SHA256'); - parts.push(datetime); - parts.push(this.credentialString(datetime)); - parts.push(this.hexEncodedHash(this.canonicalString())); - return parts.join('\n'); }, - canonicalString: function canonicalString() { - var parts = [], pathname = this.request.pathname(); - if (this.serviceName !== 's3' && this.signatureVersion !== 's3v4') pathname = AWS.util.uriEscapePath(pathname); + /** @!ignore */ - parts.push(this.request.method); - parts.push(pathname); - parts.push(this.request.search()); - parts.push(this.canonicalHeaders() + '\n'); - parts.push(this.signedHeaders()); - parts.push(this.hexEncodedBodyHash()); - return parts.join('\n'); - }, + /* Abort constant */ + abort: {}, - canonicalHeaders: function canonicalHeaders() { - var headers = []; - AWS.util.each.call(this, this.request.headers, function (key, item) { - headers.push([key, item]); - }); - headers.sort(function (a, b) { - return a[0].toLowerCase() < b[0].toLowerCase() ? -1 : 1; - }); - var parts = []; - AWS.util.arrayEach.call(this, headers, function (item) { - var key = item[0].toLowerCase(); - if (this.isSignableHeader(key)) { - var value = item[1]; - if (typeof value === 'undefined' || value === null || typeof value.toString !== 'function') { - throw AWS.util.error(new Error('Header ' + key + ' contains invalid value'), { - code: 'InvalidHeader' - }); - } - parts.push(key + ':' + - this.canonicalHeaderValues(value.toString())); + each: function each(object, iterFunction) { + for (var key in object) { + if (Object.prototype.hasOwnProperty.call(object, key)) { + var ret = iterFunction.call(this, key, object[key]); + if (ret === util.abort) break; } - }); - return parts.join('\n'); + } }, - canonicalHeaderValues: function canonicalHeaderValues(values) { - return values.replace(/\s+/g, ' ').replace(/^\s+|\s+$/g, ''); + arrayEach: function arrayEach(array, iterFunction) { + for (var idx in array) { + if (Object.prototype.hasOwnProperty.call(array, idx)) { + var ret = iterFunction.call(this, array[idx], parseInt(idx, 10)); + if (ret === util.abort) break; + } + } }, - signedHeaders: function signedHeaders() { - var keys = []; - AWS.util.each.call(this, this.request.headers, function (key) { - key = key.toLowerCase(); - if (this.isSignableHeader(key)) keys.push(key); + update: function update(obj1, obj2) { + util.each(obj2, function iterator(key, item) { + obj1[key] = item; }); - return keys.sort().join(';'); + return obj1; }, - credentialString: function credentialString(datetime) { - return v4Credentials.createScope( - datetime.substr(0, 8), - this.request.region, - this.serviceName - ); + merge: function merge(obj1, obj2) { + return util.update(util.copy(obj1), obj2); }, - hexEncodedHash: function hash(string) { - return AWS.util.crypto.sha256(string, 'hex'); + copy: function copy(object) { + if (object === null || object === undefined) return object; + var dupe = {}; + // jshint forin:false + for (var key in object) { + dupe[key] = object[key]; + } + return dupe; }, - hexEncodedBodyHash: function hexEncodedBodyHash() { - var request = this.request; - if (this.isPresigned() && (['s3', 's3-object-lambda'].indexOf(this.serviceName) > -1) && !request.body) { - return 'UNSIGNED-PAYLOAD'; - } else if (request.headers['X-Amz-Content-Sha256']) { - return request.headers['X-Amz-Content-Sha256']; - } else { - return this.hexEncodedHash(this.request.body || ''); + isEmpty: function isEmpty(obj) { + for (var prop in obj) { + if (Object.prototype.hasOwnProperty.call(obj, prop)) { + return false; + } } + return true; }, - unsignableHeaders: [ - 'authorization', - 'content-type', - 'content-length', - 'user-agent', - expiresHeader, - 'expect', - 'x-amzn-trace-id' - ], - - isSignableHeader: function isSignableHeader(key) { - if (key.toLowerCase().indexOf('x-amz-') === 0) return true; - return this.unsignableHeaders.indexOf(key) < 0; + arraySliceFn: function arraySliceFn(obj) { + var fn = obj.slice || obj.webkitSlice || obj.mozSlice; + return typeof fn === 'function' ? fn : null; }, - isPresigned: function isPresigned() { - return this.request.headers[expiresHeader] ? true : false; - } - -}); - -/** - * @api private - */ -module.exports = AWS.Signers.V4; - - -/***/ }), - -/***/ 62660: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - -var AWS = __nccwpck_require__(28437); - -/** - * @api private - */ -var cachedSecret = {}; - -/** - * @api private - */ -var cacheQueue = []; - -/** - * @api private - */ -var maxCacheEntries = 50; - -/** - * @api private - */ -var v4Identifier = 'aws4_request'; - -/** - * @api private - */ -module.exports = { - /** - * @api private - * - * @param date [String] - * @param region [String] - * @param serviceName [String] - * @return [String] - */ - createScope: function createScope(date, region, serviceName) { - return [ - date.substr(0, 8), - region, - serviceName, - v4Identifier - ].join('/'); + isType: function isType(obj, type) { + // handle cross-"frame" objects + if (typeof type === 'function') type = util.typeName(type); + return Object.prototype.toString.call(obj) === '[object ' + type + ']'; }, - /** - * @api private - * - * @param credentials [Credentials] - * @param date [String] - * @param region [String] - * @param service [String] - * @param shouldCache [Boolean] - * @return [String] - */ - getSigningKey: function getSigningKey( - credentials, - date, - region, - service, - shouldCache - ) { - var credsIdentifier = AWS.util.crypto - .hmac(credentials.secretAccessKey, credentials.accessKeyId, 'base64'); - var cacheKey = [credsIdentifier, date, region, service].join('_'); - shouldCache = shouldCache !== false; - if (shouldCache && (cacheKey in cachedSecret)) { - return cachedSecret[cacheKey]; - } - - var kDate = AWS.util.crypto.hmac( - 'AWS4' + credentials.secretAccessKey, - date, - 'buffer' - ); - var kRegion = AWS.util.crypto.hmac(kDate, region, 'buffer'); - var kService = AWS.util.crypto.hmac(kRegion, service, 'buffer'); + typeName: function typeName(type) { + if (Object.prototype.hasOwnProperty.call(type, 'name')) return type.name; + var str = type.toString(); + var match = str.match(/^\s*function (.+)\(/); + return match ? match[1] : str; + }, - var signingKey = AWS.util.crypto.hmac(kService, v4Identifier, 'buffer'); - if (shouldCache) { - cachedSecret[cacheKey] = signingKey; - cacheQueue.push(cacheKey); - if (cacheQueue.length > maxCacheEntries) { - // remove the oldest entry (not the least recently used) - delete cachedSecret[cacheQueue.shift()]; + error: function error(err, options) { + var originalError = null; + if (typeof err.message === 'string' && err.message !== '') { + if (typeof options === 'string' || (options && options.message)) { + originalError = util.copy(err); + originalError.message = err.message; } } + err.message = err.message || null; - return signingKey; - }, - - /** - * @api private - * - * Empties the derived signing key cache. Made available for testing purposes - * only. - */ - emptyCache: function emptyCache() { - cachedSecret = {}; - cacheQueue = []; - } -}; - - -/***/ }), - -/***/ 68118: -/***/ ((module) => { - -function AcceptorStateMachine(states, state) { - this.currentState = state || null; - this.states = states || {}; -} - -AcceptorStateMachine.prototype.runTo = function runTo(finalState, done, bindObject, inputError) { - if (typeof finalState === 'function') { - inputError = bindObject; bindObject = done; - done = finalState; finalState = null; - } - - var self = this; - var state = self.states[self.currentState]; - state.fn.call(bindObject || self, inputError, function(err) { - if (err) { - if (state.fail) self.currentState = state.fail; - else return done ? done.call(bindObject, err) : null; - } else { - if (state.accept) self.currentState = state.accept; - else return done ? done.call(bindObject) : null; - } - if (self.currentState === finalState) { - return done ? done.call(bindObject, err) : null; + if (typeof options === 'string') { + err.message = options; + } else if (typeof options === 'object' && options !== null) { + util.update(err, options); + if (options.message) + err.message = options.message; + if (options.code || options.name) + err.code = options.code || options.name; + if (options.stack) + err.stack = options.stack; } - self.runTo(finalState, done, bindObject, err); - }); -}; - -AcceptorStateMachine.prototype.addState = function addState(name, acceptState, failState, fn) { - if (typeof acceptState === 'function') { - fn = acceptState; acceptState = null; failState = null; - } else if (typeof failState === 'function') { - fn = failState; failState = null; - } - - if (!this.currentState) this.currentState = name; - this.states[name] = { accept: acceptState, fail: failState, fn: fn }; - return this; -}; - -/** - * @api private - */ -module.exports = AcceptorStateMachine; + if (typeof Object.defineProperty === 'function') { + Object.defineProperty(err, 'name', {writable: true, enumerable: false}); + Object.defineProperty(err, 'message', {enumerable: true}); + } + err.name = String(options && options.name || err.name || err.code || 'Error'); + err.time = new Date(); -/***/ }), + if (originalError) { + err.originalError = originalError; + } -/***/ 82647: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { -var AWS = __nccwpck_require__(28437); + for (var key in options || {}) { + if (key[0] === '[' && key[key.length - 1] === ']') { + key = key.slice(1, -1); + if (key === 'code' || key === 'message') { + continue; + } + err['[' + key + ']'] = 'See error.' + key + ' for details.'; + Object.defineProperty(err, key, { + value: err[key] || (options && options[key]) || (originalError && originalError[key]), + enumerable: false, + writable: true + }); + } + } + + return err; + }, -/** - * Represents AWS token object, which contains {token}, and optional - * {expireTime}. - * Creating a `Token` object allows you to pass around your - * token to configuration and service objects. - * - * Note that this class typically does not need to be constructed manually, - * as the {AWS.Config} and {AWS.Service} classes both accept simple - * options hashes with the two keys. The token from this object will be used - * automatically in operations which require them. - * - * ## Expiring and Refreshing Token - * - * Occasionally token can expire in the middle of a long-running - * application. In this case, the SDK will automatically attempt to - * refresh the token from the storage location if the Token - * class implements the {refresh} method. - * - * If you are implementing a token storage location, you - * will want to create a subclass of the `Token` class and - * override the {refresh} method. This method allows token to be - * retrieved from the backing store, be it a file system, database, or - * some network storage. The method should reset the token attributes - * on the object. - * - * @!attribute token - * @return [String] represents the literal token string. This will typically - * be a base64 encoded string. - * @!attribute expireTime - * @return [Date] a time when token should be considered expired. Used - * in conjunction with {expired}. - * @!attribute expired - * @return [Boolean] whether the token is expired and require a refresh. Used - * in conjunction with {expireTime}. - */ -AWS.Token = AWS.util.inherit({ /** - * Creates a Token object with a given set of information in options hash. - * @option options token [String] represents the literal token string. - * @option options expireTime [Date] field representing the time at which - * the token expires. - * @example Create a token object - * var token = new AWS.Token({ token: 'token' }); + * @api private */ - constructor: function Token(options) { - // hide token from being displayed with util.inspect - AWS.util.hideProperties(this, ['token']); + inherit: function inherit(klass, features) { + var newObject = null; + if (features === undefined) { + features = klass; + klass = Object; + newObject = {}; + } else { + var ctor = function ConstructorWrapper() {}; + ctor.prototype = klass.prototype; + newObject = new ctor(); + } - this.expired = false; - this.expireTime = null; - this.refreshCallbacks = []; - if (arguments.length === 1) { - var options = arguments[0]; - this.token = options.token; - this.expireTime = options.expireTime; + // constructor not supplied, create pass-through ctor + if (features.constructor === Object) { + features.constructor = function() { + if (klass !== Object) { + return klass.apply(this, arguments); + } + }; } + + features.constructor.prototype = newObject; + util.update(features.constructor.prototype, features); + features.constructor.__super__ = klass; + return features.constructor; }, /** - * @return [Integer] the number of seconds before {expireTime} during which - * the token will be considered expired. + * @api private */ - expiryWindow: 15, + mixin: function mixin() { + var klass = arguments[0]; + for (var i = 1; i < arguments.length; i++) { + // jshint forin:false + for (var prop in arguments[i].prototype) { + var fn = arguments[i].prototype[prop]; + if (prop !== 'constructor') { + klass.prototype[prop] = fn; + } + } + } + return klass; + }, /** - * @return [Boolean] whether the Token object should call {refresh} - * @note Subclasses should override this method to provide custom refresh - * logic. + * @api private */ - needsRefresh: function needsRefresh() { - var currentTime = AWS.util.date.getDate().getTime(); - var adjustedTime = new Date(currentTime + this.expiryWindow * 1000); - - if (this.expireTime && adjustedTime > this.expireTime) - return true; + hideProperties: function hideProperties(obj, props) { + if (typeof Object.defineProperty !== 'function') return; - return this.expired || !this.token; + util.arrayEach(props, function (key) { + Object.defineProperty(obj, key, { + enumerable: false, writable: true, configurable: true }); + }); }, /** - * Gets the existing token, refreshing them if they are not yet loaded - * or have expired. Users should call this method before using {refresh}, - * as this will not attempt to reload token when they are already - * loaded into the object. - * - * @callback callback function(err) - * When this callback is called with no error, it means either token - * do not need to be refreshed or refreshed token information has - * been loaded into the object (as the `token` property). - * @param err [Error] if an error occurred, this value will be filled + * @api private */ - get: function get(callback) { - var self = this; - if (this.needsRefresh()) { - this.refresh(function(err) { - if (!err) self.expired = false; // reset expired flag - if (callback) callback(err); - }); - } else if (callback) { - callback(); + property: function property(obj, name, value, enumerable, isValue) { + var opts = { + configurable: true, + enumerable: enumerable !== undefined ? enumerable : true + }; + if (typeof value === 'function' && !isValue) { + opts.get = value; + } + else { + opts.value = value; opts.writable = true; } + + Object.defineProperty(obj, name, opts); }, /** - * @!method getPromise() - * Returns a 'thenable' promise. - * Gets the existing token, refreshing it if it's not yet loaded - * or have expired. Users should call this method before using {refresh}, - * as this will not attempt to reload token when it's already - * loaded into the object. - * - * Two callbacks can be provided to the `then` method on the returned promise. - * The first callback will be called if the promise is fulfilled, and the second - * callback will be called if the promise is rejected. - * @callback fulfilledCallback function() - * Called if the promise is fulfilled. When this callback is called, it means - * either token does not need to be refreshed or refreshed token information - * has been loaded into the object (as the `token` property). - * @callback rejectedCallback function(err) - * Called if the promise is rejected. - * @param err [Error] if an error occurred, this value will be filled. - * @return [Promise] A promise that represents the state of the `get` call. - * @example Calling the `getPromise` method. - * var promise = tokenProvider.getPromise(); - * promise.then(function() { ... }, function(err) { ... }); + * @api private */ + memoizedProperty: function memoizedProperty(obj, name, get, enumerable) { + var cachedValue = null; - /** - * @!method refreshPromise() - * Returns a 'thenable' promise. - * Refreshes the token. Users should call {get} before attempting - * to forcibly refresh token. - * - * Two callbacks can be provided to the `then` method on the returned promise. - * The first callback will be called if the promise is fulfilled, and the second - * callback will be called if the promise is rejected. - * @callback fulfilledCallback function() - * Called if the promise is fulfilled. When this callback is called, it - * means refreshed token information has been loaded into the object - * (as the `token` property). - * @callback rejectedCallback function(err) - * Called if the promise is rejected. - * @param err [Error] if an error occurred, this value will be filled. - * @return [Promise] A promise that represents the state of the `refresh` call. - * @example Calling the `refreshPromise` method. - * var promise = tokenProvider.refreshPromise(); - * promise.then(function() { ... }, function(err) { ... }); - */ + // build enumerable attribute for each value with lazy accessor. + util.property(obj, name, function() { + if (cachedValue === null) { + cachedValue = get(); + } + return cachedValue; + }, enumerable); + }, /** - * Refreshes the token. Users should call {get} before attempting - * to forcibly refresh token. + * TODO Remove in major version revision + * This backfill populates response data without the + * top-level payload name. * - * @callback callback function(err) - * When this callback is called with no error, it means refreshed - * token information has been loaded into the object (as the - * `token` property). - * @param err [Error] if an error occurred, this value will be filled - * @note Subclasses should override this class to reset the - * {token} on the token object and then call the callback with - * any error information. - * @see get + * @api private */ - refresh: function refresh(callback) { - this.expired = false; - callback(); + hoistPayloadMember: function hoistPayloadMember(resp) { + var req = resp.request; + var operationName = req.operation; + var operation = req.service.api.operations[operationName]; + var output = operation.output; + if (output.payload && !operation.hasEventOutput) { + var payloadMember = output.members[output.payload]; + var responsePayload = resp.data[output.payload]; + if (payloadMember.type === 'structure') { + util.each(responsePayload, function(key, value) { + util.property(resp.data, key, value, false); + }); + } + } }, /** + * Compute SHA-256 checksums of streams + * * @api private - * @param callback */ - coalesceRefresh: function coalesceRefresh(callback, sync) { - var self = this; - if (self.refreshCallbacks.push(callback) === 1) { - self.load(function onLoad(err) { - AWS.util.arrayEach(self.refreshCallbacks, function(callback) { - if (sync) { - callback(err); - } else { - // callback could throw, so defer to ensure all callbacks are notified - AWS.util.defer(function () { - callback(err); - }); + computeSha256: function computeSha256(body, done) { + if (util.isNode()) { + var Stream = util.stream.Stream; + var fs = __nccwpck_require__(57147); + if (typeof Stream === 'function' && body instanceof Stream) { + if (typeof body.path === 'string') { // assume file object + var settings = {}; + if (typeof body.start === 'number') { + settings.start = body.start; } - }); - self.refreshCallbacks.length = 0; - }); + if (typeof body.end === 'number') { + settings.end = body.end; + } + body = fs.createReadStream(body.path, settings); + } else { // TODO support other stream types + return done(new Error('Non-file stream objects are ' + + 'not supported with SigV4')); + } + } } + + util.crypto.sha256(body, 'hex', function(err, sha) { + if (err) done(err); + else done(null, sha); + }); }, /** * @api private - * @param callback */ - load: function load(callback) { - callback(); - } -}); - -/** - * @api private - */ -AWS.Token.addPromisesToClass = function addPromisesToClass(PromiseDependency) { - this.prototype.getPromise = AWS.util.promisifyMethod('get', PromiseDependency); - this.prototype.refreshPromise = AWS.util.promisifyMethod('refresh', PromiseDependency); -}; + isClockSkewed: function isClockSkewed(serverTime) { + if (serverTime) { + util.property(AWS.config, 'isClockSkewed', + Math.abs(new Date().getTime() - serverTime) >= 300000, false); + return AWS.config.isClockSkewed; + } + }, -/** - * @api private - */ -AWS.Token.deletePromisesFromClass = function deletePromisesFromClass() { - delete this.prototype.getPromise; - delete this.prototype.refreshPromise; -}; + applyClockOffset: function applyClockOffset(serverTime) { + if (serverTime) + AWS.config.systemClockOffset = serverTime - new Date().getTime(); + }, -AWS.util.addPromises(AWS.Token); + /** + * @api private + */ + extractRequestId: function extractRequestId(resp) { + var requestId = resp.httpResponse.headers['x-amz-request-id'] || + resp.httpResponse.headers['x-amzn-requestid']; + if (!requestId && resp.data && resp.data.ResponseMetadata) { + requestId = resp.data.ResponseMetadata.RequestId; + } -/***/ }), + if (requestId) { + resp.requestId = requestId; + } -/***/ 90327: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { + if (resp.error) { + resp.error.requestId = requestId; + } + }, -var AWS = __nccwpck_require__(28437); -var crypto = __nccwpck_require__(6113); -var fs = __nccwpck_require__(57147); -var path = __nccwpck_require__(71017); -var iniLoader = AWS.util.iniLoader; + /** + * @api private + */ + addPromises: function addPromises(constructors, PromiseDependency) { + var deletePromises = false; + if (PromiseDependency === undefined && AWS && AWS.config) { + PromiseDependency = AWS.config.getPromisesDependency(); + } + if (PromiseDependency === undefined && typeof Promise !== 'undefined') { + PromiseDependency = Promise; + } + if (typeof PromiseDependency !== 'function') deletePromises = true; + if (!Array.isArray(constructors)) constructors = [constructors]; -// Tracking refresh attempt to ensure refresh is not attempted more than once every 30 seconds. -var lastRefreshAttemptTime = 0; + for (var ind = 0; ind < constructors.length; ind++) { + var constructor = constructors[ind]; + if (deletePromises) { + if (constructor.deletePromisesFromClass) { + constructor.deletePromisesFromClass(); + } + } else if (constructor.addPromisesToClass) { + constructor.addPromisesToClass(PromiseDependency); + } + } + }, -/** - * Throws error is key is not present in token object. - * - * @param token [Object] Object to be validated. - * @param key [String] The key to be validated on the object. - */ -var validateTokenKey = function validateTokenKey(token, key) { - if (!token[key]) { - throw AWS.util.error( - new Error('Key "' + key + '" not present in SSO Token'), - { code: 'SSOTokenProviderFailure' } - ); - } -}; + /** + * @api private + * Return a function that will return a promise whose fate is decided by the + * callback behavior of the given method with `methodName`. The method to be + * promisified should conform to node.js convention of accepting a callback as + * last argument and calling that callback with error as the first argument + * and success value on the second argument. + */ + promisifyMethod: function promisifyMethod(methodName, PromiseDependency) { + return function promise() { + var self = this; + var args = Array.prototype.slice.call(arguments); + return new PromiseDependency(function(resolve, reject) { + args.push(function(err, data) { + if (err) { + reject(err); + } else { + resolve(data); + } + }); + self[methodName].apply(self, args); + }); + }; + }, -/** - * Calls callback function with or without error based on provided times in case - * of unsuccessful refresh. - * - * @param currentTime [number] current time in milliseconds since ECMAScript epoch. - * @param tokenExpireTime [number] token expire time in milliseconds since ECMAScript epoch. - * @param callback [Function] Callback to call in case of error. - */ -var refreshUnsuccessful = function refreshUnsuccessful( - currentTime, - tokenExpireTime, - callback -) { - if (tokenExpireTime > currentTime) { - // Cached token is still valid, return. - callback(null); - } else { - // Token invalid, throw error requesting user to sso login. - throw AWS.util.error( - new Error('SSO Token refresh failed. Please log in using "aws sso login"'), - { code: 'SSOTokenProviderFailure' } - ); - } -}; + /** + * @api private + */ + isDualstackAvailable: function isDualstackAvailable(service) { + if (!service) return false; + var metadata = __nccwpck_require__(17752); + if (typeof service !== 'string') service = service.serviceIdentifier; + if (typeof service !== 'string' || !metadata.hasOwnProperty(service)) return false; + return !!metadata[service].dualstackAvailable; + }, -/** - * Represents token loaded from disk derived from the AWS SSO device grant authorication flow. - * - * ## Using SSO Token Provider - * - * This provider is checked by default in the Node.js environment in TokenProviderChain. - * To use the SSO Token Provider, simply add your SSO Start URL and Region to the - * ~/.aws/config file in the following format: - * - * [default] - * sso_start_url = https://d-abc123.awsapps.com/start - * sso_region = us-east-1 - * - * ## Using custom profiles - * - * The SDK supports loading token for separate profiles. This can be done in two ways: - * - * 1. Set the `AWS_PROFILE` environment variable in your process prior to loading the SDK. - * 2. Directly load the AWS.SSOTokenProvider: - * - * ```javascript - * var ssoTokenProvider = new AWS.SSOTokenProvider({profile: 'myprofile'}); - * ``` - * - * @!macro nobrowser - */ -AWS.SSOTokenProvider = AWS.util.inherit(AWS.Token, { /** - * Expiry window of five minutes. + * @api private */ - expiryWindow: 5 * 60, + calculateRetryDelay: function calculateRetryDelay(retryCount, retryDelayOptions, err) { + if (!retryDelayOptions) retryDelayOptions = {}; + var customBackoff = retryDelayOptions.customBackoff || null; + if (typeof customBackoff === 'function') { + return customBackoff(retryCount, err); + } + var base = typeof retryDelayOptions.base === 'number' ? retryDelayOptions.base : 100; + var delay = Math.random() * (Math.pow(2, retryCount) * base); + return delay; + }, /** - * Creates a new token object from cached access token. - * - * @param options [map] a set of options - * @option options profile [String] (AWS_PROFILE env var or 'default') - * the name of the profile to load. - * @option options callback [Function] (err) Token is eagerly loaded - * by the constructor. When the callback is called with no error, the - * token has been loaded successfully. + * @api private */ - constructor: function SSOTokenProvider(options) { - AWS.Token.call(this); + handleRequestWithRetries: function handleRequestWithRetries(httpRequest, options, cb) { + if (!options) options = {}; + var http = AWS.HttpClient.getInstance(); + var httpOptions = options.httpOptions || {}; + var retryCount = 0; + + var errCallback = function(err) { + var maxRetries = options.maxRetries || 0; + if (err && err.code === 'TimeoutError') err.retryable = true; + + // Call `calculateRetryDelay()` only when relevant, see #3401 + if (err && err.retryable && retryCount < maxRetries) { + var delay = util.calculateRetryDelay(retryCount, options.retryDelayOptions, err); + if (delay >= 0) { + retryCount++; + setTimeout(sendRequest, delay + (err.retryAfter || 0)); + return; + } + } + cb(err); + }; - options = options || {}; + var sendRequest = function() { + var data = ''; + http.handleRequest(httpRequest, httpOptions, function(httpResponse) { + httpResponse.on('data', function(chunk) { data += chunk.toString(); }); + httpResponse.on('end', function() { + var statusCode = httpResponse.statusCode; + if (statusCode < 300) { + cb(null, data); + } else { + var retryAfter = parseInt(httpResponse.headers['retry-after'], 10) * 1000 || 0; + var err = util.error(new Error(), + { + statusCode: statusCode, + retryable: statusCode >= 500 || statusCode === 429 + } + ); + if (retryAfter && err.retryable) err.retryAfter = retryAfter; + errCallback(err); + } + }); + }, errCallback); + }; - this.expired = true; - this.profile = options.profile || process.env.AWS_PROFILE || AWS.util.defaultProfile; - this.get(options.callback || AWS.util.fn.noop); + AWS.util.defer(sendRequest); }, /** - * Reads sso_start_url from provided profile, and reads token from - * ~/.aws/sso/cache/.json - * - * Throws an error if required fields token and expiresAt are missing. - * Throws an error if token has expired and metadata to perform refresh is - * not available. - * Attempts to refresh the token if it's within 5 minutes before expiry time. - * * @api private */ - load: function load(callback) { - var self = this; - var profiles = iniLoader.loadFrom({ isConfig: true }); - var profile = profiles[this.profile] || {}; - - if (Object.keys(profile).length === 0) { - throw AWS.util.error( - new Error('Profile "' + this.profile + '" not found'), - { code: 'SSOTokenProviderFailure' } - ); - } else if (!profile['sso_session']) { - throw AWS.util.error( - new Error('Profile "' + this.profile + '" is missing required property "sso_session".'), - { code: 'SSOTokenProviderFailure' } - ); + uuid: { + v4: function uuidV4() { + return (__nccwpck_require__(57821).v4)(); } + }, - var ssoSessionName = profile['sso_session']; - var ssoSessions = iniLoader.loadSsoSessionsFrom(); - var ssoSession = ssoSessions[ssoSessionName]; - - if (!ssoSession) { - throw AWS.util.error( - new Error('Sso session "' + ssoSessionName + '" not found'), - { code: 'SSOTokenProviderFailure' } - ); - } else if (!ssoSession['sso_start_url']) { - throw AWS.util.error( - new Error('Sso session "' + this.profile + '" is missing required property "sso_start_url".'), - { code: 'SSOTokenProviderFailure' } - ); - } else if (!ssoSession['sso_region']) { - throw AWS.util.error( - new Error('Sso session "' + this.profile + '" is missing required property "sso_region".'), - { code: 'SSOTokenProviderFailure' } - ); + /** + * @api private + */ + convertPayloadToString: function convertPayloadToString(resp) { + var req = resp.request; + var operation = req.operation; + var rules = req.service.api.operations[operation].output || {}; + if (rules.payload && resp.data[rules.payload]) { + resp.data[rules.payload] = resp.data[rules.payload].toString(); } + }, - var hasher = crypto.createHash('sha1'); - var fileName = hasher.update(ssoSessionName).digest('hex') + '.json'; - var cachePath = path.join(iniLoader.getHomeDir(), '.aws', 'sso', 'cache', fileName); - var tokenFromCache = JSON.parse(fs.readFileSync(cachePath)); - - if (!tokenFromCache) { - throw AWS.util.error( - new Error('Cached token not found. Please log in using "aws sso login"' - + ' for profile "' + this.profile + '".'), - { code: 'SSOTokenProviderFailure' } - ); + /** + * @api private + */ + defer: function defer(callback) { + if (typeof process === 'object' && typeof process.nextTick === 'function') { + process.nextTick(callback); + } else if (typeof setImmediate === 'function') { + setImmediate(callback); + } else { + setTimeout(callback, 0); } + }, - validateTokenKey(tokenFromCache, 'accessToken'); - validateTokenKey(tokenFromCache, 'expiresAt'); - - var currentTime = AWS.util.date.getDate().getTime(); - var adjustedTime = new Date(currentTime + this.expiryWindow * 1000); - var tokenExpireTime = new Date(tokenFromCache['expiresAt']); + /** + * @api private + */ + getRequestPayloadShape: function getRequestPayloadShape(req) { + var operations = req.service.api.operations; + if (!operations) return undefined; + var operation = (operations || {})[req.operation]; + if (!operation || !operation.input || !operation.input.payload) return undefined; + return operation.input.members[operation.input.payload]; + }, - if (tokenExpireTime > adjustedTime) { - // Token is valid and not expired. - self.token = tokenFromCache.accessToken; - self.expireTime = tokenExpireTime; - self.expired = false; - callback(null); - return; + getProfilesFromSharedConfig: function getProfilesFromSharedConfig(iniLoader, filename) { + var profiles = {}; + var profilesFromConfig = {}; + if (process.env[util.configOptInEnv]) { + var profilesFromConfig = iniLoader.loadFrom({ + isConfig: true, + filename: process.env[util.sharedConfigFileEnv] + }); } - - // Skip new refresh, if last refresh was done within 30 seconds. - if (currentTime - lastRefreshAttemptTime < 30 * 1000) { - refreshUnsuccessful(currentTime, tokenExpireTime, callback); - return; + var profilesFromCreds= {}; + try { + var profilesFromCreds = iniLoader.loadFrom({ + filename: filename || + (process.env[util.configOptInEnv] && process.env[util.sharedCredentialsFileEnv]) + }); + } catch (error) { + // if using config, assume it is fully descriptive without a credentials file: + if (!process.env[util.configOptInEnv]) throw error; } - - // Token is in expiry window, refresh from SSOOIDC.createToken() call. - validateTokenKey(tokenFromCache, 'clientId'); - validateTokenKey(tokenFromCache, 'clientSecret'); - validateTokenKey(tokenFromCache, 'refreshToken'); - - if (!self.service || self.service.config.region !== ssoSession.sso_region) { - self.service = new AWS.SSOOIDC({ region: ssoSession.sso_region }); + for (var i = 0, profileNames = Object.keys(profilesFromConfig); i < profileNames.length; i++) { + profiles[profileNames[i]] = objectAssign(profiles[profileNames[i]] || {}, profilesFromConfig[profileNames[i]]); } + for (var i = 0, profileNames = Object.keys(profilesFromCreds); i < profileNames.length; i++) { + profiles[profileNames[i]] = objectAssign(profiles[profileNames[i]] || {}, profilesFromCreds[profileNames[i]]); + } + return profiles; - var params = { - clientId: tokenFromCache.clientId, - clientSecret: tokenFromCache.clientSecret, - refreshToken: tokenFromCache.refreshToken, - grantType: 'refresh_token', - }; - - lastRefreshAttemptTime = AWS.util.date.getDate().getTime(); - self.service.createToken(params, function(err, data) { - if (err || !data) { - refreshUnsuccessful(currentTime, tokenExpireTime, callback); - } else { - try { - validateTokenKey(data, 'accessToken'); - validateTokenKey(data, 'expiresIn'); - self.expired = false; - self.token = data.accessToken; - self.expireTime = new Date(Date.now() + data.expiresIn * 1000); - callback(null); - - try { - // Write updated token data to disk. - tokenFromCache.accessToken = data.accessToken; - tokenFromCache.expiresAt = self.expireTime.toISOString(); - tokenFromCache.refreshToken = data.refreshToken; - fs.writeFileSync(cachePath, JSON.stringify(tokenFromCache, null, 2)); - } catch (error) { - // Swallow error if unable to write token to file. - } - } catch (error) { - refreshUnsuccessful(currentTime, tokenExpireTime, callback); - } + /** + * Roughly the semantics of `Object.assign(target, source)` + */ + function objectAssign(target, source) { + for (var i = 0, keys = Object.keys(source); i < keys.length; i++) { + target[keys[i]] = source[keys[i]]; } - }); + return target; + } }, /** - * Loads the cached access token from disk. - * - * @callback callback function(err) - * Called after the AWS SSO process has been executed. When this - * callback is called with no error, it means that the token information - * has been loaded into the object (as the `token` property). - * @param err [Error] if an error occurred, this value will be filled. - * @see get + * @api private */ - refresh: function refresh(callback) { - iniLoader.clearCachedFiles(); - this.coalesceRefresh(callback || AWS.util.fn.callback); + ARN: { + validate: function validateARN(str) { + return str && str.indexOf('arn:') === 0 && str.split(':').length >= 6; + }, + parse: function parseARN(arn) { + var matched = arn.split(':'); + return { + partition: matched[1], + service: matched[2], + region: matched[3], + accountId: matched[4], + resource: matched.slice(5).join(':') + }; + }, + build: function buildARN(arnObject) { + if ( + arnObject.service === undefined || + arnObject.region === undefined || + arnObject.accountId === undefined || + arnObject.resource === undefined + ) throw util.error(new Error('Input ARN object is invalid')); + return 'arn:'+ (arnObject.partition || 'aws') + ':' + arnObject.service + + ':' + arnObject.region + ':' + arnObject.accountId + ':' + arnObject.resource; + } }, -}); - - -/***/ }), - -/***/ 50126: -/***/ ((__unused_webpack_module, __unused_webpack_exports, __nccwpck_require__) => { -var AWS = __nccwpck_require__(28437); + /** + * @api private + */ + defaultProfile: 'default', -/** - * Creates a token provider chain that searches for token in a list of - * token providers specified by the {providers} property. - * - * By default, the chain will use the {defaultProviders} to resolve token. - * - * ## Setting Providers - * - * Each provider in the {providers} list should be a function that returns - * a {AWS.Token} object, or a hardcoded token object. The function - * form allows for delayed execution of the Token construction. - * - * ## Resolving Token from a Chain - * - * Call {resolve} to return the first valid token object that can be - * loaded by the provider chain. - * - * For example, to resolve a chain with a custom provider that checks a file - * on disk after the set of {defaultProviders}: - * - * ```javascript - * var diskProvider = new FileTokenProvider('./token.json'); - * var chain = new AWS.TokenProviderChain(); - * chain.providers.push(diskProvider); - * chain.resolve(); - * ``` - * - * The above code will return the `diskProvider` object if the - * file contains token and the `defaultProviders` do not contain - * any token. - * - * @!attribute providers - * @return [Array] - * a list of token objects or functions that return token - * objects. If the provider is a function, the function will be - * executed lazily when the provider needs to be checked for valid - * token. By default, this object will be set to the {defaultProviders}. - * @see defaultProviders - */ -AWS.TokenProviderChain = AWS.util.inherit(AWS.Token, { + /** + * @api private + */ + configOptInEnv: 'AWS_SDK_LOAD_CONFIG', /** - * Creates a new TokenProviderChain with a default set of providers - * specified by {defaultProviders}. + * @api private */ - constructor: function TokenProviderChain(providers) { - if (providers) { - this.providers = providers; - } else { - this.providers = AWS.TokenProviderChain.defaultProviders.slice(0); - } - this.resolveCallbacks = []; - }, + sharedCredentialsFileEnv: 'AWS_SHARED_CREDENTIALS_FILE', /** - * @!method resolvePromise() - * Returns a 'thenable' promise. - * Resolves the provider chain by searching for the first token in {providers}. - * - * Two callbacks can be provided to the `then` method on the returned promise. - * The first callback will be called if the promise is fulfilled, and the second - * callback will be called if the promise is rejected. - * @callback fulfilledCallback function(token) - * Called if the promise is fulfilled and the provider resolves the chain - * to a token object - * @param token [AWS.Token] the token object resolved by the provider chain. - * @callback rejectedCallback function(error) - * Called if the promise is rejected. - * @param err [Error] the error object returned if no token is found. - * @return [Promise] A promise that represents the state of the `resolve` method call. - * @example Calling the `resolvePromise` method. - * var promise = chain.resolvePromise(); - * promise.then(function(token) { ... }, function(err) { ... }); + * @api private */ + sharedConfigFileEnv: 'AWS_CONFIG_FILE', /** - * Resolves the provider chain by searching for the first token in {providers}. - * - * @callback callback function(err, token) - * Called when the provider resolves the chain to a token object - * or null if no token can be found. - * - * @param err [Error] the error object returned if no token is found. - * @param token [AWS.Token] the token object resolved by the provider chain. - * @return [AWS.TokenProviderChain] the provider, for chaining. + * @api private */ - resolve: function resolve(callback) { - var self = this; - if (self.providers.length === 0) { - callback(new Error('No providers')); - return self; - } + imdsDisabledEnv: 'AWS_EC2_METADATA_DISABLED' +}; - if (self.resolveCallbacks.push(callback) === 1) { - var index = 0; - var providers = self.providers.slice(0); +/** + * @api private + */ +module.exports = util; - function resolveNext(err, token) { - if ((!err && token) || index === providers.length) { - AWS.util.arrayEach(self.resolveCallbacks, function (callback) { - callback(err, token); - }); - self.resolveCallbacks.length = 0; - return; - } - var provider = providers[index++]; - if (typeof provider === 'function') { - token = provider.call(); - } else { - token = provider; - } +/***/ }), - if (token.get) { - token.get(function (getErr) { - resolveNext(getErr, getErr ? null : token); - }); - } else { - resolveNext(null, token); - } - } +/***/ 23546: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - resolveNext(); +var util = __nccwpck_require__(77985); +var XmlNode = (__nccwpck_require__(20397).XmlNode); +var XmlText = (__nccwpck_require__(90971).XmlText); + +function XmlBuilder() { } + +XmlBuilder.prototype.toXML = function(params, shape, rootElement, noEmpty) { + var xml = new XmlNode(rootElement); + applyNamespaces(xml, shape, true); + serialize(xml, params, shape); + return xml.children.length > 0 || noEmpty ? xml.toString() : ''; +}; + +function serialize(xml, value, shape) { + switch (shape.type) { + case 'structure': return serializeStructure(xml, value, shape); + case 'map': return serializeMap(xml, value, shape); + case 'list': return serializeList(xml, value, shape); + default: return serializeScalar(xml, value, shape); + } +} + +function serializeStructure(xml, params, shape) { + util.arrayEach(shape.memberNames, function(memberName) { + var memberShape = shape.members[memberName]; + if (memberShape.location !== 'body') return; + + var value = params[memberName]; + var name = memberShape.name; + if (value !== undefined && value !== null) { + if (memberShape.isXmlAttribute) { + xml.addAttribute(name, value); + } else if (memberShape.flattened) { + serialize(xml, value, memberShape); + } else { + var element = new XmlNode(name); + xml.addChildNode(element); + applyNamespaces(element, memberShape); + serialize(element, value, memberShape); + } } + }); +} - return self; +function serializeMap(xml, map, shape) { + var xmlKey = shape.key.name || 'key'; + var xmlValue = shape.value.name || 'value'; + + util.each(map, function(key, value) { + var entry = new XmlNode(shape.flattened ? shape.name : 'entry'); + xml.addChildNode(entry); + + var entryKey = new XmlNode(xmlKey); + var entryValue = new XmlNode(xmlValue); + entry.addChildNode(entryKey); + entry.addChildNode(entryValue); + + serialize(entryKey, key, shape.key); + serialize(entryValue, value, shape.value); + }); +} + +function serializeList(xml, list, shape) { + if (shape.flattened) { + util.arrayEach(list, function(value) { + var name = shape.member.name || shape.name; + var element = new XmlNode(name); + xml.addChildNode(element); + serialize(element, value, shape.member); + }); + } else { + util.arrayEach(list, function(value) { + var name = shape.member.name || 'member'; + var element = new XmlNode(name); + xml.addChildNode(element); + serialize(element, value, shape.member); + }); } -}); +} + +function serializeScalar(xml, value, shape) { + xml.addChildNode( + new XmlText(shape.toWireFormat(value)) + ); +} + +function applyNamespaces(xml, shape, isRoot) { + var uri, prefix = 'xmlns'; + if (shape.xmlNamespaceUri) { + uri = shape.xmlNamespaceUri; + if (shape.xmlNamespacePrefix) prefix += ':' + shape.xmlNamespacePrefix; + } else if (isRoot && shape.api.xmlNamespaceUri) { + uri = shape.api.xmlNamespaceUri; + } + + if (uri) xml.addAttribute(prefix, uri); +} /** - * The default set of providers used by a vanilla TokenProviderChain. - * - * In the browser: - * - * ```javascript - * AWS.TokenProviderChain.defaultProviders = [] - * ``` - * - * In Node.js: - * - * ```javascript - * AWS.TokenProviderChain.defaultProviders = [ - * function () { return new AWS.SSOTokenProvider(); }, - * ] - * ``` + * @api private */ -AWS.TokenProviderChain.defaultProviders = []; +module.exports = XmlBuilder; + + +/***/ }), + +/***/ 98241: +/***/ ((module) => { /** - * @api private + * Escapes characters that can not be in an XML attribute. */ -AWS.TokenProviderChain.addPromisesToClass = function addPromisesToClass(PromiseDependency) { - this.prototype.resolvePromise = AWS.util.promisifyMethod('resolve', PromiseDependency); -}; +function escapeAttribute(value) { + return value.replace(/&/g, '&').replace(/'/g, ''').replace(//g, '>').replace(/"/g, '"'); +} /** * @api private */ -AWS.TokenProviderChain.deletePromisesFromClass = function deletePromisesFromClass() { - delete this.prototype.resolvePromise; +module.exports = { + escapeAttribute: escapeAttribute }; -AWS.util.addPromises(AWS.TokenProviderChain); - /***/ }), -/***/ 77985: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 98464: +/***/ ((module) => { -/* eslint guard-for-in:0 */ -var AWS; +/** + * Escapes characters that can not be in an XML element. + */ +function escapeElement(value) { + return value.replace(/&/g, '&') + .replace(//g, '>') + .replace(/\r/g, ' ') + .replace(/\n/g, ' ') + .replace(/\u0085/g, '…') + .replace(/\u2028/, '
'); +} /** - * A set of utility methods for use with the AWS SDK. - * - * @!attribute abort - * Return this value from an iterator function {each} or {arrayEach} - * to break out of the iteration. - * @example Breaking out of an iterator function - * AWS.util.each({a: 1, b: 2, c: 3}, function(key, value) { - * if (key == 'b') return AWS.util.abort; - * }); - * @see each - * @see arrayEach * @api private */ -var util = { - environment: 'nodejs', - engine: function engine() { - if (util.isBrowser() && typeof navigator !== 'undefined') { - return navigator.userAgent; - } else { - var engine = process.platform + '/' + process.version; - if (process.env.AWS_EXECUTION_ENV) { - engine += ' exec-env/' + process.env.AWS_EXECUTION_ENV; - } - return engine; - } - }, - - userAgent: function userAgent() { - var name = util.environment; - var agent = 'aws-sdk-' + name + '/' + (__nccwpck_require__(28437).VERSION); - if (name === 'nodejs') agent += ' ' + util.engine(); - return agent; - }, - - uriEscape: function uriEscape(string) { - var output = encodeURIComponent(string); - output = output.replace(/[^A-Za-z0-9_.~\-%]+/g, escape); - - // AWS percent-encodes some extra non-standard characters in a URI - output = output.replace(/[*]/g, function(ch) { - return '%' + ch.charCodeAt(0).toString(16).toUpperCase(); - }); +module.exports = { + escapeElement: escapeElement +}; - return output; - }, - uriEscapePath: function uriEscapePath(string) { - var parts = []; - util.arrayEach(string.split('/'), function (part) { - parts.push(util.uriEscape(part)); - }); - return parts.join('/'); - }, +/***/ }), - urlParse: function urlParse(url) { - return util.url.parse(url); - }, +/***/ 96752: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - urlFormat: function urlFormat(url) { - return util.url.format(url); - }, +var AWS = __nccwpck_require__(28437); +var util = AWS.util; +var Shape = AWS.Model.Shape; - queryStringParse: function queryStringParse(qs) { - return util.querystring.parse(qs); - }, +var xml2js = __nccwpck_require__(66189); - queryParamsToString: function queryParamsToString(params) { - var items = []; - var escape = util.uriEscape; - var sortedKeys = Object.keys(params).sort(); +/** + * @api private + */ +var options = { // options passed to xml2js parser + explicitCharkey: false, // undocumented + trim: false, // trim the leading/trailing whitespace from text nodes + normalize: false, // trim interior whitespace inside text nodes + explicitRoot: false, // return the root node in the resulting object? + emptyTag: null, // the default value for empty nodes + explicitArray: true, // always put child nodes in an array + ignoreAttrs: false, // ignore attributes, only create text nodes + mergeAttrs: false, // merge attributes and child elements + validator: null // a callable validator +}; - util.arrayEach(sortedKeys, function(name) { - var value = params[name]; - var ename = escape(name); - var result = ename + '='; - if (Array.isArray(value)) { - var vals = []; - util.arrayEach(value, function(item) { vals.push(escape(item)); }); - result = ename + '=' + vals.sort().join('&' + ename + '='); - } else if (value !== undefined && value !== null) { - result = ename + '=' + escape(value); - } - items.push(result); - }); +function NodeXmlParser() { } - return items.join('&'); - }, +NodeXmlParser.prototype.parse = function(xml, shape) { + shape = shape || {}; - readFileSync: function readFileSync(path) { - if (util.isBrowser()) return null; - return (__nccwpck_require__(57147).readFileSync)(path, 'utf-8'); - }, + var result = null; + var error = null; - base64: { - encode: function encode64(string) { - if (typeof string === 'number') { - throw util.error(new Error('Cannot base64 encode number ' + string)); - } - if (string === null || typeof string === 'undefined') { - return string; - } - var buf = util.buffer.toBuffer(string); - return buf.toString('base64'); - }, + var parser = new xml2js.Parser(options); + parser.parseString(xml, function (e, r) { + error = e; + result = r; + }); - decode: function decode64(string) { - if (typeof string === 'number') { - throw util.error(new Error('Cannot base64 decode number ' + string)); - } - if (string === null || typeof string === 'undefined') { - return string; - } - return util.buffer.toBuffer(string, 'base64'); + if (result) { + var data = parseXml(result, shape); + if (result.ResponseMetadata) { + data.ResponseMetadata = parseXml(result.ResponseMetadata[0], {}); } + return data; + } else if (error) { + throw util.error(error, {code: 'XMLParserError', retryable: true}); + } else { // empty xml document + return parseXml({}, shape); + } +}; - }, - - buffer: { - /** - * Buffer constructor for Node buffer and buffer pollyfill - */ - toBuffer: function(data, encoding) { - return (typeof util.Buffer.from === 'function' && util.Buffer.from !== Uint8Array.from) ? - util.Buffer.from(data, encoding) : new util.Buffer(data, encoding); - }, - - alloc: function(size, fill, encoding) { - if (typeof size !== 'number') { - throw new Error('size passed to alloc must be a number.'); - } - if (typeof util.Buffer.alloc === 'function') { - return util.Buffer.alloc(size, fill, encoding); - } else { - var buf = new util.Buffer(size); - if (fill !== undefined && typeof buf.fill === 'function') { - buf.fill(fill, undefined, undefined, encoding); - } - return buf; - } - }, - - toStream: function toStream(buffer) { - if (!util.Buffer.isBuffer(buffer)) buffer = util.buffer.toBuffer(buffer); - - var readable = new (util.stream.Readable)(); - var pos = 0; - readable._read = function(size) { - if (pos >= buffer.length) return readable.push(null); - - var end = pos + size; - if (end > buffer.length) end = buffer.length; - readable.push(buffer.slice(pos, end)); - pos = end; - }; - - return readable; - }, - - /** - * Concatenates a list of Buffer objects. - */ - concat: function(buffers) { - var length = 0, - offset = 0, - buffer = null, i; - - for (i = 0; i < buffers.length; i++) { - length += buffers[i].length; - } +function parseXml(xml, shape) { + switch (shape.type) { + case 'structure': return parseStructure(xml, shape); + case 'map': return parseMap(xml, shape); + case 'list': return parseList(xml, shape); + case undefined: case null: return parseUnknown(xml); + default: return parseScalar(xml, shape); + } +} - buffer = util.buffer.alloc(length); +function parseStructure(xml, shape) { + var data = {}; + if (xml === null) return data; - for (i = 0; i < buffers.length; i++) { - buffers[i].copy(buffer, offset); - offset += buffers[i].length; - } + util.each(shape.members, function(memberName, memberShape) { + var xmlName = memberShape.name; + if (Object.prototype.hasOwnProperty.call(xml, xmlName) && Array.isArray(xml[xmlName])) { + var xmlChild = xml[xmlName]; + if (!memberShape.flattened) xmlChild = xmlChild[0]; - return buffer; + data[memberName] = parseXml(xmlChild, memberShape); + } else if (memberShape.isXmlAttribute && + xml.$ && Object.prototype.hasOwnProperty.call(xml.$, xmlName)) { + data[memberName] = parseScalar(xml.$[xmlName], memberShape); + } else if (memberShape.type === 'list' && !shape.api.xmlNoDefaultLists) { + data[memberName] = memberShape.defaultValue; } - }, + }); - string: { - byteLength: function byteLength(string) { - if (string === null || string === undefined) return 0; - if (typeof string === 'string') string = util.buffer.toBuffer(string); + return data; +} - if (typeof string.byteLength === 'number') { - return string.byteLength; - } else if (typeof string.length === 'number') { - return string.length; - } else if (typeof string.size === 'number') { - return string.size; - } else if (typeof string.path === 'string') { - return (__nccwpck_require__(57147).lstatSync)(string.path).size; - } else { - throw util.error(new Error('Cannot determine length of ' + string), - { object: string }); - } - }, +function parseMap(xml, shape) { + var data = {}; + if (xml === null) return data; - upperFirst: function upperFirst(string) { - return string[0].toUpperCase() + string.substr(1); - }, + var xmlKey = shape.key.name || 'key'; + var xmlValue = shape.value.name || 'value'; + var iterable = shape.flattened ? xml : xml.entry; - lowerFirst: function lowerFirst(string) { - return string[0].toLowerCase() + string.substr(1); - } - }, + if (Array.isArray(iterable)) { + util.arrayEach(iterable, function(child) { + data[child[xmlKey][0]] = parseXml(child[xmlValue][0], shape.value); + }); + } - ini: { - parse: function string(ini) { - var currentSection, map = {}; - util.arrayEach(ini.split(/\r?\n/), function(line) { - line = line.split(/(^|\s)[;#]/)[0].trim(); // remove comments and trim - var isSection = line[0] === '[' && line[line.length - 1] === ']'; - if (isSection) { - currentSection = line.substring(1, line.length - 1); - if (currentSection === '__proto__' || currentSection.split(/\s/)[1] === '__proto__') { - throw util.error( - new Error('Cannot load profile name \'' + currentSection + '\' from shared ini file.') - ); - } - } else if (currentSection) { - var indexOfEqualsSign = line.indexOf('='); - var start = 0; - var end = line.length - 1; - var isAssignment = - indexOfEqualsSign !== -1 && indexOfEqualsSign !== start && indexOfEqualsSign !== end; + return data; +} - if (isAssignment) { - var name = line.substring(0, indexOfEqualsSign).trim(); - var value = line.substring(indexOfEqualsSign + 1).trim(); +function parseList(xml, shape) { + var data = []; + var name = shape.member.name || 'member'; + if (shape.flattened) { + util.arrayEach(xml, function(xmlChild) { + data.push(parseXml(xmlChild, shape.member)); + }); + } else if (xml && Array.isArray(xml[name])) { + util.arrayEach(xml[name], function(child) { + data.push(parseXml(child, shape.member)); + }); + } - map[currentSection] = map[currentSection] || {}; - map[currentSection][name] = value; - } - } - }); + return data; +} - return map; - } - }, +function parseScalar(text, shape) { + if (text && text.$ && text.$.encoding === 'base64') { + shape = new Shape.create({type: text.$.encoding}); + } + if (text && text._) text = text._; - fn: { - noop: function() {}, - callback: function (err) { if (err) throw err; }, + if (typeof shape.toType === 'function') { + return shape.toType(text); + } else { + return text; + } +} - /** - * Turn a synchronous function into as "async" function by making it call - * a callback. The underlying function is called with all but the last argument, - * which is treated as the callback. The callback is passed passed a first argument - * of null on success to mimick standard node callbacks. - */ - makeAsync: function makeAsync(fn, expectedArgs) { - if (expectedArgs && expectedArgs <= fn.length) { - return fn; - } +function parseUnknown(xml) { + if (xml === undefined || xml === null) return ''; + if (typeof xml === 'string') return xml; - return function() { - var args = Array.prototype.slice.call(arguments, 0); - var callback = args.pop(); - var result = fn.apply(null, args); - callback(result); - }; + // parse a list + if (Array.isArray(xml)) { + var arr = []; + for (i = 0; i < xml.length; i++) { + arr.push(parseXml(xml[i], {})); } - }, + return arr; + } - /** - * Date and time utility functions. - */ - date: { + // empty object + var keys = Object.keys(xml), i; + if (keys.length === 0 || (keys.length === 1 && keys[0] === '$')) { + return {}; + } - /** - * @return [Date] the current JavaScript date object. Since all - * AWS services rely on this date object, you can override - * this function to provide a special time value to AWS service - * requests. - */ - getDate: function getDate() { - if (!AWS) AWS = __nccwpck_require__(28437); - if (AWS.config.systemClockOffset) { // use offset when non-zero - return new Date(new Date().getTime() + AWS.config.systemClockOffset); - } else { - return new Date(); - } - }, + // object, parse as structure + var data = {}; + for (i = 0; i < keys.length; i++) { + var key = keys[i], value = xml[key]; + if (key === '$') continue; + if (value.length > 1) { // this member is a list + data[key] = parseList(value, {member: {}}); + } else { // this member is a single item + data[key] = parseXml(value[0], {}); + } + } + return data; +} - /** - * @return [String] the date in ISO-8601 format - */ - iso8601: function iso8601(date) { - if (date === undefined) { date = util.date.getDate(); } - return date.toISOString().replace(/\.\d{3}Z$/, 'Z'); - }, +/** + * @api private + */ +module.exports = NodeXmlParser; - /** - * @return [String] the date in RFC 822 format - */ - rfc822: function rfc822(date) { - if (date === undefined) { date = util.date.getDate(); } - return date.toUTCString(); - }, - /** - * @return [Integer] the UNIX timestamp value for the current time - */ - unixTimestamp: function unixTimestamp(date) { - if (date === undefined) { date = util.date.getDate(); } - return date.getTime() / 1000; - }, +/***/ }), - /** - * @param [String,number,Date] date - * @return [Date] - */ - from: function format(date) { - if (typeof date === 'number') { - return new Date(date * 1000); // unix timestamp - } else { - return new Date(date); - } - }, +/***/ 20397: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - /** - * Given a Date or date-like value, this function formats the - * date into a string of the requested value. - * @param [String,number,Date] date - * @param [String] formatter Valid formats are: - # * 'iso8601' - # * 'rfc822' - # * 'unixTimestamp' - * @return [String] - */ - format: function format(date, formatter) { - if (!formatter) formatter = 'iso8601'; - return util.date[formatter](util.date.from(date)); - }, +var escapeAttribute = (__nccwpck_require__(98241).escapeAttribute); - parseTimestamp: function parseTimestamp(value) { - if (typeof value === 'number') { // unix timestamp (number) - return new Date(value * 1000); - } else if (value.match(/^\d+$/)) { // unix timestamp - return new Date(value * 1000); - } else if (value.match(/^\d{4}/)) { // iso8601 - return new Date(value); - } else if (value.match(/^\w{3},/)) { // rfc822 - return new Date(value); - } else { - throw util.error( - new Error('unhandled timestamp format: ' + value), - {code: 'TimestampParserError'}); - } +/** + * Represents an XML node. + * @api private + */ +function XmlNode(name, children) { + if (children === void 0) { children = []; } + this.name = name; + this.children = children; + this.attributes = {}; +} +XmlNode.prototype.addAttribute = function (name, value) { + this.attributes[name] = value; + return this; +}; +XmlNode.prototype.addChildNode = function (child) { + this.children.push(child); + return this; +}; +XmlNode.prototype.removeAttribute = function (name) { + delete this.attributes[name]; + return this; +}; +XmlNode.prototype.toString = function () { + var hasChildren = Boolean(this.children.length); + var xmlText = '<' + this.name; + // add attributes + var attributes = this.attributes; + for (var i = 0, attributeNames = Object.keys(attributes); i < attributeNames.length; i++) { + var attributeName = attributeNames[i]; + var attribute = attributes[attributeName]; + if (typeof attribute !== 'undefined' && attribute !== null) { + xmlText += ' ' + attributeName + '=\"' + escapeAttribute('' + attribute) + '\"'; + } } + return xmlText += !hasChildren ? '/>' : '>' + this.children.map(function (c) { return c.toString(); }).join('') + ''; +}; - }, +/** + * @api private + */ +module.exports = { + XmlNode: XmlNode +}; - crypto: { - crc32Table: [ - 0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA, 0x076DC419, - 0x706AF48F, 0xE963A535, 0x9E6495A3, 0x0EDB8832, 0x79DCB8A4, - 0xE0D5E91E, 0x97D2D988, 0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, - 0x90BF1D91, 0x1DB71064, 0x6AB020F2, 0xF3B97148, 0x84BE41DE, - 0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7, 0x136C9856, - 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC, 0x14015C4F, 0x63066CD9, - 0xFA0F3D63, 0x8D080DF5, 0x3B6E20C8, 0x4C69105E, 0xD56041E4, - 0xA2677172, 0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B, - 0x35B5A8FA, 0x42B2986C, 0xDBBBC9D6, 0xACBCF940, 0x32D86CE3, - 0x45DF5C75, 0xDCD60DCF, 0xABD13D59, 0x26D930AC, 0x51DE003A, - 0xC8D75180, 0xBFD06116, 0x21B4F4B5, 0x56B3C423, 0xCFBA9599, - 0xB8BDA50F, 0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924, - 0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D, 0x76DC4190, - 0x01DB7106, 0x98D220BC, 0xEFD5102A, 0x71B18589, 0x06B6B51F, - 0x9FBFE4A5, 0xE8B8D433, 0x7807C9A2, 0x0F00F934, 0x9609A88E, - 0xE10E9818, 0x7F6A0DBB, 0x086D3D2D, 0x91646C97, 0xE6635C01, - 0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E, 0x6C0695ED, - 0x1B01A57B, 0x8208F4C1, 0xF50FC457, 0x65B0D9C6, 0x12B7E950, - 0x8BBEB8EA, 0xFCB9887C, 0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, - 0xFBD44C65, 0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2, - 0x4ADFA541, 0x3DD895D7, 0xA4D1C46D, 0xD3D6F4FB, 0x4369E96A, - 0x346ED9FC, 0xAD678846, 0xDA60B8D0, 0x44042D73, 0x33031DE5, - 0xAA0A4C5F, 0xDD0D7CC9, 0x5005713C, 0x270241AA, 0xBE0B1010, - 0xC90C2086, 0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F, - 0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4, 0x59B33D17, - 0x2EB40D81, 0xB7BD5C3B, 0xC0BA6CAD, 0xEDB88320, 0x9ABFB3B6, - 0x03B6E20C, 0x74B1D29A, 0xEAD54739, 0x9DD277AF, 0x04DB2615, - 0x73DC1683, 0xE3630B12, 0x94643B84, 0x0D6D6A3E, 0x7A6A5AA8, - 0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1, 0xF00F9344, - 0x8708A3D2, 0x1E01F268, 0x6906C2FE, 0xF762575D, 0x806567CB, - 0x196C3671, 0x6E6B06E7, 0xFED41B76, 0x89D32BE0, 0x10DA7A5A, - 0x67DD4ACC, 0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5, - 0xD6D6A3E8, 0xA1D1937E, 0x38D8C2C4, 0x4FDFF252, 0xD1BB67F1, - 0xA6BC5767, 0x3FB506DD, 0x48B2364B, 0xD80D2BDA, 0xAF0A1B4C, - 0x36034AF6, 0x41047A60, 0xDF60EFC3, 0xA867DF55, 0x316E8EEF, - 0x4669BE79, 0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236, - 0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F, 0xC5BA3BBE, - 0xB2BD0B28, 0x2BB45A92, 0x5CB36A04, 0xC2D7FFA7, 0xB5D0CF31, - 0x2CD99E8B, 0x5BDEAE1D, 0x9B64C2B0, 0xEC63F226, 0x756AA39C, - 0x026D930A, 0x9C0906A9, 0xEB0E363F, 0x72076785, 0x05005713, - 0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38, 0x92D28E9B, - 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21, 0x86D3D2D4, 0xF1D4E242, - 0x68DDB3F8, 0x1FDA836E, 0x81BE16CD, 0xF6B9265B, 0x6FB077E1, - 0x18B74777, 0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C, - 0x8F659EFF, 0xF862AE69, 0x616BFFD3, 0x166CCF45, 0xA00AE278, - 0xD70DD2EE, 0x4E048354, 0x3903B3C2, 0xA7672661, 0xD06016F7, - 0x4969474D, 0x3E6E77DB, 0xAED16A4A, 0xD9D65ADC, 0x40DF0B66, - 0x37D83BF0, 0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9, - 0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6, 0xBAD03605, - 0xCDD70693, 0x54DE5729, 0x23D967BF, 0xB3667A2E, 0xC4614AB8, - 0x5D681B02, 0x2A6F2B94, 0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, - 0x2D02EF8D], - crc32: function crc32(data) { - var tbl = util.crypto.crc32Table; - var crc = 0 ^ -1; +/***/ }), - if (typeof data === 'string') { - data = util.buffer.toBuffer(data); - } +/***/ 90971: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - for (var i = 0; i < data.length; i++) { - var code = data.readUInt8(i); - crc = (crc >>> 8) ^ tbl[(crc ^ code) & 0xFF]; - } - return (crc ^ -1) >>> 0; - }, +var escapeElement = (__nccwpck_require__(98464).escapeElement); - hmac: function hmac(key, string, digest, fn) { - if (!digest) digest = 'binary'; - if (digest === 'buffer') { digest = undefined; } - if (!fn) fn = 'sha256'; - if (typeof string === 'string') string = util.buffer.toBuffer(string); - return util.crypto.lib.createHmac(fn, key).update(string).digest(digest); - }, +/** + * Represents an XML text value. + * @api private + */ +function XmlText(value) { + this.value = value; +} - md5: function md5(data, digest, callback) { - return util.crypto.hash('md5', data, digest, callback); - }, +XmlText.prototype.toString = function () { + return escapeElement('' + this.value); +}; - sha256: function sha256(data, digest, callback) { - return util.crypto.hash('sha256', data, digest, callback); - }, +/** + * @api private + */ +module.exports = { + XmlText: XmlText +}; - hash: function(algorithm, data, digest, callback) { - var hash = util.crypto.createHash(algorithm); - if (!digest) { digest = 'binary'; } - if (digest === 'buffer') { digest = undefined; } - if (typeof data === 'string') data = util.buffer.toBuffer(data); - var sliceFn = util.arraySliceFn(data); - var isBuffer = util.Buffer.isBuffer(data); - //Identifying objects with an ArrayBuffer as buffers - if (util.isBrowser() && typeof ArrayBuffer !== 'undefined' && data && data.buffer instanceof ArrayBuffer) isBuffer = true; - if (callback && typeof data === 'object' && - typeof data.on === 'function' && !isBuffer) { - data.on('data', function(chunk) { hash.update(chunk); }); - data.on('error', function(err) { callback(err); }); - data.on('end', function() { callback(null, hash.digest(digest)); }); - } else if (callback && sliceFn && !isBuffer && - typeof FileReader !== 'undefined') { - // this might be a File/Blob - var index = 0, size = 1024 * 512; - var reader = new FileReader(); - reader.onerror = function() { - callback(new Error('Failed to read data.')); - }; - reader.onload = function() { - var buf = new util.Buffer(new Uint8Array(reader.result)); - hash.update(buf); - index += buf.length; - reader._continueReading(); - }; - reader._continueReading = function() { - if (index >= data.size) { - callback(null, hash.digest(digest)); - return; - } +/***/ }), - var back = index + size; - if (back > data.size) back = data.size; - reader.readAsArrayBuffer(sliceFn.call(data, index, back)); - }; +/***/ 35827: +/***/ ((__unused_webpack_module, exports) => { - reader._continueReading(); - } else { - if (util.isBrowser() && typeof data === 'object' && !isBuffer) { - data = new util.Buffer(new Uint8Array(data)); - } - var out = hash.update(data).digest(digest); - if (callback) callback(null, out); - return out; - } - }, +"use strict"; - toHex: function toHex(data) { - var out = []; - for (var i = 0; i < data.length; i++) { - out.push(('0' + data.charCodeAt(i).toString(16)).substr(-2, 2)); - } - return out.join(''); - }, - createHash: function createHash(algorithm) { - return util.crypto.lib.createHash(algorithm); - } +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; - }, +/** + * Convert array of 16 byte values to UUID string format of the form: + * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + */ +var byteToHex = []; - /** @!ignore */ +for (var i = 0; i < 256; ++i) { + byteToHex[i] = (i + 0x100).toString(16).substr(1); +} - /* Abort constant */ - abort: {}, +function bytesToUuid(buf, offset) { + var i = offset || 0; + var bth = byteToHex; // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 - each: function each(object, iterFunction) { - for (var key in object) { - if (Object.prototype.hasOwnProperty.call(object, key)) { - var ret = iterFunction.call(this, key, object[key]); - if (ret === util.abort) break; - } - } - }, + return [bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]]].join(''); +} - arrayEach: function arrayEach(array, iterFunction) { - for (var idx in array) { - if (Object.prototype.hasOwnProperty.call(array, idx)) { - var ret = iterFunction.call(this, array[idx], parseInt(idx, 10)); - if (ret === util.abort) break; - } - } - }, +var _default = bytesToUuid; +exports["default"] = _default; - update: function update(obj1, obj2) { - util.each(obj2, function iterator(key, item) { - obj1[key] = item; - }); - return obj1; - }, +/***/ }), - merge: function merge(obj1, obj2) { - return util.update(util.copy(obj1), obj2); - }, +/***/ 57821: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - copy: function copy(object) { - if (object === null || object === undefined) return object; - var dupe = {}; - // jshint forin:false - for (var key in object) { - dupe[key] = object[key]; - } - return dupe; - }, +"use strict"; +var __webpack_unused_export__; - isEmpty: function isEmpty(obj) { - for (var prop in obj) { - if (Object.prototype.hasOwnProperty.call(obj, prop)) { - return false; - } - } - return true; - }, - arraySliceFn: function arraySliceFn(obj) { - var fn = obj.slice || obj.webkitSlice || obj.mozSlice; - return typeof fn === 'function' ? fn : null; - }, +__webpack_unused_export__ = ({ + value: true +}); +__webpack_unused_export__ = ({ + enumerable: true, + get: function () { + return _v.default; + } +}); +__webpack_unused_export__ = ({ + enumerable: true, + get: function () { + return _v2.default; + } +}); +Object.defineProperty(exports, "v4", ({ + enumerable: true, + get: function () { + return _v3.default; + } +})); +__webpack_unused_export__ = ({ + enumerable: true, + get: function () { + return _v4.default; + } +}); - isType: function isType(obj, type) { - // handle cross-"frame" objects - if (typeof type === 'function') type = util.typeName(type); - return Object.prototype.toString.call(obj) === '[object ' + type + ']'; - }, +var _v = _interopRequireDefault(__nccwpck_require__(67668)); - typeName: function typeName(type) { - if (Object.prototype.hasOwnProperty.call(type, 'name')) return type.name; - var str = type.toString(); - var match = str.match(/^\s*function (.+)\(/); - return match ? match[1] : str; - }, +var _v2 = _interopRequireDefault(__nccwpck_require__(98573)); - error: function error(err, options) { - var originalError = null; - if (typeof err.message === 'string' && err.message !== '') { - if (typeof options === 'string' || (options && options.message)) { - originalError = util.copy(err); - originalError.message = err.message; - } - } - err.message = err.message || null; +var _v3 = _interopRequireDefault(__nccwpck_require__(7811)); - if (typeof options === 'string') { - err.message = options; - } else if (typeof options === 'object' && options !== null) { - util.update(err, options); - if (options.message) - err.message = options.message; - if (options.code || options.name) - err.code = options.code || options.name; - if (options.stack) - err.stack = options.stack; - } +var _v4 = _interopRequireDefault(__nccwpck_require__(46508)); - if (typeof Object.defineProperty === 'function') { - Object.defineProperty(err, 'name', {writable: true, enumerable: false}); - Object.defineProperty(err, 'message', {enumerable: true}); - } +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - err.name = String(options && options.name || err.name || err.code || 'Error'); - err.time = new Date(); +/***/ }), - if (originalError) { - err.originalError = originalError; - } +/***/ 93525: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +"use strict"; - for (var key in options || {}) { - if (key[0] === '[' && key[key.length - 1] === ']') { - key = key.slice(1, -1); - if (key === 'code' || key === 'message') { - continue; - } - err['[' + key + ']'] = 'See error.' + key + ' for details.'; - Object.defineProperty(err, key, { - value: err[key] || (options && options[key]) || (originalError && originalError[key]), - enumerable: false, - writable: true - }); - } - } - return err; - }, +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; - /** - * @api private - */ - inherit: function inherit(klass, features) { - var newObject = null; - if (features === undefined) { - features = klass; - klass = Object; - newObject = {}; - } else { - var ctor = function ConstructorWrapper() {}; - ctor.prototype = klass.prototype; - newObject = new ctor(); - } +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); - // constructor not supplied, create pass-through ctor - if (features.constructor === Object) { - features.constructor = function() { - if (klass !== Object) { - return klass.apply(this, arguments); - } - }; - } +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - features.constructor.prototype = newObject; - util.update(features.constructor.prototype, features); - features.constructor.__super__ = klass; - return features.constructor; - }, +function md5(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } - /** - * @api private - */ - mixin: function mixin() { - var klass = arguments[0]; - for (var i = 1; i < arguments.length; i++) { - // jshint forin:false - for (var prop in arguments[i].prototype) { - var fn = arguments[i].prototype[prop]; - if (prop !== 'constructor') { - klass.prototype[prop] = fn; - } - } - } - return klass; - }, + return _crypto.default.createHash('md5').update(bytes).digest(); +} - /** - * @api private - */ - hideProperties: function hideProperties(obj, props) { - if (typeof Object.defineProperty !== 'function') return; +var _default = md5; +exports["default"] = _default; - util.arrayEach(props, function (key) { - Object.defineProperty(obj, key, { - enumerable: false, writable: true, configurable: true }); - }); - }, +/***/ }), - /** - * @api private - */ - property: function property(obj, name, value, enumerable, isValue) { - var opts = { - configurable: true, - enumerable: enumerable !== undefined ? enumerable : true - }; - if (typeof value === 'function' && !isValue) { - opts.get = value; - } - else { - opts.value = value; opts.writable = true; - } +/***/ 49788: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - Object.defineProperty(obj, name, opts); - }, +"use strict"; - /** - * @api private - */ - memoizedProperty: function memoizedProperty(obj, name, get, enumerable) { - var cachedValue = null; - // build enumerable attribute for each value with lazy accessor. - util.property(obj, name, function() { - if (cachedValue === null) { - cachedValue = get(); - } - return cachedValue; - }, enumerable); - }, +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = rng; - /** - * TODO Remove in major version revision - * This backfill populates response data without the - * top-level payload name. - * - * @api private - */ - hoistPayloadMember: function hoistPayloadMember(resp) { - var req = resp.request; - var operationName = req.operation; - var operation = req.service.api.operations[operationName]; - var output = operation.output; - if (output.payload && !operation.hasEventOutput) { - var payloadMember = output.members[output.payload]; - var responsePayload = resp.data[output.payload]; - if (payloadMember.type === 'structure') { - util.each(responsePayload, function(key, value) { - util.property(resp.data, key, value, false); - }); - } - } - }, +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); - /** - * Compute SHA-256 checksums of streams - * - * @api private - */ - computeSha256: function computeSha256(body, done) { - if (util.isNode()) { - var Stream = util.stream.Stream; - var fs = __nccwpck_require__(57147); - if (typeof Stream === 'function' && body instanceof Stream) { - if (typeof body.path === 'string') { // assume file object - var settings = {}; - if (typeof body.start === 'number') { - settings.start = body.start; - } - if (typeof body.end === 'number') { - settings.end = body.end; - } - body = fs.createReadStream(body.path, settings); - } else { // TODO support other stream types - return done(new Error('Non-file stream objects are ' + - 'not supported with SigV4')); - } - } - } +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function rng() { + return _crypto.default.randomBytes(16); +} + +/***/ }), + +/***/ 7387: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; - util.crypto.sha256(body, 'hex', function(err, sha) { - if (err) done(err); - else done(null, sha); - }); - }, +var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); - /** - * @api private - */ - isClockSkewed: function isClockSkewed(serverTime) { - if (serverTime) { - util.property(AWS.config, 'isClockSkewed', - Math.abs(new Date().getTime() - serverTime) >= 300000, false); - return AWS.config.isClockSkewed; - } - }, +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - applyClockOffset: function applyClockOffset(serverTime) { - if (serverTime) - AWS.config.systemClockOffset = serverTime - new Date().getTime(); - }, +function sha1(bytes) { + if (Array.isArray(bytes)) { + bytes = Buffer.from(bytes); + } else if (typeof bytes === 'string') { + bytes = Buffer.from(bytes, 'utf8'); + } - /** - * @api private - */ - extractRequestId: function extractRequestId(resp) { - var requestId = resp.httpResponse.headers['x-amz-request-id'] || - resp.httpResponse.headers['x-amzn-requestid']; + return _crypto.default.createHash('sha1').update(bytes).digest(); +} - if (!requestId && resp.data && resp.data.ResponseMetadata) { - requestId = resp.data.ResponseMetadata.RequestId; - } +var _default = sha1; +exports["default"] = _default; - if (requestId) { - resp.requestId = requestId; - } +/***/ }), - if (resp.error) { - resp.error.requestId = requestId; - } - }, +/***/ 67668: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - /** - * @api private - */ - addPromises: function addPromises(constructors, PromiseDependency) { - var deletePromises = false; - if (PromiseDependency === undefined && AWS && AWS.config) { - PromiseDependency = AWS.config.getPromisesDependency(); - } - if (PromiseDependency === undefined && typeof Promise !== 'undefined') { - PromiseDependency = Promise; - } - if (typeof PromiseDependency !== 'function') deletePromises = true; - if (!Array.isArray(constructors)) constructors = [constructors]; +"use strict"; - for (var ind = 0; ind < constructors.length; ind++) { - var constructor = constructors[ind]; - if (deletePromises) { - if (constructor.deletePromisesFromClass) { - constructor.deletePromisesFromClass(); - } - } else if (constructor.addPromisesToClass) { - constructor.addPromisesToClass(PromiseDependency); - } - } - }, - /** - * @api private - * Return a function that will return a promise whose fate is decided by the - * callback behavior of the given method with `methodName`. The method to be - * promisified should conform to node.js convention of accepting a callback as - * last argument and calling that callback with error as the first argument - * and success value on the second argument. - */ - promisifyMethod: function promisifyMethod(methodName, PromiseDependency) { - return function promise() { - var self = this; - var args = Array.prototype.slice.call(arguments); - return new PromiseDependency(function(resolve, reject) { - args.push(function(err, data) { - if (err) { - reject(err); - } else { - resolve(data); - } - }); - self[methodName].apply(self, args); - }); - }; - }, +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; - /** - * @api private - */ - isDualstackAvailable: function isDualstackAvailable(service) { - if (!service) return false; - var metadata = __nccwpck_require__(17752); - if (typeof service !== 'string') service = service.serviceIdentifier; - if (typeof service !== 'string' || !metadata.hasOwnProperty(service)) return false; - return !!metadata[service].dualstackAvailable; - }, +var _rng = _interopRequireDefault(__nccwpck_require__(49788)); - /** - * @api private - */ - calculateRetryDelay: function calculateRetryDelay(retryCount, retryDelayOptions, err) { - if (!retryDelayOptions) retryDelayOptions = {}; - var customBackoff = retryDelayOptions.customBackoff || null; - if (typeof customBackoff === 'function') { - return customBackoff(retryCount, err); - } - var base = typeof retryDelayOptions.base === 'number' ? retryDelayOptions.base : 100; - var delay = Math.random() * (Math.pow(2, retryCount) * base); - return delay; - }, +var _bytesToUuid = _interopRequireDefault(__nccwpck_require__(35827)); - /** - * @api private - */ - handleRequestWithRetries: function handleRequestWithRetries(httpRequest, options, cb) { - if (!options) options = {}; - var http = AWS.HttpClient.getInstance(); - var httpOptions = options.httpOptions || {}; - var retryCount = 0; +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - var errCallback = function(err) { - var maxRetries = options.maxRetries || 0; - if (err && err.code === 'TimeoutError') err.retryable = true; +// **`v1()` - Generate time-based UUID** +// +// Inspired by https://github.com/LiosK/UUID.js +// and http://docs.python.org/library/uuid.html +var _nodeId; - // Call `calculateRetryDelay()` only when relevant, see #3401 - if (err && err.retryable && retryCount < maxRetries) { - var delay = util.calculateRetryDelay(retryCount, options.retryDelayOptions, err); - if (delay >= 0) { - retryCount++; - setTimeout(sendRequest, delay + (err.retryAfter || 0)); - return; - } - } - cb(err); - }; +var _clockseq; // Previous uuid creation time - var sendRequest = function() { - var data = ''; - http.handleRequest(httpRequest, httpOptions, function(httpResponse) { - httpResponse.on('data', function(chunk) { data += chunk.toString(); }); - httpResponse.on('end', function() { - var statusCode = httpResponse.statusCode; - if (statusCode < 300) { - cb(null, data); - } else { - var retryAfter = parseInt(httpResponse.headers['retry-after'], 10) * 1000 || 0; - var err = util.error(new Error(), - { - statusCode: statusCode, - retryable: statusCode >= 500 || statusCode === 429 - } - ); - if (retryAfter && err.retryable) err.retryAfter = retryAfter; - errCallback(err); - } - }); - }, errCallback); - }; - AWS.util.defer(sendRequest); - }, +var _lastMSecs = 0; +var _lastNSecs = 0; // See https://github.com/uuidjs/uuid for API details - /** - * @api private - */ - uuid: { - v4: function uuidV4() { - return (__nccwpck_require__(57821).v4)(); - } - }, +function v1(options, buf, offset) { + var i = buf && offset || 0; + var b = buf || []; + options = options || {}; + var node = options.node || _nodeId; + var clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not + // specified. We do this lazily to minimize issues related to insufficient + // system entropy. See #189 - /** - * @api private - */ - convertPayloadToString: function convertPayloadToString(resp) { - var req = resp.request; - var operation = req.operation; - var rules = req.service.api.operations[operation].output || {}; - if (rules.payload && resp.data[rules.payload]) { - resp.data[rules.payload] = resp.data[rules.payload].toString(); + if (node == null || clockseq == null) { + var seedBytes = options.random || (options.rng || _rng.default)(); + + if (node == null) { + // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) + node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; } - }, - /** - * @api private - */ - defer: function defer(callback) { - if (typeof process === 'object' && typeof process.nextTick === 'function') { - process.nextTick(callback); - } else if (typeof setImmediate === 'function') { - setImmediate(callback); - } else { - setTimeout(callback, 0); + if (clockseq == null) { + // Per 4.2.2, randomize (14 bit) clockseq + clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; } - }, + } // UUID timestamps are 100 nano-second units since the Gregorian epoch, + // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so + // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' + // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. - /** - * @api private - */ - getRequestPayloadShape: function getRequestPayloadShape(req) { - var operations = req.service.api.operations; - if (!operations) return undefined; - var operation = (operations || {})[req.operation]; - if (!operation || !operation.input || !operation.input.payload) return undefined; - return operation.input.members[operation.input.payload]; - }, - getProfilesFromSharedConfig: function getProfilesFromSharedConfig(iniLoader, filename) { - var profiles = {}; - var profilesFromConfig = {}; - if (process.env[util.configOptInEnv]) { - var profilesFromConfig = iniLoader.loadFrom({ - isConfig: true, - filename: process.env[util.sharedConfigFileEnv] - }); - } - var profilesFromCreds= {}; - try { - var profilesFromCreds = iniLoader.loadFrom({ - filename: filename || - (process.env[util.configOptInEnv] && process.env[util.sharedCredentialsFileEnv]) - }); - } catch (error) { - // if using config, assume it is fully descriptive without a credentials file: - if (!process.env[util.configOptInEnv]) throw error; - } - for (var i = 0, profileNames = Object.keys(profilesFromConfig); i < profileNames.length; i++) { - profiles[profileNames[i]] = objectAssign(profiles[profileNames[i]] || {}, profilesFromConfig[profileNames[i]]); - } - for (var i = 0, profileNames = Object.keys(profilesFromCreds); i < profileNames.length; i++) { - profiles[profileNames[i]] = objectAssign(profiles[profileNames[i]] || {}, profilesFromCreds[profileNames[i]]); - } - return profiles; + var msecs = options.msecs !== undefined ? options.msecs : new Date().getTime(); // Per 4.2.1.2, use count of uuid's generated during the current clock + // cycle to simulate higher resolution clock - /** - * Roughly the semantics of `Object.assign(target, source)` - */ - function objectAssign(target, source) { - for (var i = 0, keys = Object.keys(source); i < keys.length; i++) { - target[keys[i]] = source[keys[i]]; - } - return target; - } - }, + var nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) - /** - * @api private - */ - ARN: { - validate: function validateARN(str) { - return str && str.indexOf('arn:') === 0 && str.split(':').length >= 6; - }, - parse: function parseARN(arn) { - var matched = arn.split(':'); - return { - partition: matched[1], - service: matched[2], - region: matched[3], - accountId: matched[4], - resource: matched.slice(5).join(':') - }; - }, - build: function buildARN(arnObject) { - if ( - arnObject.service === undefined || - arnObject.region === undefined || - arnObject.accountId === undefined || - arnObject.resource === undefined - ) throw util.error(new Error('Input ARN object is invalid')); - return 'arn:'+ (arnObject.partition || 'aws') + ':' + arnObject.service + - ':' + arnObject.region + ':' + arnObject.accountId + ':' + arnObject.resource; - } - }, + var dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression - /** - * @api private - */ - defaultProfile: 'default', + if (dt < 0 && options.clockseq === undefined) { + clockseq = clockseq + 1 & 0x3fff; + } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new + // time interval - /** - * @api private - */ - configOptInEnv: 'AWS_SDK_LOAD_CONFIG', - /** - * @api private - */ - sharedCredentialsFileEnv: 'AWS_SHARED_CREDENTIALS_FILE', + if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { + nsecs = 0; + } // Per 4.2.1.2 Throw error if too many uuids are requested - /** - * @api private - */ - sharedConfigFileEnv: 'AWS_CONFIG_FILE', - /** - * @api private - */ - imdsDisabledEnv: 'AWS_EC2_METADATA_DISABLED' -}; + if (nsecs >= 10000) { + throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); + } -/** - * @api private - */ -module.exports = util; + _lastMSecs = msecs; + _lastNSecs = nsecs; + _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch + msecs += 12219292800000; // `time_low` -/***/ }), + var tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; + b[i++] = tl >>> 24 & 0xff; + b[i++] = tl >>> 16 & 0xff; + b[i++] = tl >>> 8 & 0xff; + b[i++] = tl & 0xff; // `time_mid` -/***/ 23546: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { + var tmh = msecs / 0x100000000 * 10000 & 0xfffffff; + b[i++] = tmh >>> 8 & 0xff; + b[i++] = tmh & 0xff; // `time_high_and_version` -var util = __nccwpck_require__(77985); -var XmlNode = (__nccwpck_require__(20397).XmlNode); -var XmlText = (__nccwpck_require__(90971).XmlText); + b[i++] = tmh >>> 24 & 0xf | 0x10; // include version -function XmlBuilder() { } + b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) -XmlBuilder.prototype.toXML = function(params, shape, rootElement, noEmpty) { - var xml = new XmlNode(rootElement); - applyNamespaces(xml, shape, true); - serialize(xml, params, shape); - return xml.children.length > 0 || noEmpty ? xml.toString() : ''; -}; + b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` -function serialize(xml, value, shape) { - switch (shape.type) { - case 'structure': return serializeStructure(xml, value, shape); - case 'map': return serializeMap(xml, value, shape); - case 'list': return serializeList(xml, value, shape); - default: return serializeScalar(xml, value, shape); + b[i++] = clockseq & 0xff; // `node` + + for (var n = 0; n < 6; ++n) { + b[i + n] = node[n]; } + + return buf ? buf : (0, _bytesToUuid.default)(b); } -function serializeStructure(xml, params, shape) { - util.arrayEach(shape.memberNames, function(memberName) { - var memberShape = shape.members[memberName]; - if (memberShape.location !== 'body') return; +var _default = v1; +exports["default"] = _default; - var value = params[memberName]; - var name = memberShape.name; - if (value !== undefined && value !== null) { - if (memberShape.isXmlAttribute) { - xml.addAttribute(name, value); - } else if (memberShape.flattened) { - serialize(xml, value, memberShape); - } else { - var element = new XmlNode(name); - xml.addChildNode(element); - applyNamespaces(element, memberShape); - serialize(element, value, memberShape); - } - } - }); -} +/***/ }), -function serializeMap(xml, map, shape) { - var xmlKey = shape.key.name || 'key'; - var xmlValue = shape.value.name || 'value'; +/***/ 98573: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - util.each(map, function(key, value) { - var entry = new XmlNode(shape.flattened ? shape.name : 'entry'); - xml.addChildNode(entry); +"use strict"; - var entryKey = new XmlNode(xmlKey); - var entryValue = new XmlNode(xmlValue); - entry.addChildNode(entryKey); - entry.addChildNode(entryValue); - serialize(entryKey, key, shape.key); - serialize(entryValue, value, shape.value); +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; + +var _v = _interopRequireDefault(__nccwpck_require__(36097)); + +var _md = _interopRequireDefault(__nccwpck_require__(93525)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +const v3 = (0, _v.default)('v3', 0x30, _md.default); +var _default = v3; +exports["default"] = _default; + +/***/ }), + +/***/ 36097: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; + + +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = _default; +exports.URL = exports.DNS = void 0; + +var _bytesToUuid = _interopRequireDefault(__nccwpck_require__(35827)); + +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + +function uuidToBytes(uuid) { + // Note: We assume we're being passed a valid uuid string + var bytes = []; + uuid.replace(/[a-fA-F0-9]{2}/g, function (hex) { + bytes.push(parseInt(hex, 16)); }); + return bytes; } -function serializeList(xml, list, shape) { - if (shape.flattened) { - util.arrayEach(list, function(value) { - var name = shape.member.name || shape.name; - var element = new XmlNode(name); - xml.addChildNode(element); - serialize(element, value, shape.member); - }); - } else { - util.arrayEach(list, function(value) { - var name = shape.member.name || 'member'; - var element = new XmlNode(name); - xml.addChildNode(element); - serialize(element, value, shape.member); - }); - } -} +function stringToBytes(str) { + str = unescape(encodeURIComponent(str)); // UTF8 escape -function serializeScalar(xml, value, shape) { - xml.addChildNode( - new XmlText(shape.toWireFormat(value)) - ); -} + var bytes = new Array(str.length); -function applyNamespaces(xml, shape, isRoot) { - var uri, prefix = 'xmlns'; - if (shape.xmlNamespaceUri) { - uri = shape.xmlNamespaceUri; - if (shape.xmlNamespacePrefix) prefix += ':' + shape.xmlNamespacePrefix; - } else if (isRoot && shape.api.xmlNamespaceUri) { - uri = shape.api.xmlNamespaceUri; + for (var i = 0; i < str.length; i++) { + bytes[i] = str.charCodeAt(i); } - if (uri) xml.addAttribute(prefix, uri); + return bytes; } -/** - * @api private - */ -module.exports = XmlBuilder; - +const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; +exports.DNS = DNS; +const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; +exports.URL = URL; -/***/ }), +function _default(name, version, hashfunc) { + var generateUUID = function (value, namespace, buf, offset) { + var off = buf && offset || 0; + if (typeof value == 'string') value = stringToBytes(value); + if (typeof namespace == 'string') namespace = uuidToBytes(namespace); + if (!Array.isArray(value)) throw TypeError('value must be an array of bytes'); + if (!Array.isArray(namespace) || namespace.length !== 16) throw TypeError('namespace must be uuid string or an Array of 16 byte values'); // Per 4.3 -/***/ 98241: -/***/ ((module) => { + var bytes = hashfunc(namespace.concat(value)); + bytes[6] = bytes[6] & 0x0f | version; + bytes[8] = bytes[8] & 0x3f | 0x80; -/** - * Escapes characters that can not be in an XML attribute. - */ -function escapeAttribute(value) { - return value.replace(/&/g, '&').replace(/'/g, ''').replace(//g, '>').replace(/"/g, '"'); -} + if (buf) { + for (var idx = 0; idx < 16; ++idx) { + buf[off + idx] = bytes[idx]; + } + } -/** - * @api private - */ -module.exports = { - escapeAttribute: escapeAttribute -}; + return buf || (0, _bytesToUuid.default)(bytes); + }; // Function#name is not settable on some platforms (#270) -/***/ }), + try { + generateUUID.name = name; + } catch (err) {} // For CommonJS default export support -/***/ 98464: -/***/ ((module) => { -/** - * Escapes characters that can not be in an XML element. - */ -function escapeElement(value) { - return value.replace(/&/g, '&') - .replace(//g, '>') - .replace(/\r/g, ' ') - .replace(/\n/g, ' ') - .replace(/\u0085/g, '…') - .replace(/\u2028/, '
'); + generateUUID.DNS = DNS; + generateUUID.URL = URL; + return generateUUID; } -/** - * @api private - */ -module.exports = { - escapeElement: escapeElement -}; - - /***/ }), -/***/ 96752: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 7811: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { -var AWS = __nccwpck_require__(28437); -var util = AWS.util; -var Shape = AWS.Model.Shape; +"use strict"; -var xml2js = __nccwpck_require__(66189); -/** - * @api private - */ -var options = { // options passed to xml2js parser - explicitCharkey: false, // undocumented - trim: false, // trim the leading/trailing whitespace from text nodes - normalize: false, // trim interior whitespace inside text nodes - explicitRoot: false, // return the root node in the resulting object? - emptyTag: null, // the default value for empty nodes - explicitArray: true, // always put child nodes in an array - ignoreAttrs: false, // ignore attributes, only create text nodes - mergeAttrs: false, // merge attributes and child elements - validator: null // a callable validator -}; +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; -function NodeXmlParser() { } +var _rng = _interopRequireDefault(__nccwpck_require__(49788)); -NodeXmlParser.prototype.parse = function(xml, shape) { - shape = shape || {}; +var _bytesToUuid = _interopRequireDefault(__nccwpck_require__(35827)); - var result = null; - var error = null; +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - var parser = new xml2js.Parser(options); - parser.parseString(xml, function (e, r) { - error = e; - result = r; - }); +function v4(options, buf, offset) { + var i = buf && offset || 0; - if (result) { - var data = parseXml(result, shape); - if (result.ResponseMetadata) { - data.ResponseMetadata = parseXml(result.ResponseMetadata[0], {}); - } - return data; - } else if (error) { - throw util.error(error, {code: 'XMLParserError', retryable: true}); - } else { // empty xml document - return parseXml({}, shape); + if (typeof options == 'string') { + buf = options === 'binary' ? new Array(16) : null; + options = null; } -}; -function parseXml(xml, shape) { - switch (shape.type) { - case 'structure': return parseStructure(xml, shape); - case 'map': return parseMap(xml, shape); - case 'list': return parseList(xml, shape); - case undefined: case null: return parseUnknown(xml); - default: return parseScalar(xml, shape); - } -} + options = options || {}; -function parseStructure(xml, shape) { - var data = {}; - if (xml === null) return data; + var rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` - util.each(shape.members, function(memberName, memberShape) { - var xmlName = memberShape.name; - if (Object.prototype.hasOwnProperty.call(xml, xmlName) && Array.isArray(xml[xmlName])) { - var xmlChild = xml[xmlName]; - if (!memberShape.flattened) xmlChild = xmlChild[0]; - data[memberName] = parseXml(xmlChild, memberShape); - } else if (memberShape.isXmlAttribute && - xml.$ && Object.prototype.hasOwnProperty.call(xml.$, xmlName)) { - data[memberName] = parseScalar(xml.$[xmlName], memberShape); - } else if (memberShape.type === 'list' && !shape.api.xmlNoDefaultLists) { - data[memberName] = memberShape.defaultValue; + rnds[6] = rnds[6] & 0x0f | 0x40; + rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided + + if (buf) { + for (var ii = 0; ii < 16; ++ii) { + buf[i + ii] = rnds[ii]; } - }); + } - return data; + return buf || (0, _bytesToUuid.default)(rnds); } -function parseMap(xml, shape) { - var data = {}; - if (xml === null) return data; +var _default = v4; +exports["default"] = _default; - var xmlKey = shape.key.name || 'key'; - var xmlValue = shape.value.name || 'value'; - var iterable = shape.flattened ? xml : xml.entry; +/***/ }), - if (Array.isArray(iterable)) { - util.arrayEach(iterable, function(child) { - data[child[xmlKey][0]] = parseXml(child[xmlValue][0], shape.value); - }); - } +/***/ 46508: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { - return data; -} +"use strict"; -function parseList(xml, shape) { - var data = []; - var name = shape.member.name || 'member'; - if (shape.flattened) { - util.arrayEach(xml, function(xmlChild) { - data.push(parseXml(xmlChild, shape.member)); - }); - } else if (xml && Array.isArray(xml[name])) { - util.arrayEach(xml[name], function(child) { - data.push(parseXml(child, shape.member)); - }); - } - return data; -} +Object.defineProperty(exports, "__esModule", ({ + value: true +})); +exports["default"] = void 0; -function parseScalar(text, shape) { - if (text && text.$ && text.$.encoding === 'base64') { - shape = new Shape.create({type: text.$.encoding}); - } - if (text && text._) text = text._; +var _v = _interopRequireDefault(__nccwpck_require__(36097)); - if (typeof shape.toType === 'function') { - return shape.toType(text); - } else { - return text; - } -} +var _sha = _interopRequireDefault(__nccwpck_require__(7387)); -function parseUnknown(xml) { - if (xml === undefined || xml === null) return ''; - if (typeof xml === 'string') return xml; +function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - // parse a list - if (Array.isArray(xml)) { - var arr = []; - for (i = 0; i < xml.length; i++) { - arr.push(parseXml(xml[i], {})); - } - return arr; - } +const v5 = (0, _v.default)('v5', 0x50, _sha.default); +var _default = v5; +exports["default"] = _default; - // empty object - var keys = Object.keys(xml), i; - if (keys.length === 0 || (keys.length === 1 && keys[0] === '$')) { - return {}; - } +/***/ }), - // object, parse as structure - var data = {}; - for (i = 0; i < keys.length; i++) { - var key = keys[i], value = xml[key]; - if (key === '$') continue; - if (value.length > 1) { // this member is a list - data[key] = parseList(value, {member: {}}); - } else { // this member is a single item - data[key] = parseXml(value[0], {}); - } - } - return data; -} +/***/ 96323: +/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + +"use strict"; +var __webpack_unused_export__; +__webpack_unused_export__ = ({ value: true }); +var LRU_1 = __nccwpck_require__(77710); +var CACHE_SIZE = 1000; /** - * @api private + * Inspired node-lru-cache[https://github.com/isaacs/node-lru-cache] */ -module.exports = NodeXmlParser; - +var EndpointCache = /** @class */ (function () { + function EndpointCache(maxSize) { + if (maxSize === void 0) { maxSize = CACHE_SIZE; } + this.maxSize = maxSize; + this.cache = new LRU_1.LRUCache(maxSize); + } + ; + Object.defineProperty(EndpointCache.prototype, "size", { + get: function () { + return this.cache.length; + }, + enumerable: true, + configurable: true + }); + EndpointCache.prototype.put = function (key, value) { + var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; + var endpointRecord = this.populateValue(value); + this.cache.put(keyString, endpointRecord); + }; + EndpointCache.prototype.get = function (key) { + var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; + var now = Date.now(); + var records = this.cache.get(keyString); + if (records) { + for (var i = records.length-1; i >= 0; i--) { + var record = records[i]; + if (record.Expire < now) { + records.splice(i, 1); + } + } + if (records.length === 0) { + this.cache.remove(keyString); + return undefined; + } + } + return records; + }; + EndpointCache.getKeyString = function (key) { + var identifiers = []; + var identifierNames = Object.keys(key).sort(); + for (var i = 0; i < identifierNames.length; i++) { + var identifierName = identifierNames[i]; + if (key[identifierName] === undefined) + continue; + identifiers.push(key[identifierName]); + } + return identifiers.join(' '); + }; + EndpointCache.prototype.populateValue = function (endpoints) { + var now = Date.now(); + return endpoints.map(function (endpoint) { return ({ + Address: endpoint.Address || '', + Expire: now + (endpoint.CachePeriodInMinutes || 1) * 60 * 1000 + }); }); + }; + EndpointCache.prototype.empty = function () { + this.cache.empty(); + }; + EndpointCache.prototype.remove = function (key) { + var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; + this.cache.remove(keyString); + }; + return EndpointCache; +}()); +exports.$ = EndpointCache; /***/ }), -/***/ 20397: -/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { +/***/ 77710: +/***/ ((__unused_webpack_module, exports) => { -var escapeAttribute = (__nccwpck_require__(98241).escapeAttribute); +"use strict"; -/** - * Represents an XML node. - * @api private - */ -function XmlNode(name, children) { - if (children === void 0) { children = []; } - this.name = name; - this.children = children; - this.attributes = {}; -} -XmlNode.prototype.addAttribute = function (name, value) { - this.attributes[name] = value; - return this; -}; -XmlNode.prototype.addChildNode = function (child) { - this.children.push(child); - return this; -}; -XmlNode.prototype.removeAttribute = function (name) { - delete this.attributes[name]; - return this; -}; -XmlNode.prototype.toString = function () { - var hasChildren = Boolean(this.children.length); - var xmlText = '<' + this.name; - // add attributes - var attributes = this.attributes; - for (var i = 0, attributeNames = Object.keys(attributes); i < attributeNames.length; i++) { - var attributeName = attributeNames[i]; - var attribute = attributes[attributeName]; - if (typeof attribute !== 'undefined' && attribute !== null) { - xmlText += ' ' + attributeName + '=\"' + escapeAttribute('' + attribute) + '\"'; +Object.defineProperty(exports, "__esModule", ({ value: true })); +var LinkedListNode = /** @class */ (function () { + function LinkedListNode(key, value) { + this.key = key; + this.value = value; + } + return LinkedListNode; +}()); +var LRUCache = /** @class */ (function () { + function LRUCache(size) { + this.nodeMap = {}; + this.size = 0; + if (typeof size !== 'number' || size < 1) { + throw new Error('Cache size can only be positive number'); } + this.sizeLimit = size; } - return xmlText += !hasChildren ? '/>' : '>' + this.children.map(function (c) { return c.toString(); }).join('') + ''; -}; - -/** - * @api private - */ -module.exports = { - XmlNode: XmlNode -}; - + Object.defineProperty(LRUCache.prototype, "length", { + get: function () { + return this.size; + }, + enumerable: true, + configurable: true + }); + LRUCache.prototype.prependToList = function (node) { + if (!this.headerNode) { + this.tailNode = node; + } + else { + this.headerNode.prev = node; + node.next = this.headerNode; + } + this.headerNode = node; + this.size++; + }; + LRUCache.prototype.removeFromTail = function () { + if (!this.tailNode) { + return undefined; + } + var node = this.tailNode; + var prevNode = node.prev; + if (prevNode) { + prevNode.next = undefined; + } + node.prev = undefined; + this.tailNode = prevNode; + this.size--; + return node; + }; + LRUCache.prototype.detachFromList = function (node) { + if (this.headerNode === node) { + this.headerNode = node.next; + } + if (this.tailNode === node) { + this.tailNode = node.prev; + } + if (node.prev) { + node.prev.next = node.next; + } + if (node.next) { + node.next.prev = node.prev; + } + node.next = undefined; + node.prev = undefined; + this.size--; + }; + LRUCache.prototype.get = function (key) { + if (this.nodeMap[key]) { + var node = this.nodeMap[key]; + this.detachFromList(node); + this.prependToList(node); + return node.value; + } + }; + LRUCache.prototype.remove = function (key) { + if (this.nodeMap[key]) { + var node = this.nodeMap[key]; + this.detachFromList(node); + delete this.nodeMap[key]; + } + }; + LRUCache.prototype.put = function (key, value) { + if (this.nodeMap[key]) { + this.remove(key); + } + else if (this.size === this.sizeLimit) { + var tailNode = this.removeFromTail(); + var key_1 = tailNode.key; + delete this.nodeMap[key_1]; + } + var newNode = new LinkedListNode(key, value); + this.nodeMap[key] = newNode; + this.prependToList(newNode); + }; + LRUCache.prototype.empty = function () { + var keys = Object.keys(this.nodeMap); + for (var i = 0; i < keys.length; i++) { + var key = keys[i]; + var node = this.nodeMap[key]; + this.detachFromList(node); + delete this.nodeMap[key]; + } + }; + return LRUCache; +}()); +exports.LRUCache = LRUCache; /***/ }), -/***/ 90971: +/***/ 12603: /***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { -var escapeElement = (__nccwpck_require__(98464).escapeElement); +"use strict"; -/** - * Represents an XML text value. - * @api private - */ -function XmlText(value) { - this.value = value; -} -XmlText.prototype.toString = function () { - return escapeElement('' + this.value); -}; +const validator = __nccwpck_require__(61739); +const XMLParser = __nccwpck_require__(42380); +const XMLBuilder = __nccwpck_require__(80660); -/** - * @api private - */ module.exports = { - XmlText: XmlText -}; - + XMLParser: XMLParser, + XMLValidator: validator, + XMLBuilder: XMLBuilder +} /***/ }), -/***/ 35827: +/***/ 38280: /***/ ((__unused_webpack_module, exports) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; +const nameStartChar = ':A-Za-z_\\u00C0-\\u00D6\\u00D8-\\u00F6\\u00F8-\\u02FF\\u0370-\\u037D\\u037F-\\u1FFF\\u200C-\\u200D\\u2070-\\u218F\\u2C00-\\u2FEF\\u3001-\\uD7FF\\uF900-\\uFDCF\\uFDF0-\\uFFFD'; +const nameChar = nameStartChar + '\\-.\\d\\u00B7\\u0300-\\u036F\\u203F-\\u2040'; +const nameRegexp = '[' + nameStartChar + '][' + nameChar + ']*' +const regexName = new RegExp('^' + nameRegexp + '$'); + +const getAllMatches = function(string, regex) { + const matches = []; + let match = regex.exec(string); + while (match) { + const allmatches = []; + allmatches.startIndex = regex.lastIndex - match[0].length; + const len = match.length; + for (let index = 0; index < len; index++) { + allmatches.push(match[index]); + } + matches.push(allmatches); + match = regex.exec(string); + } + return matches; +}; + +const isName = function(string) { + const match = regexName.exec(string); + return !(match === null || typeof match === 'undefined'); +}; + +exports.isExist = function(v) { + return typeof v !== 'undefined'; +}; + +exports.isEmptyObject = function(obj) { + return Object.keys(obj).length === 0; +}; /** - * Convert array of 16 byte values to UUID string format of the form: - * XXXXXXXX-XXXX-XXXX-XXXX-XXXXXXXXXXXX + * Copy all the properties of a into b. + * @param {*} target + * @param {*} a */ -var byteToHex = []; +exports.merge = function(target, a, arrayMode) { + if (a) { + const keys = Object.keys(a); // will return an array of own properties + const len = keys.length; //don't make it inline + for (let i = 0; i < len; i++) { + if (arrayMode === 'strict') { + target[keys[i]] = [ a[keys[i]] ]; + } else { + target[keys[i]] = a[keys[i]]; + } + } + } +}; +/* exports.merge =function (b,a){ + return Object.assign(b,a); +} */ -for (var i = 0; i < 256; ++i) { - byteToHex[i] = (i + 0x100).toString(16).substr(1); -} +exports.getValue = function(v) { + if (exports.isExist(v)) { + return v; + } else { + return ''; + } +}; -function bytesToUuid(buf, offset) { - var i = offset || 0; - var bth = byteToHex; // join used to fix memory issue caused by concatenation: https://bugs.chromium.org/p/v8/issues/detail?id=3175#c4 +// const fakeCall = function(a) {return a;}; +// const fakeCallNoReturn = function() {}; - return [bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], '-', bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]], bth[buf[i++]]].join(''); -} +exports.isName = isName; +exports.getAllMatches = getAllMatches; +exports.nameRegexp = nameRegexp; -var _default = bytesToUuid; -exports["default"] = _default; /***/ }), -/***/ 57821: +/***/ 61739: /***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { "use strict"; -var __webpack_unused_export__; -__webpack_unused_export__ = ({ - value: true -}); -__webpack_unused_export__ = ({ - enumerable: true, - get: function () { - return _v.default; - } -}); -__webpack_unused_export__ = ({ - enumerable: true, - get: function () { - return _v2.default; - } -}); -Object.defineProperty(exports, "v4", ({ - enumerable: true, - get: function () { - return _v3.default; - } -})); -__webpack_unused_export__ = ({ - enumerable: true, - get: function () { - return _v4.default; +const util = __nccwpck_require__(38280); + +const defaultOptions = { + allowBooleanAttributes: false, //A tag can have attributes without any value + unpairedTags: [] +}; + +//const tagsPattern = new RegExp("<\\/?([\\w:\\-_\.]+)\\s*\/?>","g"); +exports.validate = function (xmlData, options) { + options = Object.assign({}, defaultOptions, options); + + //xmlData = xmlData.replace(/(\r\n|\n|\r)/gm,"");//make it single line + //xmlData = xmlData.replace(/(^\s*<\?xml.*?\?>)/g,"");//Remove XML starting tag + //xmlData = xmlData.replace(/()/g,"");//Remove DOCTYPE + const tags = []; + let tagFound = false; + + //indicates that the root tag has been closed (aka. depth 0 has been reached) + let reachedRoot = false; + + if (xmlData[0] === '\ufeff') { + // check for byte order mark (BOM) + xmlData = xmlData.substr(1); } -}); + + for (let i = 0; i < xmlData.length; i++) { + + if (xmlData[i] === '<' && xmlData[i+1] === '?') { + i+=2; + i = readPI(xmlData,i); + if (i.err) return i; + }else if (xmlData[i] === '<') { + //starting of tag + //read until you reach to '>' avoiding any '>' in attribute value + let tagStartPos = i; + i++; + + if (xmlData[i] === '!') { + i = readCommentAndCDATA(xmlData, i); + continue; + } else { + let closingTag = false; + if (xmlData[i] === '/') { + //closing tag + closingTag = true; + i++; + } + //read tagname + let tagName = ''; + for (; i < xmlData.length && + xmlData[i] !== '>' && + xmlData[i] !== ' ' && + xmlData[i] !== '\t' && + xmlData[i] !== '\n' && + xmlData[i] !== '\r'; i++ + ) { + tagName += xmlData[i]; + } + tagName = tagName.trim(); + //console.log(tagName); + + if (tagName[tagName.length - 1] === '/') { + //self closing tag without attributes + tagName = tagName.substring(0, tagName.length - 1); + //continue; + i--; + } + if (!validateTagName(tagName)) { + let msg; + if (tagName.trim().length === 0) { + msg = "Invalid space after '<'."; + } else { + msg = "Tag '"+tagName+"' is an invalid name."; + } + return getErrorObject('InvalidTag', msg, getLineNumberForPosition(xmlData, i)); + } -var _v = _interopRequireDefault(__nccwpck_require__(67668)); + const result = readAttributeStr(xmlData, i); + if (result === false) { + return getErrorObject('InvalidAttr', "Attributes for '"+tagName+"' have open quote.", getLineNumberForPosition(xmlData, i)); + } + let attrStr = result.value; + i = result.index; + + if (attrStr[attrStr.length - 1] === '/') { + //self closing tag + const attrStrStart = i - attrStr.length; + attrStr = attrStr.substring(0, attrStr.length - 1); + const isValid = validateAttributeString(attrStr, options); + if (isValid === true) { + tagFound = true; + //continue; //text may presents after self closing tag + } else { + //the result from the nested function returns the position of the error within the attribute + //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute + //this gives us the absolute index in the entire xml, which we can use to find the line at last + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, attrStrStart + isValid.err.line)); + } + } else if (closingTag) { + if (!result.tagClosed) { + return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' doesn't have proper closing.", getLineNumberForPosition(xmlData, i)); + } else if (attrStr.trim().length > 0) { + return getErrorObject('InvalidTag', "Closing tag '"+tagName+"' can't have attributes or invalid starting.", getLineNumberForPosition(xmlData, tagStartPos)); + } else { + const otg = tags.pop(); + if (tagName !== otg.tagName) { + let openPos = getLineNumberForPosition(xmlData, otg.tagStartPos); + return getErrorObject('InvalidTag', + "Expected closing tag '"+otg.tagName+"' (opened in line "+openPos.line+", col "+openPos.col+") instead of closing tag '"+tagName+"'.", + getLineNumberForPosition(xmlData, tagStartPos)); + } -var _v2 = _interopRequireDefault(__nccwpck_require__(98573)); + //when there are no more tags, we reached the root level. + if (tags.length == 0) { + reachedRoot = true; + } + } + } else { + const isValid = validateAttributeString(attrStr, options); + if (isValid !== true) { + //the result from the nested function returns the position of the error within the attribute + //in order to get the 'true' error line, we need to calculate the position where the attribute begins (i - attrStr.length) and then add the position within the attribute + //this gives us the absolute index in the entire xml, which we can use to find the line at last + return getErrorObject(isValid.err.code, isValid.err.msg, getLineNumberForPosition(xmlData, i - attrStr.length + isValid.err.line)); + } -var _v3 = _interopRequireDefault(__nccwpck_require__(7811)); + //if the root level has been reached before ... + if (reachedRoot === true) { + return getErrorObject('InvalidXml', 'Multiple possible root nodes found.', getLineNumberForPosition(xmlData, i)); + } else if(options.unpairedTags.indexOf(tagName) !== -1){ + //don't push into stack + } else { + tags.push({tagName, tagStartPos}); + } + tagFound = true; + } -var _v4 = _interopRequireDefault(__nccwpck_require__(46508)); + //skip tag text value + //It may include comments and CDATA value + for (i++; i < xmlData.length; i++) { + if (xmlData[i] === '<') { + if (xmlData[i + 1] === '!') { + //comment or CADATA + i++; + i = readCommentAndCDATA(xmlData, i); + continue; + } else if (xmlData[i+1] === '?') { + i = readPI(xmlData, ++i); + if (i.err) return i; + } else{ + break; + } + } else if (xmlData[i] === '&') { + const afterAmp = validateAmpersand(xmlData, i); + if (afterAmp == -1) + return getErrorObject('InvalidChar', "char '&' is not expected.", getLineNumberForPosition(xmlData, i)); + i = afterAmp; + }else{ + if (reachedRoot === true && !isWhiteSpace(xmlData[i])) { + return getErrorObject('InvalidXml', "Extra text at the end", getLineNumberForPosition(xmlData, i)); + } + } + } //end of reading tag text value + if (xmlData[i] === '<') { + i--; + } + } + } else { + if ( isWhiteSpace(xmlData[i])) { + continue; + } + return getErrorObject('InvalidChar', "char '"+xmlData[i]+"' is not expected.", getLineNumberForPosition(xmlData, i)); + } + } -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + if (!tagFound) { + return getErrorObject('InvalidXml', 'Start tag expected.', 1); + }else if (tags.length == 1) { + return getErrorObject('InvalidTag', "Unclosed tag '"+tags[0].tagName+"'.", getLineNumberForPosition(xmlData, tags[0].tagStartPos)); + }else if (tags.length > 0) { + return getErrorObject('InvalidXml', "Invalid '"+ + JSON.stringify(tags.map(t => t.tagName), null, 4).replace(/\r?\n/g, '')+ + "' found.", {line: 1, col: 1}); + } -/***/ }), + return true; +}; -/***/ 93525: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +function isWhiteSpace(char){ + return char === ' ' || char === '\t' || char === '\n' || char === '\r'; +} +/** + * Read Processing insstructions and skip + * @param {*} xmlData + * @param {*} i + */ +function readPI(xmlData, i) { + const start = i; + for (; i < xmlData.length; i++) { + if (xmlData[i] == '?' || xmlData[i] == ' ') { + //tagname + const tagname = xmlData.substr(start, i - start); + if (i > 5 && tagname === 'xml') { + return getErrorObject('InvalidXml', 'XML declaration allowed only at the start of the document.', getLineNumberForPosition(xmlData, i)); + } else if (xmlData[i] == '?' && xmlData[i + 1] == '>') { + //check if valid attribut string + i++; + break; + } else { + continue; + } + } + } + return i; +} -"use strict"; +function readCommentAndCDATA(xmlData, i) { + if (xmlData.length > i + 5 && xmlData[i + 1] === '-' && xmlData[i + 2] === '-') { + //comment + for (i += 3; i < xmlData.length; i++) { + if (xmlData[i] === '-' && xmlData[i + 1] === '-' && xmlData[i + 2] === '>') { + i += 2; + break; + } + } + } else if ( + xmlData.length > i + 8 && + xmlData[i + 1] === 'D' && + xmlData[i + 2] === 'O' && + xmlData[i + 3] === 'C' && + xmlData[i + 4] === 'T' && + xmlData[i + 5] === 'Y' && + xmlData[i + 6] === 'P' && + xmlData[i + 7] === 'E' + ) { + let angleBracketsCount = 1; + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === '<') { + angleBracketsCount++; + } else if (xmlData[i] === '>') { + angleBracketsCount--; + if (angleBracketsCount === 0) { + break; + } + } + } + } else if ( + xmlData.length > i + 9 && + xmlData[i + 1] === '[' && + xmlData[i + 2] === 'C' && + xmlData[i + 3] === 'D' && + xmlData[i + 4] === 'A' && + xmlData[i + 5] === 'T' && + xmlData[i + 6] === 'A' && + xmlData[i + 7] === '[' + ) { + for (i += 8; i < xmlData.length; i++) { + if (xmlData[i] === ']' && xmlData[i + 1] === ']' && xmlData[i + 2] === '>') { + i += 2; + break; + } + } + } + return i; +} -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; +const doubleQuote = '"'; +const singleQuote = "'"; -var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); +/** + * Keep reading xmlData until '<' is found outside the attribute value. + * @param {string} xmlData + * @param {number} i + */ +function readAttributeStr(xmlData, i) { + let attrStr = ''; + let startChar = ''; + let tagClosed = false; + for (; i < xmlData.length; i++) { + if (xmlData[i] === doubleQuote || xmlData[i] === singleQuote) { + if (startChar === '') { + startChar = xmlData[i]; + } else if (startChar !== xmlData[i]) { + //if vaue is enclosed with double quote then single quotes are allowed inside the value and vice versa + } else { + startChar = ''; + } + } else if (xmlData[i] === '>') { + if (startChar === '') { + tagClosed = true; + break; + } + } + attrStr += xmlData[i]; + } + if (startChar !== '') { + return false; + } -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + return { + value: attrStr, + index: i, + tagClosed: tagClosed + }; +} -function md5(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === 'string') { - bytes = Buffer.from(bytes, 'utf8'); +/** + * Select all the attributes whether valid or invalid. + */ +const validAttrStrRegxp = new RegExp('(\\s*)([^\\s=]+)(\\s*=)?(\\s*([\'"])(([\\s\\S])*?)\\5)?', 'g'); + +//attr, ="sd", a="amit's", a="sd"b="saf", ab cd="" + +function validateAttributeString(attrStr, options) { + //console.log("start:"+attrStr+":end"); + + //if(attrStr.trim().length === 0) return true; //empty string + + const matches = util.getAllMatches(attrStr, validAttrStrRegxp); + const attrNames = {}; + + for (let i = 0; i < matches.length; i++) { + if (matches[i][1].length === 0) { + //nospace before attribute name: a="sd"b="saf" + return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' has no space in starting.", getPositionFromMatch(matches[i])) + } else if (matches[i][3] !== undefined && matches[i][4] === undefined) { + return getErrorObject('InvalidAttr', "Attribute '"+matches[i][2]+"' is without value.", getPositionFromMatch(matches[i])); + } else if (matches[i][3] === undefined && !options.allowBooleanAttributes) { + //independent attribute: ab + return getErrorObject('InvalidAttr', "boolean attribute '"+matches[i][2]+"' is not allowed.", getPositionFromMatch(matches[i])); + } + /* else if(matches[i][6] === undefined){//attribute without value: ab= + return { err: { code:"InvalidAttr",msg:"attribute " + matches[i][2] + " has no value assigned."}}; + } */ + const attrName = matches[i][2]; + if (!validateAttrName(attrName)) { + return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is an invalid name.", getPositionFromMatch(matches[i])); + } + if (!attrNames.hasOwnProperty(attrName)) { + //check for duplicate attribute. + attrNames[attrName] = 1; + } else { + return getErrorObject('InvalidAttr', "Attribute '"+attrName+"' is repeated.", getPositionFromMatch(matches[i])); + } } - return _crypto.default.createHash('md5').update(bytes).digest(); + return true; } -var _default = md5; -exports["default"] = _default; +function validateNumberAmpersand(xmlData, i) { + let re = /\d/; + if (xmlData[i] === 'x') { + i++; + re = /[\da-fA-F]/; + } + for (; i < xmlData.length; i++) { + if (xmlData[i] === ';') + return i; + if (!xmlData[i].match(re)) + break; + } + return -1; +} -/***/ }), +function validateAmpersand(xmlData, i) { + // https://www.w3.org/TR/xml/#dt-charref + i++; + if (xmlData[i] === ';') + return -1; + if (xmlData[i] === '#') { + i++; + return validateNumberAmpersand(xmlData, i); + } + let count = 0; + for (; i < xmlData.length; i++, count++) { + if (xmlData[i].match(/\w/) && count < 20) + continue; + if (xmlData[i] === ';') + break; + return -1; + } + return i; +} -/***/ 49788: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +function getErrorObject(code, message, lineNumber) { + return { + err: { + code: code, + msg: message, + line: lineNumber.line || lineNumber, + col: lineNumber.col, + }, + }; +} -"use strict"; +function validateAttrName(attrName) { + return util.isName(attrName); +} +// const startsWithXML = /^xml/i; -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = rng; +function validateTagName(tagname) { + return util.isName(tagname) /* && !tagname.match(startsWithXML) */; +} -var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); +//this function returns the line number for the character at the given index +function getLineNumberForPosition(xmlData, index) { + const lines = xmlData.substring(0, index).split(/\r?\n/); + return { + line: lines.length, -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + // column number is last line's length + 1, because column numbering starts at 1: + col: lines[lines.length - 1].length + 1 + }; +} -function rng() { - return _crypto.default.randomBytes(16); +//this function returns the position of the first character of match within attrStr +function getPositionFromMatch(match) { + return match.startIndex + match[1].length; } + /***/ }), -/***/ 7387: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 80660: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { "use strict"; +//parse Empty Node as self closing node +const buildFromOrderedJs = __nccwpck_require__(72462); + +const defaultOptions = { + attributeNamePrefix: '@_', + attributesGroupName: false, + textNodeName: '#text', + ignoreAttributes: true, + cdataPropName: false, + format: false, + indentBy: ' ', + suppressEmptyNode: false, + suppressUnpairedNode: true, + suppressBooleanAttributes: true, + tagValueProcessor: function(key, a) { + return a; + }, + attributeValueProcessor: function(attrName, a) { + return a; + }, + preserveOrder: false, + commentPropName: false, + unpairedTags: [], + entities: [ + { regex: new RegExp("&", "g"), val: "&" },//it must be on top + { regex: new RegExp(">", "g"), val: ">" }, + { regex: new RegExp("<", "g"), val: "<" }, + { regex: new RegExp("\'", "g"), val: "'" }, + { regex: new RegExp("\"", "g"), val: """ } + ], + processEntities: true, + stopNodes: [], + // transformTagName: false, + // transformAttributeName: false, + oneListGroup: false +}; -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; +function Builder(options) { + this.options = Object.assign({}, defaultOptions, options); + if (this.options.ignoreAttributes || this.options.attributesGroupName) { + this.isAttribute = function(/*a*/) { + return false; + }; + } else { + this.attrPrefixLen = this.options.attributeNamePrefix.length; + this.isAttribute = isAttribute; + } -var _crypto = _interopRequireDefault(__nccwpck_require__(6113)); + this.processTextOrObjNode = processTextOrObjNode -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + if (this.options.format) { + this.indentate = indentate; + this.tagEndChar = '>\n'; + this.newLine = '\n'; + } else { + this.indentate = function() { + return ''; + }; + this.tagEndChar = '>'; + this.newLine = ''; + } +} -function sha1(bytes) { - if (Array.isArray(bytes)) { - bytes = Buffer.from(bytes); - } else if (typeof bytes === 'string') { - bytes = Buffer.from(bytes, 'utf8'); +Builder.prototype.build = function(jObj) { + if(this.options.preserveOrder){ + return buildFromOrderedJs(jObj, this.options); + }else { + if(Array.isArray(jObj) && this.options.arrayNodeName && this.options.arrayNodeName.length > 1){ + jObj = { + [this.options.arrayNodeName] : jObj + } + } + return this.j2x(jObj, 0).val; } +}; - return _crypto.default.createHash('sha1').update(bytes).digest(); +Builder.prototype.j2x = function(jObj, level) { + let attrStr = ''; + let val = ''; + for (let key in jObj) { + if (typeof jObj[key] === 'undefined') { + // supress undefined node + } else if (jObj[key] === null) { + if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; + else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + } else if (jObj[key] instanceof Date) { + val += this.buildTextValNode(jObj[key], key, '', level); + } else if (typeof jObj[key] !== 'object') { + //premitive type + const attr = this.isAttribute(key); + if (attr) { + attrStr += this.buildAttrPairStr(attr, '' + jObj[key]); + }else { + //tag value + if (key === this.options.textNodeName) { + let newval = this.options.tagValueProcessor(key, '' + jObj[key]); + val += this.replaceEntitiesValue(newval); + } else { + val += this.buildTextValNode(jObj[key], key, '', level); + } + } + } else if (Array.isArray(jObj[key])) { + //repeated nodes + const arrLen = jObj[key].length; + let listTagVal = ""; + for (let j = 0; j < arrLen; j++) { + const item = jObj[key][j]; + if (typeof item === 'undefined') { + // supress undefined node + } else if (item === null) { + if(key[0] === "?") val += this.indentate(level) + '<' + key + '?' + this.tagEndChar; + else val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + // val += this.indentate(level) + '<' + key + '/' + this.tagEndChar; + } else if (typeof item === 'object') { + if(this.options.oneListGroup ){ + listTagVal += this.j2x(item, level + 1).val; + }else{ + listTagVal += this.processTextOrObjNode(item, key, level) + } + } else { + listTagVal += this.buildTextValNode(item, key, '', level); + } + } + if(this.options.oneListGroup){ + listTagVal = this.buildObjectNode(listTagVal, key, '', level); + } + val += listTagVal; + } else { + //nested node + if (this.options.attributesGroupName && key === this.options.attributesGroupName) { + const Ks = Object.keys(jObj[key]); + const L = Ks.length; + for (let j = 0; j < L; j++) { + attrStr += this.buildAttrPairStr(Ks[j], '' + jObj[key][Ks[j]]); + } + } else { + val += this.processTextOrObjNode(jObj[key], key, level) + } + } + } + return {attrStr: attrStr, val: val}; +}; + +Builder.prototype.buildAttrPairStr = function(attrName, val){ + val = this.options.attributeValueProcessor(attrName, '' + val); + val = this.replaceEntitiesValue(val); + if (this.options.suppressBooleanAttributes && val === "true") { + return ' ' + attrName; + } else return ' ' + attrName + '="' + val + '"'; } -var _default = sha1; -exports["default"] = _default; +function processTextOrObjNode (object, key, level) { + const result = this.j2x(object, level + 1); + if (object[this.options.textNodeName] !== undefined && Object.keys(object).length === 1) { + return this.buildTextValNode(object[this.options.textNodeName], key, result.attrStr, level); + } else { + return this.buildObjectNode(result.val, key, result.attrStr, level); + } +} -/***/ }), +Builder.prototype.buildObjectNode = function(val, key, attrStr, level) { + if(val === ""){ + if(key[0] === "?") return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; + else { + return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar; + } + }else{ -/***/ 67668: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + let tagEndExp = '' + val + tagEndExp ); + } else if (this.options.commentPropName !== false && key === this.options.commentPropName && piClosingChar.length === 0) { + return this.indentate(level) + `` + this.newLine; + }else { + return ( + this.indentate(level) + '<' + key + attrStr + piClosingChar + this.tagEndChar + + val + + this.indentate(level) + tagEndExp ); + } + } +} -"use strict"; +Builder.prototype.closeTag = function(key){ + let closeTag = ""; + if(this.options.unpairedTags.indexOf(key) !== -1){ //unpaired + if(!this.options.suppressUnpairedNode) closeTag = "/" + }else if(this.options.suppressEmptyNode){ //empty + closeTag = "/"; + }else{ + closeTag = `>` + this.newLine; + }else if (this.options.commentPropName !== false && key === this.options.commentPropName) { + return this.indentate(level) + `` + this.newLine; + }else if(key[0] === "?") {//PI tag + return this.indentate(level) + '<' + key + attrStr+ '?' + this.tagEndChar; + }else{ + let textValue = this.options.tagValueProcessor(key, val); + textValue = this.replaceEntitiesValue(textValue); + + if( textValue === ''){ + return this.indentate(level) + '<' + key + attrStr + this.closeTag(key) + this.tagEndChar; + }else{ + return this.indentate(level) + '<' + key + attrStr + '>' + + textValue + + ' 0 && this.options.processEntities){ + for (let i=0; i { -function v1(options, buf, offset) { - var i = buf && offset || 0; - var b = buf || []; - options = options || {}; - var node = options.node || _nodeId; - var clockseq = options.clockseq !== undefined ? options.clockseq : _clockseq; // node and clockseq need to be initialized to random values if they're not - // specified. We do this lazily to minimize issues related to insufficient - // system entropy. See #189 +const EOL = "\n"; - if (node == null || clockseq == null) { - var seedBytes = options.random || (options.rng || _rng.default)(); +/** + * + * @param {array} jArray + * @param {any} options + * @returns + */ +function toXml(jArray, options) { + let indentation = ""; + if (options.format && options.indentBy.length > 0) { + indentation = EOL; + } + return arrToStr(jArray, options, "", indentation); +} - if (node == null) { - // Per 4.5, create and 48-bit node id, (47 random bits + multicast bit = 1) - node = _nodeId = [seedBytes[0] | 0x01, seedBytes[1], seedBytes[2], seedBytes[3], seedBytes[4], seedBytes[5]]; +function arrToStr(arr, options, jPath, indentation) { + let xmlStr = ""; + let isPreviousElementTag = false; + + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const tagName = propName(tagObj); + let newJPath = ""; + if (jPath.length === 0) newJPath = tagName + else newJPath = `${jPath}.${tagName}`; + + if (tagName === options.textNodeName) { + let tagText = tagObj[tagName]; + if (!isStopNode(newJPath, options)) { + tagText = options.tagValueProcessor(tagName, tagText); + tagText = replaceEntitiesValue(tagText, options); + } + if (isPreviousElementTag) { + xmlStr += indentation; + } + xmlStr += tagText; + isPreviousElementTag = false; + continue; + } else if (tagName === options.cdataPropName) { + if (isPreviousElementTag) { + xmlStr += indentation; + } + xmlStr += ``; + isPreviousElementTag = false; + continue; + } else if (tagName === options.commentPropName) { + xmlStr += indentation + ``; + isPreviousElementTag = true; + continue; + } else if (tagName[0] === "?") { + const attStr = attr_to_str(tagObj[":@"], options); + const tempInd = tagName === "?xml" ? "" : indentation; + let piTextNodeName = tagObj[tagName][0][options.textNodeName]; + piTextNodeName = piTextNodeName.length !== 0 ? " " + piTextNodeName : ""; //remove extra spacing + xmlStr += tempInd + `<${tagName}${piTextNodeName}${attStr}?>`; + isPreviousElementTag = true; + continue; + } + let newIdentation = indentation; + if (newIdentation !== "") { + newIdentation += options.indentBy; + } + const attStr = attr_to_str(tagObj[":@"], options); + const tagStart = indentation + `<${tagName}${attStr}`; + const tagValue = arrToStr(tagObj[tagName], options, newJPath, newIdentation); + if (options.unpairedTags.indexOf(tagName) !== -1) { + if (options.suppressUnpairedNode) xmlStr += tagStart + ">"; + else xmlStr += tagStart + "/>"; + } else if ((!tagValue || tagValue.length === 0) && options.suppressEmptyNode) { + xmlStr += tagStart + "/>"; + } else if (tagValue && tagValue.endsWith(">")) { + xmlStr += tagStart + `>${tagValue}${indentation}`; + } else { + xmlStr += tagStart + ">"; + if (tagValue && indentation !== "" && (tagValue.includes("/>") || tagValue.includes("`; + } + isPreviousElementTag = true; } - if (clockseq == null) { - // Per 4.2.2, randomize (14 bit) clockseq - clockseq = _clockseq = (seedBytes[6] << 8 | seedBytes[7]) & 0x3fff; + return xmlStr; +} + +function propName(obj) { + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if (key !== ":@") return key; } - } // UUID timestamps are 100 nano-second units since the Gregorian epoch, - // (1582-10-15 00:00). JSNumbers aren't precise enough for this, so - // time is handled internally as 'msecs' (integer milliseconds) and 'nsecs' - // (100-nanoseconds offset from msecs) since unix epoch, 1970-01-01 00:00. +} +function attr_to_str(attrMap, options) { + let attrStr = ""; + if (attrMap && !options.ignoreAttributes) { + for (let attr in attrMap) { + let attrVal = options.attributeValueProcessor(attr, attrMap[attr]); + attrVal = replaceEntitiesValue(attrVal, options); + if (attrVal === true && options.suppressBooleanAttributes) { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}`; + } else { + attrStr += ` ${attr.substr(options.attributeNamePrefix.length)}="${attrVal}"`; + } + } + } + return attrStr; +} - var msecs = options.msecs !== undefined ? options.msecs : new Date().getTime(); // Per 4.2.1.2, use count of uuid's generated during the current clock - // cycle to simulate higher resolution clock +function isStopNode(jPath, options) { + jPath = jPath.substr(0, jPath.length - options.textNodeName.length - 1); + let tagName = jPath.substr(jPath.lastIndexOf(".") + 1); + for (let index in options.stopNodes) { + if (options.stopNodes[index] === jPath || options.stopNodes[index] === "*." + tagName) return true; + } + return false; +} - var nsecs = options.nsecs !== undefined ? options.nsecs : _lastNSecs + 1; // Time since last uuid creation (in msecs) +function replaceEntitiesValue(textValue, options) { + if (textValue && textValue.length > 0 && options.processEntities) { + for (let i = 0; i < options.entities.length; i++) { + const entity = options.entities[i]; + textValue = textValue.replace(entity.regex, entity.val); + } + } + return textValue; +} +module.exports = toXml; - var dt = msecs - _lastMSecs + (nsecs - _lastNSecs) / 10000; // Per 4.2.1.2, Bump clockseq on clock regression - if (dt < 0 && options.clockseq === undefined) { - clockseq = clockseq + 1 & 0x3fff; - } // Reset nsecs if clock regresses (new clockseq) or we've moved onto a new - // time interval +/***/ }), +/***/ 6072: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - if ((dt < 0 || msecs > _lastMSecs) && options.nsecs === undefined) { - nsecs = 0; - } // Per 4.2.1.2 Throw error if too many uuids are requested +const util = __nccwpck_require__(38280); +//TODO: handle comments +function readDocType(xmlData, i){ + + const entities = {}; + if( xmlData[i + 3] === 'O' && + xmlData[i + 4] === 'C' && + xmlData[i + 5] === 'T' && + xmlData[i + 6] === 'Y' && + xmlData[i + 7] === 'P' && + xmlData[i + 8] === 'E') + { + i = i+9; + let angleBracketsCount = 1; + let hasBody = false, comment = false; + let exp = ""; + for(;i') { //Read tag content + if(comment){ + if( xmlData[i - 1] === "-" && xmlData[i - 2] === "-"){ + comment = false; + angleBracketsCount--; + } + }else{ + angleBracketsCount--; + } + if (angleBracketsCount === 0) { + break; + } + }else if( xmlData[i] === '['){ + hasBody = true; + }else{ + exp += xmlData[i]; + } + } + if(angleBracketsCount !== 0){ + throw new Error(`Unclosed DOCTYPE`); + } + }else{ + throw new Error(`Invalid Tag instead of DOCTYPE`); + } + return {entities, i}; +} - if (nsecs >= 10000) { - throw new Error("uuid.v1(): Can't create more than 10M uuids/sec"); - } +function readEntityExp(xmlData,i){ + //External entities are not supported + // - _lastMSecs = msecs; - _lastNSecs = nsecs; - _clockseq = clockseq; // Per 4.1.4 - Convert from unix epoch to Gregorian epoch + //Parameter entities are not supported + // - msecs += 12219292800000; // `time_low` + //Internal entities are supported + // + + //read EntityName + let entityName = ""; + for (; i < xmlData.length && (xmlData[i] !== "'" && xmlData[i] !== '"' ); i++) { + // if(xmlData[i] === " ") continue; + // else + entityName += xmlData[i]; + } + entityName = entityName.trim(); + if(entityName.indexOf(" ") !== -1) throw new Error("External entites are not supported"); + + //read Entity Value + const startChar = xmlData[i++]; + let val = "" + for (; i < xmlData.length && xmlData[i] !== startChar ; i++) { + val += xmlData[i]; + } + return [entityName, val, i]; +} - var tl = ((msecs & 0xfffffff) * 10000 + nsecs) % 0x100000000; - b[i++] = tl >>> 24 & 0xff; - b[i++] = tl >>> 16 & 0xff; - b[i++] = tl >>> 8 & 0xff; - b[i++] = tl & 0xff; // `time_mid` +function isComment(xmlData, i){ + if(xmlData[i+1] === '!' && + xmlData[i+2] === '-' && + xmlData[i+3] === '-') return true + return false +} +function isEntity(xmlData, i){ + if(xmlData[i+1] === '!' && + xmlData[i+2] === 'E' && + xmlData[i+3] === 'N' && + xmlData[i+4] === 'T' && + xmlData[i+5] === 'I' && + xmlData[i+6] === 'T' && + xmlData[i+7] === 'Y') return true + return false +} +function isElement(xmlData, i){ + if(xmlData[i+1] === '!' && + xmlData[i+2] === 'E' && + xmlData[i+3] === 'L' && + xmlData[i+4] === 'E' && + xmlData[i+5] === 'M' && + xmlData[i+6] === 'E' && + xmlData[i+7] === 'N' && + xmlData[i+8] === 'T') return true + return false +} - var tmh = msecs / 0x100000000 * 10000 & 0xfffffff; - b[i++] = tmh >>> 8 & 0xff; - b[i++] = tmh & 0xff; // `time_high_and_version` +function isAttlist(xmlData, i){ + if(xmlData[i+1] === '!' && + xmlData[i+2] === 'A' && + xmlData[i+3] === 'T' && + xmlData[i+4] === 'T' && + xmlData[i+5] === 'L' && + xmlData[i+6] === 'I' && + xmlData[i+7] === 'S' && + xmlData[i+8] === 'T') return true + return false +} +function isNotation(xmlData, i){ + if(xmlData[i+1] === '!' && + xmlData[i+2] === 'N' && + xmlData[i+3] === 'O' && + xmlData[i+4] === 'T' && + xmlData[i+5] === 'A' && + xmlData[i+6] === 'T' && + xmlData[i+7] === 'I' && + xmlData[i+8] === 'O' && + xmlData[i+9] === 'N') return true + return false +} - b[i++] = tmh >>> 24 & 0xf | 0x10; // include version +function validateEntityName(name){ + if (util.isName(name)) + return name; + else + throw new Error(`Invalid entity name ${name}`); +} - b[i++] = tmh >>> 16 & 0xff; // `clock_seq_hi_and_reserved` (Per 4.2.2 - include variant) +module.exports = readDocType; - b[i++] = clockseq >>> 8 | 0x80; // `clock_seq_low` - b[i++] = clockseq & 0xff; // `node` +/***/ }), - for (var n = 0; n < 6; ++n) { - b[i + n] = node[n]; - } +/***/ 86993: +/***/ ((__unused_webpack_module, exports) => { - return buf ? buf : (0, _bytesToUuid.default)(b); -} -var _default = v1; -exports["default"] = _default; +const defaultOptions = { + preserveOrder: false, + attributeNamePrefix: '@_', + attributesGroupName: false, + textNodeName: '#text', + ignoreAttributes: true, + removeNSPrefix: false, // remove NS from tag name or attribute name if true + allowBooleanAttributes: false, //a tag can have attributes without any value + //ignoreRootElement : false, + parseTagValue: true, + parseAttributeValue: false, + trimValues: true, //Trim string values of tag and attributes + cdataPropName: false, + numberParseOptions: { + hex: true, + leadingZeros: true, + eNotation: true + }, + tagValueProcessor: function(tagName, val) { + return val; + }, + attributeValueProcessor: function(attrName, val) { + return val; + }, + stopNodes: [], //nested tags will not be parsed even for errors + alwaysCreateTextNode: false, + isArray: () => false, + commentPropName: false, + unpairedTags: [], + processEntities: true, + htmlEntities: false, + ignoreDeclaration: false, + ignorePiTags: false, + transformTagName: false, + transformAttributeName: false, + updateTag: function(tagName, jPath, attrs){ + return tagName + }, + // skipEmptyListItem: false +}; + +const buildOptions = function(options) { + return Object.assign({}, defaultOptions, options); +}; + +exports.buildOptions = buildOptions; +exports.defaultOptions = defaultOptions; /***/ }), -/***/ 98573: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 25832: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { "use strict"; +///@ts-check -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; +const util = __nccwpck_require__(38280); +const xmlNode = __nccwpck_require__(7462); +const readDocType = __nccwpck_require__(6072); +const toNumber = __nccwpck_require__(14526); -var _v = _interopRequireDefault(__nccwpck_require__(36097)); +const regx = + '<((!\\[CDATA\\[([\\s\\S]*?)(]]>))|((NAME:)?(NAME))([^>]*)>|((\\/)(NAME)\\s*>))([^<]*)' + .replace(/NAME/g, util.nameRegexp); -var _md = _interopRequireDefault(__nccwpck_require__(93525)); +//const tagsRegx = new RegExp("<(\\/?[\\w:\\-\._]+)([^>]*)>(\\s*"+cdataRegx+")*([^<]+)?","g"); +//const tagsRegx = new RegExp("<(\\/?)((\\w*:)?([\\w:\\-\._]+))([^>]*)>([^<]*)("+cdataRegx+"([^<]*))*([^<]+)?","g"); -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } +class OrderedObjParser{ + constructor(options){ + this.options = options; + this.currentNode = null; + this.tagsNodeStack = []; + this.docTypeEntities = {}; + this.lastEntities = { + "apos" : { regex: /&(apos|#39|#x27);/g, val : "'"}, + "gt" : { regex: /&(gt|#62|#x3E);/g, val : ">"}, + "lt" : { regex: /&(lt|#60|#x3C);/g, val : "<"}, + "quot" : { regex: /&(quot|#34|#x22);/g, val : "\""}, + }; + this.ampEntity = { regex: /&(amp|#38|#x26);/g, val : "&"}; + this.htmlEntities = { + "space": { regex: /&(nbsp|#160);/g, val: " " }, + // "lt" : { regex: /&(lt|#60);/g, val: "<" }, + // "gt" : { regex: /&(gt|#62);/g, val: ">" }, + // "amp" : { regex: /&(amp|#38);/g, val: "&" }, + // "quot" : { regex: /&(quot|#34);/g, val: "\"" }, + // "apos" : { regex: /&(apos|#39);/g, val: "'" }, + "cent" : { regex: /&(cent|#162);/g, val: "¢" }, + "pound" : { regex: /&(pound|#163);/g, val: "£" }, + "yen" : { regex: /&(yen|#165);/g, val: "¥" }, + "euro" : { regex: /&(euro|#8364);/g, val: "€" }, + "copyright" : { regex: /&(copy|#169);/g, val: "©" }, + "reg" : { regex: /&(reg|#174);/g, val: "®" }, + "inr" : { regex: /&(inr|#8377);/g, val: "₹" }, + }; + this.addExternalEntities = addExternalEntities; + this.parseXml = parseXml; + this.parseTextData = parseTextData; + this.resolveNameSpace = resolveNameSpace; + this.buildAttributesMap = buildAttributesMap; + this.isItStopNode = isItStopNode; + this.replaceEntitiesValue = replaceEntitiesValue; + this.readStopNodeData = readStopNodeData; + this.saveTextToParentTag = saveTextToParentTag; + this.addChild = addChild; + } -const v3 = (0, _v.default)('v3', 0x30, _md.default); -var _default = v3; -exports["default"] = _default; +} -/***/ }), +function addExternalEntities(externalEntities){ + const entKeys = Object.keys(externalEntities); + for (let i = 0; i < entKeys.length; i++) { + const ent = entKeys[i]; + this.lastEntities[ent] = { + regex: new RegExp("&"+ent+";","g"), + val : externalEntities[ent] + } + } +} -/***/ 36097: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/** + * @param {string} val + * @param {string} tagName + * @param {string} jPath + * @param {boolean} dontTrim + * @param {boolean} hasAttributes + * @param {boolean} isLeafNode + * @param {boolean} escapeEntities + */ +function parseTextData(val, tagName, jPath, dontTrim, hasAttributes, isLeafNode, escapeEntities) { + if (val !== undefined) { + if (this.options.trimValues && !dontTrim) { + val = val.trim(); + } + if(val.length > 0){ + if(!escapeEntities) val = this.replaceEntitiesValue(val); + + const newval = this.options.tagValueProcessor(tagName, val, jPath, hasAttributes, isLeafNode); + if(newval === null || newval === undefined){ + //don't parse + return val; + }else if(typeof newval !== typeof val || newval !== val){ + //overwrite + return newval; + }else if(this.options.trimValues){ + return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions); + }else{ + const trimmedVal = val.trim(); + if(trimmedVal === val){ + return parseValue(val, this.options.parseTagValue, this.options.numberParseOptions); + }else{ + return val; + } + } + } + } +} -"use strict"; +function resolveNameSpace(tagname) { + if (this.options.removeNSPrefix) { + const tags = tagname.split(':'); + const prefix = tagname.charAt(0) === '/' ? '/' : ''; + if (tags[0] === 'xmlns') { + return ''; + } + if (tags.length === 2) { + tagname = prefix + tags[1]; + } + } + return tagname; +} +//TODO: change regex to capture NS +//const attrsRegx = new RegExp("([\\w\\-\\.\\:]+)\\s*=\\s*(['\"])((.|\n)*?)\\2","gm"); +const attrsRegx = new RegExp('([^\\s=]+)\\s*(=\\s*([\'"])([\\s\\S]*?)\\3)?', 'gm'); + +function buildAttributesMap(attrStr, jPath, tagName) { + if (!this.options.ignoreAttributes && typeof attrStr === 'string') { + // attrStr = attrStr.replace(/\r?\n/g, ' '); + //attrStr = attrStr || attrStr.trim(); + + const matches = util.getAllMatches(attrStr, attrsRegx); + const len = matches.length; //don't make it inline + const attrs = {}; + for (let i = 0; i < len; i++) { + const attrName = this.resolveNameSpace(matches[i][1]); + let oldVal = matches[i][4]; + let aName = this.options.attributeNamePrefix + attrName; + if (attrName.length) { + if (this.options.transformAttributeName) { + aName = this.options.transformAttributeName(aName); + } + if(aName === "__proto__") aName = "#__proto__"; + if (oldVal !== undefined) { + if (this.options.trimValues) { + oldVal = oldVal.trim(); + } + oldVal = this.replaceEntitiesValue(oldVal); + const newVal = this.options.attributeValueProcessor(attrName, oldVal, jPath); + if(newVal === null || newVal === undefined){ + //don't parse + attrs[aName] = oldVal; + }else if(typeof newVal !== typeof oldVal || newVal !== oldVal){ + //overwrite + attrs[aName] = newVal; + }else{ + //parse + attrs[aName] = parseValue( + oldVal, + this.options.parseAttributeValue, + this.options.numberParseOptions + ); + } + } else if (this.options.allowBooleanAttributes) { + attrs[aName] = true; + } + } + } + if (!Object.keys(attrs).length) { + return; + } + if (this.options.attributesGroupName) { + const attrCollection = {}; + attrCollection[this.options.attributesGroupName] = attrs; + return attrCollection; + } + return attrs + } +} -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = _default; -exports.URL = exports.DNS = void 0; +const parseXml = function(xmlData) { + xmlData = xmlData.replace(/\r\n?/g, "\n"); //TODO: remove this line + const xmlObj = new xmlNode('!xml'); + let currentNode = xmlObj; + let textData = ""; + let jPath = ""; + for(let i=0; i< xmlData.length; i++){//for each char in XML data + const ch = xmlData[i]; + if(ch === '<'){ + // const nextIndex = i+1; + // const _2ndChar = xmlData[nextIndex]; + if( xmlData[i+1] === '/') {//Closing Tag + const closeIndex = findClosingIndex(xmlData, ">", i, "Closing Tag is not closed.") + let tagName = xmlData.substring(i+2,closeIndex).trim(); + + if(this.options.removeNSPrefix){ + const colonIndex = tagName.indexOf(":"); + if(colonIndex !== -1){ + tagName = tagName.substr(colonIndex+1); + } + } -var _bytesToUuid = _interopRequireDefault(__nccwpck_require__(35827)); + if(this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } + if(currentNode){ + textData = this.saveTextToParentTag(textData, currentNode, jPath); + } -function uuidToBytes(uuid) { - // Note: We assume we're being passed a valid uuid string - var bytes = []; - uuid.replace(/[a-fA-F0-9]{2}/g, function (hex) { - bytes.push(parseInt(hex, 16)); - }); - return bytes; -} + //check if last tag of nested tag was unpaired tag + const lastTagName = jPath.substring(jPath.lastIndexOf(".")+1); + if(tagName && this.options.unpairedTags.indexOf(tagName) !== -1 ){ + throw new Error(`Unpaired tag can not be used as closing tag: `); + } + let propIndex = 0 + if(lastTagName && this.options.unpairedTags.indexOf(lastTagName) !== -1 ){ + propIndex = jPath.lastIndexOf('.', jPath.lastIndexOf('.')-1) + this.tagsNodeStack.pop(); + }else{ + propIndex = jPath.lastIndexOf("."); + } + jPath = jPath.substring(0, propIndex); + + currentNode = this.tagsNodeStack.pop();//avoid recursion, set the parent tag scope + textData = ""; + i = closeIndex; + } else if( xmlData[i+1] === '?') { + + let tagData = readTagExp(xmlData,i, false, "?>"); + if(!tagData) throw new Error("Pi Tag is not closed."); + + textData = this.saveTextToParentTag(textData, currentNode, jPath); + if( (this.options.ignoreDeclaration && tagData.tagName === "?xml") || this.options.ignorePiTags){ + + }else{ + + const childNode = new xmlNode(tagData.tagName); + childNode.add(this.options.textNodeName, ""); + + if(tagData.tagName !== tagData.tagExp && tagData.attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagData.tagExp, jPath, tagData.tagName); + } + this.addChild(currentNode, childNode, jPath) -function stringToBytes(str) { - str = unescape(encodeURIComponent(str)); // UTF8 escape + } - var bytes = new Array(str.length); - for (var i = 0; i < str.length; i++) { - bytes[i] = str.charCodeAt(i); - } + i = tagData.closeIndex + 1; + } else if(xmlData.substr(i + 1, 3) === '!--') { + const endIndex = findClosingIndex(xmlData, "-->", i+4, "Comment is not closed.") + if(this.options.commentPropName){ + const comment = xmlData.substring(i + 4, endIndex - 2); - return bytes; -} + textData = this.saveTextToParentTag(textData, currentNode, jPath); -const DNS = '6ba7b810-9dad-11d1-80b4-00c04fd430c8'; -exports.DNS = DNS; -const URL = '6ba7b811-9dad-11d1-80b4-00c04fd430c8'; -exports.URL = URL; + currentNode.add(this.options.commentPropName, [ { [this.options.textNodeName] : comment } ]); + } + i = endIndex; + } else if( xmlData.substr(i + 1, 2) === '!D') { + const result = readDocType(xmlData, i); + this.docTypeEntities = result.entities; + i = result.i; + }else if(xmlData.substr(i + 1, 2) === '![') { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "CDATA is not closed.") - 2; + const tagExp = xmlData.substring(i + 9,closeIndex); + + textData = this.saveTextToParentTag(textData, currentNode, jPath); + + //cdata should be set even if it is 0 length string + if(this.options.cdataPropName){ + // let val = this.parseTextData(tagExp, this.options.cdataPropName, jPath + "." + this.options.cdataPropName, true, false, true); + // if(!val) val = ""; + currentNode.add(this.options.cdataPropName, [ { [this.options.textNodeName] : tagExp } ]); + }else{ + let val = this.parseTextData(tagExp, currentNode.tagname, jPath, true, false, true); + if(val == undefined) val = ""; + currentNode.add(this.options.textNodeName, val); + } + + i = closeIndex + 2; + }else {//Opening tag + let result = readTagExp(xmlData,i, this.options.removeNSPrefix); + let tagName= result.tagName; + let tagExp = result.tagExp; + let attrExpPresent = result.attrExpPresent; + let closeIndex = result.closeIndex; + + if (this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } + + //save text as child node + if (currentNode && textData) { + if(currentNode.tagname !== '!xml'){ + //when nested tag is found + textData = this.saveTextToParentTag(textData, currentNode, jPath, false); + } + } -function _default(name, version, hashfunc) { - var generateUUID = function (value, namespace, buf, offset) { - var off = buf && offset || 0; - if (typeof value == 'string') value = stringToBytes(value); - if (typeof namespace == 'string') namespace = uuidToBytes(namespace); - if (!Array.isArray(value)) throw TypeError('value must be an array of bytes'); - if (!Array.isArray(namespace) || namespace.length !== 16) throw TypeError('namespace must be uuid string or an Array of 16 byte values'); // Per 4.3 + //check if last tag was unpaired tag + const lastTag = currentNode; + if(lastTag && this.options.unpairedTags.indexOf(lastTag.tagname) !== -1 ){ + currentNode = this.tagsNodeStack.pop(); + jPath = jPath.substring(0, jPath.lastIndexOf(".")); + } + if(tagName !== xmlObj.tagname){ + jPath += jPath ? "." + tagName : tagName; + } + if (this.isItStopNode(this.options.stopNodes, jPath, tagName)) { //TODO: namespace + let tagContent = ""; + //self-closing tag + if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){ + i = result.closeIndex; + } + //unpaired tag + else if(this.options.unpairedTags.indexOf(tagName) !== -1){ + i = result.closeIndex; + } + //normal tag + else{ + //read until closing tag is found + const result = this.readStopNodeData(xmlData, tagName, closeIndex + 1); + if(!result) throw new Error(`Unexpected end of ${tagName}`); + i = result.i; + tagContent = result.tagContent; + } - var bytes = hashfunc(namespace.concat(value)); - bytes[6] = bytes[6] & 0x0f | version; - bytes[8] = bytes[8] & 0x3f | 0x80; + const childNode = new xmlNode(tagName); + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + if(tagContent) { + tagContent = this.parseTextData(tagContent, tagName, jPath, true, attrExpPresent, true, true); + } + + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + childNode.add(this.options.textNodeName, tagContent); + + this.addChild(currentNode, childNode, jPath) + }else{ + //selfClosing tag + if(tagExp.length > 0 && tagExp.lastIndexOf("/") === tagExp.length - 1){ + if(tagName[tagName.length - 1] === "/"){ //remove trailing '/' + tagName = tagName.substr(0, tagName.length - 1); + tagExp = tagName; + }else{ + tagExp = tagExp.substr(0, tagExp.length - 1); + } + + if(this.options.transformTagName) { + tagName = this.options.transformTagName(tagName); + } - if (buf) { - for (var idx = 0; idx < 16; ++idx) { - buf[off + idx] = bytes[idx]; + const childNode = new xmlNode(tagName); + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath) + jPath = jPath.substr(0, jPath.lastIndexOf(".")); + } + //opening tag + else{ + const childNode = new xmlNode( tagName); + this.tagsNodeStack.push(currentNode); + + if(tagName !== tagExp && attrExpPresent){ + childNode[":@"] = this.buildAttributesMap(tagExp, jPath, tagName); + } + this.addChild(currentNode, childNode, jPath) + currentNode = childNode; + } + textData = ""; + i = closeIndex; + } } + }else{ + textData += xmlData[i]; } + } + return xmlObj.child; +} - return buf || (0, _bytesToUuid.default)(bytes); - }; // Function#name is not settable on some platforms (#270) - - - try { - generateUUID.name = name; - } catch (err) {} // For CommonJS default export support +function addChild(currentNode, childNode, jPath){ + const result = this.options.updateTag(childNode.tagname, jPath, childNode[":@"]) + if(result === false){ + }else if(typeof result === "string"){ + childNode.tagname = result + currentNode.addChild(childNode); + }else{ + currentNode.addChild(childNode); + } +} +const replaceEntitiesValue = function(val){ - generateUUID.DNS = DNS; - generateUUID.URL = URL; - return generateUUID; + if(this.options.processEntities){ + for(let entityName in this.docTypeEntities){ + const entity = this.docTypeEntities[entityName]; + val = val.replace( entity.regx, entity.val); + } + for(let entityName in this.lastEntities){ + const entity = this.lastEntities[entityName]; + val = val.replace( entity.regex, entity.val); + } + if(this.options.htmlEntities){ + for(let entityName in this.htmlEntities){ + const entity = this.htmlEntities[entityName]; + val = val.replace( entity.regex, entity.val); + } + } + val = val.replace( this.ampEntity.regex, this.ampEntity.val); + } + return val; +} +function saveTextToParentTag(textData, currentNode, jPath, isLeafNode) { + if (textData) { //store previously collected data as textNode + if(isLeafNode === undefined) isLeafNode = Object.keys(currentNode.child).length === 0 + + textData = this.parseTextData(textData, + currentNode.tagname, + jPath, + false, + currentNode[":@"] ? Object.keys(currentNode[":@"]).length !== 0 : false, + isLeafNode); + + if (textData !== undefined && textData !== "") + currentNode.add(this.options.textNodeName, textData); + textData = ""; + } + return textData; } -/***/ }), +//TODO: use jPath to simplify the logic +/** + * + * @param {string[]} stopNodes + * @param {string} jPath + * @param {string} currentTagName + */ +function isItStopNode(stopNodes, jPath, currentTagName){ + const allNodesExp = "*." + currentTagName; + for (const stopNodePath in stopNodes) { + const stopNodeExp = stopNodes[stopNodePath]; + if( allNodesExp === stopNodeExp || jPath === stopNodeExp ) return true; + } + return false; +} -/***/ 7811: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/** + * Returns the tag Expression and where it is ending handling single-double quotes situation + * @param {string} xmlData + * @param {number} i starting index + * @returns + */ +function tagExpWithClosingIndex(xmlData, i, closingChar = ">"){ + let attrBoundary; + let tagExp = ""; + for (let index = i; index < xmlData.length; index++) { + let ch = xmlData[index]; + if (attrBoundary) { + if (ch === attrBoundary) attrBoundary = "";//reset + } else if (ch === '"' || ch === "'") { + attrBoundary = ch; + } else if (ch === closingChar[0]) { + if(closingChar[1]){ + if(xmlData[index + 1] === closingChar[1]){ + return { + data: tagExp, + index: index + } + } + }else{ + return { + data: tagExp, + index: index + } + } + } else if (ch === '\t') { + ch = " " + } + tagExp += ch; + } +} -"use strict"; +function findClosingIndex(xmlData, str, i, errMsg){ + const closingIndex = xmlData.indexOf(str, i); + if(closingIndex === -1){ + throw new Error(errMsg) + }else{ + return closingIndex + str.length - 1; + } +} +function readTagExp(xmlData,i, removeNSPrefix, closingChar = ">"){ + const result = tagExpWithClosingIndex(xmlData, i+1, closingChar); + if(!result) return; + let tagExp = result.data; + const closeIndex = result.index; + const separatorIndex = tagExp.search(/\s/); + let tagName = tagExp; + let attrExpPresent = true; + if(separatorIndex !== -1){//separate tag name and attributes expression + tagName = tagExp.substr(0, separatorIndex).replace(/\s\s*$/, ''); + tagExp = tagExp.substr(separatorIndex + 1); + } -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; + if(removeNSPrefix){ + const colonIndex = tagName.indexOf(":"); + if(colonIndex !== -1){ + tagName = tagName.substr(colonIndex+1); + attrExpPresent = tagName !== result.data.substr(colonIndex + 1); + } + } -var _rng = _interopRequireDefault(__nccwpck_require__(49788)); + return { + tagName: tagName, + tagExp: tagExp, + closeIndex: closeIndex, + attrExpPresent: attrExpPresent, + } +} +/** + * find paired tag for a stop node + * @param {string} xmlData + * @param {string} tagName + * @param {number} i + */ +function readStopNodeData(xmlData, tagName, i){ + const startIndex = i; + // Starting at 1 since we already have an open tag + let openTagCount = 1; + + for (; i < xmlData.length; i++) { + if( xmlData[i] === "<"){ + if (xmlData[i+1] === "/") {//close tag + const closeIndex = findClosingIndex(xmlData, ">", i, `${tagName} is not closed`); + let closeTagName = xmlData.substring(i+2,closeIndex).trim(); + if(closeTagName === tagName){ + openTagCount--; + if (openTagCount === 0) { + return { + tagContent: xmlData.substring(startIndex, i), + i : closeIndex + } + } + } + i=closeIndex; + } else if(xmlData[i+1] === '?') { + const closeIndex = findClosingIndex(xmlData, "?>", i+1, "StopNode is not closed.") + i=closeIndex; + } else if(xmlData.substr(i + 1, 3) === '!--') { + const closeIndex = findClosingIndex(xmlData, "-->", i+3, "StopNode is not closed.") + i=closeIndex; + } else if(xmlData.substr(i + 1, 2) === '![') { + const closeIndex = findClosingIndex(xmlData, "]]>", i, "StopNode is not closed.") - 2; + i=closeIndex; + } else { + const tagData = readTagExp(xmlData, i, '>') -var _bytesToUuid = _interopRequireDefault(__nccwpck_require__(35827)); + if (tagData) { + const openTagName = tagData && tagData.tagName; + if (openTagName === tagName && tagData.tagExp[tagData.tagExp.length-1] !== "/") { + openTagCount++; + } + i=tagData.closeIndex; + } + } + } + }//end for loop +} -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } +function parseValue(val, shouldParse, options) { + if (shouldParse && typeof val === 'string') { + //console.log(options) + const newval = val.trim(); + if(newval === 'true' ) return true; + else if(newval === 'false' ) return false; + else return toNumber(val, options); + } else { + if (util.isExist(val)) { + return val; + } else { + return ''; + } + } +} -function v4(options, buf, offset) { - var i = buf && offset || 0; - if (typeof options == 'string') { - buf = options === 'binary' ? new Array(16) : null; - options = null; - } +module.exports = OrderedObjParser; - options = options || {}; - var rnds = options.random || (options.rng || _rng.default)(); // Per 4.4, set bits for version and `clock_seq_hi_and_reserved` +/***/ }), +/***/ 42380: +/***/ ((module, __unused_webpack_exports, __nccwpck_require__) => { - rnds[6] = rnds[6] & 0x0f | 0x40; - rnds[8] = rnds[8] & 0x3f | 0x80; // Copy bytes to buffer, if provided +const { buildOptions} = __nccwpck_require__(86993); +const OrderedObjParser = __nccwpck_require__(25832); +const { prettify} = __nccwpck_require__(42882); +const validator = __nccwpck_require__(61739); - if (buf) { - for (var ii = 0; ii < 16; ++ii) { - buf[i + ii] = rnds[ii]; +class XMLParser{ + + constructor(options){ + this.externalEntities = {}; + this.options = buildOptions(options); + + } + /** + * Parse XML dats to JS object + * @param {string|Buffer} xmlData + * @param {boolean|Object} validationOption + */ + parse(xmlData,validationOption){ + if(typeof xmlData === "string"){ + }else if( xmlData.toString){ + xmlData = xmlData.toString(); + }else{ + throw new Error("XML data is accepted in String or Bytes[] form.") + } + if( validationOption){ + if(validationOption === true) validationOption = {}; //validate with default options + + const result = validator.validate(xmlData, validationOption); + if (result !== true) { + throw Error( `${result.err.msg}:${result.err.line}:${result.err.col}` ) + } + } + const orderedObjParser = new OrderedObjParser(this.options); + orderedObjParser.addExternalEntities(this.externalEntities); + const orderedResult = orderedObjParser.parseXml(xmlData); + if(this.options.preserveOrder || orderedResult === undefined) return orderedResult; + else return prettify(orderedResult, this.options); } - } - return buf || (0, _bytesToUuid.default)(rnds); + /** + * Add Entity which is not by default supported by this library + * @param {string} key + * @param {string} value + */ + addEntity(key, value){ + if(value.indexOf("&") !== -1){ + throw new Error("Entity value can't have '&'") + }else if(key.indexOf("&") !== -1 || key.indexOf(";") !== -1){ + throw new Error("An entity must be set without '&' and ';'. Eg. use '#xD' for ' '") + }else if(value === "&"){ + throw new Error("An entity with value '&' is not permitted"); + }else{ + this.externalEntities[key] = value; + } + } } -var _default = v4; -exports["default"] = _default; +module.exports = XMLParser; /***/ }), -/***/ 46508: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { +/***/ 42882: +/***/ ((__unused_webpack_module, exports) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ - value: true -})); -exports["default"] = void 0; - -var _v = _interopRequireDefault(__nccwpck_require__(36097)); +/** + * + * @param {array} node + * @param {any} options + * @returns + */ +function prettify(node, options){ + return compress( node, options); +} -var _sha = _interopRequireDefault(__nccwpck_require__(7387)); +/** + * + * @param {array} arr + * @param {object} options + * @param {string} jPath + * @returns object + */ +function compress(arr, options, jPath){ + let text; + const compressedObj = {}; + for (let i = 0; i < arr.length; i++) { + const tagObj = arr[i]; + const property = propName(tagObj); + let newJpath = ""; + if(jPath === undefined) newJpath = property; + else newJpath = jPath + "." + property; + + if(property === options.textNodeName){ + if(text === undefined) text = tagObj[property]; + else text += "" + tagObj[property]; + }else if(property === undefined){ + continue; + }else if(tagObj[property]){ + + let val = compress(tagObj[property], options, newJpath); + const isLeaf = isLeafTag(val, options); + + if(tagObj[":@"]){ + assignAttributes( val, tagObj[":@"], newJpath, options); + }else if(Object.keys(val).length === 1 && val[options.textNodeName] !== undefined && !options.alwaysCreateTextNode){ + val = val[options.textNodeName]; + }else if(Object.keys(val).length === 0){ + if(options.alwaysCreateTextNode) val[options.textNodeName] = ""; + else val = ""; + } + + if(compressedObj[property] !== undefined && compressedObj.hasOwnProperty(property)) { + if(!Array.isArray(compressedObj[property])) { + compressedObj[property] = [ compressedObj[property] ]; + } + compressedObj[property].push(val); + }else{ + //TODO: if a node is not an array, then check if it should be an array + //also determine if it is a leaf node + if (options.isArray(property, newJpath, isLeaf )) { + compressedObj[property] = [val]; + }else{ + compressedObj[property] = val; + } + } + } + + } + // if(text && text.length > 0) compressedObj[options.textNodeName] = text; + if(typeof text === "string"){ + if(text.length > 0) compressedObj[options.textNodeName] = text; + }else if(text !== undefined) compressedObj[options.textNodeName] = text; + return compressedObj; +} -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } +function propName(obj){ + const keys = Object.keys(obj); + for (let i = 0; i < keys.length; i++) { + const key = keys[i]; + if(key !== ":@") return key; + } +} -const v5 = (0, _v.default)('v5', 0x50, _sha.default); -var _default = v5; -exports["default"] = _default; +function assignAttributes(obj, attrMap, jpath, options){ + if (attrMap) { + const keys = Object.keys(attrMap); + const len = keys.length; //don't make it inline + for (let i = 0; i < len; i++) { + const atrrName = keys[i]; + if (options.isArray(atrrName, jpath + "." + atrrName, true, true)) { + obj[atrrName] = [ attrMap[atrrName] ]; + } else { + obj[atrrName] = attrMap[atrrName]; + } + } + } +} -/***/ }), +function isLeafTag(obj, options){ + const { textNodeName } = options; + const propCount = Object.keys(obj).length; + + if (propCount === 0) { + return true; + } -/***/ 96323: -/***/ ((__unused_webpack_module, exports, __nccwpck_require__) => { + if ( + propCount === 1 && + (obj[textNodeName] || typeof obj[textNodeName] === "boolean" || obj[textNodeName] === 0) + ) { + return true; + } -"use strict"; -var __webpack_unused_export__; + return false; +} +exports.prettify = prettify; -__webpack_unused_export__ = ({ value: true }); -var LRU_1 = __nccwpck_require__(77710); -var CACHE_SIZE = 1000; -/** - * Inspired node-lru-cache[https://github.com/isaacs/node-lru-cache] - */ -var EndpointCache = /** @class */ (function () { - function EndpointCache(maxSize) { - if (maxSize === void 0) { maxSize = CACHE_SIZE; } - this.maxSize = maxSize; - this.cache = new LRU_1.LRUCache(maxSize); - } - ; - Object.defineProperty(EndpointCache.prototype, "size", { - get: function () { - return this.cache.length; - }, - enumerable: true, - configurable: true - }); - EndpointCache.prototype.put = function (key, value) { - var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; - var endpointRecord = this.populateValue(value); - this.cache.put(keyString, endpointRecord); - }; - EndpointCache.prototype.get = function (key) { - var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; - var now = Date.now(); - var records = this.cache.get(keyString); - if (records) { - for (var i = records.length-1; i >= 0; i--) { - var record = records[i]; - if (record.Expire < now) { - records.splice(i, 1); - } - } - if (records.length === 0) { - this.cache.remove(keyString); - return undefined; - } - } - return records; - }; - EndpointCache.getKeyString = function (key) { - var identifiers = []; - var identifierNames = Object.keys(key).sort(); - for (var i = 0; i < identifierNames.length; i++) { - var identifierName = identifierNames[i]; - if (key[identifierName] === undefined) - continue; - identifiers.push(key[identifierName]); - } - return identifiers.join(' '); - }; - EndpointCache.prototype.populateValue = function (endpoints) { - var now = Date.now(); - return endpoints.map(function (endpoint) { return ({ - Address: endpoint.Address || '', - Expire: now + (endpoint.CachePeriodInMinutes || 1) * 60 * 1000 - }); }); - }; - EndpointCache.prototype.empty = function () { - this.cache.empty(); - }; - EndpointCache.prototype.remove = function (key) { - var keyString = typeof key !== 'string' ? EndpointCache.getKeyString(key) : key; - this.cache.remove(keyString); - }; - return EndpointCache; -}()); -exports.$ = EndpointCache; /***/ }), -/***/ 77710: -/***/ ((__unused_webpack_module, exports) => { +/***/ 7462: +/***/ ((module) => { "use strict"; -Object.defineProperty(exports, "__esModule", ({ value: true })); -var LinkedListNode = /** @class */ (function () { - function LinkedListNode(key, value) { - this.key = key; - this.value = value; - } - return LinkedListNode; -}()); -var LRUCache = /** @class */ (function () { - function LRUCache(size) { - this.nodeMap = {}; - this.size = 0; - if (typeof size !== 'number' || size < 1) { - throw new Error('Cache size can only be positive number'); - } - this.sizeLimit = size; + +class XmlNode{ + constructor(tagname) { + this.tagname = tagname; + this.child = []; //nested tags, text, cdata, comments in order + this[":@"] = {}; //attributes map + } + add(key,val){ + // this.child.push( {name : key, val: val, isCdata: isCdata }); + if(key === "__proto__") key = "#__proto__"; + this.child.push( {[key]: val }); + } + addChild(node) { + if(node.tagname === "__proto__") node.tagname = "#__proto__"; + if(node[":@"] && Object.keys(node[":@"]).length > 0){ + this.child.push( { [node.tagname]: node.child, [":@"]: node[":@"] }); + }else{ + this.child.push( { [node.tagname]: node.child }); } - Object.defineProperty(LRUCache.prototype, "length", { - get: function () { - return this.size; - }, - enumerable: true, - configurable: true - }); - LRUCache.prototype.prependToList = function (node) { - if (!this.headerNode) { - this.tailNode = node; - } - else { - this.headerNode.prev = node; - node.next = this.headerNode; - } - this.headerNode = node; - this.size++; - }; - LRUCache.prototype.removeFromTail = function () { - if (!this.tailNode) { - return undefined; - } - var node = this.tailNode; - var prevNode = node.prev; - if (prevNode) { - prevNode.next = undefined; - } - node.prev = undefined; - this.tailNode = prevNode; - this.size--; - return node; - }; - LRUCache.prototype.detachFromList = function (node) { - if (this.headerNode === node) { - this.headerNode = node.next; - } - if (this.tailNode === node) { - this.tailNode = node.prev; - } - if (node.prev) { - node.prev.next = node.next; - } - if (node.next) { - node.next.prev = node.prev; - } - node.next = undefined; - node.prev = undefined; - this.size--; - }; - LRUCache.prototype.get = function (key) { - if (this.nodeMap[key]) { - var node = this.nodeMap[key]; - this.detachFromList(node); - this.prependToList(node); - return node.value; - } - }; - LRUCache.prototype.remove = function (key) { - if (this.nodeMap[key]) { - var node = this.nodeMap[key]; - this.detachFromList(node); - delete this.nodeMap[key]; - } - }; - LRUCache.prototype.put = function (key, value) { - if (this.nodeMap[key]) { - this.remove(key); - } - else if (this.size === this.sizeLimit) { - var tailNode = this.removeFromTail(); - var key_1 = tailNode.key; - delete this.nodeMap[key_1]; - } - var newNode = new LinkedListNode(key, value); - this.nodeMap[key] = newNode; - this.prependToList(newNode); - }; - LRUCache.prototype.empty = function () { - var keys = Object.keys(this.nodeMap); - for (var i = 0; i < keys.length; i++) { - var key = keys[i]; - var node = this.nodeMap[key]; - this.detachFromList(node); - delete this.nodeMap[key]; - } - }; - return LRUCache; -}()); -exports.LRUCache = LRUCache; + }; +}; + + +module.exports = XmlNode; /***/ }), @@ -37629,6 +60614,568 @@ module.exports.logEventToMessage = new CWLogEventToMessage(); +/***/ }), + +/***/ 14526: +/***/ ((module) => { + +const hexRegex = /^[-+]?0x[a-fA-F0-9]+$/; +const numRegex = /^([\-\+])?(0*)(\.[0-9]+([eE]\-?[0-9]+)?|[0-9]+(\.[0-9]+([eE]\-?[0-9]+)?)?)$/; +// const octRegex = /0x[a-z0-9]+/; +// const binRegex = /0x[a-z0-9]+/; + + +//polyfill +if (!Number.parseInt && window.parseInt) { + Number.parseInt = window.parseInt; +} +if (!Number.parseFloat && window.parseFloat) { + Number.parseFloat = window.parseFloat; +} + + +const consider = { + hex : true, + leadingZeros: true, + decimalPoint: "\.", + eNotation: true + //skipLike: /regex/ +}; + +function toNumber(str, options = {}){ + // const options = Object.assign({}, consider); + // if(opt.leadingZeros === false){ + // options.leadingZeros = false; + // }else if(opt.hex === false){ + // options.hex = false; + // } + + options = Object.assign({}, consider, options ); + if(!str || typeof str !== "string" ) return str; + + let trimmedStr = str.trim(); + // if(trimmedStr === "0.0") return 0; + // else if(trimmedStr === "+0.0") return 0; + // else if(trimmedStr === "-0.0") return -0; + + if(options.skipLike !== undefined && options.skipLike.test(trimmedStr)) return str; + else if (options.hex && hexRegex.test(trimmedStr)) { + return Number.parseInt(trimmedStr, 16); + // } else if (options.parseOct && octRegex.test(str)) { + // return Number.parseInt(val, 8); + // }else if (options.parseBin && binRegex.test(str)) { + // return Number.parseInt(val, 2); + }else{ + //separate negative sign, leading zeros, and rest number + const match = numRegex.exec(trimmedStr); + if(match){ + const sign = match[1]; + const leadingZeros = match[2]; + let numTrimmedByZeros = trimZeros(match[3]); //complete num without leading zeros + //trim ending zeros for floating number + + const eNotation = match[4] || match[6]; + if(!options.leadingZeros && leadingZeros.length > 0 && sign && trimmedStr[2] !== ".") return str; //-0123 + else if(!options.leadingZeros && leadingZeros.length > 0 && !sign && trimmedStr[1] !== ".") return str; //0123 + else{//no leading zeros or leading zeros are allowed + const num = Number(trimmedStr); + const numStr = "" + num; + if(numStr.search(/[eE]/) !== -1){ //given number is long and parsed to eNotation + if(options.eNotation) return num; + else return str; + }else if(eNotation){ //given number has enotation + if(options.eNotation) return num; + else return str; + }else if(trimmedStr.indexOf(".") !== -1){ //floating number + // const decimalPart = match[5].substr(1); + // const intPart = trimmedStr.substr(0,trimmedStr.indexOf(".")); + + + // const p = numStr.indexOf("."); + // const givenIntPart = numStr.substr(0,p); + // const givenDecPart = numStr.substr(p+1); + if(numStr === "0" && (numTrimmedByZeros === "") ) return num; //0.0 + else if(numStr === numTrimmedByZeros) return num; //0.456. 0.79000 + else if( sign && numStr === "-"+numTrimmedByZeros) return num; + else return str; + } + + if(leadingZeros){ + // if(numTrimmedByZeros === numStr){ + // if(options.leadingZeros) return num; + // else return str; + // }else return str; + if(numTrimmedByZeros === numStr) return num; + else if(sign+numTrimmedByZeros === numStr) return num; + else return str; + } + + if(trimmedStr === numStr) return num; + else if(trimmedStr === sign+numStr) return num; + // else{ + // //number with +/- sign + // trimmedStr.test(/[-+][0-9]); + + // } + return str; + } + // else if(!eNotation && trimmedStr && trimmedStr !== Number(trimmedStr) ) return str; + + }else{ //non-numeric string + return str; + } + } +} + +/** + * + * @param {string} numStr without leading zeros + * @returns + */ +function trimZeros(numStr){ + if(numStr && numStr.indexOf(".") !== -1){//float + numStr = numStr.replace(/0+$/, ""); //remove ending zeros + if(numStr === ".") numStr = "0"; + else if(numStr[0] === ".") numStr = "0"+numStr; + else if(numStr[numStr.length-1] === ".") numStr = numStr.substr(0,numStr.length-1); + return numStr; + } + return numStr; +} +module.exports = toNumber + + +/***/ }), + +/***/ 4351: +/***/ ((module) => { + +/****************************************************************************** +Copyright (c) Microsoft Corporation. + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH +REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, +INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM +LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR +OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. +***************************************************************************** */ +/* global global, define, Symbol, Reflect, Promise, SuppressedError */ +var __extends; +var __assign; +var __rest; +var __decorate; +var __param; +var __esDecorate; +var __runInitializers; +var __propKey; +var __setFunctionName; +var __metadata; +var __awaiter; +var __generator; +var __exportStar; +var __values; +var __read; +var __spread; +var __spreadArrays; +var __spreadArray; +var __await; +var __asyncGenerator; +var __asyncDelegator; +var __asyncValues; +var __makeTemplateObject; +var __importStar; +var __importDefault; +var __classPrivateFieldGet; +var __classPrivateFieldSet; +var __classPrivateFieldIn; +var __createBinding; +var __addDisposableResource; +var __disposeResources; +(function (factory) { + var root = typeof global === "object" ? global : typeof self === "object" ? self : typeof this === "object" ? this : {}; + if (typeof define === "function" && define.amd) { + define("tslib", ["exports"], function (exports) { factory(createExporter(root, createExporter(exports))); }); + } + else if ( true && typeof module.exports === "object") { + factory(createExporter(root, createExporter(module.exports))); + } + else { + factory(createExporter(root)); + } + function createExporter(exports, previous) { + if (exports !== root) { + if (typeof Object.create === "function") { + Object.defineProperty(exports, "__esModule", { value: true }); + } + else { + exports.__esModule = true; + } + } + return function (id, v) { return exports[id] = previous ? previous(id, v) : v; }; + } +}) +(function (exporter) { + var extendStatics = Object.setPrototypeOf || + ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || + function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; }; + + __extends = function (d, b) { + if (typeof b !== "function" && b !== null) + throw new TypeError("Class extends value " + String(b) + " is not a constructor or null"); + extendStatics(d, b); + function __() { this.constructor = d; } + d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); + }; + + __assign = Object.assign || function (t) { + for (var s, i = 1, n = arguments.length; i < n; i++) { + s = arguments[i]; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; + } + return t; + }; + + __rest = function (s, e) { + var t = {}; + for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) + t[p] = s[p]; + if (s != null && typeof Object.getOwnPropertySymbols === "function") + for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) { + if (e.indexOf(p[i]) < 0 && Object.prototype.propertyIsEnumerable.call(s, p[i])) + t[p[i]] = s[p[i]]; + } + return t; + }; + + __decorate = function (decorators, target, key, desc) { + var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); + else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; + return c > 3 && r && Object.defineProperty(target, key, r), r; + }; + + __param = function (paramIndex, decorator) { + return function (target, key) { decorator(target, key, paramIndex); } + }; + + __esDecorate = function (ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) { + function accept(f) { if (f !== void 0 && typeof f !== "function") throw new TypeError("Function expected"); return f; } + var kind = contextIn.kind, key = kind === "getter" ? "get" : kind === "setter" ? "set" : "value"; + var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null; + var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {}); + var _, done = false; + for (var i = decorators.length - 1; i >= 0; i--) { + var context = {}; + for (var p in contextIn) context[p] = p === "access" ? {} : contextIn[p]; + for (var p in contextIn.access) context.access[p] = contextIn.access[p]; + context.addInitializer = function (f) { if (done) throw new TypeError("Cannot add initializers after decoration has completed"); extraInitializers.push(accept(f || null)); }; + var result = (0, decorators[i])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key], context); + if (kind === "accessor") { + if (result === void 0) continue; + if (result === null || typeof result !== "object") throw new TypeError("Object expected"); + if (_ = accept(result.get)) descriptor.get = _; + if (_ = accept(result.set)) descriptor.set = _; + if (_ = accept(result.init)) initializers.unshift(_); + } + else if (_ = accept(result)) { + if (kind === "field") initializers.unshift(_); + else descriptor[key] = _; + } + } + if (target) Object.defineProperty(target, contextIn.name, descriptor); + done = true; + }; + + __runInitializers = function (thisArg, initializers, value) { + var useValue = arguments.length > 2; + for (var i = 0; i < initializers.length; i++) { + value = useValue ? initializers[i].call(thisArg, value) : initializers[i].call(thisArg); + } + return useValue ? value : void 0; + }; + + __propKey = function (x) { + return typeof x === "symbol" ? x : "".concat(x); + }; + + __setFunctionName = function (f, name, prefix) { + if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : ""; + return Object.defineProperty(f, "name", { configurable: true, value: prefix ? "".concat(prefix, " ", name) : name }); + }; + + __metadata = function (metadataKey, metadataValue) { + if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); + }; + + __awaiter = function (thisArg, _arguments, P, generator) { + function adopt(value) { return value instanceof P ? value : new P(function (resolve) { resolve(value); }); } + return new (P || (P = Promise))(function (resolve, reject) { + function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } + function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } + function step(result) { result.done ? resolve(result.value) : adopt(result.value).then(fulfilled, rejected); } + step((generator = generator.apply(thisArg, _arguments || [])).next()); + }); + }; + + __generator = function (thisArg, body) { + var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; + return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; + function verb(n) { return function (v) { return step([n, v]); }; } + function step(op) { + if (f) throw new TypeError("Generator is already executing."); + while (g && (g = 0, op[0] && (_ = 0)), _) try { + if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; + if (y = 0, t) op = [op[0] & 2, t.value]; + switch (op[0]) { + case 0: case 1: t = op; break; + case 4: _.label++; return { value: op[1], done: false }; + case 5: _.label++; y = op[1]; op = [0]; continue; + case 7: op = _.ops.pop(); _.trys.pop(); continue; + default: + if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } + if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } + if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } + if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } + if (t[2]) _.ops.pop(); + _.trys.pop(); continue; + } + op = body.call(thisArg, _); + } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } + if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; + } + }; + + __exportStar = function(m, o) { + for (var p in m) if (p !== "default" && !Object.prototype.hasOwnProperty.call(o, p)) __createBinding(o, m, p); + }; + + __createBinding = Object.create ? (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + var desc = Object.getOwnPropertyDescriptor(m, k); + if (!desc || ("get" in desc ? !m.__esModule : desc.writable || desc.configurable)) { + desc = { enumerable: true, get: function() { return m[k]; } }; + } + Object.defineProperty(o, k2, desc); + }) : (function(o, m, k, k2) { + if (k2 === undefined) k2 = k; + o[k2] = m[k]; + }); + + __values = function (o) { + var s = typeof Symbol === "function" && Symbol.iterator, m = s && o[s], i = 0; + if (m) return m.call(o); + if (o && typeof o.length === "number") return { + next: function () { + if (o && i >= o.length) o = void 0; + return { value: o && o[i++], done: !o }; + } + }; + throw new TypeError(s ? "Object is not iterable." : "Symbol.iterator is not defined."); + }; + + __read = function (o, n) { + var m = typeof Symbol === "function" && o[Symbol.iterator]; + if (!m) return o; + var i = m.call(o), r, ar = [], e; + try { + while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); + } + catch (error) { e = { error: error }; } + finally { + try { + if (r && !r.done && (m = i["return"])) m.call(i); + } + finally { if (e) throw e.error; } + } + return ar; + }; + + /** @deprecated */ + __spread = function () { + for (var ar = [], i = 0; i < arguments.length; i++) + ar = ar.concat(__read(arguments[i])); + return ar; + }; + + /** @deprecated */ + __spreadArrays = function () { + for (var s = 0, i = 0, il = arguments.length; i < il; i++) s += arguments[i].length; + for (var r = Array(s), k = 0, i = 0; i < il; i++) + for (var a = arguments[i], j = 0, jl = a.length; j < jl; j++, k++) + r[k] = a[j]; + return r; + }; + + __spreadArray = function (to, from, pack) { + if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) { + if (ar || !(i in from)) { + if (!ar) ar = Array.prototype.slice.call(from, 0, i); + ar[i] = from[i]; + } + } + return to.concat(ar || Array.prototype.slice.call(from)); + }; + + __await = function (v) { + return this instanceof __await ? (this.v = v, this) : new __await(v); + }; + + __asyncGenerator = function (thisArg, _arguments, generator) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var g = generator.apply(thisArg, _arguments || []), i, q = []; + return i = {}, verb("next"), verb("throw"), verb("return", awaitReturn), i[Symbol.asyncIterator] = function () { return this; }, i; + function awaitReturn(f) { return function (v) { return Promise.resolve(v).then(f, reject); }; } + function verb(n, f) { if (g[n]) { i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; if (f) i[n] = f(i[n]); } } + function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } } + function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); } + function fulfill(value) { resume("next", value); } + function reject(value) { resume("throw", value); } + function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); } + }; + + __asyncDelegator = function (o) { + var i, p; + return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i; + function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: false } : f ? f(v) : v; } : f; } + }; + + __asyncValues = function (o) { + if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); + var m = o[Symbol.asyncIterator], i; + return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i); + function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; } + function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); } + }; + + __makeTemplateObject = function (cooked, raw) { + if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; } + return cooked; + }; + + var __setModuleDefault = Object.create ? (function(o, v) { + Object.defineProperty(o, "default", { enumerable: true, value: v }); + }) : function(o, v) { + o["default"] = v; + }; + + __importStar = function (mod) { + if (mod && mod.__esModule) return mod; + var result = {}; + if (mod != null) for (var k in mod) if (k !== "default" && Object.prototype.hasOwnProperty.call(mod, k)) __createBinding(result, mod, k); + __setModuleDefault(result, mod); + return result; + }; + + __importDefault = function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; + }; + + __classPrivateFieldGet = function (receiver, state, kind, f) { + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a getter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it"); + return kind === "m" ? f : kind === "a" ? f.call(receiver) : f ? f.value : state.get(receiver); + }; + + __classPrivateFieldSet = function (receiver, state, value, kind, f) { + if (kind === "m") throw new TypeError("Private method is not writable"); + if (kind === "a" && !f) throw new TypeError("Private accessor was defined without a setter"); + if (typeof state === "function" ? receiver !== state || !f : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it"); + return (kind === "a" ? f.call(receiver, value) : f ? f.value = value : state.set(receiver, value)), value; + }; + + __classPrivateFieldIn = function (state, receiver) { + if (receiver === null || (typeof receiver !== "object" && typeof receiver !== "function")) throw new TypeError("Cannot use 'in' operator on non-object"); + return typeof state === "function" ? receiver === state : state.has(receiver); + }; + + __addDisposableResource = function (env, value, async) { + if (value !== null && value !== void 0) { + if (typeof value !== "object" && typeof value !== "function") throw new TypeError("Object expected."); + var dispose, inner; + if (async) { + if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined."); + dispose = value[Symbol.asyncDispose]; + } + if (dispose === void 0) { + if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined."); + dispose = value[Symbol.dispose]; + if (async) inner = dispose; + } + if (typeof dispose !== "function") throw new TypeError("Object not disposable."); + if (inner) dispose = function() { try { inner.call(this); } catch (e) { return Promise.reject(e); } }; + env.stack.push({ value: value, dispose: dispose, async: async }); + } + else if (async) { + env.stack.push({ async: true }); + } + return value; + }; + + var _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function (error, suppressed, message) { + var e = new Error(message); + return e.name = "SuppressedError", e.error = error, e.suppressed = suppressed, e; + }; + + __disposeResources = function (env) { + function fail(e) { + env.error = env.hasError ? new _SuppressedError(e, env.error, "An error was suppressed during disposal.") : e; + env.hasError = true; + } + function next() { + while (env.stack.length) { + var rec = env.stack.pop(); + try { + var result = rec.dispose && rec.dispose.call(rec.value); + if (rec.async) return Promise.resolve(result).then(next, function(e) { fail(e); return next(); }); + } + catch (e) { + fail(e); + } + } + if (env.hasError) throw env.error; + } + return next(); + }; + + exporter("__extends", __extends); + exporter("__assign", __assign); + exporter("__rest", __rest); + exporter("__decorate", __decorate); + exporter("__param", __param); + exporter("__esDecorate", __esDecorate); + exporter("__runInitializers", __runInitializers); + exporter("__propKey", __propKey); + exporter("__setFunctionName", __setFunctionName); + exporter("__metadata", __metadata); + exporter("__awaiter", __awaiter); + exporter("__generator", __generator); + exporter("__exportStar", __exportStar); + exporter("__createBinding", __createBinding); + exporter("__values", __values); + exporter("__read", __read); + exporter("__spread", __spread); + exporter("__spreadArrays", __spreadArrays); + exporter("__spreadArray", __spreadArray); + exporter("__await", __await); + exporter("__asyncGenerator", __asyncGenerator); + exporter("__asyncDelegator", __asyncDelegator); + exporter("__asyncValues", __asyncValues); + exporter("__makeTemplateObject", __makeTemplateObject); + exporter("__importStar", __importStar); + exporter("__importDefault", __importDefault); + exporter("__classPrivateFieldGet", __classPrivateFieldGet); + exporter("__classPrivateFieldSet", __classPrivateFieldSet); + exporter("__classPrivateFieldIn", __classPrivateFieldIn); + exporter("__addDisposableResource", __addDisposableResource); + exporter("__disposeResources", __disposeResources); +}); + + /***/ }), /***/ 74294: @@ -43562,14 +67109,6 @@ exports["default"] = _default; }).call(this); -/***/ }), - -/***/ 78072: -/***/ ((module) => { - -module.exports = eval("require")("@aws-sdk/client-ecs"); - - /***/ }), /***/ 39491: @@ -43636,6 +67175,14 @@ module.exports = require("fs"); /***/ }), +/***/ 73292: +/***/ ((module) => { + +"use strict"; +module.exports = require("fs/promises"); + +/***/ }), + /***/ 13685: /***/ ((module) => { @@ -43644,6 +67191,14 @@ module.exports = require("http"); /***/ }), +/***/ 85158: +/***/ ((module) => { + +"use strict"; +module.exports = require("http2"); + +/***/ }), + /***/ 95687: /***/ ((module) => { @@ -43676,6 +67231,14 @@ module.exports = require("path"); /***/ }), +/***/ 77282: +/***/ ((module) => { + +"use strict"; +module.exports = require("process"); + +/***/ }), + /***/ 63477: /***/ ((module) => { @@ -43732,6 +67295,38 @@ module.exports = require("util"); /***/ }), +/***/ 95223: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-ecs","description":"AWS SDK for JavaScript Ecs Client for Node.js, Browser and React Native","version":"3.609.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-ecs","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo ecs"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/client-sso-oidc":"3.609.0","@aws-sdk/client-sts":"3.609.0","@aws-sdk/core":"3.609.0","@aws-sdk/credential-provider-node":"3.609.0","@aws-sdk/middleware-host-header":"3.609.0","@aws-sdk/middleware-logger":"3.609.0","@aws-sdk/middleware-recursion-detection":"3.609.0","@aws-sdk/middleware-user-agent":"3.609.0","@aws-sdk/region-config-resolver":"3.609.0","@aws-sdk/types":"3.609.0","@aws-sdk/util-endpoints":"3.609.0","@aws-sdk/util-user-agent-browser":"3.609.0","@aws-sdk/util-user-agent-node":"3.609.0","@smithy/config-resolver":"^3.0.4","@smithy/core":"^2.2.4","@smithy/fetch-http-handler":"^3.2.0","@smithy/hash-node":"^3.0.3","@smithy/invalid-dependency":"^3.0.3","@smithy/middleware-content-length":"^3.0.3","@smithy/middleware-endpoint":"^3.0.4","@smithy/middleware-retry":"^3.0.7","@smithy/middleware-serde":"^3.0.3","@smithy/middleware-stack":"^3.0.3","@smithy/node-config-provider":"^3.1.3","@smithy/node-http-handler":"^3.1.1","@smithy/protocol-http":"^4.0.3","@smithy/smithy-client":"^3.1.5","@smithy/types":"^3.3.0","@smithy/url-parser":"^3.0.3","@smithy/util-base64":"^3.0.0","@smithy/util-body-length-browser":"^3.0.0","@smithy/util-body-length-node":"^3.0.0","@smithy/util-defaults-mode-browser":"^3.0.7","@smithy/util-defaults-mode-node":"^3.0.7","@smithy/util-endpoints":"^2.0.4","@smithy/util-middleware":"^3.0.3","@smithy/util-retry":"^3.0.3","@smithy/util-utf8":"^3.0.0","@smithy/util-waiter":"^3.1.2","tslib":"^2.6.2","uuid":"^9.0.1"},"devDependencies":{"@tsconfig/node16":"16.1.3","@types/node":"^16.18.96","@types/uuid":"^9.0.4","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=16.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-ecs","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-ecs"}}'); + +/***/ }), + +/***/ 69722: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-sso-oidc","description":"AWS SDK for JavaScript Sso Oidc Client for Node.js, Browser and React Native","version":"3.609.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-sso-oidc","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso-oidc"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.609.0","@aws-sdk/credential-provider-node":"3.609.0","@aws-sdk/middleware-host-header":"3.609.0","@aws-sdk/middleware-logger":"3.609.0","@aws-sdk/middleware-recursion-detection":"3.609.0","@aws-sdk/middleware-user-agent":"3.609.0","@aws-sdk/region-config-resolver":"3.609.0","@aws-sdk/types":"3.609.0","@aws-sdk/util-endpoints":"3.609.0","@aws-sdk/util-user-agent-browser":"3.609.0","@aws-sdk/util-user-agent-node":"3.609.0","@smithy/config-resolver":"^3.0.4","@smithy/core":"^2.2.4","@smithy/fetch-http-handler":"^3.2.0","@smithy/hash-node":"^3.0.3","@smithy/invalid-dependency":"^3.0.3","@smithy/middleware-content-length":"^3.0.3","@smithy/middleware-endpoint":"^3.0.4","@smithy/middleware-retry":"^3.0.7","@smithy/middleware-serde":"^3.0.3","@smithy/middleware-stack":"^3.0.3","@smithy/node-config-provider":"^3.1.3","@smithy/node-http-handler":"^3.1.1","@smithy/protocol-http":"^4.0.3","@smithy/smithy-client":"^3.1.5","@smithy/types":"^3.3.0","@smithy/url-parser":"^3.0.3","@smithy/util-base64":"^3.0.0","@smithy/util-body-length-browser":"^3.0.0","@smithy/util-body-length-node":"^3.0.0","@smithy/util-defaults-mode-browser":"^3.0.7","@smithy/util-defaults-mode-node":"^3.0.7","@smithy/util-endpoints":"^2.0.4","@smithy/util-middleware":"^3.0.3","@smithy/util-retry":"^3.0.3","@smithy/util-utf8":"^3.0.0","tslib":"^2.6.2"},"peerDependencies":{"@aws-sdk/client-sts":"^3.609.0"},"devDependencies":{"@tsconfig/node16":"16.1.3","@types/node":"^16.18.96","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=16.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso-oidc","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso-oidc"}}'); + +/***/ }), + +/***/ 91092: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-sso","description":"AWS SDK for JavaScript Sso Client for Node.js, Browser and React Native","version":"3.609.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-sso","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sso"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/core":"3.609.0","@aws-sdk/middleware-host-header":"3.609.0","@aws-sdk/middleware-logger":"3.609.0","@aws-sdk/middleware-recursion-detection":"3.609.0","@aws-sdk/middleware-user-agent":"3.609.0","@aws-sdk/region-config-resolver":"3.609.0","@aws-sdk/types":"3.609.0","@aws-sdk/util-endpoints":"3.609.0","@aws-sdk/util-user-agent-browser":"3.609.0","@aws-sdk/util-user-agent-node":"3.609.0","@smithy/config-resolver":"^3.0.4","@smithy/core":"^2.2.4","@smithy/fetch-http-handler":"^3.2.0","@smithy/hash-node":"^3.0.3","@smithy/invalid-dependency":"^3.0.3","@smithy/middleware-content-length":"^3.0.3","@smithy/middleware-endpoint":"^3.0.4","@smithy/middleware-retry":"^3.0.7","@smithy/middleware-serde":"^3.0.3","@smithy/middleware-stack":"^3.0.3","@smithy/node-config-provider":"^3.1.3","@smithy/node-http-handler":"^3.1.1","@smithy/protocol-http":"^4.0.3","@smithy/smithy-client":"^3.1.5","@smithy/types":"^3.3.0","@smithy/url-parser":"^3.0.3","@smithy/util-base64":"^3.0.0","@smithy/util-body-length-browser":"^3.0.0","@smithy/util-body-length-node":"^3.0.0","@smithy/util-defaults-mode-browser":"^3.0.7","@smithy/util-defaults-mode-node":"^3.0.7","@smithy/util-endpoints":"^2.0.4","@smithy/util-middleware":"^3.0.3","@smithy/util-retry":"^3.0.3","@smithy/util-utf8":"^3.0.0","tslib":"^2.6.2"},"devDependencies":{"@tsconfig/node16":"16.1.3","@types/node":"^16.18.96","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=16.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sso","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sso"}}'); + +/***/ }), + +/***/ 7947: +/***/ ((module) => { + +"use strict"; +module.exports = JSON.parse('{"name":"@aws-sdk/client-sts","description":"AWS SDK for JavaScript Sts Client for Node.js, Browser and React Native","version":"3.609.0","scripts":{"build":"concurrently \'yarn:build:cjs\' \'yarn:build:es\' \'yarn:build:types\'","build:cjs":"node ../../scripts/compilation/inline client-sts","build:es":"tsc -p tsconfig.es.json","build:include:deps":"lerna run --scope $npm_package_name --include-dependencies build","build:types":"rimraf ./dist-types tsconfig.types.tsbuildinfo && tsc -p tsconfig.types.json","build:types:downlevel":"downlevel-dts dist-types dist-types/ts3.4","clean":"rimraf ./dist-* && rimraf *.tsbuildinfo","extract:docs":"api-extractor run --local","generate:client":"node ../../scripts/generate-clients/single-service --solo sts","test":"yarn test:unit","test:unit":"jest"},"main":"./dist-cjs/index.js","types":"./dist-types/index.d.ts","module":"./dist-es/index.js","sideEffects":false,"dependencies":{"@aws-crypto/sha256-browser":"5.2.0","@aws-crypto/sha256-js":"5.2.0","@aws-sdk/client-sso-oidc":"3.609.0","@aws-sdk/core":"3.609.0","@aws-sdk/credential-provider-node":"3.609.0","@aws-sdk/middleware-host-header":"3.609.0","@aws-sdk/middleware-logger":"3.609.0","@aws-sdk/middleware-recursion-detection":"3.609.0","@aws-sdk/middleware-user-agent":"3.609.0","@aws-sdk/region-config-resolver":"3.609.0","@aws-sdk/types":"3.609.0","@aws-sdk/util-endpoints":"3.609.0","@aws-sdk/util-user-agent-browser":"3.609.0","@aws-sdk/util-user-agent-node":"3.609.0","@smithy/config-resolver":"^3.0.4","@smithy/core":"^2.2.4","@smithy/fetch-http-handler":"^3.2.0","@smithy/hash-node":"^3.0.3","@smithy/invalid-dependency":"^3.0.3","@smithy/middleware-content-length":"^3.0.3","@smithy/middleware-endpoint":"^3.0.4","@smithy/middleware-retry":"^3.0.7","@smithy/middleware-serde":"^3.0.3","@smithy/middleware-stack":"^3.0.3","@smithy/node-config-provider":"^3.1.3","@smithy/node-http-handler":"^3.1.1","@smithy/protocol-http":"^4.0.3","@smithy/smithy-client":"^3.1.5","@smithy/types":"^3.3.0","@smithy/url-parser":"^3.0.3","@smithy/util-base64":"^3.0.0","@smithy/util-body-length-browser":"^3.0.0","@smithy/util-body-length-node":"^3.0.0","@smithy/util-defaults-mode-browser":"^3.0.7","@smithy/util-defaults-mode-node":"^3.0.7","@smithy/util-endpoints":"^2.0.4","@smithy/util-middleware":"^3.0.3","@smithy/util-retry":"^3.0.3","@smithy/util-utf8":"^3.0.0","tslib":"^2.6.2"},"devDependencies":{"@tsconfig/node16":"16.1.3","@types/node":"^16.18.96","concurrently":"7.0.0","downlevel-dts":"0.10.1","rimraf":"3.0.2","typescript":"~4.9.5"},"engines":{"node":">=16.0.0"},"typesVersions":{"<4.0":{"dist-types/*":["dist-types/ts3.4/*"]}},"files":["dist-*/**"],"author":{"name":"AWS SDK for JavaScript Team","url":"https://aws.amazon.com/javascript/"},"license":"Apache-2.0","browser":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.browser"},"react-native":{"./dist-es/runtimeConfig":"./dist-es/runtimeConfig.native"},"homepage":"https://github.com/aws/aws-sdk-js-v3/tree/main/clients/client-sts","repository":{"type":"git","url":"https://github.com/aws/aws-sdk-js-v3.git","directory":"clients/client-sts"}}'); + +/***/ }), + /***/ 99161: /***/ ((module) => { @@ -50304,7 +73899,7 @@ var __webpack_exports__ = {}; const core = __nccwpck_require__(42186); const aws = __nccwpck_require__(71786); -const {ECS, waitUntilTasksRunning, waitUntilTasksStopped} = __nccwpck_require__(78072); +const {ECS, waitUntilTasksRunning, waitUntilTasksStopped} = __nccwpck_require__(18209); const smoketail = __nccwpck_require__(45601) diff --git a/package-lock.json b/package-lock.json index d568c91..1ec5fb8 100644 --- a/package-lock.json +++ b/package-lock.json @@ -10,6 +10,7 @@ "license": "Apache-2.0", "dependencies": { "@actions/core": "^1.9.1", + "@aws-sdk/client-ecs": "^3.609.0", "aws-sdk": "^2.1244.0", "smoketail": "^0.2.2", "yaml": "^2.2.2" @@ -60,6 +61,641 @@ "node": ">=6.0.0" } }, + "node_modules/@aws-crypto/sha256-browser": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@aws-crypto/sha256-browser/-/sha256-browser-5.2.0.tgz", + "integrity": "sha512-AXfN/lGotSQwu6HNcEsIASo7kWXZ5HYWvfOmSNKDsEqC4OashTp8alTmaz+F7TC2L083SFv5RdB+qU3Vs1kZqw==", + "dependencies": { + "@aws-crypto/sha256-js": "^5.2.0", + "@aws-crypto/supports-web-crypto": "^5.2.0", + "@aws-crypto/util": "^5.2.0", + "@aws-sdk/types": "^3.222.0", + "@aws-sdk/util-locate-window": "^3.0.0", + "@smithy/util-utf8": "^2.0.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@aws-crypto/sha256-browser/node_modules/@smithy/is-array-buffer": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/@smithy/is-array-buffer/-/is-array-buffer-2.2.0.tgz", + "integrity": "sha512-GGP3O9QFD24uGeAXYUjwSTXARoqpZykHadOmA8G5vfJPK0/DC67qa//0qvqrJzL1xc8WQWX7/yc7fwudjPHPhA==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-crypto/sha256-browser/node_modules/@smithy/util-buffer-from": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-buffer-from/-/util-buffer-from-2.2.0.tgz", + "integrity": "sha512-IJdWBbTcMQ6DA0gdNhh/BwrLkDR+ADW5Kr1aZmd4k3DIF6ezMV4R2NIAmT08wQJ3yUK82thHWmC/TnK/wpMMIA==", + "dependencies": { + "@smithy/is-array-buffer": "^2.2.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-crypto/sha256-browser/node_modules/@smithy/util-utf8": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/@smithy/util-utf8/-/util-utf8-2.3.0.tgz", + "integrity": "sha512-R8Rdn8Hy72KKcebgLiv8jQcQkXoLMOGGv5uI1/k0l+snqkOzQ1R0ChUBCxWMlBsFMekWjq0wRudIweFs7sKT5A==", + "dependencies": { + "@smithy/util-buffer-from": "^2.2.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-crypto/sha256-js": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@aws-crypto/sha256-js/-/sha256-js-5.2.0.tgz", + "integrity": "sha512-FFQQyu7edu4ufvIZ+OadFpHHOt+eSTBaYaki44c+akjg7qZg9oOQeLlk77F6tSYqjDAFClrHJk9tMf0HdVyOvA==", + "dependencies": { + "@aws-crypto/util": "^5.2.0", + "@aws-sdk/types": "^3.222.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-crypto/supports-web-crypto": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@aws-crypto/supports-web-crypto/-/supports-web-crypto-5.2.0.tgz", + "integrity": "sha512-iAvUotm021kM33eCdNfwIN//F77/IADDSs58i+MDaOqFrVjZo9bAal0NK7HurRuWLLpF1iLX7gbWrjHjeo+YFg==", + "dependencies": { + "tslib": "^2.6.2" + } + }, + "node_modules/@aws-crypto/util": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@aws-crypto/util/-/util-5.2.0.tgz", + "integrity": "sha512-4RkU9EsI6ZpBve5fseQlGNUWKMa1RLPQ1dnjnQoe07ldfIzcsGb5hC5W0Dm7u423KWzawlrpbjXBrXCEv9zazQ==", + "dependencies": { + "@aws-sdk/types": "^3.222.0", + "@smithy/util-utf8": "^2.0.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@aws-crypto/util/node_modules/@smithy/is-array-buffer": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/@smithy/is-array-buffer/-/is-array-buffer-2.2.0.tgz", + "integrity": "sha512-GGP3O9QFD24uGeAXYUjwSTXARoqpZykHadOmA8G5vfJPK0/DC67qa//0qvqrJzL1xc8WQWX7/yc7fwudjPHPhA==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-crypto/util/node_modules/@smithy/util-buffer-from": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/@smithy/util-buffer-from/-/util-buffer-from-2.2.0.tgz", + "integrity": "sha512-IJdWBbTcMQ6DA0gdNhh/BwrLkDR+ADW5Kr1aZmd4k3DIF6ezMV4R2NIAmT08wQJ3yUK82thHWmC/TnK/wpMMIA==", + "dependencies": { + "@smithy/is-array-buffer": "^2.2.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-crypto/util/node_modules/@smithy/util-utf8": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/@smithy/util-utf8/-/util-utf8-2.3.0.tgz", + "integrity": "sha512-R8Rdn8Hy72KKcebgLiv8jQcQkXoLMOGGv5uI1/k0l+snqkOzQ1R0ChUBCxWMlBsFMekWjq0wRudIweFs7sKT5A==", + "dependencies": { + "@smithy/util-buffer-from": "^2.2.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/@aws-sdk/client-ecs": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-ecs/-/client-ecs-3.609.0.tgz", + "integrity": "sha512-oBGfN9b4BdrMap+IZJHKwlCllUxEA/eszKFKiwz5po3QNA7ylvCCY4ePINfuB+B6oYObDogC0lEQ3vGlhbOCVA==", + "dependencies": { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/client-sso-oidc": "3.609.0", + "@aws-sdk/client-sts": "3.609.0", + "@aws-sdk/core": "3.609.0", + "@aws-sdk/credential-provider-node": "3.609.0", + "@aws-sdk/middleware-host-header": "3.609.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.609.0", + "@aws-sdk/middleware-user-agent": "3.609.0", + "@aws-sdk/region-config-resolver": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.609.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.609.0", + "@smithy/config-resolver": "^3.0.4", + "@smithy/core": "^2.2.4", + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.3", + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-retry": "^3.0.7", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.7", + "@smithy/util-defaults-mode-node": "^3.0.7", + "@smithy/util-endpoints": "^2.0.4", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + "@smithy/util-waiter": "^3.1.2", + "tslib": "^2.6.2", + "uuid": "^9.0.1" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/client-ecs/node_modules/uuid": { + "version": "9.0.1", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-9.0.1.tgz", + "integrity": "sha512-b+1eJOlsR9K8HJpow9Ok3fiWOWSIcIzXodvv0rQjVoOVNpWMpxf1wZNpt4y9h10odCNrqnYp1OBzRktckBe3sA==", + "funding": [ + "https://github.com/sponsors/broofa", + "https://github.com/sponsors/ctavan" + ], + "bin": { + "uuid": "dist/bin/uuid" + } + }, + "node_modules/@aws-sdk/client-sso": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-sso/-/client-sso-3.609.0.tgz", + "integrity": "sha512-gqXGFDkIpKHCKAbeJK4aIDt3tiwJ26Rf5Tqw9JS6BYXsdMeOB8FTzqD9R+Yc1epHd8s5L94sdqXT5PapgxFZrg==", + "dependencies": { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/core": "3.609.0", + "@aws-sdk/middleware-host-header": "3.609.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.609.0", + "@aws-sdk/middleware-user-agent": "3.609.0", + "@aws-sdk/region-config-resolver": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.609.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.609.0", + "@smithy/config-resolver": "^3.0.4", + "@smithy/core": "^2.2.4", + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.3", + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-retry": "^3.0.7", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.7", + "@smithy/util-defaults-mode-node": "^3.0.7", + "@smithy/util-endpoints": "^2.0.4", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/client-sso-oidc": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-sso-oidc/-/client-sso-oidc-3.609.0.tgz", + "integrity": "sha512-0bNPAyPdkWkS9EGB2A9BZDkBNrnVCBzk5lYRezoT4K3/gi9w1DTYH5tuRdwaTZdxW19U1mq7CV0YJJARKO1L9Q==", + "dependencies": { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/core": "3.609.0", + "@aws-sdk/credential-provider-node": "3.609.0", + "@aws-sdk/middleware-host-header": "3.609.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.609.0", + "@aws-sdk/middleware-user-agent": "3.609.0", + "@aws-sdk/region-config-resolver": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.609.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.609.0", + "@smithy/config-resolver": "^3.0.4", + "@smithy/core": "^2.2.4", + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.3", + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-retry": "^3.0.7", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.7", + "@smithy/util-defaults-mode-node": "^3.0.7", + "@smithy/util-endpoints": "^2.0.4", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + }, + "peerDependencies": { + "@aws-sdk/client-sts": "^3.609.0" + } + }, + "node_modules/@aws-sdk/client-sts": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/client-sts/-/client-sts-3.609.0.tgz", + "integrity": "sha512-A0B3sDKFoFlGo8RYRjDBWHXpbgirer2bZBkCIzhSPHc1vOFHt/m2NcUoE2xnBKXJFrptL1xDkvo1P+XYp/BfcQ==", + "dependencies": { + "@aws-crypto/sha256-browser": "5.2.0", + "@aws-crypto/sha256-js": "5.2.0", + "@aws-sdk/client-sso-oidc": "3.609.0", + "@aws-sdk/core": "3.609.0", + "@aws-sdk/credential-provider-node": "3.609.0", + "@aws-sdk/middleware-host-header": "3.609.0", + "@aws-sdk/middleware-logger": "3.609.0", + "@aws-sdk/middleware-recursion-detection": "3.609.0", + "@aws-sdk/middleware-user-agent": "3.609.0", + "@aws-sdk/region-config-resolver": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.609.0", + "@aws-sdk/util-user-agent-browser": "3.609.0", + "@aws-sdk/util-user-agent-node": "3.609.0", + "@smithy/config-resolver": "^3.0.4", + "@smithy/core": "^2.2.4", + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/hash-node": "^3.0.3", + "@smithy/invalid-dependency": "^3.0.3", + "@smithy/middleware-content-length": "^3.0.3", + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-retry": "^3.0.7", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-body-length-browser": "^3.0.0", + "@smithy/util-body-length-node": "^3.0.0", + "@smithy/util-defaults-mode-browser": "^3.0.7", + "@smithy/util-defaults-mode-node": "^3.0.7", + "@smithy/util-endpoints": "^2.0.4", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/core": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/core/-/core-3.609.0.tgz", + "integrity": "sha512-ptqw+DTxLr01+pKjDUuo53SEDzI+7nFM3WfQaEo0yhDg8vWw8PER4sWj1Ysx67ksctnZesPUjqxd5SHbtdBxiA==", + "dependencies": { + "@smithy/core": "^2.2.4", + "@smithy/protocol-http": "^4.0.3", + "@smithy/signature-v4": "^3.1.2", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "fast-xml-parser": "4.2.5", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-env": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-env/-/credential-provider-env-3.609.0.tgz", + "integrity": "sha512-v69ZCWcec2iuV9vLVJMa6fAb5xwkzN4jYIT8yjo2c4Ia/j976Q+TPf35Pnz5My48Xr94EFcaBazrWedF+kwfuQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/property-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-http": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-http/-/credential-provider-http-3.609.0.tgz", + "integrity": "sha512-GQQfB9Mk4XUZwaPsk4V3w8MqleS6ApkZKVQn3vTLAKa8Y7B2Imcpe5zWbKYjDd8MPpMWjHcBGFTVlDRFP4zwSQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/property-provider": "^3.1.3", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/util-stream": "^3.0.5", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-ini": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-ini/-/credential-provider-ini-3.609.0.tgz", + "integrity": "sha512-hwaBfXuBTv6/eAdEsDfGcteYUW6Km7lvvubbxEdxIuJNF3vswR7RMGIXaEC37hhPkTTgd3H0TONammhwZIfkog==", + "dependencies": { + "@aws-sdk/credential-provider-env": "3.609.0", + "@aws-sdk/credential-provider-http": "3.609.0", + "@aws-sdk/credential-provider-process": "3.609.0", + "@aws-sdk/credential-provider-sso": "3.609.0", + "@aws-sdk/credential-provider-web-identity": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@smithy/credential-provider-imds": "^3.1.3", + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + }, + "peerDependencies": { + "@aws-sdk/client-sts": "^3.609.0" + } + }, + "node_modules/@aws-sdk/credential-provider-node": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-node/-/credential-provider-node-3.609.0.tgz", + "integrity": "sha512-4J8/JRuqfxJDGD9jTHVCBxCvYt7/Vgj2Stlhj930mrjFPO/yRw8ilAAZxBWe0JHPX3QwepCmh4ErZe53F5ysxQ==", + "dependencies": { + "@aws-sdk/credential-provider-env": "3.609.0", + "@aws-sdk/credential-provider-http": "3.609.0", + "@aws-sdk/credential-provider-ini": "3.609.0", + "@aws-sdk/credential-provider-process": "3.609.0", + "@aws-sdk/credential-provider-sso": "3.609.0", + "@aws-sdk/credential-provider-web-identity": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@smithy/credential-provider-imds": "^3.1.3", + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-process": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-process/-/credential-provider-process-3.609.0.tgz", + "integrity": "sha512-Ux35nGOSJKZWUIM3Ny0ROZ8cqPRUEkh+tR3X2o9ydEbFiLq3eMMyEnHJqx4EeUjLRchidlm4CCid9GxMe5/gdw==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-sso": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-sso/-/credential-provider-sso-3.609.0.tgz", + "integrity": "sha512-oQPGDKMMIxjvTcm86g07RPYeC7mCNk+29dPpY15ZAPRpAF7F0tircsC3wT9fHzNaKShEyK5LuI5Kg/uxsdy+Iw==", + "dependencies": { + "@aws-sdk/client-sso": "3.609.0", + "@aws-sdk/token-providers": "3.609.0", + "@aws-sdk/types": "3.609.0", + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/credential-provider-web-identity": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/credential-provider-web-identity/-/credential-provider-web-identity-3.609.0.tgz", + "integrity": "sha512-U+PG8NhlYYF45zbr1km3ROtBMYqyyj/oK8NRp++UHHeuavgrP+4wJ4wQnlEaKvJBjevfo3+dlIBcaeQ7NYejWg==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/property-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + }, + "peerDependencies": { + "@aws-sdk/client-sts": "^3.609.0" + } + }, + "node_modules/@aws-sdk/middleware-host-header": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-host-header/-/middleware-host-header-3.609.0.tgz", + "integrity": "sha512-iTKfo158lc4jLDfYeZmYMIBHsn8m6zX+XB6birCSNZ/rrlzAkPbGE43CNdKfvjyWdqgLMRXF+B+OcZRvqhMXPQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/protocol-http": "^4.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/middleware-logger": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-logger/-/middleware-logger-3.609.0.tgz", + "integrity": "sha512-S62U2dy4jMDhDFDK5gZ4VxFdWzCtLzwbYyFZx2uvPYTECkepLUfzLic2BHg2Qvtu4QjX+oGE3P/7fwaGIsGNuQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/middleware-recursion-detection": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-recursion-detection/-/middleware-recursion-detection-3.609.0.tgz", + "integrity": "sha512-6sewsYB7/o/nbUfA99Aa/LokM+a/u4Wpm/X2o0RxOsDtSB795ObebLJe2BxY5UssbGaWkn7LswyfvrdZNXNj1w==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/protocol-http": "^4.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/middleware-user-agent": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/middleware-user-agent/-/middleware-user-agent-3.609.0.tgz", + "integrity": "sha512-nbq7MXRmeXm4IDqh+sJRAxGPAq0OfGmGIwKvJcw66hLoG8CmhhVMZmIAEBDFr57S+YajGwnLLRt+eMI05MMeVA==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@aws-sdk/util-endpoints": "3.609.0", + "@smithy/protocol-http": "^4.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/region-config-resolver": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/region-config-resolver/-/region-config-resolver-3.609.0.tgz", + "integrity": "sha512-lMHBG8zg9GWYBc9/XVPKyuAUd7iKqfPP7z04zGta2kGNOKbUTeqmAdc1gJGku75p4kglIPlGBorOxti8DhRmKw==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "@smithy/util-config-provider": "^3.0.0", + "@smithy/util-middleware": "^3.0.3", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/token-providers": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/token-providers/-/token-providers-3.609.0.tgz", + "integrity": "sha512-WvhW/7XSf+H7YmtiIigQxfDVZVZI7mbKikQ09YpzN7FeN3TmYib1+0tB+EE9TbICkwssjiFc71FEBEh4K9grKQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + }, + "peerDependencies": { + "@aws-sdk/client-sso-oidc": "^3.609.0" + } + }, + "node_modules/@aws-sdk/types": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/types/-/types-3.609.0.tgz", + "integrity": "sha512-+Tqnh9w0h2LcrUsdXyT1F8mNhXz+tVYBtP19LpeEGntmvHwa2XzvLUCWpoIAIVsHp5+HdB2X9Sn0KAtmbFXc2Q==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/util-endpoints": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-endpoints/-/util-endpoints-3.609.0.tgz", + "integrity": "sha512-Rh+3V8dOvEeE1aQmUy904DYWtLUEJ7Vf5XBPlQ6At3pBhp+zpXbsnpZzVL33c8lW1xfj6YPwtO6gOeEsl1juCQ==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/types": "^3.3.0", + "@smithy/util-endpoints": "^2.0.4", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/util-locate-window": { + "version": "3.568.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-locate-window/-/util-locate-window-3.568.0.tgz", + "integrity": "sha512-3nh4TINkXYr+H41QaPelCceEB2FXP3fxp93YZXB/kqJvX0U9j0N0Uk45gvsjmEPzG8XxkPEeLIfT2I1M7A6Lig==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@aws-sdk/util-user-agent-browser": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-browser/-/util-user-agent-browser-3.609.0.tgz", + "integrity": "sha512-fojPU+mNahzQ0YHYBsx0ZIhmMA96H+ZIZ665ObU9tl+SGdbLneVZVikGve+NmHTQwHzwkFsZYYnVKAkreJLAtA==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/types": "^3.3.0", + "bowser": "^2.11.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@aws-sdk/util-user-agent-node": { + "version": "3.609.0", + "resolved": "https://registry.npmjs.org/@aws-sdk/util-user-agent-node/-/util-user-agent-node-3.609.0.tgz", + "integrity": "sha512-DlZBwQ/HkZyf3pOWc7+wjJRk5R7x9YxHhs2szHwtv1IW30KMabjjjX0GMlGJ9LLkBHkbaaEY/w9Tkj12XRLhRg==", + "dependencies": { + "@aws-sdk/types": "3.609.0", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + }, + "peerDependencies": { + "aws-crt": ">=1.0.0" + }, + "peerDependenciesMeta": { + "aws-crt": { + "optional": true + } + } + }, "node_modules/@babel/code-frame": { "version": "7.23.5", "resolved": "https://registry.npmjs.org/@babel/code-frame/-/code-frame-7.23.5.tgz", @@ -1273,6 +1909,542 @@ "@sinonjs/commons": "^3.0.0" } }, + "node_modules/@smithy/abort-controller": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/@smithy/abort-controller/-/abort-controller-3.1.1.tgz", + "integrity": "sha512-MBJBiidoe+0cTFhyxT8g+9g7CeVccLM0IOKKUMCNQ1CNMJ/eIfoo0RTfVrXOONEI1UCN1W+zkiHSbzUNE9dZtQ==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/config-resolver": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/@smithy/config-resolver/-/config-resolver-3.0.4.tgz", + "integrity": "sha512-VwiOk7TwXoE7NlNguV/aPq1hFH72tqkHCw8eWXbr2xHspRyyv9DLpLXhq+Ieje+NwoqXrY0xyQjPXdOE6cGcHA==", + "dependencies": { + "@smithy/node-config-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "@smithy/util-config-provider": "^3.0.0", + "@smithy/util-middleware": "^3.0.3", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/core": { + "version": "2.2.4", + "resolved": "https://registry.npmjs.org/@smithy/core/-/core-2.2.4.tgz", + "integrity": "sha512-qdY3LpMOUyLM/gfjjMQZui+UTNS7kBRDWlvyIhVOql5dn2J3isk9qUTBtQ1CbDH8MTugHis1zu3h4rH+Qmmh4g==", + "dependencies": { + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-retry": "^3.0.7", + "@smithy/middleware-serde": "^3.0.3", + "@smithy/protocol-http": "^4.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/util-middleware": "^3.0.3", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/credential-provider-imds": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/@smithy/credential-provider-imds/-/credential-provider-imds-3.1.3.tgz", + "integrity": "sha512-U1Yrv6hx/mRK6k8AncuI6jLUx9rn0VVSd9NPEX6pyYFBfkSkChOc/n4zUb8alHUVg83TbI4OdZVo1X0Zfj3ijA==", + "dependencies": { + "@smithy/node-config-provider": "^3.1.3", + "@smithy/property-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/fetch-http-handler": { + "version": "3.2.0", + "resolved": "https://registry.npmjs.org/@smithy/fetch-http-handler/-/fetch-http-handler-3.2.0.tgz", + "integrity": "sha512-vFvDxMrc6sO5Atec8PaISckMcAwsCrRhYxwUylg97bRT2KZoumOF7qk5+6EVUtuM1IG9AJV5aqXnHln9ZdXHpg==", + "dependencies": { + "@smithy/protocol-http": "^4.0.3", + "@smithy/querystring-builder": "^3.0.3", + "@smithy/types": "^3.3.0", + "@smithy/util-base64": "^3.0.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@smithy/hash-node": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/hash-node/-/hash-node-3.0.3.tgz", + "integrity": "sha512-2ctBXpPMG+B3BtWSGNnKELJ7SH9e4TNefJS0cd2eSkOOROeBnnVBnAy9LtJ8tY4vUEoe55N4CNPxzbWvR39iBw==", + "dependencies": { + "@smithy/types": "^3.3.0", + "@smithy/util-buffer-from": "^3.0.0", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/invalid-dependency": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/invalid-dependency/-/invalid-dependency-3.0.3.tgz", + "integrity": "sha512-ID1eL/zpDULmHJbflb864k72/SNOZCADRc9i7Exq3RUNJw6raWUSlFEQ+3PX3EYs++bTxZB2dE9mEHTQLv61tw==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@smithy/is-array-buffer": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/is-array-buffer/-/is-array-buffer-3.0.0.tgz", + "integrity": "sha512-+Fsu6Q6C4RSJiy81Y8eApjEB5gVtM+oFKTffg+jSuwtvomJJrhUJBu2zS8wjXSgH/g1MKEWrzyChTBe6clb5FQ==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/middleware-content-length": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/middleware-content-length/-/middleware-content-length-3.0.3.tgz", + "integrity": "sha512-Dbz2bzexReYIQDWMr+gZhpwBetNXzbhnEMhYKA6urqmojO14CsXjnsoPYO8UL/xxcawn8ZsuVU61ElkLSltIUQ==", + "dependencies": { + "@smithy/protocol-http": "^4.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/middleware-endpoint": { + "version": "3.0.4", + "resolved": "https://registry.npmjs.org/@smithy/middleware-endpoint/-/middleware-endpoint-3.0.4.tgz", + "integrity": "sha512-whUJMEPwl3ANIbXjBXZVdJNgfV2ZU8ayln7xUM47rXL2txuenI7jQ/VFFwCzy5lCmXScjp6zYtptW5Evud8e9g==", + "dependencies": { + "@smithy/middleware-serde": "^3.0.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "@smithy/url-parser": "^3.0.3", + "@smithy/util-middleware": "^3.0.3", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/middleware-retry": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/@smithy/middleware-retry/-/middleware-retry-3.0.7.tgz", + "integrity": "sha512-f5q7Y09G+2h5ivkSx5CHvlAT4qRR3jBFEsfXyQ9nFNiWQlr8c48blnu5cmbTQ+p1xmIO14UXzKoF8d7Tm0Gsjw==", + "dependencies": { + "@smithy/node-config-provider": "^3.1.3", + "@smithy/protocol-http": "^4.0.3", + "@smithy/service-error-classification": "^3.0.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-retry": "^3.0.3", + "tslib": "^2.6.2", + "uuid": "^9.0.1" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/middleware-retry/node_modules/uuid": { + "version": "9.0.1", + "resolved": "https://registry.npmjs.org/uuid/-/uuid-9.0.1.tgz", + "integrity": "sha512-b+1eJOlsR9K8HJpow9Ok3fiWOWSIcIzXodvv0rQjVoOVNpWMpxf1wZNpt4y9h10odCNrqnYp1OBzRktckBe3sA==", + "funding": [ + "https://github.com/sponsors/broofa", + "https://github.com/sponsors/ctavan" + ], + "bin": { + "uuid": "dist/bin/uuid" + } + }, + "node_modules/@smithy/middleware-serde": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/middleware-serde/-/middleware-serde-3.0.3.tgz", + "integrity": "sha512-puUbyJQBcg9eSErFXjKNiGILJGtiqmuuNKEYNYfUD57fUl4i9+mfmThtQhvFXU0hCVG0iEJhvQUipUf+/SsFdA==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/middleware-stack": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/middleware-stack/-/middleware-stack-3.0.3.tgz", + "integrity": "sha512-r4klY9nFudB0r9UdSMaGSyjyQK5adUyPnQN/ZM6M75phTxOdnc/AhpvGD1fQUvgmqjQEBGCwpnPbDm8pH5PapA==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/node-config-provider": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/@smithy/node-config-provider/-/node-config-provider-3.1.3.tgz", + "integrity": "sha512-rxdpAZczzholz6CYZxtqDu/aKTxATD5DAUDVj7HoEulq+pDSQVWzbg0btZDlxeFfa6bb2b5tUvgdX5+k8jUqcg==", + "dependencies": { + "@smithy/property-provider": "^3.1.3", + "@smithy/shared-ini-file-loader": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/node-http-handler": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/@smithy/node-http-handler/-/node-http-handler-3.1.1.tgz", + "integrity": "sha512-L71NLyPeP450r2J/mfu1jMc//Z1YnqJt2eSNw7uhiItaONnBLDA68J5jgxq8+MBDsYnFwNAIc7dBG1ImiWBiwg==", + "dependencies": { + "@smithy/abort-controller": "^3.1.1", + "@smithy/protocol-http": "^4.0.3", + "@smithy/querystring-builder": "^3.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/property-provider": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/@smithy/property-provider/-/property-provider-3.1.3.tgz", + "integrity": "sha512-zahyOVR9Q4PEoguJ/NrFP4O7SMAfYO1HLhB18M+q+Z4KFd4V2obiMnlVoUFzFLSPeVt1POyNWneHHrZaTMoc/g==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/protocol-http": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/@smithy/protocol-http/-/protocol-http-4.0.3.tgz", + "integrity": "sha512-x5jmrCWwQlx+Zv4jAtc33ijJ+vqqYN+c/ZkrnpvEe/uDas7AT7A/4Rc2CdfxgWv4WFGmEqODIrrUToPN6DDkGw==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/querystring-builder": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/querystring-builder/-/querystring-builder-3.0.3.tgz", + "integrity": "sha512-vyWckeUeesFKzCDaRwWLUA1Xym9McaA6XpFfAK5qI9DKJ4M33ooQGqvM4J+LalH4u/Dq9nFiC8U6Qn1qi0+9zw==", + "dependencies": { + "@smithy/types": "^3.3.0", + "@smithy/util-uri-escape": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/querystring-parser": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/querystring-parser/-/querystring-parser-3.0.3.tgz", + "integrity": "sha512-zahM1lQv2YjmznnfQsWbYojFe55l0SLG/988brlLv1i8z3dubloLF+75ATRsqPBboUXsW6I9CPGE5rQgLfY0vQ==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/service-error-classification": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/service-error-classification/-/service-error-classification-3.0.3.tgz", + "integrity": "sha512-Jn39sSl8cim/VlkLsUhRFq/dKDnRUFlfRkvhOJaUbLBXUsLRLNf9WaxDv/z9BjuQ3A6k/qE8af1lsqcwm7+DaQ==", + "dependencies": { + "@smithy/types": "^3.3.0" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/shared-ini-file-loader": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/@smithy/shared-ini-file-loader/-/shared-ini-file-loader-3.1.3.tgz", + "integrity": "sha512-Z8Y3+08vgoDgl4HENqNnnzSISAaGrF2RoKupoC47u2wiMp+Z8P/8mDh1CL8+8ujfi2U5naNvopSBmP/BUj8b5w==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/signature-v4": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@smithy/signature-v4/-/signature-v4-3.1.2.tgz", + "integrity": "sha512-3BcPylEsYtD0esM4Hoyml/+s7WP2LFhcM3J2AGdcL2vx9O60TtfpDOL72gjb4lU8NeRPeKAwR77YNyyGvMbuEA==", + "dependencies": { + "@smithy/is-array-buffer": "^3.0.0", + "@smithy/types": "^3.3.0", + "@smithy/util-hex-encoding": "^3.0.0", + "@smithy/util-middleware": "^3.0.3", + "@smithy/util-uri-escape": "^3.0.0", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/smithy-client": { + "version": "3.1.5", + "resolved": "https://registry.npmjs.org/@smithy/smithy-client/-/smithy-client-3.1.5.tgz", + "integrity": "sha512-x9bL9Mx2CT2P1OiUlHM+ZNpbVU6TgT32f9CmTRzqIHA7M4vYrROCWEoC3o4xHNJASoGd4Opos3cXYPgh+/m4Ww==", + "dependencies": { + "@smithy/middleware-endpoint": "^3.0.4", + "@smithy/middleware-stack": "^3.0.3", + "@smithy/protocol-http": "^4.0.3", + "@smithy/types": "^3.3.0", + "@smithy/util-stream": "^3.0.5", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/types": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/@smithy/types/-/types-3.3.0.tgz", + "integrity": "sha512-IxvBBCTFDHbVoK7zIxqA1ZOdc4QfM5HM7rGleCuHi7L1wnKv5Pn69xXJQ9hgxH60ZVygH9/JG0jRgtUncE3QUA==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/url-parser": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/url-parser/-/url-parser-3.0.3.tgz", + "integrity": "sha512-pw3VtZtX2rg+s6HMs6/+u9+hu6oY6U7IohGhVNnjbgKy86wcIsSZwgHrFR+t67Uyxvp4Xz3p3kGXXIpTNisq8A==", + "dependencies": { + "@smithy/querystring-parser": "^3.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + } + }, + "node_modules/@smithy/util-base64": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-base64/-/util-base64-3.0.0.tgz", + "integrity": "sha512-Kxvoh5Qtt0CDsfajiZOCpJxgtPHXOKwmM+Zy4waD43UoEMA+qPxxa98aE/7ZhdnBFZFXMOiBR5xbcaMhLtznQQ==", + "dependencies": { + "@smithy/util-buffer-from": "^3.0.0", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-body-length-browser": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-body-length-browser/-/util-body-length-browser-3.0.0.tgz", + "integrity": "sha512-cbjJs2A1mLYmqmyVl80uoLTJhAcfzMOyPgjwAYusWKMdLeNtzmMz9YxNl3/jRLoxSS3wkqkf0jwNdtXWtyEBaQ==", + "dependencies": { + "tslib": "^2.6.2" + } + }, + "node_modules/@smithy/util-body-length-node": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-body-length-node/-/util-body-length-node-3.0.0.tgz", + "integrity": "sha512-Tj7pZ4bUloNUP6PzwhN7K386tmSmEET9QtQg0TgdNOnxhZvCssHji+oZTUIuzxECRfG8rdm2PMw2WCFs6eIYkA==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-buffer-from": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-buffer-from/-/util-buffer-from-3.0.0.tgz", + "integrity": "sha512-aEOHCgq5RWFbP+UDPvPot26EJHjOC+bRgse5A8V3FSShqd5E5UN4qc7zkwsvJPPAVsf73QwYcHN1/gt/rtLwQA==", + "dependencies": { + "@smithy/is-array-buffer": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-config-provider": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-config-provider/-/util-config-provider-3.0.0.tgz", + "integrity": "sha512-pbjk4s0fwq3Di/ANL+rCvJMKM5bzAQdE5S/6RL5NXgMExFAi6UgQMPOm5yPaIWPpr+EOXKXRonJ3FoxKf4mCJQ==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-defaults-mode-browser": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-browser/-/util-defaults-mode-browser-3.0.7.tgz", + "integrity": "sha512-Q2txLyvQyGfmjsaDbVV7Sg8psefpFcrnlGapDzXGFRPFKRBeEg6OvFK8FljqjeHSaCZ6/UuzQExUPqBR/2qlDA==", + "dependencies": { + "@smithy/property-provider": "^3.1.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "bowser": "^2.11.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">= 10.0.0" + } + }, + "node_modules/@smithy/util-defaults-mode-node": { + "version": "3.0.7", + "resolved": "https://registry.npmjs.org/@smithy/util-defaults-mode-node/-/util-defaults-mode-node-3.0.7.tgz", + "integrity": "sha512-F4Qcj1fG6MGi2BSWCslfsMSwllws/WzYONBGtLybyY+halAcXdWhcew+mej8M5SKd5hqPYp4f7b+ABQEaeytgg==", + "dependencies": { + "@smithy/config-resolver": "^3.0.4", + "@smithy/credential-provider-imds": "^3.1.3", + "@smithy/node-config-provider": "^3.1.3", + "@smithy/property-provider": "^3.1.3", + "@smithy/smithy-client": "^3.1.5", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">= 10.0.0" + } + }, + "node_modules/@smithy/util-endpoints": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/@smithy/util-endpoints/-/util-endpoints-2.0.4.tgz", + "integrity": "sha512-ZAtNf+vXAsgzgRutDDiklU09ZzZiiV/nATyqde4Um4priTmasDH+eLpp3tspL0hS2dEootyFMhu1Y6Y+tzpWBQ==", + "dependencies": { + "@smithy/node-config-provider": "^3.1.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-hex-encoding": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-hex-encoding/-/util-hex-encoding-3.0.0.tgz", + "integrity": "sha512-eFndh1WEK5YMUYvy3lPlVmYY/fZcQE1D8oSf41Id2vCeIkKJXPcYDCZD+4+xViI6b1XSd7tE+s5AmXzz5ilabQ==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-middleware": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/util-middleware/-/util-middleware-3.0.3.tgz", + "integrity": "sha512-l+StyYYK/eO3DlVPbU+4Bi06Jjal+PFLSMmlWM1BEwyLxZ3aKkf1ROnoIakfaA7mC6uw3ny7JBkau4Yc+5zfWw==", + "dependencies": { + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-retry": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/@smithy/util-retry/-/util-retry-3.0.3.tgz", + "integrity": "sha512-AFw+hjpbtVApzpNDhbjNG5NA3kyoMs7vx0gsgmlJF4s+yz1Zlepde7J58zpIRIsdjc+emhpAITxA88qLkPF26w==", + "dependencies": { + "@smithy/service-error-classification": "^3.0.3", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-stream": { + "version": "3.0.5", + "resolved": "https://registry.npmjs.org/@smithy/util-stream/-/util-stream-3.0.5.tgz", + "integrity": "sha512-xC3L5PKMAT/Bh8fmHNXP9sdQ4+4aKVUU3EEJ2CF/lLk7R+wtMJM+v/1B4en7jO++Wa5spGzFDBCl0QxgbUc5Ug==", + "dependencies": { + "@smithy/fetch-http-handler": "^3.2.0", + "@smithy/node-http-handler": "^3.1.1", + "@smithy/types": "^3.3.0", + "@smithy/util-base64": "^3.0.0", + "@smithy/util-buffer-from": "^3.0.0", + "@smithy/util-hex-encoding": "^3.0.0", + "@smithy/util-utf8": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-uri-escape": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-uri-escape/-/util-uri-escape-3.0.0.tgz", + "integrity": "sha512-LqR7qYLgZTD7nWLBecUi4aqolw8Mhza9ArpNEQ881MJJIU2sE5iHCK6TdyqqzcDLy0OPe10IY4T8ctVdtynubg==", + "dependencies": { + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-utf8": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/@smithy/util-utf8/-/util-utf8-3.0.0.tgz", + "integrity": "sha512-rUeT12bxFnplYDe815GXbq/oixEGHfRFFtcTF3YdDi/JaENIM6aSYYLJydG83UNzLXeRI5K8abYd/8Sp/QM0kA==", + "dependencies": { + "@smithy/util-buffer-from": "^3.0.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, + "node_modules/@smithy/util-waiter": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/@smithy/util-waiter/-/util-waiter-3.1.2.tgz", + "integrity": "sha512-4pP0EV3iTsexDx+8PPGAKCQpd/6hsQBaQhqWzU4hqKPHN5epPsxKbvUTIiYIHTxaKt6/kEaqPBpu/ufvfbrRzw==", + "dependencies": { + "@smithy/abort-controller": "^3.1.1", + "@smithy/types": "^3.3.0", + "tslib": "^2.6.2" + }, + "engines": { + "node": ">=16.0.0" + } + }, "node_modules/@types/babel__core": { "version": "7.20.2", "resolved": "https://registry.npmjs.org/@types/babel__core/-/babel__core-7.20.2.tgz", @@ -1677,6 +2849,11 @@ } ] }, + "node_modules/bowser": { + "version": "2.11.0", + "resolved": "https://registry.npmjs.org/bowser/-/bowser-2.11.0.tgz", + "integrity": "sha512-AlcaJBi/pqqJBIQ8U9Mcpc9i8Aqxn88Skv5d+xBX006BY5u8N3mGLHa5Lgppa7L/HfwgwLgZ6NYs+Ag6uUmJRA==" + }, "node_modules/brace-expansion": { "version": "1.1.11", "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", @@ -2316,6 +3493,27 @@ "integrity": "sha512-DCXu6Ifhqcks7TZKY3Hxp3y6qphY5SJZmrWMDrKcERSOXWQdMhU9Ig/PYrzyw/ul9jOIyh0N4M0tbC5hodg8dw==", "dev": true }, + "node_modules/fast-xml-parser": { + "version": "4.2.5", + "resolved": "https://registry.npmjs.org/fast-xml-parser/-/fast-xml-parser-4.2.5.tgz", + "integrity": "sha512-B9/wizE4WngqQftFPmdaMYlXoJlJOYxGQOanC77fq9k8+Z0v5dDSVh+3glErdIROP//s/jgb7ZuxKfB8nVyo0g==", + "funding": [ + { + "type": "paypal", + "url": "https://paypal.me/naturalintelligence" + }, + { + "type": "github", + "url": "https://github.com/sponsors/NaturalIntelligence" + } + ], + "dependencies": { + "strnum": "^1.0.5" + }, + "bin": { + "fxparser": "src/cli/cli.js" + } + }, "node_modules/fastq": { "version": "1.15.0", "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.15.0.tgz", @@ -4507,6 +5705,11 @@ "url": "https://github.com/sponsors/sindresorhus" } }, + "node_modules/strnum": { + "version": "1.0.5", + "resolved": "https://registry.npmjs.org/strnum/-/strnum-1.0.5.tgz", + "integrity": "sha512-J8bbNyKKXl5qYcR36TIO8W3mVGVHrmmxsd5PAItGkmyzwJvybiw2IVq5nqd0i4LSNSkB/sx9VHllbfFdr9k1JA==" + }, "node_modules/supports-color": { "version": "7.2.0", "resolved": "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz", @@ -4578,6 +5781,11 @@ "node": ">=8.0" } }, + "node_modules/tslib": { + "version": "2.6.3", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.6.3.tgz", + "integrity": "sha512-xNvxJEOUiWPGhUuUdQgAJPKOOJfGnIyKySOc09XkKsgdUV/3E2zvwZYdejjmRgPCgcym1juLH3226yA7sEFJKQ==" + }, "node_modules/tunnel": { "version": "0.0.6", "resolved": "https://registry.npmjs.org/tunnel/-/tunnel-0.0.6.tgz", diff --git a/package.json b/package.json index 49f1689..2b1bf7b 100644 --- a/package.json +++ b/package.json @@ -24,6 +24,7 @@ "license": "Apache-2.0", "dependencies": { "@actions/core": "^1.9.1", + "@aws-sdk/client-ecs": "^3.609.0", "aws-sdk": "^2.1244.0", "smoketail": "^0.2.2", "yaml": "^2.2.2"